summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--lib/gallery.common.js82
-rw-r--r--lib/jquery-ui.js15178
-rw-r--r--lib/jquery.MultiFile.js11
-rw-r--r--lib/jquery.autocomplete.css49
-rw-r--r--lib/jquery.autocomplete.js13
-rw-r--r--lib/jquery.cookie.js96
-rw-r--r--lib/jquery.form.js930
-rw-r--r--lib/jquery.jeditable.js32
-rw-r--r--lib/jquery.js9562
-rw-r--r--lib/jquery.localscroll.js9
-rw-r--r--lib/jquery.scrollTo.js11
-rw-r--r--lib/superfish/css/superfish.css16
-rw-r--r--lib/superfish/images/arrows-ffffff-rtl.pngbin378 -> 0 bytes
-rw-r--r--lib/superfish/images/shadow.pngbin1698 -> 0 bytes
-rw-r--r--lib/superfish/js/superfish.js75
-rw-r--r--modules/tag/controllers/tags.php9
-rw-r--r--modules/tag/helpers/tag_event.php3
-rw-r--r--modules/tag/views/tag_block.html.php16
-rw-r--r--themes/wind/css/screen.css6
-rw-r--r--themes/wind/js/ui.init.js3
20 files changed, 25225 insertions, 876 deletions
diff --git a/lib/gallery.common.js b/lib/gallery.common.js
index 755218f5..e23f3fad 100644
--- a/lib/gallery.common.js
+++ b/lib/gallery.common.js
@@ -200,7 +200,7 @@
// Set the input value equal to label text
if (input.val() == "") {
input.val(label.html());
- button.enable(false);
+ button.attr("disabled", true);
}
// Attach event listeners to the input
@@ -209,14 +209,14 @@
if ($(this).val() == label.html()) {
$(this).val("");
}
- button.enable(true);
+ button.attr("disabled", false);
});
input.bind("blur", function(e){
// Reset the input value if it's empty
if ($(this).val() == "") {
$(this).val(label.html());
- button.enable(false);
+ button.attr("disabled", true);
}
});
});
@@ -225,29 +225,65 @@
// Augment jQuery autocomplete to expect the first response line to
// be a <meta> tag that protects against UTF-7 attacks.
$.fn.gallery_autocomplete = function(url, options) {
- // Drop the first response - it should be a meta tag
- options.parse = function(data) {
- var parsed = [];
- var rows = data.split("\n");
- if (rows[0].indexOf("<meta") == -1) {
- throw 'Missing <meta> tag in first line of autocomplete response';
- }
- rows.shift(); // drop <META> tag
- for (var i=0; i < rows.length; i++) {
- var row = $.trim(rows[i]);
- if (row) {
- row = row.split("|");
- parsed[parsed.length] = {
- data: row,
- value: row[0],
- result: row[0]
- };
+ var autocomplete_options = {
+ source: function(request, response) {
+ var split = function(val) {
+ return val.split(/,\s*/);
+ }
+
+ var extract_last = function(term) {
+ return split(term).pop();
+ }
+
+ var ajax_options = {
+ dataType: "json",
+ url: url,
+ success: function(data) {
+ response(data);
+ },
+ };
+
+ if (options.multiple) {
+
+ $.extend(ajax_options, {
+ dataFilter: function(data, dataType) {
+ // Drop the <meta> tag
+ return data.substring(data.indexOf("\n") + 1);
+ },
+ data: {
+ term: extract_last(request.term)
+ }
+ });
}
+
+ $.ajax(ajax_options, response);
}
- return parsed;
- };
+ }
+
+ if (options.multiple) {
+ var split = function(val) {
+ return val.split(/,\s*/);
+ }
+ $.extend(autocomplete_options, {
+ focus: function(event, ui) {
+ var terms = split(this.value);
+ terms.pop();
+ terms.push(ui.item.value);
+ this.value = terms.join(", ");
+ return false;
+ },
+ select: function(event, ui) {
+ var terms = split(this.value);
+ terms.pop();
+ terms.push(ui.item.value);
+ terms.push("");
+ this.value = terms.join(", ");
+ return false;
+ }
+ })
+ }
- $(this).autocomplete(url, options);
+ $(this).autocomplete(autocomplete_options);
};
})(jQuery);
diff --git a/lib/jquery-ui.js b/lib/jquery-ui.js
index 74515a5b..bfdf3462 100644
--- a/lib/jquery-ui.js
+++ b/lib/jquery-ui.js
@@ -1,328 +1,14850 @@
-;jQuery.ui||(function($){var _remove=$.fn.remove,isFF2=$.browser.mozilla&&(parseFloat($.browser.version)<1.9);$.ui={version:"1.7.2",plugin:{add:function(module,option,set){var proto=$.ui[module].prototype;for(var i in set){proto.plugins[i]=proto.plugins[i]||[];proto.plugins[i].push([option,set[i]]);}},call:function(instance,name,args){var set=instance.plugins[name];if(!set||!instance.element[0].parentNode){return;}
-for(var i=0;i<set.length;i++){if(instance.options[set[i][0]]){set[i][1].apply(instance.element,args);}}}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b);},hasScroll:function(el,a){if($(el).css('overflow')=='hidden'){return false;}
-var scroll=(a&&a=='left')?'scrollLeft':'scrollTop',has=false;if(el[scroll]>0){return true;}
-el[scroll]=1;has=(el[scroll]>0);el[scroll]=0;return has;},isOverAxis:function(x,reference,size){return(x>reference)&&(x<(reference+size));},isOver:function(y,x,top,left,height,width){return $.ui.isOverAxis(y,top,height)&&$.ui.isOverAxis(x,left,width);},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(isFF2){var attr=$.attr,removeAttr=$.fn.removeAttr,ariaNS="http://www.w3.org/2005/07/aaa",ariaState=/^aria-/,ariaRole=/^wairole:/;$.attr=function(elem,name,value){var set=value!==undefined;return(name=='role'?(set?attr.call(this,elem,name,"wairole:"+value):(attr.apply(this,arguments)||"").replace(ariaRole,"")):(ariaState.test(name)?(set?elem.setAttributeNS(ariaNS,name.replace(ariaState,"aaa:"),value):attr.call(this,elem,name.replace(ariaState,"aaa:"))):attr.apply(this,arguments)));};$.fn.removeAttr=function(name){return(ariaState.test(name)?this.each(function(){this.removeAttributeNS(ariaNS,name.replace(ariaState,""));}):removeAttr.call(this,name));};}
-$.fn.extend({remove:function(){$("*",this).add(this).each(function(){$(this).triggerHandler("remove");});return _remove.apply(this,arguments);},enableSelection:function(){return this.attr('unselectable','off').css('MozUserSelect','').unbind('selectstart.ui');},disableSelection:function(){return this.attr('unselectable','on').css('MozUserSelect','none').bind('selectstart.ui',function(){return false;});},scrollParent:function(){var scrollParent;if(($.browser.msie&&(/(static|relative)/).test(this.css('position')))||(/absolute/).test(this.css('position'))){scrollParent=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test($.curCSS(this,'position',1))&&(/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));}).eq(0);}else{scrollParent=this.parents().filter(function(){return(/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));}).eq(0);}
-return(/fixed/).test(this.css('position'))||!scrollParent.length?$(document):scrollParent;}});$.extend($.expr[':'],{data:function(elem,i,match){return!!$.data(elem,match[3]);},focusable:function(element){var nodeName=element.nodeName.toLowerCase(),tabIndex=$.attr(element,'tabindex');return(/input|select|textarea|button|object/.test(nodeName)?!element.disabled:'a'==nodeName||'area'==nodeName?element.href||!isNaN(tabIndex):!isNaN(tabIndex))&&!$(element)['area'==nodeName?'parents':'closest'](':hidden').length;},tabbable:function(element){var tabIndex=$.attr(element,'tabindex');return(isNaN(tabIndex)||tabIndex>=0)&&$(element).is(':focusable');}});function getter(namespace,plugin,method,args){function getMethods(type){var methods=$[namespace][plugin][type]||[];return(typeof methods=='string'?methods.split(/,?\s+/):methods);}
-var methods=getMethods('getter');if(args.length==1&&typeof args[0]=='string'){methods=methods.concat(getMethods('getterSetter'));}
-return($.inArray(method,methods)!=-1);}
-$.widget=function(name,prototype){var namespace=name.split(".")[0];name=name.split(".")[1];$.fn[name]=function(options){var isMethodCall=(typeof options=='string'),args=Array.prototype.slice.call(arguments,1);if(isMethodCall&&options.substring(0,1)=='_'){return this;}
-if(isMethodCall&&getter(namespace,name,options,args)){var instance=$.data(this[0],name);return(instance?instance[options].apply(instance,args):undefined);}
-return this.each(function(){var instance=$.data(this,name);(!instance&&!isMethodCall&&$.data(this,name,new $[namespace][name](this,options))._init());(instance&&isMethodCall&&$.isFunction(instance[options])&&instance[options].apply(instance,args));});};$[namespace]=$[namespace]||{};$[namespace][name]=function(element,options){var self=this;this.namespace=namespace;this.widgetName=name;this.widgetEventPrefix=$[namespace][name].eventPrefix||name;this.widgetBaseClass=namespace+'-'+name;this.options=$.extend({},$.widget.defaults,$[namespace][name].defaults,$.metadata&&$.metadata.get(element)[name],options);this.element=$(element).bind('setData.'+name,function(event,key,value){if(event.target==element){return self._setData(key,value);}}).bind('getData.'+name,function(event,key){if(event.target==element){return self._getData(key);}}).bind('remove',function(){return self.destroy();});};$[namespace][name].prototype=$.extend({},$.widget.prototype,prototype);$[namespace][name].getterSetter='option';};$.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+'-disabled'+' '+this.namespace+'-state-disabled').removeAttr('aria-disabled');},option:function(key,value){var options=key,self=this;if(typeof key=="string"){if(value===undefined){return this._getData(key);}
-options={};options[key]=value;}
-$.each(options,function(key,value){self._setData(key,value);});},_getData:function(key){return this.options[key];},_setData:function(key,value){this.options[key]=value;if(key=='disabled'){this.element
-[value?'addClass':'removeClass'](this.widgetBaseClass+'-disabled'+' '+
-this.namespace+'-state-disabled').attr("aria-disabled",value);}},enable:function(){this._setData('disabled',false);},disable:function(){this._setData('disabled',true);},_trigger:function(type,event,data){var callback=this.options[type],eventName=(type==this.widgetEventPrefix?type:this.widgetEventPrefix+type);event=$.Event(event);event.type=eventName;if(event.originalEvent){for(var i=$.event.props.length,prop;i;){prop=$.event.props[--i];event[prop]=event.originalEvent[prop];}}
-this.element.trigger(event,data);return!($.isFunction(callback)&&callback.call(this.element[0],event,data)===false||event.isDefaultPrevented());}};$.widget.defaults={disabled:false};$.ui.mouse={_mouseInit:function(){var self=this;this.element.bind('mousedown.'+this.widgetName,function(event){return self._mouseDown(event);}).bind('click.'+this.widgetName,function(event){if(self._preventClickEvent){self._preventClickEvent=false;event.stopImmediatePropagation();return false;}});if($.browser.msie){this._mouseUnselectable=this.element.attr('unselectable');this.element.attr('unselectable','on');}
-this.started=false;},_mouseDestroy:function(){this.element.unbind('.'+this.widgetName);($.browser.msie&&this.element.attr('unselectable',this._mouseUnselectable));},_mouseDown:function(event){event.originalEvent=event.originalEvent||{};if(event.originalEvent.mouseHandled){return;}
-(this._mouseStarted&&this._mouseUp(event));this._mouseDownEvent=event;var self=this,btnIsLeft=(event.which==1),elIsCancel=(typeof this.options.cancel=="string"?$(event.target).parents().add(event.target).filter(this.options.cancel).length:false);if(!btnIsLeft||elIsCancel||!this._mouseCapture(event)){return true;}
-this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){self.mouseDelayMet=true;},this.options.delay);}
-if(this._mouseDistanceMet(event)&&this._mouseDelayMet(event)){this._mouseStarted=(this._mouseStart(event)!==false);if(!this._mouseStarted){event.preventDefault();return true;}}
-this._mouseMoveDelegate=function(event){return self._mouseMove(event);};this._mouseUpDelegate=function(event){return self._mouseUp(event);};$(document).bind('mousemove.'+this.widgetName,this._mouseMoveDelegate).bind('mouseup.'+this.widgetName,this._mouseUpDelegate);($.browser.safari||event.preventDefault());event.originalEvent.mouseHandled=true;return true;},_mouseMove:function(event){if($.browser.msie&&!(document.documentMode>=9)&&!event.button){return this._mouseUp(event);}
-if(this._mouseStarted){this._mouseDrag(event);return event.preventDefault();}
-if(this._mouseDistanceMet(event)&&this._mouseDelayMet(event)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,event)!==false);(this._mouseStarted?this._mouseDrag(event):this._mouseUp(event));}
-return!this._mouseStarted;},_mouseUp:function(event){$(document).unbind('mousemove.'+this.widgetName,this._mouseMoveDelegate).unbind('mouseup.'+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=(event.target==this._mouseDownEvent.target);this._mouseStop(event);}
-return false;},_mouseDistanceMet:function(event){return(Math.max(Math.abs(this._mouseDownEvent.pageX-event.pageX),Math.abs(this._mouseDownEvent.pageY-event.pageY))>=this.options.distance);},_mouseDelayMet:function(event){return this.mouseDelayMet;},_mouseStart:function(event){},_mouseDrag:function(event){},_mouseStop:function(event){},_mouseCapture:function(event){return true;}};$.ui.mouse.defaults={cancel:null,distance:1,delay:0};})(jQuery);(function($){$.widget("ui.draggable",$.extend({},$.ui.mouse,{_init:function(){if(this.options.helper=='original'&&!(/^(?:r|a|f)/).test(this.element.css("position")))
-this.element[0].style.position='relative';(this.options.addClasses&&this.element.addClass("ui-draggable"));(this.options.disabled&&this.element.addClass("ui-draggable-disabled"));this._mouseInit();},destroy:function(){if(!this.element.data('draggable'))return;this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable"
-+" ui-draggable-dragging"
-+" ui-draggable-disabled");this._mouseDestroy();},_mouseCapture:function(event){var o=this.options;if(this.helper||o.disabled||$(event.target).is('.ui-resizable-handle'))
-return false;this.handle=this._getHandle(event);if(!this.handle)
-return false;return true;},_mouseStart:function(event){var o=this.options;this.helper=this._createHelper(event);this._cacheHelperProportions();if($.ui.ddmanager)
-$.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};$.extend(this.offset,{click:{left:event.pageX-this.offset.left,top:event.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(event);this.originalPageX=event.pageX;this.originalPageY=event.pageY;if(o.cursorAt)
-this._adjustOffsetFromHelper(o.cursorAt);if(o.containment)
-this._setContainment();this._trigger("start",event);this._cacheHelperProportions();if($.ui.ddmanager&&!o.dropBehaviour)
-$.ui.ddmanager.prepareOffsets(this,event);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(event,true);return true;},_mouseDrag:function(event,noPropagation){this.position=this._generatePosition(event);this.positionAbs=this._convertPositionTo("absolute");if(!noPropagation){var ui=this._uiHash();this._trigger('drag',event,ui);this.position=ui.position;}
-if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+'px';if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+'px';if($.ui.ddmanager)$.ui.ddmanager.drag(this,event);return false;},_mouseStop:function(event){var dropped=false;if($.ui.ddmanager&&!this.options.dropBehaviour)
-dropped=$.ui.ddmanager.drop(this,event);if(this.dropped){dropped=this.dropped;this.dropped=false;}
-if((this.options.revert=="invalid"&&!dropped)||(this.options.revert=="valid"&&dropped)||this.options.revert===true||($.isFunction(this.options.revert)&&this.options.revert.call(this.element,dropped))){var self=this;$(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){self._trigger("stop",event);self._clear();});}else{this._trigger("stop",event);this._clear();}
-return false;},_getHandle:function(event){var handle=!this.options.handle||!$(this.options.handle,this.element).length?true:false;$(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==event.target)handle=true;});return handle;},_createHelper:function(event){var o=this.options;var helper=$.isFunction(o.helper)?$(o.helper.apply(this.element[0],[event])):(o.helper=='clone'?this.element.clone():this.element);if(!helper.parents('body').length)
-helper.appendTo((o.appendTo=='parent'?this.element[0].parentNode:o.appendTo));if(helper[0]!=this.element[0]&&!(/(fixed|absolute)/).test(helper.css("position")))
-helper.css("position","absolute");return helper;},_adjustOffsetFromHelper:function(obj){if(obj.left!=undefined)this.offset.click.left=obj.left+this.margins.left;if(obj.right!=undefined)this.offset.click.left=this.helperProportions.width-obj.right+this.margins.left;if(obj.top!=undefined)this.offset.click.top=obj.top+this.margins.top;if(obj.bottom!=undefined)this.offset.click.top=this.helperProportions.height-obj.bottom+this.margins.top;},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var po=this.offsetParent.offset();if(this.cssPosition=='absolute'&&this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0])){po.left+=this.scrollParent.scrollLeft();po.top+=this.scrollParent.scrollTop();}
-if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=='html'&&$.browser.msie))
-po={top:0,left:0};return{top:po.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:po.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)};},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var p=this.element.position();return{top:p.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:p.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()};}else{return{top:0,left:0};}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0)};},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()};},_setContainment:function(){var o=this.options;if(o.containment=='parent')o.containment=this.helper[0].parentNode;if(o.containment=='document'||o.containment=='window')this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,$(o.containment=='document'?document:window).width()-this.helperProportions.width-this.margins.left,($(o.containment=='document'?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!(/^(document|window|parent)$/).test(o.containment)&&o.containment.constructor!=Array){var ce=$(o.containment)[0];if(!ce)return;var co=$(o.containment).offset();var over=($(ce).css("overflow")!='hidden');this.containment=[co.left+(parseInt($(ce).css("borderLeftWidth"),10)||0)+(parseInt($(ce).css("paddingLeft"),10)||0)-this.margins.left,co.top+(parseInt($(ce).css("borderTopWidth"),10)||0)+(parseInt($(ce).css("paddingTop"),10)||0)-this.margins.top,co.left+(over?Math.max(ce.scrollWidth,ce.offsetWidth):ce.offsetWidth)-(parseInt($(ce).css("borderLeftWidth"),10)||0)-(parseInt($(ce).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,co.top+(over?Math.max(ce.scrollHeight,ce.offsetHeight):ce.offsetHeight)-(parseInt($(ce).css("borderTopWidth"),10)||0)-(parseInt($(ce).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top];}else if(o.containment.constructor==Array){this.containment=o.containment;}},_convertPositionTo:function(d,pos){if(!pos)pos=this.position;var mod=d=="absolute"?1:-1;var o=this.options,scroll=this.cssPosition=='absolute'&&!(this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,scrollIsRootNode=(/(html|body)/i).test(scroll[0].tagName);return{top:(pos.top
-+this.offset.relative.top*mod
-+this.offset.parent.top*mod
--($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollTop():(scrollIsRootNode?0:scroll.scrollTop()))*mod)),left:(pos.left
-+this.offset.relative.left*mod
-+this.offset.parent.left*mod
--($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollLeft():scrollIsRootNode?0:scroll.scrollLeft())*mod))};},_generatePosition:function(event){var o=this.options,scroll=this.cssPosition=='absolute'&&!(this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,scrollIsRootNode=(/(html|body)/i).test(scroll[0].tagName);if(this.cssPosition=='relative'&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset();}
-var pageX=event.pageX;var pageY=event.pageY;if(this.originalPosition){if(this.containment){if(event.pageX-this.offset.click.left<this.containment[0])pageX=this.containment[0]+this.offset.click.left;if(event.pageY-this.offset.click.top<this.containment[1])pageY=this.containment[1]+this.offset.click.top;if(event.pageX-this.offset.click.left>this.containment[2])pageX=this.containment[2]+this.offset.click.left;if(event.pageY-this.offset.click.top>this.containment[3])pageY=this.containment[3]+this.offset.click.top;}
-if(o.grid){var top=this.originalPageY+Math.round((pageY-this.originalPageY)/o.grid[1])*o.grid[1];pageY=this.containment?(!(top-this.offset.click.top<this.containment[1]||top-this.offset.click.top>this.containment[3])?top:(!(top-this.offset.click.top<this.containment[1])?top-o.grid[1]:top+o.grid[1])):top;var left=this.originalPageX+Math.round((pageX-this.originalPageX)/o.grid[0])*o.grid[0];pageX=this.containment?(!(left-this.offset.click.left<this.containment[0]||left-this.offset.click.left>this.containment[2])?left:(!(left-this.offset.click.left<this.containment[0])?left-o.grid[0]:left+o.grid[0])):left;}}
-return{top:(pageY
--this.offset.click.top
--this.offset.relative.top
--this.offset.parent.top
-+($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollTop():(scrollIsRootNode?0:scroll.scrollTop())))),left:(pageX
--this.offset.click.left
--this.offset.relative.left
--this.offset.parent.left
-+($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollLeft():scrollIsRootNode?0:scroll.scrollLeft())))};},_clear:function(){this.helper.removeClass("ui-draggable-dragging");if(this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval)this.helper.remove();this.helper=null;this.cancelHelperRemoval=false;},_trigger:function(type,event,ui){ui=ui||this._uiHash();$.ui.plugin.call(this,type,[event,ui]);if(type=="drag")this.positionAbs=this._convertPositionTo("absolute");return $.widget.prototype._trigger.call(this,type,event,ui);},plugins:{},_uiHash:function(event){return{helper:this.helper,position:this.position,absolutePosition:this.positionAbs,offset:this.positionAbs};}}));$.extend($.ui.draggable,{version:"1.7.2",eventPrefix:"drag",defaults:{addClasses:true,appendTo:"parent",axis:false,cancel:":input,option",connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,delay:0,distance:1,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false}});$.ui.plugin.add("draggable","connectToSortable",{start:function(event,ui){var inst=$(this).data("draggable"),o=inst.options,uiSortable=$.extend({},ui,{item:inst.element});inst.sortables=[];$(o.connectToSortable).each(function(){var sortable=$.data(this,'sortable');if(sortable&&!sortable.options.disabled){inst.sortables.push({instance:sortable,shouldRevert:sortable.options.revert});sortable._refreshItems();sortable._trigger("activate",event,uiSortable);}});},stop:function(event,ui){var inst=$(this).data("draggable"),uiSortable=$.extend({},ui,{item:inst.element});$.each(inst.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;inst.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(event);this.instance.options.helper=this.instance.options._helper;if(inst.options.helper=='original')
-this.instance.currentItem.css({top:'auto',left:'auto'});}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",event,uiSortable);}});},drag:function(event,ui){var inst=$(this).data("draggable"),self=this;var checkPos=function(o){var dyClick=this.offset.click.top,dxClick=this.offset.click.left;var helperTop=this.positionAbs.top,helperLeft=this.positionAbs.left;var itemHeight=o.height,itemWidth=o.width;var itemTop=o.top,itemLeft=o.left;return $.ui.isOver(helperTop+dyClick,helperLeft+dxClick,itemTop,itemLeft,itemHeight,itemWidth);};$.each(inst.sortables,function(i){this.instance.positionAbs=inst.positionAbs;this.instance.helperProportions=inst.helperProportions;this.instance.offset.click=inst.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=$(self).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return ui.helper[0];};event.target=this.instance.currentItem[0];this.instance._mouseCapture(event,true);this.instance._mouseStart(event,true,true);this.instance.offset.click.top=inst.offset.click.top;this.instance.offset.click.left=inst.offset.click.left;this.instance.offset.parent.left-=inst.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=inst.offset.parent.top-this.instance.offset.parent.top;inst._trigger("toSortable",event);inst.dropped=this.instance.element;inst.currentItem=inst.element;this.instance.fromOutside=inst;}
-if(this.instance.currentItem)this.instance._mouseDrag(event);}else{if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger('out',event,this.instance._uiHash(this.instance));this.instance._mouseStop(event,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();if(this.instance.placeholder)this.instance.placeholder.remove();inst._trigger("fromSortable",event);inst.dropped=false;}};});}});$.ui.plugin.add("draggable","cursor",{start:function(event,ui){var t=$('body'),o=$(this).data('draggable').options;if(t.css("cursor"))o._cursor=t.css("cursor");t.css("cursor",o.cursor);},stop:function(event,ui){var o=$(this).data('draggable').options;if(o._cursor)$('body').css("cursor",o._cursor);}});$.ui.plugin.add("draggable","iframeFix",{start:function(event,ui){var o=$(this).data('draggable').options;$(o.iframeFix===true?"iframe":o.iframeFix).each(function(){$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css($(this).offset()).appendTo("body");});},stop:function(event,ui){$("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this);});}});$.ui.plugin.add("draggable","opacity",{start:function(event,ui){var t=$(ui.helper),o=$(this).data('draggable').options;if(t.css("opacity"))o._opacity=t.css("opacity");t.css('opacity',o.opacity);},stop:function(event,ui){var o=$(this).data('draggable').options;if(o._opacity)$(ui.helper).css('opacity',o._opacity);}});$.ui.plugin.add("draggable","scroll",{start:function(event,ui){var i=$(this).data("draggable");if(i.scrollParent[0]!=document&&i.scrollParent[0].tagName!='HTML')i.overflowOffset=i.scrollParent.offset();},drag:function(event,ui){var i=$(this).data("draggable"),o=i.options,scrolled=false;if(i.scrollParent[0]!=document&&i.scrollParent[0].tagName!='HTML'){if(!o.axis||o.axis!='x'){if((i.overflowOffset.top+i.scrollParent[0].offsetHeight)-event.pageY<o.scrollSensitivity)
-i.scrollParent[0].scrollTop=scrolled=i.scrollParent[0].scrollTop+o.scrollSpeed;else if(event.pageY-i.overflowOffset.top<o.scrollSensitivity)
-i.scrollParent[0].scrollTop=scrolled=i.scrollParent[0].scrollTop-o.scrollSpeed;}
-if(!o.axis||o.axis!='y'){if((i.overflowOffset.left+i.scrollParent[0].offsetWidth)-event.pageX<o.scrollSensitivity)
-i.scrollParent[0].scrollLeft=scrolled=i.scrollParent[0].scrollLeft+o.scrollSpeed;else if(event.pageX-i.overflowOffset.left<o.scrollSensitivity)
-i.scrollParent[0].scrollLeft=scrolled=i.scrollParent[0].scrollLeft-o.scrollSpeed;}}else{if(!o.axis||o.axis!='x'){if(event.pageY-$(document).scrollTop()<o.scrollSensitivity)
-scrolled=$(document).scrollTop($(document).scrollTop()-o.scrollSpeed);else if($(window).height()-(event.pageY-$(document).scrollTop())<o.scrollSensitivity)
-scrolled=$(document).scrollTop($(document).scrollTop()+o.scrollSpeed);}
-if(!o.axis||o.axis!='y'){if(event.pageX-$(document).scrollLeft()<o.scrollSensitivity)
-scrolled=$(document).scrollLeft($(document).scrollLeft()-o.scrollSpeed);else if($(window).width()-(event.pageX-$(document).scrollLeft())<o.scrollSensitivity)
-scrolled=$(document).scrollLeft($(document).scrollLeft()+o.scrollSpeed);}}
-if(scrolled!==false&&$.ui.ddmanager&&!o.dropBehaviour)
-$.ui.ddmanager.prepareOffsets(i,event);}});$.ui.plugin.add("draggable","snap",{start:function(event,ui){var i=$(this).data("draggable"),o=i.options;i.snapElements=[];$(o.snap.constructor!=String?(o.snap.items||':data(draggable)'):o.snap).each(function(){var $t=$(this);var $o=$t.offset();if(this!=i.element[0])i.snapElements.push({item:this,width:$t.outerWidth(),height:$t.outerHeight(),top:$o.top,left:$o.left});});},drag:function(event,ui){var inst=$(this).data("draggable"),o=inst.options;var d=o.snapTolerance;var x1=ui.offset.left,x2=x1+inst.helperProportions.width,y1=ui.offset.top,y2=y1+inst.helperProportions.height;for(var i=inst.snapElements.length-1;i>=0;i--){var l=inst.snapElements[i].left,r=l+inst.snapElements[i].width,t=inst.snapElements[i].top,b=t+inst.snapElements[i].height;if(!((l-d<x1&&x1<r+d&&t-d<y1&&y1<b+d)||(l-d<x1&&x1<r+d&&t-d<y2&&y2<b+d)||(l-d<x2&&x2<r+d&&t-d<y1&&y1<b+d)||(l-d<x2&&x2<r+d&&t-d<y2&&y2<b+d))){if(inst.snapElements[i].snapping)(inst.options.snap.release&&inst.options.snap.release.call(inst.element,event,$.extend(inst._uiHash(),{snapItem:inst.snapElements[i].item})));inst.snapElements[i].snapping=false;continue;}
-if(o.snapMode!='inner'){var ts=Math.abs(t-y2)<=d;var bs=Math.abs(b-y1)<=d;var ls=Math.abs(l-x2)<=d;var rs=Math.abs(r-x1)<=d;if(ts)ui.position.top=inst._convertPositionTo("relative",{top:t-inst.helperProportions.height,left:0}).top-inst.margins.top;if(bs)ui.position.top=inst._convertPositionTo("relative",{top:b,left:0}).top-inst.margins.top;if(ls)ui.position.left=inst._convertPositionTo("relative",{top:0,left:l-inst.helperProportions.width}).left-inst.margins.left;if(rs)ui.position.left=inst._convertPositionTo("relative",{top:0,left:r}).left-inst.margins.left;}
-var first=(ts||bs||ls||rs);if(o.snapMode!='outer'){var ts=Math.abs(t-y1)<=d;var bs=Math.abs(b-y2)<=d;var ls=Math.abs(l-x1)<=d;var rs=Math.abs(r-x2)<=d;if(ts)ui.position.top=inst._convertPositionTo("relative",{top:t,left:0}).top-inst.margins.top;if(bs)ui.position.top=inst._convertPositionTo("relative",{top:b-inst.helperProportions.height,left:0}).top-inst.margins.top;if(ls)ui.position.left=inst._convertPositionTo("relative",{top:0,left:l}).left-inst.margins.left;if(rs)ui.position.left=inst._convertPositionTo("relative",{top:0,left:r-inst.helperProportions.width}).left-inst.margins.left;}
-if(!inst.snapElements[i].snapping&&(ts||bs||ls||rs||first))
-(inst.options.snap.snap&&inst.options.snap.snap.call(inst.element,event,$.extend(inst._uiHash(),{snapItem:inst.snapElements[i].item})));inst.snapElements[i].snapping=(ts||bs||ls||rs||first);};}});$.ui.plugin.add("draggable","stack",{start:function(event,ui){var o=$(this).data("draggable").options;var group=$.makeArray($(o.stack.group)).sort(function(a,b){return(parseInt($(a).css("zIndex"),10)||o.stack.min)-(parseInt($(b).css("zIndex"),10)||o.stack.min);});$(group).each(function(i){this.style.zIndex=o.stack.min+i;});this[0].style.zIndex=o.stack.min+group.length;}});$.ui.plugin.add("draggable","zIndex",{start:function(event,ui){var t=$(ui.helper),o=$(this).data("draggable").options;if(t.css("zIndex"))o._zIndex=t.css("zIndex");t.css('zIndex',o.zIndex);},stop:function(event,ui){var o=$(this).data("draggable").options;if(o._zIndex)$(ui.helper).css('zIndex',o._zIndex);}});})(jQuery);(function($){$.widget("ui.droppable",{_init:function(){var o=this.options,accept=o.accept;this.isover=0;this.isout=1;this.options.accept=this.options.accept&&$.isFunction(this.options.accept)?this.options.accept:function(d){return d.is(accept);};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};$.ui.ddmanager.droppables[this.options.scope]=$.ui.ddmanager.droppables[this.options.scope]||[];$.ui.ddmanager.droppables[this.options.scope].push(this);(this.options.addClasses&&this.element.addClass("ui-droppable"));},destroy:function(){var drop=$.ui.ddmanager.droppables[this.options.scope];for(var i=0;i<drop.length;i++)
-if(drop[i]==this)
-drop.splice(i,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");},_setData:function(key,value){if(key=='accept'){this.options.accept=value&&$.isFunction(value)?value:function(d){return d.is(value);};}else{$.widget.prototype._setData.apply(this,arguments);}},_activate:function(event){var draggable=$.ui.ddmanager.current;if(this.options.activeClass)this.element.addClass(this.options.activeClass);(draggable&&this._trigger('activate',event,this.ui(draggable)));},_deactivate:function(event){var draggable=$.ui.ddmanager.current;if(this.options.activeClass)this.element.removeClass(this.options.activeClass);(draggable&&this._trigger('deactivate',event,this.ui(draggable)));},_over:function(event){var draggable=$.ui.ddmanager.current;if(!draggable||(draggable.currentItem||draggable.element)[0]==this.element[0])return;if(this.options.accept.call(this.element[0],(draggable.currentItem||draggable.element))){if(this.options.hoverClass)this.element.addClass(this.options.hoverClass);this._trigger('over',event,this.ui(draggable));}},_out:function(event){var draggable=$.ui.ddmanager.current;if(!draggable||(draggable.currentItem||draggable.element)[0]==this.element[0])return;if(this.options.accept.call(this.element[0],(draggable.currentItem||draggable.element))){if(this.options.hoverClass)this.element.removeClass(this.options.hoverClass);this._trigger('out',event,this.ui(draggable));}},_drop:function(event,custom){var draggable=custom||$.ui.ddmanager.current;if(!draggable||(draggable.currentItem||draggable.element)[0]==this.element[0])return false;var childrenIntersection=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var inst=$.data(this,'droppable');if(inst.options.greedy&&$.ui.intersect(draggable,$.extend(inst,{offset:inst.element.offset()}),inst.options.tolerance)){childrenIntersection=true;return false;}});if(childrenIntersection)return false;if(this.options.accept.call(this.element[0],(draggable.currentItem||draggable.element))){if(this.options.activeClass)this.element.removeClass(this.options.activeClass);if(this.options.hoverClass)this.element.removeClass(this.options.hoverClass);this._trigger('drop',event,this.ui(draggable));return this.element;}
-return false;},ui:function(c){return{draggable:(c.currentItem||c.element),helper:c.helper,position:c.position,absolutePosition:c.positionAbs,offset:c.positionAbs};}});$.extend($.ui.droppable,{version:"1.7.2",eventPrefix:'drop',defaults:{accept:'*',activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:'default',tolerance:'intersect'}});$.ui.intersect=function(draggable,droppable,toleranceMode){if(!droppable.offset)return false;var x1=(draggable.positionAbs||draggable.position.absolute).left,x2=x1+draggable.helperProportions.width,y1=(draggable.positionAbs||draggable.position.absolute).top,y2=y1+draggable.helperProportions.height;var l=droppable.offset.left,r=l+droppable.proportions.width,t=droppable.offset.top,b=t+droppable.proportions.height;switch(toleranceMode){case'fit':return(l<x1&&x2<r&&t<y1&&y2<b);break;case'intersect':return(l<x1+(draggable.helperProportions.width/2)&&x2-(draggable.helperProportions.width/2)<r&&t<y1+(draggable.helperProportions.height/2)&&y2-(draggable.helperProportions.height/2)<b);break;case'pointer':var draggableLeft=((draggable.positionAbs||draggable.position.absolute).left+(draggable.clickOffset||draggable.offset.click).left),draggableTop=((draggable.positionAbs||draggable.position.absolute).top+(draggable.clickOffset||draggable.offset.click).top),isOver=$.ui.isOver(draggableTop,draggableLeft,t,l,droppable.proportions.height,droppable.proportions.width);return isOver;break;case'touch':return((y1>=t&&y1<=b)||(y2>=t&&y2<=b)||(y1<t&&y2>b))&&((x1>=l&&x1<=r)||(x2>=l&&x2<=r)||(x1<l&&x2>r));break;default:return false;break;}};$.ui.ddmanager={current:null,droppables:{'default':[]},prepareOffsets:function(t,event){var m=$.ui.ddmanager.droppables[t.options.scope];var type=event?event.type:null;var list=(t.currentItem||t.element).find(":data(droppable)").andSelf();droppablesLoop:for(var i=0;i<m.length;i++){if(m[i].options.disabled||(t&&!m[i].options.accept.call(m[i].element[0],(t.currentItem||t.element))))continue;for(var j=0;j<list.length;j++){if(list[j]==m[i].element[0]){m[i].proportions.height=0;continue droppablesLoop;}};m[i].visible=m[i].element.css("display")!="none";if(!m[i].visible)continue;m[i].offset=m[i].element.offset();m[i].proportions={width:m[i].element[0].offsetWidth,height:m[i].element[0].offsetHeight};if(type=="mousedown")m[i]._activate.call(m[i],event);}},drop:function(draggable,event){var dropped=false;$.each($.ui.ddmanager.droppables[draggable.options.scope],function(){if(!this.options)return;if(!this.options.disabled&&this.visible&&$.ui.intersect(draggable,this,this.options.tolerance))
-dropped=this._drop.call(this,event);if(!this.options.disabled&&this.visible&&this.options.accept.call(this.element[0],(draggable.currentItem||draggable.element))){this.isout=1;this.isover=0;this._deactivate.call(this,event);}});return dropped;},drag:function(draggable,event){if(draggable.options.refreshPositions)$.ui.ddmanager.prepareOffsets(draggable,event);$.each($.ui.ddmanager.droppables[draggable.options.scope],function(){if(this.options.disabled||this.greedyChild||!this.visible)return;var intersects=$.ui.intersect(draggable,this,this.options.tolerance);var c=!intersects&&this.isover==1?'isout':(intersects&&this.isover==0?'isover':null);if(!c)return;var parentInstance;if(this.options.greedy){var parent=this.element.parents(':data(droppable):eq(0)');if(parent.length){parentInstance=$.data(parent[0],'droppable');parentInstance.greedyChild=(c=='isover'?1:0);}}
-if(parentInstance&&c=='isover'){parentInstance['isover']=0;parentInstance['isout']=1;parentInstance._out.call(parentInstance,event);}
-this[c]=1;this[c=='isout'?'isover':'isout']=0;this[c=="isover"?"_over":"_out"].call(this,event);if(parentInstance&&c=='isout'){parentInstance['isout']=0;parentInstance['isover']=1;parentInstance._over.call(parentInstance,event);}});}};})(jQuery);(function($){$.widget("ui.resizable",$.extend({},$.ui.mouse,{_init:function(){var self=this,o=this.options;this.element.addClass("ui-resizable");$.extend(this,{_aspectRatio:!!(o.aspectRatio),aspectRatio:o.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:o.helper||o.ghost||o.animate?o.helper||'ui-resizable-helper':null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css('position'))&&$.browser.opera)
-this.element.css({position:'relative',top:'auto',left:'auto'});this.element.wrap($('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css('position'),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css('top'),left:this.element.css('left')}));this.element=this.element.parent().data("resizable",this.element.data('resizable'));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css('resize');this.originalElement.css('resize','none');this._proportionallyResizeElements.push(this.originalElement.css({position:'static',zoom:1,display:'block'}));this.originalElement.css({margin:this.originalElement.css('margin')});this._proportionallyResize();}
-this.handles=o.handles||(!$('.ui-resizable-handle',this.element).length?"e,s,se":{n:'.ui-resizable-n',e:'.ui-resizable-e',s:'.ui-resizable-s',w:'.ui-resizable-w',se:'.ui-resizable-se',sw:'.ui-resizable-sw',ne:'.ui-resizable-ne',nw:'.ui-resizable-nw'});if(this.handles.constructor==String){if(this.handles=='all')this.handles='n,e,s,w,se,sw,ne,nw';var n=this.handles.split(",");this.handles={};for(var i=0;i<n.length;i++){var handle=$.trim(n[i]),hname='ui-resizable-'+handle;var axis=$('<div class="ui-resizable-handle '+hname+'"></div>');if(/sw|se|ne|nw/.test(handle))axis.css({zIndex:++o.zIndex});if('se'==handle){axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');};this.handles[handle]='.ui-resizable-'+handle;this.element.append(axis);}}
-this._renderAxis=function(target){target=target||this.element;for(var i in this.handles){if(this.handles[i].constructor==String)
-this.handles[i]=$(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var axis=$(this.handles[i],this.element),padWrapper=0;padWrapper=/sw|ne|nw|se|n|s/.test(i)?axis.outerHeight():axis.outerWidth();var padPos=['padding',/ne|nw|n/.test(i)?'Top':/se|sw|s/.test(i)?'Bottom':/^e$/.test(i)?'Right':'Left'].join("");target.css(padPos,padWrapper);this._proportionallyResize();}
-if(!$(this.handles[i]).length)
-continue;}};this._renderAxis(this.element);this._handles=$('.ui-resizable-handle',this.element).disableSelection();this._handles.mouseover(function(){if(!self.resizing){if(this.className)
-var axis=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);self.axis=axis&&axis[1]?axis[1]:'se';}});if(o.autoHide){this._handles.hide();$(this.element).addClass("ui-resizable-autohide").hover(function(){$(this).removeClass("ui-resizable-autohide");self._handles.show();},function(){if(!self.resizing){$(this).addClass("ui-resizable-autohide");self._handles.hide();}});}
-this._mouseInit();},destroy:function(){this._mouseDestroy();var _destroy=function(exp){$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();};if(this.elementIsWrapper){_destroy(this.element);var wrapper=this.element;wrapper.parent().append(this.originalElement.css({position:wrapper.css('position'),width:wrapper.outerWidth(),height:wrapper.outerHeight(),top:wrapper.css('top'),left:wrapper.css('left')})).end().remove();}
-this.originalElement.css('resize',this.originalResizeStyle);_destroy(this.originalElement);},_mouseCapture:function(event){var handle=false;for(var i in this.handles){if($(this.handles[i])[0]==event.target)handle=true;}
-return this.options.disabled||!!handle;},_mouseStart:function(event){var o=this.options,iniPos=this.element.position(),el=this.element;this.resizing=true;this.documentScroll={top:$(document).scrollTop(),left:$(document).scrollLeft()};if(el.is('.ui-draggable')||(/absolute/).test(el.css('position'))){el.css({position:'absolute',top:iniPos.top,left:iniPos.left});}
-if($.browser.opera&&(/relative/).test(el.css('position')))
-el.css({position:'relative',top:'auto',left:'auto'});this._renderProxy();var curleft=num(this.helper.css('left')),curtop=num(this.helper.css('top'));if(o.containment){curleft+=$(o.containment).scrollLeft()||0;curtop+=$(o.containment).scrollTop()||0;}
-this.offset=this.helper.offset();this.position={left:curleft,top:curtop};this.size=this._helper?{width:el.outerWidth(),height:el.outerHeight()}:{width:el.width(),height:el.height()};this.originalSize=this._helper?{width:el.outerWidth(),height:el.outerHeight()}:{width:el.width(),height:el.height()};this.originalPosition={left:curleft,top:curtop};this.sizeDiff={width:el.outerWidth()-el.width(),height:el.outerHeight()-el.height()};this.originalMousePosition={left:event.pageX,top:event.pageY};this.aspectRatio=(typeof o.aspectRatio=='number')?o.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var cursor=$('.ui-resizable-'+this.axis).css('cursor');$('body').css('cursor',cursor=='auto'?this.axis+'-resize':cursor);el.addClass("ui-resizable-resizing");this._propagate("start",event);return true;},_mouseDrag:function(event){var el=this.helper,o=this.options,props={},self=this,smp=this.originalMousePosition,a=this.axis;var dx=(event.pageX-smp.left)||0,dy=(event.pageY-smp.top)||0;var trigger=this._change[a];if(!trigger)return false;var data=trigger.apply(this,[event,dx,dy]),ie6=$.browser.msie&&$.browser.version<7,csdif=this.sizeDiff;if(this._aspectRatio||event.shiftKey)
-data=this._updateRatio(data,event);data=this._respectSize(data,event);this._propagate("resize",event);el.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length)
-this._proportionallyResize();this._updateCache(data);this._trigger('resize',event,this.ui());return false;},_mouseStop:function(event){this.resizing=false;var o=this.options,self=this;if(this._helper){var pr=this._proportionallyResizeElements,ista=pr.length&&(/textarea/i).test(pr[0].nodeName),soffseth=ista&&$.ui.hasScroll(pr[0],'left')?0:self.sizeDiff.height,soffsetw=ista?0:self.sizeDiff.width;var s={width:(self.size.width-soffsetw),height:(self.size.height-soffseth)},left=(parseInt(self.element.css('left'),10)+(self.position.left-self.originalPosition.left))||null,top=(parseInt(self.element.css('top'),10)+(self.position.top-self.originalPosition.top))||null;if(!o.animate)
-this.element.css($.extend(s,{top:top,left:left}));self.helper.height(self.size.height);self.helper.width(self.size.width);if(this._helper&&!o.animate)this._proportionallyResize();}
-$('body').css('cursor','auto');this.element.removeClass("ui-resizable-resizing");this._propagate("stop",event);if(this._helper)this.helper.remove();return false;},_updateCache:function(data){var o=this.options;this.offset=this.helper.offset();if(isNumber(data.left))this.position.left=data.left;if(isNumber(data.top))this.position.top=data.top;if(isNumber(data.height))this.size.height=data.height;if(isNumber(data.width))this.size.width=data.width;},_updateRatio:function(data,event){var o=this.options,cpos=this.position,csize=this.size,a=this.axis;if(data.height)data.width=(csize.height*this.aspectRatio);else if(data.width)data.height=(csize.width/this.aspectRatio);if(a=='sw'){data.left=cpos.left+(csize.width-data.width);data.top=null;}
-if(a=='nw'){data.top=cpos.top+(csize.height-data.height);data.left=cpos.left+(csize.width-data.width);}
-return data;},_respectSize:function(data,event){var el=this.helper,o=this.options,pRatio=this._aspectRatio||event.shiftKey,a=this.axis,ismaxw=isNumber(data.width)&&o.maxWidth&&(o.maxWidth<data.width),ismaxh=isNumber(data.height)&&o.maxHeight&&(o.maxHeight<data.height),isminw=isNumber(data.width)&&o.minWidth&&(o.minWidth>data.width),isminh=isNumber(data.height)&&o.minHeight&&(o.minHeight>data.height);if(isminw)data.width=o.minWidth;if(isminh)data.height=o.minHeight;if(ismaxw)data.width=o.maxWidth;if(ismaxh)data.height=o.maxHeight;var dw=this.originalPosition.left+this.originalSize.width,dh=this.position.top+this.size.height;var cw=/sw|nw|w/.test(a),ch=/nw|ne|n/.test(a);if(isminw&&cw)data.left=dw-o.minWidth;if(ismaxw&&cw)data.left=dw-o.maxWidth;if(isminh&&ch)data.top=dh-o.minHeight;if(ismaxh&&ch)data.top=dh-o.maxHeight;var isNotwh=!data.width&&!data.height;if(isNotwh&&!data.left&&data.top)data.top=null;else if(isNotwh&&!data.top&&data.left)data.left=null;return data;},_proportionallyResize:function(){var o=this.options;if(!this._proportionallyResizeElements.length)return;var element=this.helper||this.element;for(var i=0;i<this._proportionallyResizeElements.length;i++){var prel=this._proportionallyResizeElements[i];if(!this.borderDif){var b=[prel.css('borderTopWidth'),prel.css('borderRightWidth'),prel.css('borderBottomWidth'),prel.css('borderLeftWidth')],p=[prel.css('paddingTop'),prel.css('paddingRight'),prel.css('paddingBottom'),prel.css('paddingLeft')];this.borderDif=$.map(b,function(v,i){var border=parseInt(v,10)||0,padding=parseInt(p[i],10)||0;return border+padding;});}
-if($.browser.msie&&!(!($(element).is(':hidden')||$(element).parents(':hidden').length)))
-continue;prel.css({height:(element.height()-this.borderDif[0]-this.borderDif[2])||0,width:(element.width()-this.borderDif[1]-this.borderDif[3])||0});};},_renderProxy:function(){var el=this.element,o=this.options;this.elementOffset=el.offset();if(this._helper){this.helper=this.helper||$('<div style="overflow:hidden;"></div>');var ie6=$.browser.msie&&$.browser.version<7,ie6offset=(ie6?1:0),pxyoffset=(ie6?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+pxyoffset,height:this.element.outerHeight()+pxyoffset,position:'absolute',left:this.elementOffset.left-ie6offset+'px',top:this.elementOffset.top-ie6offset+'px',zIndex:++o.zIndex});this.helper.appendTo("body").disableSelection();}else{this.helper=this.element;}},_change:{e:function(event,dx,dy){return{width:this.originalSize.width+dx};},w:function(event,dx,dy){var o=this.options,cs=this.originalSize,sp=this.originalPosition;return{left:sp.left+dx,width:cs.width-dx};},n:function(event,dx,dy){var o=this.options,cs=this.originalSize,sp=this.originalPosition;return{top:sp.top+dy,height:cs.height-dy};},s:function(event,dx,dy){return{height:this.originalSize.height+dy};},se:function(event,dx,dy){return $.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[event,dx,dy]));},sw:function(event,dx,dy){return $.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[event,dx,dy]));},ne:function(event,dx,dy){return $.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[event,dx,dy]));},nw:function(event,dx,dy){return $.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[event,dx,dy]));}},_propagate:function(n,event){$.ui.plugin.call(this,n,[event,this.ui()]);(n!="resize"&&this._trigger(n,event,this.ui()));},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition};}}));$.extend($.ui.resizable,{version:"1.7.2",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000}});$.ui.plugin.add("resizable","alsoResize",{start:function(event,ui){var self=$(this).data("resizable"),o=self.options;_store=function(exp){$(exp).each(function(){$(this).data("resizable-alsoresize",{width:parseInt($(this).width(),10),height:parseInt($(this).height(),10),left:parseInt($(this).css('left'),10),top:parseInt($(this).css('top'),10)});});};if(typeof(o.alsoResize)=='object'&&!o.alsoResize.parentNode){if(o.alsoResize.length){o.alsoResize=o.alsoResize[0];_store(o.alsoResize);}
-else{$.each(o.alsoResize,function(exp,c){_store(exp);});}}else{_store(o.alsoResize);}},resize:function(event,ui){var self=$(this).data("resizable"),o=self.options,os=self.originalSize,op=self.originalPosition;var delta={height:(self.size.height-os.height)||0,width:(self.size.width-os.width)||0,top:(self.position.top-op.top)||0,left:(self.position.left-op.left)||0},_alsoResize=function(exp,c){$(exp).each(function(){var el=$(this),start=$(this).data("resizable-alsoresize"),style={},css=c&&c.length?c:['width','height','top','left'];$.each(css||['width','height','top','left'],function(i,prop){var sum=(start[prop]||0)+(delta[prop]||0);if(sum&&sum>=0)
-style[prop]=sum||null;});if(/relative/.test(el.css('position'))&&$.browser.opera){self._revertToRelativePosition=true;el.css({position:'absolute',top:'auto',left:'auto'});}
-el.css(style);});};if(typeof(o.alsoResize)=='object'&&!o.alsoResize.nodeType){$.each(o.alsoResize,function(exp,c){_alsoResize(exp,c);});}else{_alsoResize(o.alsoResize);}},stop:function(event,ui){var self=$(this).data("resizable");if(self._revertToRelativePosition&&$.browser.opera){self._revertToRelativePosition=false;el.css({position:'relative'});}
-$(this).removeData("resizable-alsoresize-start");}});$.ui.plugin.add("resizable","animate",{stop:function(event,ui){var self=$(this).data("resizable"),o=self.options;var pr=self._proportionallyResizeElements,ista=pr.length&&(/textarea/i).test(pr[0].nodeName),soffseth=ista&&$.ui.hasScroll(pr[0],'left')?0:self.sizeDiff.height,soffsetw=ista?0:self.sizeDiff.width;var style={width:(self.size.width-soffsetw),height:(self.size.height-soffseth)},left=(parseInt(self.element.css('left'),10)+(self.position.left-self.originalPosition.left))||null,top=(parseInt(self.element.css('top'),10)+(self.position.top-self.originalPosition.top))||null;self.element.animate($.extend(style,top&&left?{top:top,left:left}:{}),{duration:o.animateDuration,easing:o.animateEasing,step:function(){var data={width:parseInt(self.element.css('width'),10),height:parseInt(self.element.css('height'),10),top:parseInt(self.element.css('top'),10),left:parseInt(self.element.css('left'),10)};if(pr&&pr.length)$(pr[0]).css({width:data.width,height:data.height});self._updateCache(data);self._propagate("resize",event);}});}});$.ui.plugin.add("resizable","containment",{start:function(event,ui){var self=$(this).data("resizable"),o=self.options,el=self.element;var oc=o.containment,ce=(oc instanceof $)?oc.get(0):(/parent/.test(oc))?el.parent().get(0):oc;if(!ce)return;self.containerElement=$(ce);if(/document/.test(oc)||oc==document){self.containerOffset={left:0,top:0};self.containerPosition={left:0,top:0};self.parentData={element:$(document),left:0,top:0,width:$(document).width(),height:$(document).height()||document.body.parentNode.scrollHeight};}
-else{var element=$(ce),p=[];$(["Top","Right","Left","Bottom"]).each(function(i,name){p[i]=num(element.css("padding"+name));});self.containerOffset=element.offset();self.containerPosition=element.position();self.containerSize={height:(element.innerHeight()-p[3]),width:(element.innerWidth()-p[1])};var co=self.containerOffset,ch=self.containerSize.height,cw=self.containerSize.width,width=($.ui.hasScroll(ce,"left")?ce.scrollWidth:cw),height=($.ui.hasScroll(ce)?ce.scrollHeight:ch);self.parentData={element:ce,left:co.left,top:co.top,width:width,height:height};}},resize:function(event,ui){var self=$(this).data("resizable"),o=self.options,ps=self.containerSize,co=self.containerOffset,cs=self.size,cp=self.position,pRatio=self._aspectRatio||event.shiftKey,cop={top:0,left:0},ce=self.containerElement;if(ce[0]!=document&&(/static/).test(ce.css('position')))cop=co;if(cp.left<(self._helper?co.left:0)){self.size.width=self.size.width+(self._helper?(self.position.left-co.left):(self.position.left-cop.left));if(pRatio)self.size.height=self.size.width/o.aspectRatio;self.position.left=o.helper?co.left:0;}
-if(cp.top<(self._helper?co.top:0)){self.size.height=self.size.height+(self._helper?(self.position.top-co.top):self.position.top);if(pRatio)self.size.width=self.size.height*o.aspectRatio;self.position.top=self._helper?co.top:0;}
-self.offset.left=self.parentData.left+self.position.left;self.offset.top=self.parentData.top+self.position.top;var woset=Math.abs((self._helper?self.offset.left-cop.left:(self.offset.left-cop.left))+self.sizeDiff.width),hoset=Math.abs((self._helper?self.offset.top-cop.top:(self.offset.top-co.top))+self.sizeDiff.height);var isParent=self.containerElement.get(0)==self.element.parent().get(0),isOffsetRelative=/relative|absolute/.test(self.containerElement.css('position'));if(isParent&&isOffsetRelative)woset-=self.parentData.left;if(woset+self.size.width>=self.parentData.width){self.size.width=self.parentData.width-woset;if(pRatio)self.size.height=self.size.width/self.aspectRatio;}
-if(hoset+self.size.height>=self.parentData.height){self.size.height=self.parentData.height-hoset;if(pRatio)self.size.width=self.size.height*self.aspectRatio;}},stop:function(event,ui){var self=$(this).data("resizable"),o=self.options,cp=self.position,co=self.containerOffset,cop=self.containerPosition,ce=self.containerElement;var helper=$(self.helper),ho=helper.offset(),w=helper.outerWidth()-self.sizeDiff.width,h=helper.outerHeight()-self.sizeDiff.height;if(self._helper&&!o.animate&&(/relative/).test(ce.css('position')))
-$(this).css({left:ho.left-cop.left-co.left,width:w,height:h});if(self._helper&&!o.animate&&(/static/).test(ce.css('position')))
-$(this).css({left:ho.left-cop.left-co.left,width:w,height:h});}});$.ui.plugin.add("resizable","ghost",{start:function(event,ui){var self=$(this).data("resizable"),o=self.options,cs=self.size;self.ghost=self.originalElement.clone();self.ghost.css({opacity:.25,display:'block',position:'relative',height:cs.height,width:cs.width,margin:0,left:0,top:0}).addClass('ui-resizable-ghost').addClass(typeof o.ghost=='string'?o.ghost:'');self.ghost.appendTo(self.helper);},resize:function(event,ui){var self=$(this).data("resizable"),o=self.options;if(self.ghost)self.ghost.css({position:'relative',height:self.size.height,width:self.size.width});},stop:function(event,ui){var self=$(this).data("resizable"),o=self.options;if(self.ghost&&self.helper)self.helper.get(0).removeChild(self.ghost.get(0));}});$.ui.plugin.add("resizable","grid",{resize:function(event,ui){var self=$(this).data("resizable"),o=self.options,cs=self.size,os=self.originalSize,op=self.originalPosition,a=self.axis,ratio=o._aspectRatio||event.shiftKey;o.grid=typeof o.grid=="number"?[o.grid,o.grid]:o.grid;var ox=Math.round((cs.width-os.width)/(o.grid[0]||1))*(o.grid[0]||1),oy=Math.round((cs.height-os.height)/(o.grid[1]||1))*(o.grid[1]||1);if(/^(se|s|e)$/.test(a)){self.size.width=os.width+ox;self.size.height=os.height+oy;}
-else if(/^(ne)$/.test(a)){self.size.width=os.width+ox;self.size.height=os.height+oy;self.position.top=op.top-oy;}
-else if(/^(sw)$/.test(a)){self.size.width=os.width+ox;self.size.height=os.height+oy;self.position.left=op.left-ox;}
-else{self.size.width=os.width+ox;self.size.height=os.height+oy;self.position.top=op.top-oy;self.position.left=op.left-ox;}}});var num=function(v){return parseInt(v,10)||0;};var isNumber=function(value){return!isNaN(parseInt(value,10));};})(jQuery);(function($){$.widget("ui.selectable",$.extend({},$.ui.mouse,{_init:function(){var self=this;this.element.addClass("ui-selectable");this.dragged=false;var selectees;this.refresh=function(){selectees=$(self.options.filter,self.element[0]);selectees.each(function(){var $this=$(this);var pos=$this.offset();$.data(this,"selectable-item",{element:this,$element:$this,left:pos.left,top:pos.top,right:pos.left+$this.outerWidth(),bottom:pos.top+$this.outerHeight(),startselected:false,selected:$this.hasClass('ui-selected'),selecting:$this.hasClass('ui-selecting'),unselecting:$this.hasClass('ui-unselecting')});});};this.refresh();this.selectees=selectees.addClass("ui-selectee");this._mouseInit();this.helper=$(document.createElement('div')).css({border:'1px dotted black'}).addClass("ui-selectable-helper");this.element.bind("mousedown.selectable",function(event){if(event.pageX>self.element[0].scrollWidth+self.element.offset().left){return;}
-var selectee=self._targetIsSelectable(event.target);if(!selectee){return;}
-var test=$(".ui-selected").length;if(!event.ctrlKey&&$(".ui-selected").length>1&&$(selectee).hasClass("ui-selected")){return(self._listenForMouseUp=1);}
-if(!event.ctrlKey){$(".ui-selected").each(function(){self._removeSelection(this,event);});}
-self._toggleSelection(selectee,event);event.preventDefault();}).bind("mouseup.selectable",function(event){if(self._listenForMouseUp){self._listenForMouseUp=0;var selectee=self._targetIsSelectable(event.target);if(!selectee){return;}
-self._addSelection(selectee,event);event.preventDefault();}})},_addSelection:function(selectee,event){$(selectee).addClass("ui-selecting");this._trigger("selecting",event,{selecting:selectee});$(selectee).removeClass('ui-selecting').addClass('ui-selected');this._trigger("selected",event,{selected:selectee});},_removeSelection:function(selected,event){$(selected).removeClass('ui-selected').addClass('ui-unselecting');this._trigger("unselecting",event,{unselecting:selected});$(selected).removeClass('ui-unselecting');this._trigger("unselected",event,{unselected:selected});},_toggleSelection:function(selectee,event){if($(selectee).hasClass("ui-selected")){this._removeSelection(selectee,event);}else{this._addSelection(selectee,event);}},_targetIsSelectable:function(target){var found=$(target).parents().andSelf().filter(".ui-selectee");return found.length&&found;},destroy:function(){this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();},_mouseStart:function(event){var self=this;if(event.pageX>this.element[0].scrollWidth+this.element.offset().left){this.opos=null;return;}
-this.opos=[event.pageX,event.pageY];if(this.options.disabled)
-return;var options=this.options,appendTo=$(options.appendTo),parentOffset=appendTo.css('position')=='static'?appendTo.offsetParent().offset():appendTo.offset();this.selectees=$(options.filter,this.element[0]);this._trigger("start",event);appendTo.append(this.helper);this.helper.css({"z-index":100,"position":"absolute","left":event.clientX-parentOffset.left,"top":event.clientY-parentOffset.top,"width":0,"height":0});if(options.autoRefresh){this.refresh();}
-this.selectees.filter('.ui-selected').each(function(){var selectee=$.data(this,"selectable-item");selectee.startselected=true;if(!event.metaKey){selectee.$element.removeClass('ui-selected');selectee.selected=false;selectee.$element.addClass('ui-unselecting');selectee.unselecting=true;self._trigger("unselecting",event,{unselecting:selectee.element});}});$(event.target).parents().andSelf().each(function(){var selectee=$.data(this,"selectable-item");if(selectee){selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');selectee.unselecting=false;selectee.selecting=true;selectee.selected=true;self._trigger("selecting",event,{selecting:selectee.element});return false;}});},_mouseDrag:function(event){var self=this;if(!this.opos){return;}
-this.dragged=true;if(this.options.disabled)
-return;var options=this.options;var x1=this.opos[0],y1=this.opos[1],x2=event.pageX,y2=event.pageY,appendTo=$(options.appendTo),parentOffset=appendTo.css('position')=='static'?appendTo.offsetParent().offset():appendTo.offset();if(x1>x2){var tmp=x2;x2=x1;x1=tmp;}
-if(y1>y2){var tmp=y2;y2=y1;y1=tmp;}
-this.helper.css({left:x1-parentOffset.left,top:y1-parentOffset.top,width:x2-x1,height:y2-y1});this.selectees.each(function(){var selectee=$.data(this,"selectable-item");if(!selectee||selectee.element==self.element[0])
-return;var hit=false;if(options.tolerance=='touch'){hit=(!(selectee.left>x2||selectee.right<x1||selectee.top>y2||selectee.bottom<y1));}else if(options.tolerance=='fit'){hit=(selectee.left>x1&&selectee.right<x2&&selectee.top>y1&&selectee.bottom<y2);}
-if(hit){if(selectee.selected){selectee.$element.removeClass('ui-selected');selectee.selected=false;}
-if(selectee.unselecting){selectee.$element.removeClass('ui-unselecting');selectee.unselecting=false;}
-if(!selectee.selecting){selectee.$element.addClass('ui-selecting');selectee.selecting=true;self._trigger("selecting",event,{selecting:selectee.element});}}else{if(selectee.selecting){if(event.metaKey&&selectee.startselected){selectee.$element.removeClass('ui-selecting');selectee.selecting=false;selectee.$element.addClass('ui-selected');selectee.selected=true;}else{selectee.$element.removeClass('ui-selecting');selectee.selecting=false;if(selectee.startselected){selectee.$element.addClass('ui-unselecting');selectee.unselecting=true;}
-self._trigger("unselecting",event,{unselecting:selectee.element});}}
-if(selectee.selected){if(!event.metaKey&&!selectee.startselected){selectee.$element.removeClass('ui-selected');selectee.selected=false;selectee.$element.addClass('ui-unselecting');selectee.unselecting=true;self._trigger("unselecting",event,{unselecting:selectee.element});}}}});return false;},_mouseStop:function(event){var self=this;if(!this.opos){return;}
-this.dragged=false;var options=this.options;$('.ui-unselecting',this.element[0]).each(function(){var selectee=$.data(this,"selectable-item");selectee.$element.removeClass('ui-unselecting');selectee.unselecting=false;selectee.startselected=false;self._trigger("unselected",event,{unselected:selectee.element});});$('.ui-selecting',this.element[0]).each(function(){var selectee=$.data(this,"selectable-item");selectee.$element.removeClass('ui-selecting').addClass('ui-selected');selectee.selecting=false;selectee.selected=true;selectee.startselected=true;self._trigger("selected",event,{selected:selectee.element});});this._trigger("stop",event);this.helper.remove();return false;}}));$.extend($.ui.selectable,{version:"1.7.2",defaults:{appendTo:'body',autoRefresh:true,cancel:":input,option",delay:0,distance:0,filter:'*',tolerance:'touch'}});})(jQuery);(function($){$.widget("ui.sortable",$.extend({},$.ui.mouse,{_init:function(){var o=this.options;this.containerCache={};this.element.addClass("ui-sortable");this.refresh();this.floating=this.items.length?(/left|right/).test(this.items[0].item.css('float')):false;this.offset=this.element.offset();this._mouseInit();},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var i=this.items.length-1;i>=0;i--)
-this.items[i].item.removeData("sortable-item");},_mouseCapture:function(event,overrideHandle){if(this.reverting){return false;}
-if(this.options.disabled||this.options.type=='static')return false;this._refreshItems(event);var currentItem=null,self=this,nodes=$(event.target).parents().each(function(){if($.data(this,'sortable-item')==self){currentItem=$(this);return false;}});if($.data(event.target,'sortable-item')==self)currentItem=$(event.target);if(!currentItem)return false;if(this.options.handle&&!overrideHandle){var validHandle=false;$(this.options.handle,currentItem).find("*").andSelf().each(function(){if(this==event.target)validHandle=true;});if(!validHandle)return false;}
-this.currentItem=currentItem;this._removeCurrentsFromItems();return true;},_mouseStart:function(event,overrideHandle,noActivation){var o=this.options,self=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(event);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");$.extend(this.offset,{click:{left:event.pageX-this.offset.left,top:event.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(event);this.originalPageX=event.pageX;this.originalPageY=event.pageY;if(o.cursorAt)
-this._adjustOffsetFromHelper(o.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};if(this.helper[0]!=this.currentItem[0]){this.currentItem.hide();}
-this._createPlaceholder();if(o.containment)
-this._setContainment();if(o.cursor){if($('body').css("cursor"))this._storedCursor=$('body').css("cursor");$('body').css("cursor",o.cursor);}
-if(o.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",o.opacity);}
-if(o.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",o.zIndex);}
-if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!='HTML')
-this.overflowOffset=this.scrollParent.offset();this._trigger("start",event,this._uiHash());if(!this._preserveHelperProportions)
-this._cacheHelperProportions();if(!noActivation){for(var i=this.containers.length-1;i>=0;i--){this.containers[i]._trigger("activate",event,self._uiHash(this));}}
-if($.ui.ddmanager)
-$.ui.ddmanager.current=this;if($.ui.ddmanager&&!o.dropBehaviour)
-$.ui.ddmanager.prepareOffsets(this,event);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(event);return true;},_mouseDrag:function(event){this.position=this._generatePosition(event);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs){this.lastPositionAbs=this.positionAbs;}
-if(this.options.scroll){var o=this.options,scrolled=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!='HTML'){if((this.overflowOffset.top+this.scrollParent[0].offsetHeight)-event.pageY<o.scrollSensitivity)
-this.scrollParent[0].scrollTop=scrolled=this.scrollParent[0].scrollTop+o.scrollSpeed;else if(event.pageY-this.overflowOffset.top<o.scrollSensitivity)
-this.scrollParent[0].scrollTop=scrolled=this.scrollParent[0].scrollTop-o.scrollSpeed;if((this.overflowOffset.left+this.scrollParent[0].offsetWidth)-event.pageX<o.scrollSensitivity)
-this.scrollParent[0].scrollLeft=scrolled=this.scrollParent[0].scrollLeft+o.scrollSpeed;else if(event.pageX-this.overflowOffset.left<o.scrollSensitivity)
-this.scrollParent[0].scrollLeft=scrolled=this.scrollParent[0].scrollLeft-o.scrollSpeed;}else{if(event.pageY-$(document).scrollTop()<o.scrollSensitivity)
-scrolled=$(document).scrollTop($(document).scrollTop()-o.scrollSpeed);else if($(window).height()-(event.pageY-$(document).scrollTop())<o.scrollSensitivity)
-scrolled=$(document).scrollTop($(document).scrollTop()+o.scrollSpeed);if(event.pageX-$(document).scrollLeft()<o.scrollSensitivity)
-scrolled=$(document).scrollLeft($(document).scrollLeft()-o.scrollSpeed);else if($(window).width()-(event.pageX-$(document).scrollLeft())<o.scrollSensitivity)
-scrolled=$(document).scrollLeft($(document).scrollLeft()+o.scrollSpeed);}
-if(scrolled!==false&&$.ui.ddmanager&&!o.dropBehaviour)
-$.ui.ddmanager.prepareOffsets(this,event);}
-this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+'px';if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+'px';for(var i=this.items.length-1;i>=0;i--){var item=this.items[i],itemElement=item.item[0],intersection=this._intersectsWithPointer(item);if(!intersection)continue;if(itemElement!=this.currentItem[0]&&this.placeholder[intersection==1?"next":"prev"]()[0]!=itemElement&&!$.ui.contains(this.placeholder[0],itemElement)&&(this.options.type=='semi-dynamic'?!$.ui.contains(this.element[0],itemElement):true)){this.direction=intersection==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(item)){this._rearrange(event,item);}else{break;}
-this._trigger("change",event,this._uiHash());break;}}
-this._contactContainers(event);if($.ui.ddmanager)$.ui.ddmanager.drag(this,event);this._trigger('sort',event,this._uiHash());this.lastPositionAbs=this.positionAbs;return false;},_mouseStop:function(event,noPropagation){if(!event)return;if($.ui.ddmanager&&!this.options.dropBehaviour)
-$.ui.ddmanager.drop(this,event);if(this.options.revert){var self=this;var cur=self.placeholder.offset();self.reverting=true;$(this.helper).animate({left:cur.left-this.offset.parent.left-self.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:cur.top-this.offset.parent.top-self.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){self._clear(event);});}else{this._clear(event,noPropagation);}
-return false;},cancel:function(){var self=this;if(this.dragging){this._mouseUp();if(this.options.helper=="original")
-this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");else
-this.currentItem.show();for(var i=this.containers.length-1;i>=0;i--){this.containers[i]._trigger("deactivate",null,self._uiHash(this));if(this.containers[i].containerCache.over){this.containers[i]._trigger("out",null,self._uiHash(this));this.containers[i].containerCache.over=0;}}}
-if(this.placeholder[0].parentNode)this.placeholder[0].parentNode.removeChild(this.placeholder[0]);if(this.options.helper!="original"&&this.helper&&this.helper[0].parentNode)this.helper.remove();$.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});if(this.domPosition.prev){$(this.domPosition.prev).after(this.currentItem);}else{$(this.domPosition.parent).prepend(this.currentItem);}
-return true;},serialize:function(o){var items=this._getItemsAsjQuery(o&&o.connected);var str=[];o=o||{};$(items).each(function(){var res=($(o.item||this).attr(o.attribute||'id')||'').match(o.expression||(/(.+)[-=_](.+)/));if(res)str.push((o.key||res[1]+'[]')+'='+(o.key&&o.expression?res[1]:res[2]));});return str.join('&');},toArray:function(o){var items=this._getItemsAsjQuery(o&&o.connected);var ret=[];o=o||{};items.each(function(){ret.push($(o.item||this).attr(o.attribute||'id')||'');});return ret;},_intersectsWith:function(item){var x1=this.positionAbs.left,x2=x1+this.helperProportions.width,y1=this.positionAbs.top,y2=y1+this.helperProportions.height;var l=item.left,r=l+item.width,t=item.top,b=t+item.height;var dyClick=this.offset.click.top,dxClick=this.offset.click.left;var isOverElement=(y1+dyClick)>t&&(y1+dyClick)<b&&(x1+dxClick)>l&&(x1+dxClick)<r;if(this.options.tolerance=="pointer"||this.options.forcePointerForContainers||(this.options.tolerance!="pointer"&&this.helperProportions[this.floating?'width':'height']>item[this.floating?'width':'height'])){return isOverElement;}else{return(l<x1+(this.helperProportions.width/2)&&x2-(this.helperProportions.width/2)<r&&t<y1+(this.helperProportions.height/2)&&y2-(this.helperProportions.height/2)<b);}},_intersectsWithPointer:function(item){var isOverElementHeight=$.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,item.top,item.height),isOverElementWidth=$.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,item.left,item.width),isOverElement=isOverElementHeight&&isOverElementWidth,verticalDirection=this._getDragVerticalDirection(),horizontalDirection=this._getDragHorizontalDirection();if(!isOverElement)
-return false;return this.floating?(((horizontalDirection&&horizontalDirection=="right")||verticalDirection=="down")?2:1):(verticalDirection&&(verticalDirection=="down"?2:1));},_intersectsWithSides:function(item){var isOverBottomHalf=$.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,item.top+(item.height/2),item.height),isOverRightHalf=$.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,item.left+(item.width/2),item.width),verticalDirection=this._getDragVerticalDirection(),horizontalDirection=this._getDragHorizontalDirection();if(this.floating&&horizontalDirection){return((horizontalDirection=="right"&&isOverRightHalf)||(horizontalDirection=="left"&&!isOverRightHalf));}else{return verticalDirection&&((verticalDirection=="down"&&isOverBottomHalf)||(verticalDirection=="up"&&!isOverBottomHalf));}},_getDragVerticalDirection:function(){var delta=this.positionAbs.top-this.lastPositionAbs.top;return delta!=0&&(delta>0?"down":"up");},_getDragHorizontalDirection:function(){var delta=this.positionAbs.left-this.lastPositionAbs.left;return delta!=0&&(delta>0?"right":"left");},refresh:function(event){this._refreshItems(event);this.refreshPositions();},_connectWith:function(){var options=this.options;return options.connectWith.constructor==String?[options.connectWith]:options.connectWith;},_getItemsAsjQuery:function(connected){var self=this;var items=[];var queries=[];var connectWith=this._connectWith();if(connectWith&&connected){for(var i=connectWith.length-1;i>=0;i--){var cur=$(connectWith[i]);for(var j=cur.length-1;j>=0;j--){var inst=$.data(cur[j],'sortable');if(inst&&inst!=this&&!inst.options.disabled){queries.push([$.isFunction(inst.options.items)?inst.options.items.call(inst.element):$(inst.options.items,inst.element).not(".ui-sortable-helper"),inst]);}};};}
-queries.push([$.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):$(this.options.items,this.element).not(".ui-sortable-helper"),this]);for(var i=queries.length-1;i>=0;i--){queries[i][0].each(function(){items.push(this);});};return $(items);},_removeCurrentsFromItems:function(){var list=this.currentItem.find(":data(sortable-item)");for(var i=0;i<this.items.length;i++){for(var j=0;j<list.length;j++){if(list[j]==this.items[i].item[0])
-this.items.splice(i,1);};};},_refreshItems:function(event){this.items=[];this.containers=[this];var items=this.items;var self=this;var queries=[[$.isFunction(this.options.items)?this.options.items.call(this.element[0],event,{item:this.currentItem}):$(this.options.items,this.element),this]];var connectWith=this._connectWith();if(connectWith){for(var i=connectWith.length-1;i>=0;i--){var cur=$(connectWith[i]);for(var j=cur.length-1;j>=0;j--){var inst=$.data(cur[j],'sortable');if(inst&&inst!=this&&!inst.options.disabled){queries.push([$.isFunction(inst.options.items)?inst.options.items.call(inst.element[0],event,{item:this.currentItem}):$(inst.options.items,inst.element),inst]);this.containers.push(inst);}};};}
-for(var i=queries.length-1;i>=0;i--){var targetData=queries[i][1];var _queries=queries[i][0];for(var j=0,queriesLength=_queries.length;j<queriesLength;j++){var item=$(_queries[j]);item.data('sortable-item',targetData);items.push({item:item,instance:targetData,width:0,height:0,left:0,top:0});};};},refreshPositions:function(fast){if(this.offsetParent&&this.helper){this.offset.parent=this._getParentOffset();}
-for(var i=this.items.length-1;i>=0;i--){var item=this.items[i];if(item.instance!=this.currentContainer&&this.currentContainer&&item.item[0]!=this.currentItem[0])
-continue;var t=this.options.toleranceElement?$(this.options.toleranceElement,item.item):item.item;if(!fast){item.width=t.outerWidth();item.height=t.outerHeight();}
-var p=t.offset();item.left=p.left;item.top=p.top;};if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this);}else{for(var i=this.containers.length-1;i>=0;i--){var p=this.containers[i].element.offset();this.containers[i].containerCache.left=p.left;this.containers[i].containerCache.top=p.top;this.containers[i].containerCache.width=this.containers[i].element.outerWidth();this.containers[i].containerCache.height=this.containers[i].element.outerHeight();};}},_createPlaceholder:function(that){var self=that||this,o=self.options;if(!o.placeholder||o.placeholder.constructor==String){var className=o.placeholder;o.placeholder={element:function(){var el=$(document.createElement(self.currentItem[0].nodeName)).addClass(className||self.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!className)
-el.style.visibility="hidden";return el;},update:function(container,p){if(className&&!o.forcePlaceholderSize)return;if(!p.height()){p.height(self.currentItem.innerHeight()-parseInt(self.currentItem.css('paddingTop')||0,10)-parseInt(self.currentItem.css('paddingBottom')||0,10));};if(!p.width()){p.width(self.currentItem.innerWidth()-parseInt(self.currentItem.css('paddingLeft')||0,10)-parseInt(self.currentItem.css('paddingRight')||0,10));};}};}
-self.placeholder=$(o.placeholder.element.call(self.element,self.currentItem));self.currentItem.after(self.placeholder);o.placeholder.update(self,self.placeholder);},_contactContainers:function(event){for(var i=this.containers.length-1;i>=0;i--){if(this._intersectsWith(this.containers[i].containerCache)){if(!this.containers[i].containerCache.over){if(this.currentContainer!=this.containers[i]){var dist=10000;var itemWithLeastDistance=null;var base=this.positionAbs[this.containers[i].floating?'left':'top'];for(var j=this.items.length-1;j>=0;j--){if(!$.ui.contains(this.containers[i].element[0],this.items[j].item[0]))continue;var cur=this.items[j][this.containers[i].floating?'left':'top'];if(Math.abs(cur-base)<dist){dist=Math.abs(cur-base);itemWithLeastDistance=this.items[j];}}
-if(!itemWithLeastDistance&&!this.options.dropOnEmpty)
-continue;this.currentContainer=this.containers[i];itemWithLeastDistance?this._rearrange(event,itemWithLeastDistance,null,true):this._rearrange(event,null,this.containers[i].element,true);this._trigger("change",event,this._uiHash());this.containers[i]._trigger("change",event,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);}
-this.containers[i]._trigger("over",event,this._uiHash(this));this.containers[i].containerCache.over=1;}}else{if(this.containers[i].containerCache.over){this.containers[i]._trigger("out",event,this._uiHash(this));this.containers[i].containerCache.over=0;}}};},_createHelper:function(event){var o=this.options;var helper=$.isFunction(o.helper)?$(o.helper.apply(this.element[0],[event,this.currentItem])):(o.helper=='clone'?this.currentItem.clone():this.currentItem);if(!helper.parents('body').length)
-$(o.appendTo!='parent'?o.appendTo:this.currentItem[0].parentNode)[0].appendChild(helper[0]);if(helper[0]==this.currentItem[0])
-this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(helper[0].style.width==''||o.forceHelperSize)helper.width(this.currentItem.width());if(helper[0].style.height==''||o.forceHelperSize)helper.height(this.currentItem.height());return helper;},_adjustOffsetFromHelper:function(obj){if(obj.left!=undefined)this.offset.click.left=obj.left+this.margins.left;if(obj.right!=undefined)this.offset.click.left=this.helperProportions.width-obj.right+this.margins.left;if(obj.top!=undefined)this.offset.click.top=obj.top+this.margins.top;if(obj.bottom!=undefined)this.offset.click.top=this.helperProportions.height-obj.bottom+this.margins.top;},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var po=this.offsetParent.offset();if(this.cssPosition=='absolute'&&this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0])){po.left+=this.scrollParent.scrollLeft();po.top+=this.scrollParent.scrollTop();}
-if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=='html'&&$.browser.msie))
-po={top:0,left:0};return{top:po.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:po.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)};},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var p=this.currentItem.position();return{top:p.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:p.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()};}else{return{top:0,left:0};}},_cacheMargins:function(){this.margins={left:(parseInt(this.currentItem.css("marginLeft"),10)||0),top:(parseInt(this.currentItem.css("marginTop"),10)||0)};},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()};},_setContainment:function(){var o=this.options;if(o.containment=='parent')o.containment=this.helper[0].parentNode;if(o.containment=='document'||o.containment=='window')this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,$(o.containment=='document'?document:window).width()-this.helperProportions.width-this.margins.left,($(o.containment=='document'?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!(/^(document|window|parent)$/).test(o.containment)){var ce=$(o.containment)[0];var co=$(o.containment).offset();var over=($(ce).css("overflow")!='hidden');this.containment=[co.left+(parseInt($(ce).css("borderLeftWidth"),10)||0)+(parseInt($(ce).css("paddingLeft"),10)||0)-this.margins.left,co.top+(parseInt($(ce).css("borderTopWidth"),10)||0)+(parseInt($(ce).css("paddingTop"),10)||0)-this.margins.top,co.left+(over?Math.max(ce.scrollWidth,ce.offsetWidth):ce.offsetWidth)-(parseInt($(ce).css("borderLeftWidth"),10)||0)-(parseInt($(ce).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,co.top+(over?Math.max(ce.scrollHeight,ce.offsetHeight):ce.offsetHeight)-(parseInt($(ce).css("borderTopWidth"),10)||0)-(parseInt($(ce).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top];}},_convertPositionTo:function(d,pos){if(!pos)pos=this.position;var mod=d=="absolute"?1:-1;var o=this.options,scroll=this.cssPosition=='absolute'&&!(this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,scrollIsRootNode=(/(html|body)/i).test(scroll[0].tagName);return{top:(pos.top
-+this.offset.relative.top*mod
-+this.offset.parent.top*mod
--($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollTop():(scrollIsRootNode?0:scroll.scrollTop()))*mod)),left:(pos.left
-+this.offset.relative.left*mod
-+this.offset.parent.left*mod
--($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollLeft():scrollIsRootNode?0:scroll.scrollLeft())*mod))};},_generatePosition:function(event){var o=this.options,scroll=this.cssPosition=='absolute'&&!(this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,scrollIsRootNode=(/(html|body)/i).test(scroll[0].tagName);if(this.cssPosition=='relative'&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset();}
-var pageX=event.pageX;var pageY=event.pageY;if(this.originalPosition){if(this.containment){if(event.pageX-this.offset.click.left<this.containment[0])pageX=this.containment[0]+this.offset.click.left;if(event.pageY-this.offset.click.top<this.containment[1])pageY=this.containment[1]+this.offset.click.top;if(event.pageX-this.offset.click.left>this.containment[2])pageX=this.containment[2]+this.offset.click.left;if(event.pageY-this.offset.click.top>this.containment[3])pageY=this.containment[3]+this.offset.click.top;}
-if(o.grid){var top=this.originalPageY+Math.round((pageY-this.originalPageY)/o.grid[1])*o.grid[1];pageY=this.containment?(!(top-this.offset.click.top<this.containment[1]||top-this.offset.click.top>this.containment[3])?top:(!(top-this.offset.click.top<this.containment[1])?top-o.grid[1]:top+o.grid[1])):top;var left=this.originalPageX+Math.round((pageX-this.originalPageX)/o.grid[0])*o.grid[0];pageX=this.containment?(!(left-this.offset.click.left<this.containment[0]||left-this.offset.click.left>this.containment[2])?left:(!(left-this.offset.click.left<this.containment[0])?left-o.grid[0]:left+o.grid[0])):left;}}
-return{top:(pageY
--this.offset.click.top
--this.offset.relative.top
--this.offset.parent.top
-+($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollTop():(scrollIsRootNode?0:scroll.scrollTop())))),left:(pageX
--this.offset.click.left
--this.offset.relative.left
--this.offset.parent.left
-+($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollLeft():scrollIsRootNode?0:scroll.scrollLeft())))};},_rearrange:function(event,i,a,hardRefresh){a?a[0].appendChild(this.placeholder[0]):i.item[0].parentNode.insertBefore(this.placeholder[0],(this.direction=='down'?i.item[0]:i.item[0].nextSibling));this.counter=this.counter?++this.counter:1;var self=this,counter=this.counter;window.setTimeout(function(){if(counter==self.counter)self.refreshPositions(!hardRefresh);},0);},_clear:function(event,noPropagation){this.reverting=false;var delayedTriggers=[],self=this;if(!this._noFinalSort&&this.currentItem[0].parentNode)this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var i in this._storedCSS){if(this._storedCSS[i]=='auto'||this._storedCSS[i]=='static')this._storedCSS[i]='';}
-this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");}else{this.currentItem.show();}
-if(this.fromOutside&&!noPropagation)delayedTriggers.push(function(event){this._trigger("receive",event,this._uiHash(this.fromOutside));});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!noPropagation)delayedTriggers.push(function(event){this._trigger("update",event,this._uiHash());});if(!$.ui.contains(this.element[0],this.currentItem[0])){if(!noPropagation)delayedTriggers.push(function(event){this._trigger("remove",event,this._uiHash());});for(var i=this.containers.length-1;i>=0;i--){if($.ui.contains(this.containers[i].element[0],this.currentItem[0])&&!noPropagation){delayedTriggers.push((function(c){return function(event){c._trigger("receive",event,this._uiHash(this));};}).call(this,this.containers[i]));delayedTriggers.push((function(c){return function(event){c._trigger("update",event,this._uiHash(this));};}).call(this,this.containers[i]));}};};for(var i=this.containers.length-1;i>=0;i--){if(!noPropagation)delayedTriggers.push((function(c){return function(event){c._trigger("deactivate",event,this._uiHash(this));};}).call(this,this.containers[i]));if(this.containers[i].containerCache.over){delayedTriggers.push((function(c){return function(event){c._trigger("out",event,this._uiHash(this));};}).call(this,this.containers[i]));this.containers[i].containerCache.over=0;}}
-if(this._storedCursor)$('body').css("cursor",this._storedCursor);if(this._storedOpacity)this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=='auto'?'':this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!noPropagation){this._trigger("beforeStop",event,this._uiHash());for(var i=0;i<delayedTriggers.length;i++){delayedTriggers[i].call(this,event);};this._trigger("stop",event,this._uiHash());}
-return false;}
-if(!noPropagation)this._trigger("beforeStop",event,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);if(this.helper[0]!=this.currentItem[0])this.helper.remove();this.helper=null;if(!noPropagation){for(var i=0;i<delayedTriggers.length;i++){delayedTriggers[i].call(this,event);};this._trigger("stop",event,this._uiHash());}
-this.fromOutside=false;return true;},_trigger:function(){if($.widget.prototype._trigger.apply(this,arguments)===false){this.cancel();}},_uiHash:function(inst){var self=inst||this;return{helper:self.helper,placeholder:self.placeholder||$([]),position:self.position,absolutePosition:self.positionAbs,offset:self.positionAbs,item:self.currentItem,sender:inst?inst.element:null};}}));$.extend($.ui.sortable,{getter:"serialize toArray",version:"1.7.2",eventPrefix:"sort",defaults:{appendTo:"parent",axis:false,cancel:":input,option",connectWith:false,containment:false,cursor:'auto',cursorAt:false,delay:0,distance:1,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:'> *',opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1000}});})(jQuery);(function($){$.widget("ui.accordion",{_init:function(){var o=this.options,self=this;this.running=0;if(o.collapsible==$.ui.accordion.defaults.collapsible&&o.alwaysOpen!=$.ui.accordion.defaults.alwaysOpen){o.collapsible=!o.alwaysOpen;}
-if(o.navigation){var current=this.element.find("a").filter(o.navigationFilter);if(current.length){if(current.filter(o.header).length){this.active=current;}else{this.active=current.parent().parent().prev();current.addClass("ui-accordion-content-active");}}}
-this.element.addClass("ui-accordion ui-widget ui-helper-reset");if(this.element[0].nodeName=="UL"){this.element.children("li").addClass("ui-accordion-li-fix");}
-this.headers=this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){$(this).addClass('ui-state-hover');}).bind("mouseleave.accordion",function(){$(this).removeClass('ui-state-hover');}).bind("focus.accordion",function(){$(this).addClass('ui-state-focus');}).bind("blur.accordion",function(){$(this).removeClass('ui-state-focus');});this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");this.active=this._findActive(this.active||o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");this.active.next().addClass('ui-accordion-content-active');$("<span/>").addClass("ui-icon "+o.icons.header).prependTo(this.headers);this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);if($.browser.msie){this.element.find('a').css('zoom','1');}
-this.resize();this.element.attr('role','tablist');this.headers.attr('role','tab').bind('keydown',function(event){return self._keydown(event);}).next().attr('role','tabpanel');this.headers.not(this.active||"").attr('aria-expanded','false').attr("tabIndex","-1").next().hide();if(!this.active.length){this.headers.eq(0).attr('tabIndex','0');}else{this.active.attr('aria-expanded','true').attr('tabIndex','0');}
-if(!$.browser.safari)
-this.headers.find('a').attr('tabIndex','-1');if(o.event){this.headers.bind((o.event)+".accordion",function(event){return self._clickHandler.call(self,event,this);});}},destroy:function(){var o=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role").unbind('.accordion').removeData('accordion');this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");this.headers.find("a").removeAttr("tabindex");this.headers.children(".ui-icon").remove();var contents=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");if(o.autoHeight||o.fillHeight){contents.css("height","");}},_setData:function(key,value){if(key=='alwaysOpen'){key='collapsible';value=!value;}
-$.widget.prototype._setData.apply(this,arguments);},_keydown:function(event){var o=this.options,keyCode=$.ui.keyCode;if(o.disabled||event.altKey||event.ctrlKey)
-return;var length=this.headers.length;var currentIndex=this.headers.index(event.target);var toFocus=false;switch(event.keyCode){case keyCode.RIGHT:case keyCode.DOWN:toFocus=this.headers[(currentIndex+1)%length];break;case keyCode.LEFT:case keyCode.UP:toFocus=this.headers[(currentIndex-1+length)%length];break;case keyCode.SPACE:case keyCode.ENTER:return this._clickHandler({target:event.target},event.target);}
-if(toFocus){$(event.target).attr('tabIndex','-1');$(toFocus).attr('tabIndex','0');toFocus.focus();return false;}
-return true;},resize:function(){var o=this.options,maxHeight;if(o.fillSpace){if($.browser.msie){var defOverflow=this.element.parent().css('overflow');this.element.parent().css('overflow','hidden');}
-maxHeight=this.element.parent().height();if($.browser.msie){this.element.parent().css('overflow',defOverflow);}
-this.headers.each(function(){maxHeight-=$(this).outerHeight();});var maxPadding=0;this.headers.next().each(function(){maxPadding=Math.max(maxPadding,$(this).innerHeight()-$(this).height());}).height(Math.max(0,maxHeight-maxPadding)).css('overflow','auto');}else if(o.autoHeight){maxHeight=0;this.headers.next().each(function(){maxHeight=Math.max(maxHeight,$(this).outerHeight());}).height(maxHeight);}},activate:function(index){var active=this._findActive(index)[0];this._clickHandler({target:active},active);},_findActive:function(selector){return selector?typeof selector=="number"?this.headers.filter(":eq("+selector+")"):this.headers.not(this.headers.not(selector)):selector===false?$([]):this.headers.filter(":eq(0)");},_clickHandler:function(event,target){var o=this.options;if(o.disabled)return false;if(!event.target&&o.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);this.active.next().addClass('ui-accordion-content-active');var toHide=this.active.next(),data={options:o,newHeader:$([]),oldHeader:o.active,newContent:$([]),oldContent:toHide},toShow=(this.active=$([]));this._toggle(toShow,toHide,data);return false;}
-var clicked=$(event.currentTarget||target);var clickedIsActive=clicked[0]==this.active[0];if(this.running||(!o.collapsible&&clickedIsActive)){return false;}
-this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);this.active.next().addClass('ui-accordion-content-active');if(!clickedIsActive){clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);clicked.next().addClass('ui-accordion-content-active');}
-var toShow=clicked.next(),toHide=this.active.next(),data={options:o,newHeader:clickedIsActive&&o.collapsible?$([]):clicked,oldHeader:this.active,newContent:clickedIsActive&&o.collapsible?$([]):toShow.find('> *'),oldContent:toHide.find('> *')},down=this.headers.index(this.active[0])>this.headers.index(clicked[0]);this.active=clickedIsActive?$([]):clicked;this._toggle(toShow,toHide,data,clickedIsActive,down);return false;},_toggle:function(toShow,toHide,data,clickedIsActive,down){var o=this.options,self=this;this.toShow=toShow;this.toHide=toHide;this.data=data;var complete=function(){if(!self)return;return self._completed.apply(self,arguments);};this._trigger("changestart",null,this.data);this.running=toHide.size()===0?toShow.size():toHide.size();if(o.animated){var animOptions={};if(o.collapsible&&clickedIsActive){animOptions={toShow:$([]),toHide:toHide,complete:complete,down:down,autoHeight:o.autoHeight||o.fillSpace};}else{animOptions={toShow:toShow,toHide:toHide,complete:complete,down:down,autoHeight:o.autoHeight||o.fillSpace};}
-if(!o.proxied){o.proxied=o.animated;}
-if(!o.proxiedDuration){o.proxiedDuration=o.duration;}
-o.animated=$.isFunction(o.proxied)?o.proxied(animOptions):o.proxied;o.duration=$.isFunction(o.proxiedDuration)?o.proxiedDuration(animOptions):o.proxiedDuration;var animations=$.ui.accordion.animations,duration=o.duration,easing=o.animated;if(!animations[easing]){animations[easing]=function(options){this.slide(options,{easing:easing,duration:duration||700});};}
-animations[easing](animOptions);}else{if(o.collapsible&&clickedIsActive){toShow.toggle();}else{toHide.hide();toShow.show();}
-complete(true);}
-toHide.prev().attr('aria-expanded','false').attr("tabIndex","-1").blur();toShow.prev().attr('aria-expanded','true').attr("tabIndex","0").focus();},_completed:function(cancel){var o=this.options;this.running=cancel?0:--this.running;if(this.running)return;if(o.clearStyle){this.toShow.add(this.toHide).css({height:"",overflow:""});}
-this._trigger('change',null,this.data);}});$.extend($.ui.accordion,{version:"1.7.2",defaults:{active:null,alwaysOpen:true,animated:'slide',autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()==location.href.toLowerCase();}},animations:{slide:function(options,additions){options=$.extend({easing:"swing",duration:300},options,additions);if(!options.toHide.size()){options.toShow.animate({height:"show"},options);return;}
-if(!options.toShow.size()){options.toHide.animate({height:"hide"},options);return;}
-var overflow=options.toShow.css('overflow'),percentDone,showProps={},hideProps={},fxAttrs=["height","paddingTop","paddingBottom"],originalWidth;var s=options.toShow;originalWidth=s[0].style.width;s.width(parseInt(s.parent().width(),10)-parseInt(s.css("paddingLeft"),10)-parseInt(s.css("paddingRight"),10)-(parseInt(s.css("borderLeftWidth"),10)||0)-(parseInt(s.css("borderRightWidth"),10)||0));$.each(fxAttrs,function(i,prop){hideProps[prop]='hide';var parts=(''+$.css(options.toShow[0],prop)).match(/^([\d+-.]+)(.*)$/);showProps[prop]={value:parts[1],unit:parts[2]||'px'};});options.toShow.css({height:0,overflow:'hidden'}).show();options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{step:function(now,settings){if(settings.prop=='height'){percentDone=(settings.now-settings.start)/(settings.end-settings.start);}
-options.toShow[0].style[settings.prop]=(percentDone*showProps[settings.prop].value)+showProps[settings.prop].unit;},duration:options.duration,easing:options.easing,complete:function(){if(!options.autoHeight){options.toShow.css("height","");}
-options.toShow.css("width",originalWidth);options.toShow.css({overflow:overflow});options.complete();}});},bounceslide:function(options){this.slide(options,{easing:options.down?"easeOutBounce":"swing",duration:options.down?1000:200});},easeslide:function(options){this.slide(options,{easing:"easeinout",duration:700});}}});})(jQuery);(function($){var setDataSwitch={dragStart:"start.draggable",drag:"drag.draggable",dragStop:"stop.draggable",maxHeight:"maxHeight.resizable",minHeight:"minHeight.resizable",maxWidth:"maxWidth.resizable",minWidth:"minWidth.resizable",resizeStart:"start.resizable",resize:"drag.resizable",resizeStop:"stop.resizable"},uiDialogClasses='ui-dialog '+'ui-widget '+'ui-widget-content '+'ui-corner-all ';$.widget("ui.dialog",{_init:function(){this.originalTitle=this.element.attr('title');var self=this,options=this.options,title=options.title||this.originalTitle||'&nbsp;',titleId=$.ui.dialog.getTitleId(this.element),uiDialog=(this.uiDialog=$('<div/>')).appendTo(document.body).hide().addClass(uiDialogClasses+options.dialogClass).css({position:'absolute',overflow:'hidden',zIndex:options.zIndex}).attr('tabIndex',-1).css('outline',0).keydown(function(event){(options.closeOnEscape&&event.keyCode&&event.keyCode==$.ui.keyCode.ESCAPE&&self.close(event));}).attr({role:'dialog','aria-labelledby':titleId}).mousedown(function(event){self.moveToTop(false,event);}),uiDialogContent=this.element.show().removeAttr('title').addClass('ui-dialog-content '+'ui-widget-content').appendTo(uiDialog),uiDialogTitlebar=(this.uiDialogTitlebar=$('<div></div>')).addClass('ui-dialog-titlebar '+'ui-widget-header '+'ui-corner-all '+'ui-helper-clearfix').prependTo(uiDialog),uiDialogTitlebarClose=$('<a href="#"/>').addClass('ui-dialog-titlebar-close '+'ui-corner-all').attr('role','button').hover(function(){uiDialogTitlebarClose.addClass('ui-state-hover');},function(){uiDialogTitlebarClose.removeClass('ui-state-hover');}).focus(function(){uiDialogTitlebarClose.addClass('ui-state-focus');}).blur(function(){uiDialogTitlebarClose.removeClass('ui-state-focus');}).mousedown(function(ev){ev.stopPropagation();}).click(function(event){self.close(event);return false;}).appendTo(uiDialogTitlebar),uiDialogTitlebarCloseText=(this.uiDialogTitlebarCloseText=$('<span/>')).addClass('ui-icon '+'ui-icon-closethick').text(options.closeText).appendTo(uiDialogTitlebarClose),uiDialogTitle=$('<span/>').addClass('ui-dialog-title').attr('id',titleId).html(title).prependTo(uiDialogTitlebar);uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();(options.draggable&&$.fn.draggable&&this._makeDraggable());(options.resizable&&$.fn.resizable&&this._makeResizable());this._createButtons(options.buttons);this._isOpen=false;(options.bgiframe&&$.fn.bgiframe&&uiDialog.bgiframe());(options.autoOpen&&this.open());},destroy:function(){(this.overlay&&this.overlay.destroy());this.uiDialog.hide();this.element.unbind('.dialog').removeData('dialog').removeClass('ui-dialog-content ui-widget-content').hide().appendTo('body');this.uiDialog.remove();(this.originalTitle&&this.element.attr('title',this.originalTitle));},close:function(event){var self=this;if(false===self._trigger('beforeclose',event)){return;}
-(self.overlay&&self.overlay.destroy());self.uiDialog.unbind('keypress.ui-dialog');(self.options.hide?self.uiDialog.hide(self.options.hide,function(){self._trigger('close',event);}):self.uiDialog.hide()&&self._trigger('close',event));$.ui.dialog.overlay.resize();self._isOpen=false;if(self.options.modal){var maxZ=0;$('.ui-dialog').each(function(){if(this!=self.uiDialog[0]){maxZ=Math.max(maxZ,$(this).css('z-index'));}});$.ui.dialog.maxZ=maxZ;}},isOpen:function(){return this._isOpen;},moveToTop:function(force,event){if((this.options.modal&&!force)||(!this.options.stack&&!this.options.modal)){return this._trigger('focus',event);}
-if(this.options.zIndex>$.ui.dialog.maxZ){$.ui.dialog.maxZ=this.options.zIndex;}
-(this.overlay&&this.overlay.$el.css('z-index',$.ui.dialog.overlay.maxZ=++$.ui.dialog.maxZ));var saveScroll={scrollTop:this.element.attr('scrollTop'),scrollLeft:this.element.attr('scrollLeft')};this.uiDialog.css('z-index',++$.ui.dialog.maxZ);this.element.attr(saveScroll);this._trigger('focus',event);},open:function(){if(this._isOpen){return;}
-var options=this.options,uiDialog=this.uiDialog;this.overlay=options.modal?new $.ui.dialog.overlay(this):null;(uiDialog.next().length&&uiDialog.appendTo('body'));this._size();this._position(options.position);uiDialog.show(options.show);this.moveToTop(true);(options.modal&&uiDialog.bind('keypress.ui-dialog',function(event){if(event.keyCode!=$.ui.keyCode.TAB){return;}
-var tabbables=$(':tabbable',this),first=tabbables.filter(':first')[0],last=tabbables.filter(':last')[0];if(event.target==last&&!event.shiftKey){setTimeout(function(){first.focus();},1);}else if(event.target==first&&event.shiftKey){setTimeout(function(){last.focus();},1);}}));$([]).add(uiDialog.find('.ui-dialog-content :tabbable:first')).add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')).add(uiDialog).filter(':first').focus();this._trigger('open');this._isOpen=true;},_createButtons:function(buttons){var self=this,hasButtons=false,uiDialogButtonPane=$('<div></div>').addClass('ui-dialog-buttonpane '+'ui-widget-content '+'ui-helper-clearfix');this.uiDialog.find('.ui-dialog-buttonpane').remove();(typeof buttons=='object'&&buttons!==null&&$.each(buttons,function(){return!(hasButtons=true);}));if(hasButtons){$.each(buttons,function(name,fn){$('<button type="button"></button>').addClass('ui-state-default '+'ui-corner-all').text(name).click(function(){fn.apply(self.element[0],arguments);}).hover(function(){$(this).addClass('ui-state-hover');},function(){$(this).removeClass('ui-state-hover');}).focus(function(){$(this).addClass('ui-state-focus');}).blur(function(){$(this).removeClass('ui-state-focus');}).appendTo(uiDialogButtonPane);});uiDialogButtonPane.appendTo(this.uiDialog);}},_makeDraggable:function(){var self=this,options=this.options,heightBeforeDrag;this.uiDialog.draggable({cancel:'.ui-dialog-content',handle:'.ui-dialog-titlebar',containment:'document',start:function(){heightBeforeDrag=options.height;$(this).height($(this).height()).addClass("ui-dialog-dragging");(options.dragStart&&options.dragStart.apply(self.element[0],arguments));},drag:function(){(options.drag&&options.drag.apply(self.element[0],arguments));},stop:function(){$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);(options.dragStop&&options.dragStop.apply(self.element[0],arguments));$.ui.dialog.overlay.resize();}});},_makeResizable:function(handles){handles=(handles===undefined?this.options.resizable:handles);var self=this,options=this.options,resizeHandles=typeof handles=='string'?handles:'n,e,s,w,se,sw,ne,nw';this.uiDialog.resizable({cancel:'.ui-dialog-content',alsoResize:this.element,maxWidth:options.maxWidth,maxHeight:options.maxHeight,minWidth:options.minWidth,minHeight:options.minHeight,start:function(){$(this).addClass("ui-dialog-resizing");(options.resizeStart&&options.resizeStart.apply(self.element[0],arguments));},resize:function(){(options.resize&&options.resize.apply(self.element[0],arguments));},handles:resizeHandles,stop:function(){$(this).removeClass("ui-dialog-resizing");options.height=$(this).height();options.width=$(this).width();(options.resizeStop&&options.resizeStop.apply(self.element[0],arguments));$.ui.dialog.overlay.resize();}}).find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');},_position:function(pos){var wnd=$(window),doc=$(document),pTop=doc.scrollTop(),pLeft=doc.scrollLeft(),minTop=pTop;if($.inArray(pos,['center','top','right','bottom','left'])>=0){pos=[pos=='right'||pos=='left'?pos:'center',pos=='top'||pos=='bottom'?pos:'middle'];}
-if(pos.constructor!=Array){pos=['center','middle'];}
-if(pos[0].constructor==Number){pLeft+=pos[0];}else{switch(pos[0]){case'left':pLeft+=0;break;case'right':pLeft+=wnd.width()-this.uiDialog.outerWidth();break;default:case'center':pLeft+=(wnd.width()-this.uiDialog.outerWidth())/2;}}
-if(pos[1].constructor==Number){pTop+=pos[1];}else{switch(pos[1]){case'top':pTop+=0;break;case'bottom':pTop+=wnd.height()-this.uiDialog.outerHeight();break;default:case'middle':pTop+=(wnd.height()-this.uiDialog.outerHeight())/2;}}
-pTop=Math.max(pTop,minTop);this.uiDialog.css({top:pTop,left:pLeft});},_setData:function(key,value){(setDataSwitch[key]&&this.uiDialog.data(setDataSwitch[key],value));switch(key){case"buttons":this._createButtons(value);break;case"closeText":this.uiDialogTitlebarCloseText.text(value);break;case"dialogClass":this.uiDialog.removeClass(this.options.dialogClass).addClass(uiDialogClasses+value);break;case"draggable":(value?this._makeDraggable():this.uiDialog.draggable('destroy'));break;case"height":this.uiDialog.height(value);break;case"position":this._position(value);break;case"resizable":var uiDialog=this.uiDialog,isResizable=this.uiDialog.is(':data(resizable)');(isResizable&&!value&&uiDialog.resizable('destroy'));(isResizable&&typeof value=='string'&&uiDialog.resizable('option','handles',value));(isResizable||this._makeResizable(value));break;case"title":$(".ui-dialog-title",this.uiDialogTitlebar).html(value||'&nbsp;');break;case"width":this.uiDialog.width(value);break;}
-$.widget.prototype._setData.apply(this,arguments);},_size:function(){var options=this.options;this.element.css({height:0,minHeight:0,width:'auto'});var nonContentHeight=this.uiDialog.css({height:'auto',width:options.width}).height();this.element.css({minHeight:Math.max(options.minHeight-nonContentHeight,0),height:options.height=='auto'?'auto':Math.max(options.height-nonContentHeight,0)});}});$.extend($.ui.dialog,{version:"1.7.2",defaults:{autoOpen:true,bgiframe:false,buttons:{},closeOnEscape:true,closeText:'close',dialogClass:'',draggable:true,hide:null,height:'auto',maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:'center',resizable:true,show:null,stack:true,title:'',width:300,zIndex:1000},getter:'isOpen',uuid:0,maxZ:0,getTitleId:function($el){return'ui-dialog-title-'+($el.attr('id')||++this.uuid);},overlay:function(dialog){this.$el=$.ui.dialog.overlay.create(dialog);}});$.extend($.ui.dialog.overlay,{instances:[],maxZ:0,events:$.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),function(event){return event+'.dialog-overlay';}).join(' '),create:function(dialog){if(this.instances.length===0){setTimeout(function(){if($.ui.dialog.overlay.instances.length){$(document).bind($.ui.dialog.overlay.events,function(event){var dialogZ=$(event.target).parents('.ui-dialog').css('zIndex')||0;return(dialogZ>$.ui.dialog.overlay.maxZ);});}},1);$(document).bind('keydown.dialog-overlay',function(event){(dialog.options.closeOnEscape&&event.keyCode&&event.keyCode==$.ui.keyCode.ESCAPE&&dialog.close(event));});$(window).bind('resize.dialog-overlay',$.ui.dialog.overlay.resize);}
-var $el=$('<div></div>').appendTo(document.body).addClass('ui-widget-overlay').css({width:this.width(),height:this.height()});(dialog.options.bgiframe&&$.fn.bgiframe&&$el.bgiframe());this.instances.push($el);return $el;},destroy:function($el){this.instances.splice($.inArray(this.instances,$el),1);if(this.instances.length===0){$([document,window]).unbind('.dialog-overlay');}
-$el.remove();var maxZ=0;$.each(this.instances,function(){maxZ=Math.max(maxZ,this.css('z-index'));});this.maxZ=maxZ;},height:function(){if($.browser.msie&&$.browser.version<7){var scrollHeight=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var offsetHeight=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(scrollHeight<offsetHeight){return $(window).height()+'px';}else{return scrollHeight+'px';}}else{return $(document).height()+'px';}},width:function(){if($.browser.msie&&$.browser.version<7){var scrollWidth=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);var offsetWidth=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);if(scrollWidth<offsetWidth){return $(window).width()+'px';}else{return scrollWidth+'px';}}else{return $(document).width()+'px';}},resize:function(){var $overlays=$([]);$.each($.ui.dialog.overlay.instances,function(){$overlays=$overlays.add(this);});$overlays.css({width:0,height:0}).css({width:$.ui.dialog.overlay.width(),height:$.ui.dialog.overlay.height()});}});$.extend($.ui.dialog.overlay.prototype,{destroy:function(){$.ui.dialog.overlay.destroy(this.$el);}});})(jQuery);(function($){$.widget("ui.tabs",{_init:function(){if(this.options.deselectable!==undefined){this.options.collapsible=this.options.deselectable;}
-this._tabify(true);},_setData:function(key,value){if(key=='selected'){if(this.options.collapsible&&value==this.options.selected){return;}
-this.select(value);}
-else{this.options[key]=value;if(key=='deselectable'){this.options.collapsible=value;}
-this._tabify();}},_tabId:function(a){return a.title&&a.title.replace(/\s/g,'_').replace(/[^A-Za-z0-9\-_:\.]/g,'')||this.options.idPrefix+$.data(a);},_sanitizeSelector:function(hash){return hash.replace(/:/g,'\\:');},_cookie:function(){var cookie=this.cookie||(this.cookie=this.options.cookie.name||'ui-tabs-'+$.data(this.list[0]));return $.cookie.apply(null,[cookie].concat($.makeArray(arguments)));},_ui:function(tab,panel){return{tab:tab,panel:panel,index:this.anchors.index(tab)};},_cleanup:function(){this.lis.filter('.ui-state-processing').removeClass('ui-state-processing').find('span:data(label.tabs)').each(function(){var el=$(this);el.html(el.data('label.tabs')).removeData('label.tabs');});},_tabify:function(init){this.list=this.element.children('ul:first');this.lis=$('li:has(a[href])',this.list);this.anchors=this.lis.map(function(){return $('a',this)[0];});this.panels=$([]);var self=this,o=this.options;var fragmentId=/^#.+/;this.anchors.each(function(i,a){var href=$(a).attr('href');var hrefBase=href.split('#')[0],baseEl;if(hrefBase&&(hrefBase===location.toString().split('#')[0]||(baseEl=$('base')[0])&&hrefBase===baseEl.href)){href=a.hash;a.href=href;}
-if(fragmentId.test(href)){self.panels=self.panels.add(self._sanitizeSelector(href));}
-else if(href!='#'){$.data(a,'href.tabs',href);$.data(a,'load.tabs',href.replace(/#.*$/,''));var id=self._tabId(a);a.href='#'+id;var $panel=$('#'+id);if(!$panel.length){$panel=$(o.panelTemplate).attr('id',id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom').insertAfter(self.panels[i-1]||self.list);$panel.data('destroy.tabs',true);}
-self.panels=self.panels.add($panel);}
-else{o.disabled.push(i);}});if(init){this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');this.lis.addClass('ui-state-default ui-corner-top');this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');if(o.selected===undefined){if(location.hash){this.anchors.each(function(i,a){if(a.hash==location.hash){o.selected=i;return false;}});}
-if(typeof o.selected!='number'&&o.cookie){o.selected=parseInt(self._cookie(),10);}
-if(typeof o.selected!='number'&&this.lis.filter('.ui-tabs-selected').length){o.selected=this.lis.index(this.lis.filter('.ui-tabs-selected'));}
-o.selected=o.selected||0;}
-else if(o.selected===null){o.selected=-1;}
-o.selected=((o.selected>=0&&this.anchors[o.selected])||o.selected<0)?o.selected:0;o.disabled=$.unique(o.disabled.concat($.map(this.lis.filter('.ui-state-disabled'),function(n,i){return self.lis.index(n);}))).sort();if($.inArray(o.selected,o.disabled)!=-1){o.disabled.splice($.inArray(o.selected,o.disabled),1);}
-this.panels.addClass('ui-tabs-hide');this.lis.removeClass('ui-tabs-selected ui-state-active');if(o.selected>=0&&this.anchors.length){this.panels.eq(o.selected).removeClass('ui-tabs-hide');this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');self.element.queue("tabs",function(){self._trigger('show',null,self._ui(self.anchors[o.selected],self.panels[o.selected]));});this.load(o.selected);}
-$(window).bind('unload',function(){self.lis.add(self.anchors).unbind('.tabs');self.lis=self.anchors=self.panels=null;});}
-else{o.selected=this.lis.index(this.lis.filter('.ui-tabs-selected'));}
-this.element[o.collapsible?'addClass':'removeClass']('ui-tabs-collapsible');if(o.cookie){this._cookie(o.selected,o.cookie);}
-for(var i=0,li;(li=this.lis[i]);i++){$(li)[$.inArray(i,o.disabled)!=-1&&!$(li).hasClass('ui-tabs-selected')?'addClass':'removeClass']('ui-state-disabled');}
-if(o.cache===false){this.anchors.removeData('cache.tabs');}
-this.lis.add(this.anchors).unbind('.tabs');if(o.event!='mouseover'){var addState=function(state,el){if(el.is(':not(.ui-state-disabled)')){el.addClass('ui-state-'+state);}};var removeState=function(state,el){el.removeClass('ui-state-'+state);};this.lis.bind('mouseover.tabs',function(){addState('hover',$(this));});this.lis.bind('mouseout.tabs',function(){removeState('hover',$(this));});this.anchors.bind('focus.tabs',function(){addState('focus',$(this).closest('li'));});this.anchors.bind('blur.tabs',function(){removeState('focus',$(this).closest('li'));});}
-var hideFx,showFx;if(o.fx){if($.isArray(o.fx)){hideFx=o.fx[0];showFx=o.fx[1];}
-else{hideFx=showFx=o.fx;}}
-function resetStyle($el,fx){$el.css({display:''});if($.browser.msie&&fx.opacity){$el[0].style.removeAttribute('filter');}}
-var showTab=showFx?function(clicked,$show){$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');$show.hide().removeClass('ui-tabs-hide').animate(showFx,showFx.duration||'normal',function(){resetStyle($show,showFx);self._trigger('show',null,self._ui(clicked,$show[0]));});}:function(clicked,$show){$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');$show.removeClass('ui-tabs-hide');self._trigger('show',null,self._ui(clicked,$show[0]));};var hideTab=hideFx?function(clicked,$hide){$hide.animate(hideFx,hideFx.duration||'normal',function(){self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');$hide.addClass('ui-tabs-hide');resetStyle($hide,hideFx);self.element.dequeue("tabs");});}:function(clicked,$hide,$show){self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');$hide.addClass('ui-tabs-hide');self.element.dequeue("tabs");};this.anchors.bind(o.event+'.tabs',function(){var el=this,$li=$(this).closest('li'),$hide=self.panels.filter(':not(.ui-tabs-hide)'),$show=$(self._sanitizeSelector(this.hash));if(($li.hasClass('ui-tabs-selected')&&!o.collapsible)||$li.hasClass('ui-state-disabled')||$li.hasClass('ui-state-processing')||self._trigger('select',null,self._ui(this,$show[0]))===false){this.blur();return false;}
-o.selected=self.anchors.index(this);self.abort();if(o.collapsible){if($li.hasClass('ui-tabs-selected')){o.selected=-1;if(o.cookie){self._cookie(o.selected,o.cookie);}
-self.element.queue("tabs",function(){hideTab(el,$hide);}).dequeue("tabs");this.blur();return false;}
-else if(!$hide.length){if(o.cookie){self._cookie(o.selected,o.cookie);}
-self.element.queue("tabs",function(){showTab(el,$show);});self.load(self.anchors.index(this));this.blur();return false;}}
-if(o.cookie){self._cookie(o.selected,o.cookie);}
-if($show.length){if($hide.length){self.element.queue("tabs",function(){hideTab(el,$hide);});}
-self.element.queue("tabs",function(){showTab(el,$show);});self.load(self.anchors.index(this));}
-else{throw'jQuery UI Tabs: Mismatching fragment identifier.';}
-if($.browser.msie){this.blur();}});this.anchors.bind('click.tabs',function(){return false;});},destroy:function(){var o=this.options;this.abort();this.element.unbind('.tabs').removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible').removeData('tabs');this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');this.anchors.each(function(){var href=$.data(this,'href.tabs');if(href){this.href=href;}
-var $this=$(this).unbind('.tabs');$.each(['href','load','cache'],function(i,prefix){$this.removeData(prefix+'.tabs');});});this.lis.unbind('.tabs').add(this.panels).each(function(){if($.data(this,'destroy.tabs')){$(this).remove();}
-else{$(this).removeClass(['ui-state-default','ui-corner-top','ui-tabs-selected','ui-state-active','ui-state-hover','ui-state-focus','ui-state-disabled','ui-tabs-panel','ui-widget-content','ui-corner-bottom','ui-tabs-hide'].join(' '));}});if(o.cookie){this._cookie(null,o.cookie);}},add:function(url,label,index){if(index===undefined){index=this.anchors.length;}
-var self=this,o=this.options,$li=$(o.tabTemplate.replace(/#\{href\}/g,url).replace(/#\{label\}/g,label)),id=!url.indexOf('#')?url.replace('#',''):this._tabId($('a',$li)[0]);$li.addClass('ui-state-default ui-corner-top').data('destroy.tabs',true);var $panel=$('#'+id);if(!$panel.length){$panel=$(o.panelTemplate).attr('id',id).data('destroy.tabs',true);}
-$panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');if(index>=this.lis.length){$li.appendTo(this.list);$panel.appendTo(this.list[0].parentNode);}
-else{$li.insertBefore(this.lis[index]);$panel.insertBefore(this.panels[index]);}
-o.disabled=$.map(o.disabled,function(n,i){return n>=index?++n:n;});this._tabify();if(this.anchors.length==1){$li.addClass('ui-tabs-selected ui-state-active');$panel.removeClass('ui-tabs-hide');this.element.queue("tabs",function(){self._trigger('show',null,self._ui(self.anchors[0],self.panels[0]));});this.load(0);}
-this._trigger('add',null,this._ui(this.anchors[index],this.panels[index]));},remove:function(index){var o=this.options,$li=this.lis.eq(index).remove(),$panel=this.panels.eq(index).remove();if($li.hasClass('ui-tabs-selected')&&this.anchors.length>1){this.select(index+(index+1<this.anchors.length?1:-1));}
-o.disabled=$.map($.grep(o.disabled,function(n,i){return n!=index;}),function(n,i){return n>=index?--n:n;});this._tabify();this._trigger('remove',null,this._ui($li.find('a')[0],$panel[0]));},enable:function(index){var o=this.options;if($.inArray(index,o.disabled)==-1){return;}
-this.lis.eq(index).removeClass('ui-state-disabled');o.disabled=$.grep(o.disabled,function(n,i){return n!=index;});this._trigger('enable',null,this._ui(this.anchors[index],this.panels[index]));},disable:function(index){var self=this,o=this.options;if(index!=o.selected){this.lis.eq(index).addClass('ui-state-disabled');o.disabled.push(index);o.disabled.sort();this._trigger('disable',null,this._ui(this.anchors[index],this.panels[index]));}},select:function(index){if(typeof index=='string'){index=this.anchors.index(this.anchors.filter('[href$='+index+']'));}
-else if(index===null){index=-1;}
-if(index==-1&&this.options.collapsible){index=this.options.selected;}
-this.anchors.eq(index).trigger(this.options.event+'.tabs');},load:function(index){var self=this,o=this.options,a=this.anchors.eq(index)[0],url=$.data(a,'load.tabs');this.abort();if(!url||this.element.queue("tabs").length!==0&&$.data(a,'cache.tabs')){this.element.dequeue("tabs");return;}
-this.lis.eq(index).addClass('ui-state-processing');if(o.spinner){var span=$('span',a);span.data('label.tabs',span.html()).html(o.spinner);}
-this.xhr=$.ajax($.extend({},o.ajaxOptions,{url:url,success:function(r,s){$(self._sanitizeSelector(a.hash)).html(r);self._cleanup();if(o.cache){$.data(a,'cache.tabs',true);}
-self._trigger('load',null,self._ui(self.anchors[index],self.panels[index]));try{o.ajaxOptions.success(r,s);}
-catch(e){}
-self.element.dequeue("tabs");}}));},abort:function(){this.element.queue([]);this.panels.stop(false,true);if(this.xhr){this.xhr.abort();delete this.xhr;}
-this._cleanup();},url:function(index,url){this.anchors.eq(index).removeData('cache.tabs').data('load.tabs',url);},length:function(){return this.anchors.length;}});$.extend($.ui.tabs,{version:'1.7.2',getter:'length',defaults:{ajaxOptions:null,cache:false,cookie:null,collapsible:false,disabled:[],event:'click',fx:null,idPrefix:'ui-tabs-',panelTemplate:'<div></div>',spinner:'<em>Loading&#8230;</em>',tabTemplate:'<li><a href="#{href}"><span>#{label}</span></a></li>'}});$.extend($.ui.tabs.prototype,{rotation:null,rotate:function(ms,continuing){var self=this,o=this.options;var rotate=self._rotate||(self._rotate=function(e){clearTimeout(self.rotation);self.rotation=setTimeout(function(){var t=o.selected;self.select(++t<self.anchors.length?t:0);},ms);if(e){e.stopPropagation();}});var stop=self._unrotate||(self._unrotate=!continuing?function(e){if(e.clientX){self.rotate(null);}}:function(e){t=o.selected;rotate();});if(ms){this.element.bind('tabsshow',rotate);this.anchors.bind(o.event+'.tabs',stop);rotate();}
-else{clearTimeout(self.rotation);this.element.unbind('tabsshow',rotate);this.anchors.unbind(o.event+'.tabs',stop);delete this._rotate;delete this._unrotate;}}});})(jQuery);(function($){$.widget("ui.progressbar",{_init:function(){this.element.addClass("ui-progressbar"
-+" ui-widget"
-+" ui-widget-content"
-+" ui-corner-all").attr({role:"progressbar","aria-valuemin":this._valueMin(),"aria-valuemax":this._valueMax(),"aria-valuenow":this._value()});this.valueDiv=$('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);this._refreshValue();},destroy:function(){this.element.removeClass("ui-progressbar"
-+" ui-widget"
-+" ui-widget-content"
-+" ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow").removeData("progressbar").unbind(".progressbar");this.valueDiv.remove();$.widget.prototype.destroy.apply(this,arguments);},value:function(newValue){if(newValue===undefined){return this._value();}
-this._setData('value',newValue);return this;},_setData:function(key,value){switch(key){case'value':this.options.value=value;this._refreshValue();this._trigger('change',null,{});break;}
-$.widget.prototype._setData.apply(this,arguments);},_value:function(){var val=this.options.value;if(val<this._valueMin())val=this._valueMin();if(val>this._valueMax())val=this._valueMax();return val;},_valueMin:function(){var valueMin=0;return valueMin;},_valueMax:function(){var valueMax=100;return valueMax;},_refreshValue:function(){var value=this.value();this.valueDiv[value==this._valueMax()?'addClass':'removeClass']("ui-corner-right");this.valueDiv.width(value+'%');this.element.attr("aria-valuenow",value);}});$.extend($.ui.progressbar,{version:"1.7.2",defaults:{value:0}});})(jQuery);;jQuery.effects||(function($){$.effects={version:"1.7.2",save:function(element,set){for(var i=0;i<set.length;i++){if(set[i]!==null)element.data("ec.storage."+set[i],element[0].style[set[i]]);}},restore:function(element,set){for(var i=0;i<set.length;i++){if(set[i]!==null)element.css(set[i],element.data("ec.storage."+set[i]));}},setMode:function(el,mode){if(mode=='toggle')mode=el.is(':hidden')?'show':'hide';return mode;},getBaseline:function(origin,original){var y,x;switch(origin[0]){case'top':y=0;break;case'middle':y=0.5;break;case'bottom':y=1;break;default:y=origin[0]/original.height;};switch(origin[1]){case'left':x=0;break;case'center':x=0.5;break;case'right':x=1;break;default:x=origin[1]/original.width;};return{x:x,y:y};},createWrapper:function(element){if(element.parent().is('.ui-effects-wrapper'))
-return element.parent();var props={width:element.outerWidth(true),height:element.outerHeight(true),'float':element.css('float')};element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');var wrapper=element.parent();if(element.css('position')=='static'){wrapper.css({position:'relative'});element.css({position:'relative'});}else{var top=element.css('top');if(isNaN(parseInt(top,10)))top='auto';var left=element.css('left');if(isNaN(parseInt(left,10)))left='auto';wrapper.css({position:element.css('position'),top:top,left:left,zIndex:element.css('z-index')}).show();element.css({position:'relative',top:0,left:0});}
-wrapper.css(props);return wrapper;},removeWrapper:function(element){if(element.parent().is('.ui-effects-wrapper'))
-return element.parent().replaceWith(element);return element;},setTransition:function(element,list,factor,value){value=value||{};$.each(list,function(i,x){unit=element.cssUnit(x);if(unit[0]>0)value[x]=unit[0]*factor+unit[1];});return value;},animateClass:function(value,duration,easing,callback){var cb=(typeof easing=="function"?easing:(callback?callback:null));var ea=(typeof easing=="string"?easing:null);return this.each(function(){var offset={};var that=$(this);var oldStyleAttr=that.attr("style")||'';if(typeof oldStyleAttr=='object')oldStyleAttr=oldStyleAttr["cssText"];if(value.toggle){that.hasClass(value.toggle)?value.remove=value.toggle:value.add=value.toggle;}
-var oldStyle=$.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(value.add)that.addClass(value.add);if(value.remove)that.removeClass(value.remove);var newStyle=$.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(value.add)that.removeClass(value.add);if(value.remove)that.addClass(value.remove);for(var n in newStyle){if(typeof newStyle[n]!="function"&&newStyle[n]&&n.indexOf("Moz")==-1&&n.indexOf("length")==-1&&newStyle[n]!=oldStyle[n]&&(n.match(/color/i)||(!n.match(/color/i)&&!isNaN(parseInt(newStyle[n],10))))&&(oldStyle.position!="static"||(oldStyle.position=="static"&&!n.match(/left|top|bottom|right/))))offset[n]=newStyle[n];}
-that.animate(offset,duration,ea,function(){if(typeof $(this).attr("style")=='object'){$(this).attr("style")["cssText"]="";$(this).attr("style")["cssText"]=oldStyleAttr;}else $(this).attr("style",oldStyleAttr);if(value.add)$(this).addClass(value.add);if(value.remove)$(this).removeClass(value.remove);if(cb)cb.apply(this,arguments);});});}};function _normalizeArguments(a,m){var o=a[1]&&a[1].constructor==Object?a[1]:{};if(m)o.mode=m;var speed=a[1]&&a[1].constructor!=Object?a[1]:(o.duration?o.duration:a[2]);speed=$.fx.off?0:typeof speed==="number"?speed:$.fx.speeds[speed]||$.fx.speeds._default;var callback=o.callback||($.isFunction(a[1])&&a[1])||($.isFunction(a[2])&&a[2])||($.isFunction(a[3])&&a[3]);return[a[0],o,speed,callback];}
-$.fn.extend({_show:$.fn.show,_hide:$.fn.hide,__toggle:$.fn.toggle,_addClass:$.fn.addClass,_removeClass:$.fn.removeClass,_toggleClass:$.fn.toggleClass,effect:function(fx,options,speed,callback){return $.effects[fx]?$.effects[fx].call(this,{method:fx,options:options||{},duration:speed,callback:callback}):null;},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0])))
-return this._show.apply(this,arguments);else{return this.effect.apply(this,_normalizeArguments(arguments,'show'));}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0])))
-return this._hide.apply(this,arguments);else{return this.effect.apply(this,_normalizeArguments(arguments,'hide'));}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))||($.isFunction(arguments[0])||typeof arguments[0]=='boolean')){return this.__toggle.apply(this,arguments);}else{return this.effect.apply(this,_normalizeArguments(arguments,'toggle'));}},addClass:function(classNames,speed,easing,callback){return speed?$.effects.animateClass.apply(this,[{add:classNames},speed,easing,callback]):this._addClass(classNames);},removeClass:function(classNames,speed,easing,callback){return speed?$.effects.animateClass.apply(this,[{remove:classNames},speed,easing,callback]):this._removeClass(classNames);},toggleClass:function(classNames,speed,easing,callback){return((typeof speed!=="boolean")&&speed)?$.effects.animateClass.apply(this,[{toggle:classNames},speed,easing,callback]):this._toggleClass(classNames,speed);},morph:function(remove,add,speed,easing,callback){return $.effects.animateClass.apply(this,[{add:add,remove:remove},speed,easing,callback]);},switchClass:function(){return this.morph.apply(this,arguments);},cssUnit:function(key){var style=this.css(key),val=[];$.each(['em','px','%','pt'],function(i,unit){if(style.indexOf(unit)>0)
-val=[parseFloat(style),unit];});return val;}});$.each(['backgroundColor','borderBottomColor','borderLeftColor','borderRightColor','borderTopColor','color','outlineColor'],function(i,attr){$.fx.step[attr]=function(fx){if(fx.state==0){fx.start=getColor(fx.elem,attr);fx.end=getRGB(fx.end);}
-fx.elem.style[attr]="rgb("+[Math.max(Math.min(parseInt((fx.pos*(fx.end[0]-fx.start[0]))+fx.start[0],10),255),0),Math.max(Math.min(parseInt((fx.pos*(fx.end[1]-fx.start[1]))+fx.start[1],10),255),0),Math.max(Math.min(parseInt((fx.pos*(fx.end[2]-fx.start[2]))+fx.start[2],10),255),0)].join(",")+")";};});function getRGB(color){var result;if(color&&color.constructor==Array&&color.length==3)
-return color;if(result=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
-return[parseInt(result[1],10),parseInt(result[2],10),parseInt(result[3],10)];if(result=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
-return[parseFloat(result[1])*2.55,parseFloat(result[2])*2.55,parseFloat(result[3])*2.55];if(result=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
-return[parseInt(result[1],16),parseInt(result[2],16),parseInt(result[3],16)];if(result=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
-return[parseInt(result[1]+result[1],16),parseInt(result[2]+result[2],16),parseInt(result[3]+result[3],16)];if(result=/rgba\(0, 0, 0, 0\)/.exec(color))
-return colors['transparent'];return colors[$.trim(color).toLowerCase()];}
-function getColor(elem,attr){var color;do{color=$.curCSS(elem,attr);if(color!=''&&color!='transparent'||$.nodeName(elem,"body"))
-break;attr="backgroundColor";}while(elem=elem.parentNode);return getRGB(color);};var colors={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};$.easing.jswing=$.easing.swing;$.extend($.easing,{def:'easeOutQuad',swing:function(x,t,b,c,d){return $.easing[$.easing.def](x,t,b,c,d);},easeInQuad:function(x,t,b,c,d){return c*(t/=d)*t+b;},easeOutQuad:function(x,t,b,c,d){return-c*(t/=d)*(t-2)+b;},easeInOutQuad:function(x,t,b,c,d){if((t/=d/2)<1)return c/2*t*t+b;return-c/2*((--t)*(t-2)-1)+b;},easeInCubic:function(x,t,b,c,d){return c*(t/=d)*t*t+b;},easeOutCubic:function(x,t,b,c,d){return c*((t=t/d-1)*t*t+1)+b;},easeInOutCubic:function(x,t,b,c,d){if((t/=d/2)<1)return c/2*t*t*t+b;return c/2*((t-=2)*t*t+2)+b;},easeInQuart:function(x,t,b,c,d){return c*(t/=d)*t*t*t+b;},easeOutQuart:function(x,t,b,c,d){return-c*((t=t/d-1)*t*t*t-1)+b;},easeInOutQuart:function(x,t,b,c,d){if((t/=d/2)<1)return c/2*t*t*t*t+b;return-c/2*((t-=2)*t*t*t-2)+b;},easeInQuint:function(x,t,b,c,d){return c*(t/=d)*t*t*t*t+b;},easeOutQuint:function(x,t,b,c,d){return c*((t=t/d-1)*t*t*t*t+1)+b;},easeInOutQuint:function(x,t,b,c,d){if((t/=d/2)<1)return c/2*t*t*t*t*t+b;return c/2*((t-=2)*t*t*t*t+2)+b;},easeInSine:function(x,t,b,c,d){return-c*Math.cos(t/d*(Math.PI/2))+c+b;},easeOutSine:function(x,t,b,c,d){return c*Math.sin(t/d*(Math.PI/2))+b;},easeInOutSine:function(x,t,b,c,d){return-c/2*(Math.cos(Math.PI*t/d)-1)+b;},easeInExpo:function(x,t,b,c,d){return(t==0)?b:c*Math.pow(2,10*(t/d-1))+b;},easeOutExpo:function(x,t,b,c,d){return(t==d)?b+c:c*(-Math.pow(2,-10*t/d)+1)+b;},easeInOutExpo:function(x,t,b,c,d){if(t==0)return b;if(t==d)return b+c;if((t/=d/2)<1)return c/2*Math.pow(2,10*(t-1))+b;return c/2*(-Math.pow(2,-10*--t)+2)+b;},easeInCirc:function(x,t,b,c,d){return-c*(Math.sqrt(1-(t/=d)*t)-1)+b;},easeOutCirc:function(x,t,b,c,d){return c*Math.sqrt(1-(t=t/d-1)*t)+b;},easeInOutCirc:function(x,t,b,c,d){if((t/=d/2)<1)return-c/2*(Math.sqrt(1-t*t)-1)+b;return c/2*(Math.sqrt(1-(t-=2)*t)+1)+b;},easeInElastic:function(x,t,b,c,d){var s=1.70158;var p=0;var a=c;if(t==0)return b;if((t/=d)==1)return b+c;if(!p)p=d*.3;if(a<Math.abs(c)){a=c;var s=p/4;}
-else var s=p/(2*Math.PI)*Math.asin(c/a);return-(a*Math.pow(2,10*(t-=1))*Math.sin((t*d-s)*(2*Math.PI)/p))+b;},easeOutElastic:function(x,t,b,c,d){var s=1.70158;var p=0;var a=c;if(t==0)return b;if((t/=d)==1)return b+c;if(!p)p=d*.3;if(a<Math.abs(c)){a=c;var s=p/4;}
-else var s=p/(2*Math.PI)*Math.asin(c/a);return a*Math.pow(2,-10*t)*Math.sin((t*d-s)*(2*Math.PI)/p)+c+b;},easeInOutElastic:function(x,t,b,c,d){var s=1.70158;var p=0;var a=c;if(t==0)return b;if((t/=d/2)==2)return b+c;if(!p)p=d*(.3*1.5);if(a<Math.abs(c)){a=c;var s=p/4;}
-else var s=p/(2*Math.PI)*Math.asin(c/a);if(t<1)return-.5*(a*Math.pow(2,10*(t-=1))*Math.sin((t*d-s)*(2*Math.PI)/p))+b;return a*Math.pow(2,-10*(t-=1))*Math.sin((t*d-s)*(2*Math.PI)/p)*.5+c+b;},easeInBack:function(x,t,b,c,d,s){if(s==undefined)s=1.70158;return c*(t/=d)*t*((s+1)*t-s)+b;},easeOutBack:function(x,t,b,c,d,s){if(s==undefined)s=1.70158;return c*((t=t/d-1)*t*((s+1)*t+s)+1)+b;},easeInOutBack:function(x,t,b,c,d,s){if(s==undefined)s=1.70158;if((t/=d/2)<1)return c/2*(t*t*(((s*=(1.525))+1)*t-s))+b;return c/2*((t-=2)*t*(((s*=(1.525))+1)*t+s)+2)+b;},easeInBounce:function(x,t,b,c,d){return c-$.easing.easeOutBounce(x,d-t,0,c,d)+b;},easeOutBounce:function(x,t,b,c,d){if((t/=d)<(1/2.75)){return c*(7.5625*t*t)+b;}else if(t<(2/2.75)){return c*(7.5625*(t-=(1.5/2.75))*t+.75)+b;}else if(t<(2.5/2.75)){return c*(7.5625*(t-=(2.25/2.75))*t+.9375)+b;}else{return c*(7.5625*(t-=(2.625/2.75))*t+.984375)+b;}},easeInOutBounce:function(x,t,b,c,d){if(t<d/2)return $.easing.easeInBounce(x,t*2,0,c,d)*.5+b;return $.easing.easeOutBounce(x,t*2-d,0,c,d)*.5+c*.5+b;}});})(jQuery);(function($){$.effects.highlight=function(o){return this.queue(function(){var el=$(this),props=['backgroundImage','backgroundColor','opacity'];var mode=$.effects.setMode(el,o.options.mode||'show');var color=o.options.color||"#ffff99";var oldColor=el.css("backgroundColor");$.effects.save(el,props);el.show();el.css({backgroundImage:'none',backgroundColor:color});var animation={backgroundColor:oldColor};if(mode=="hide")animation['opacity']=0;el.animate(animation,{queue:false,duration:o.duration,easing:o.options.easing,complete:function(){if(mode=="hide")el.hide();$.effects.restore(el,props);if(mode=="show"&&$.browser.msie)this.style.removeAttribute('filter');if(o.callback)o.callback.apply(this,arguments);el.dequeue();}});});};})(jQuery);(function($){$.effects.transfer=function(o){return this.queue(function(){var elem=$(this),target=$(o.options.to),endPosition=target.offset(),animation={top:endPosition.top,left:endPosition.left,height:target.innerHeight(),width:target.innerWidth()},startPosition=elem.offset(),transfer=$('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(o.options.className).css({top:startPosition.top,left:startPosition.left,height:elem.innerHeight(),width:elem.innerWidth(),position:'absolute'}).animate(animation,o.duration,o.options.easing,function(){transfer.remove();(o.callback&&o.callback.apply(elem[0],arguments));elem.dequeue();});});};})(jQuery); \ No newline at end of file
+/*! jQuery UI - v1.10.0 - 2013-01-17
+* http://jqueryui.com
+* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.position.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.effect.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js, jquery.ui.menu.js, jquery.ui.progressbar.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.slider.js, jquery.ui.sortable.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js
+* Copyright (c) 2013 jQuery Foundation and other contributors Licensed MIT */
+
+(function( $, undefined ) {
+
+var uuid = 0,
+ runiqueId = /^ui-id-\d+$/;
+
+// prevent duplicate loading
+// this is only a problem because we proxy existing functions
+// and we don't want to double proxy them
+$.ui = $.ui || {};
+if ( $.ui.version ) {
+ return;
+}
+
+$.extend( $.ui, {
+ version: "1.10.0",
+
+ keyCode: {
+ BACKSPACE: 8,
+ COMMA: 188,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+});
+
+// plugins
+$.fn.extend({
+ _focus: $.fn.focus,
+ focus: function( delay, fn ) {
+ return typeof delay === "number" ?
+ this.each(function() {
+ var elem = this;
+ setTimeout(function() {
+ $( elem ).focus();
+ if ( fn ) {
+ fn.call( elem );
+ }
+ }, delay );
+ }) :
+ this._focus.apply( this, arguments );
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if (($.ui.ie && (/(static|relative)/).test(this.css("position"))) || (/absolute/).test(this.css("position"))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.css(this,"position")) && (/(auto|scroll)/).test($.css(this,"overflow")+$.css(this,"overflow-y")+$.css(this,"overflow-x"));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.css(this,"overflow")+$.css(this,"overflow-y")+$.css(this,"overflow-x"));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css("position")) || !scrollParent.length ? $(document) : scrollParent;
+ },
+
+ zIndex: function( zIndex ) {
+ if ( zIndex !== undefined ) {
+ return this.css( "zIndex", zIndex );
+ }
+
+ if ( this.length ) {
+ var elem = $( this[ 0 ] ), position, value;
+ while ( elem.length && elem[ 0 ] !== document ) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css( "position" );
+ if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt( elem.css( "zIndex" ), 10 );
+ if ( !isNaN( value ) && value !== 0 ) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
+ },
+
+ uniqueId: function() {
+ return this.each(function() {
+ if ( !this.id ) {
+ this.id = "ui-id-" + (++uuid);
+ }
+ });
+ },
+
+ removeUniqueId: function() {
+ return this.each(function() {
+ if ( runiqueId.test( this.id ) ) {
+ $( this ).removeAttr( "id" );
+ }
+ });
+ }
+});
+
+// selectors
+function focusable( element, isTabIndexNotNaN ) {
+ var map, mapName, img,
+ nodeName = element.nodeName.toLowerCase();
+ if ( "area" === nodeName ) {
+ map = element.parentNode;
+ mapName = map.name;
+ if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+ return false;
+ }
+ img = $( "img[usemap=#" + mapName + "]" )[0];
+ return !!img && visible( img );
+ }
+ return ( /input|select|textarea|button|object/.test( nodeName ) ?
+ !element.disabled :
+ "a" === nodeName ?
+ element.href || isTabIndexNotNaN :
+ isTabIndexNotNaN) &&
+ // the element and all of its ancestors must be visible
+ visible( element );
+}
+
+function visible( element ) {
+ return $.expr.filters.visible( element ) &&
+ !$( element ).parents().addBack().filter(function() {
+ return $.css( this, "visibility" ) === "hidden";
+ }).length;
+}
+
+$.extend( $.expr[ ":" ], {
+ data: $.expr.createPseudo ?
+ $.expr.createPseudo(function( dataName ) {
+ return function( elem ) {
+ return !!$.data( elem, dataName );
+ };
+ }) :
+ // support: jQuery <1.8
+ function( elem, i, match ) {
+ return !!$.data( elem, match[ 3 ] );
+ },
+
+ focusable: function( element ) {
+ return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
+ },
+
+ tabbable: function( element ) {
+ var tabIndex = $.attr( element, "tabindex" ),
+ isTabIndexNaN = isNaN( tabIndex );
+ return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN );
+ }
+});
+
+// support: jQuery <1.8
+if ( !$( "<a>" ).outerWidth( 1 ).jquery ) {
+ $.each( [ "Width", "Height" ], function( i, name ) {
+ var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+ type = name.toLowerCase(),
+ orig = {
+ innerWidth: $.fn.innerWidth,
+ innerHeight: $.fn.innerHeight,
+ outerWidth: $.fn.outerWidth,
+ outerHeight: $.fn.outerHeight
+ };
+
+ function reduce( elem, size, border, margin ) {
+ $.each( side, function() {
+ size -= parseFloat( $.css( elem, "padding" + this ) ) || 0;
+ if ( border ) {
+ size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0;
+ }
+ if ( margin ) {
+ size -= parseFloat( $.css( elem, "margin" + this ) ) || 0;
+ }
+ });
+ return size;
+ }
+
+ $.fn[ "inner" + name ] = function( size ) {
+ if ( size === undefined ) {
+ return orig[ "inner" + name ].call( this );
+ }
+
+ return this.each(function() {
+ $( this ).css( type, reduce( this, size ) + "px" );
+ });
+ };
+
+ $.fn[ "outer" + name] = function( size, margin ) {
+ if ( typeof size !== "number" ) {
+ return orig[ "outer" + name ].call( this, size );
+ }
+
+ return this.each(function() {
+ $( this).css( type, reduce( this, size, true, margin ) + "px" );
+ });
+ };
+ });
+}
+
+// support: jQuery <1.8
+if ( !$.fn.addBack ) {
+ $.fn.addBack = function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter( selector )
+ );
+ };
+}
+
+// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413)
+if ( $( "<a>" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) {
+ $.fn.removeData = (function( removeData ) {
+ return function( key ) {
+ if ( arguments.length ) {
+ return removeData.call( this, $.camelCase( key ) );
+ } else {
+ return removeData.call( this );
+ }
+ };
+ })( $.fn.removeData );
+}
+
+
+
+
+
+// deprecated
+$.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() );
+
+$.support.selectstart = "onselectstart" in document.createElement( "div" );
+$.fn.extend({
+ disableSelection: function() {
+ return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
+ ".ui-disableSelection", function( event ) {
+ event.preventDefault();
+ });
+ },
+
+ enableSelection: function() {
+ return this.unbind( ".ui-disableSelection" );
+ }
+});
+
+$.extend( $.ui, {
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function( module, option, set ) {
+ var i,
+ proto = $.ui[ module ].prototype;
+ for ( i in set ) {
+ proto.plugins[ i ] = proto.plugins[ i ] || [];
+ proto.plugins[ i ].push( [ option, set[ i ] ] );
+ }
+ },
+ call: function( instance, name, args ) {
+ var i,
+ set = instance.plugins[ name ];
+ if ( !set || !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) {
+ return;
+ }
+
+ for ( i = 0; i < set.length; i++ ) {
+ if ( instance.options[ set[ i ][ 0 ] ] ) {
+ set[ i ][ 1 ].apply( instance.element, args );
+ }
+ }
+ }
+ },
+
+ // only used by resizable
+ hasScroll: function( el, a ) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ( $( el ).css( "overflow" ) === "hidden") {
+ return false;
+ }
+
+ var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+ has = false;
+
+ if ( el[ scroll ] > 0 ) {
+ return true;
+ }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[ scroll ] = 1;
+ has = ( el[ scroll ] > 0 );
+ el[ scroll ] = 0;
+ return has;
+ }
+});
+
+})( jQuery );
+(function( $, undefined ) {
+
+var uuid = 0,
+ slice = Array.prototype.slice,
+ _cleanData = $.cleanData;
+$.cleanData = function( elems ) {
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ try {
+ $( elem ).triggerHandler( "remove" );
+ // http://bugs.jquery.com/ticket/8235
+ } catch( e ) {}
+ }
+ _cleanData( elems );
+};
+
+$.widget = function( name, base, prototype ) {
+ var fullName, existingConstructor, constructor, basePrototype,
+ // proxiedPrototype allows the provided prototype to remain unmodified
+ // so that it can be used as a mixin for multiple widgets (#8876)
+ proxiedPrototype = {},
+ namespace = name.split( "." )[ 0 ];
+
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
+
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) {
+ return !!$.data( elem, fullName );
+ };
+
+ $[ namespace ] = $[ namespace ] || {};
+ existingConstructor = $[ namespace ][ name ];
+ constructor = $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without "new" keyword
+ if ( !this._createWidget ) {
+ return new constructor( options, element );
+ }
+
+ // allow instantiation without initializing for simple inheritance
+ // must use "new" keyword (the code above always passes args)
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+ };
+ // extend with the existing constructor to carry over any static properties
+ $.extend( constructor, existingConstructor, {
+ version: prototype.version,
+ // copy the object used to create the prototype in case we need to
+ // redefine the widget later
+ _proto: $.extend( {}, prototype ),
+ // track widgets that inherit from this widget in case this widget is
+ // redefined after a widget inherits from it
+ _childConstructors: []
+ });
+
+ basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+ basePrototype.options = $.widget.extend( {}, basePrototype.options );
+ $.each( prototype, function( prop, value ) {
+ if ( !$.isFunction( value ) ) {
+ proxiedPrototype[ prop ] = value;
+ return;
+ }
+ proxiedPrototype[ prop ] = (function() {
+ var _super = function() {
+ return base.prototype[ prop ].apply( this, arguments );
+ },
+ _superApply = function( args ) {
+ return base.prototype[ prop ].apply( this, args );
+ };
+ return function() {
+ var __super = this._super,
+ __superApply = this._superApply,
+ returnValue;
+
+ this._super = _super;
+ this._superApply = _superApply;
+
+ returnValue = value.apply( this, arguments );
+
+ this._super = __super;
+ this._superApply = __superApply;
+
+ return returnValue;
+ };
+ })();
+ });
+ constructor.prototype = $.widget.extend( basePrototype, {
+ // TODO: remove support for widgetEventPrefix
+ // always use the name + a colon as the prefix, e.g., draggable:start
+ // don't prefix for widgets that aren't DOM-based
+ widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name
+ }, proxiedPrototype, {
+ constructor: constructor,
+ namespace: namespace,
+ widgetName: name,
+ widgetFullName: fullName
+ });
+
+ // If this widget is being redefined then we need to find all widgets that
+ // are inheriting from it and redefine all of them so that they inherit from
+ // the new version of this widget. We're essentially trying to replace one
+ // level in the prototype chain.
+ if ( existingConstructor ) {
+ $.each( existingConstructor._childConstructors, function( i, child ) {
+ var childPrototype = child.prototype;
+
+ // redefine the child widget using the same prototype that was
+ // originally used, but inherit from the new version of the base
+ $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto );
+ });
+ // remove the list of existing child constructors from the old constructor
+ // so the old child constructors can be garbage collected
+ delete existingConstructor._childConstructors;
+ } else {
+ base._childConstructors.push( constructor );
+ }
+
+ $.widget.bridge( name, constructor );
+};
+
+$.widget.extend = function( target ) {
+ var input = slice.call( arguments, 1 ),
+ inputIndex = 0,
+ inputLength = input.length,
+ key,
+ value;
+ for ( ; inputIndex < inputLength; inputIndex++ ) {
+ for ( key in input[ inputIndex ] ) {
+ value = input[ inputIndex ][ key ];
+ if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) {
+ // Clone objects
+ if ( $.isPlainObject( value ) ) {
+ target[ key ] = $.isPlainObject( target[ key ] ) ?
+ $.widget.extend( {}, target[ key ], value ) :
+ // Don't extend strings, arrays, etc. with objects
+ $.widget.extend( {}, value );
+ // Copy everything else by reference
+ } else {
+ target[ key ] = value;
+ }
+ }
+ }
+ }
+ return target;
+};
+
+$.widget.bridge = function( name, object ) {
+ var fullName = object.prototype.widgetFullName || name;
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = slice.call( arguments, 1 ),
+ returnValue = this;
+
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.widget.extend.apply( null, [ options ].concat(args) ) :
+ options;
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var methodValue,
+ instance = $.data( this, fullName );
+ if ( !instance ) {
+ return $.error( "cannot call methods on " + name + " prior to initialization; " +
+ "attempted to call method '" + options + "'" );
+ }
+ if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) {
+ return $.error( "no such method '" + options + "' for " + name + " widget instance" );
+ }
+ methodValue = instance[ options ].apply( instance, args );
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue && methodValue.jquery ?
+ returnValue.pushStack( methodValue.get() ) :
+ methodValue;
+ return false;
+ }
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, fullName );
+ if ( instance ) {
+ instance.option( options || {} )._init();
+ } else {
+ $.data( this, fullName, new object( options, this ) );
+ }
+ });
+ }
+
+ return returnValue;
+ };
+};
+
+$.Widget = function( /* options, element */ ) {};
+$.Widget._childConstructors = [];
+
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ defaultElement: "<div>",
+ options: {
+ disabled: false,
+
+ // callbacks
+ create: null
+ },
+ _createWidget: function( options, element ) {
+ element = $( element || this.defaultElement || this )[ 0 ];
+ this.element = $( element );
+ this.uuid = uuid++;
+ this.eventNamespace = "." + this.widgetName + this.uuid;
+ this.options = $.widget.extend( {},
+ this.options,
+ this._getCreateOptions(),
+ options );
+
+ this.bindings = $();
+ this.hoverable = $();
+ this.focusable = $();
+
+ if ( element !== this ) {
+ $.data( element, this.widgetFullName, this );
+ this._on( true, this.element, {
+ remove: function( event ) {
+ if ( event.target === element ) {
+ this.destroy();
+ }
+ }
+ });
+ this.document = $( element.style ?
+ // element within the document
+ element.ownerDocument :
+ // element is window or document
+ element.document || element );
+ this.window = $( this.document[0].defaultView || this.document[0].parentWindow );
+ }
+
+ this._create();
+ this._trigger( "create", null, this._getCreateEventData() );
+ this._init();
+ },
+ _getCreateOptions: $.noop,
+ _getCreateEventData: $.noop,
+ _create: $.noop,
+ _init: $.noop,
+
+ destroy: function() {
+ this._destroy();
+ // we can probably remove the unbind calls in 2.0
+ // all event bindings should go through this._on()
+ this.element
+ .unbind( this.eventNamespace )
+ // 1.9 BC for #7810
+ // TODO remove dual storage
+ .removeData( this.widgetName )
+ .removeData( this.widgetFullName )
+ // support: jquery <1.6.3
+ // http://bugs.jquery.com/ticket/9413
+ .removeData( $.camelCase( this.widgetFullName ) );
+ this.widget()
+ .unbind( this.eventNamespace )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetFullName + "-disabled " +
+ "ui-state-disabled" );
+
+ // clean up events and states
+ this.bindings.unbind( this.eventNamespace );
+ this.hoverable.removeClass( "ui-state-hover" );
+ this.focusable.removeClass( "ui-state-focus" );
+ },
+ _destroy: $.noop,
+
+ widget: function() {
+ return this.element;
+ },
+
+ option: function( key, value ) {
+ var options = key,
+ parts,
+ curOption,
+ i;
+
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.widget.extend( {}, this.options );
+ }
+
+ if ( typeof key === "string" ) {
+ // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
+ options = {};
+ parts = key.split( "." );
+ key = parts.shift();
+ if ( parts.length ) {
+ curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] );
+ for ( i = 0; i < parts.length - 1; i++ ) {
+ curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {};
+ curOption = curOption[ parts[ i ] ];
+ }
+ key = parts.pop();
+ if ( value === undefined ) {
+ return curOption[ key ] === undefined ? null : curOption[ key ];
+ }
+ curOption[ key ] = value;
+ } else {
+ if ( value === undefined ) {
+ return this.options[ key ] === undefined ? null : this.options[ key ];
+ }
+ options[ key ] = value;
+ }
+ }
+
+ this._setOptions( options );
+
+ return this;
+ },
+ _setOptions: function( options ) {
+ var key;
+
+ for ( key in options ) {
+ this._setOption( key, options[ key ] );
+ }
+
+ return this;
+ },
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
+
+ if ( key === "disabled" ) {
+ this.widget()
+ .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value )
+ .attr( "aria-disabled", value );
+ this.hoverable.removeClass( "ui-state-hover" );
+ this.focusable.removeClass( "ui-state-focus" );
+ }
+
+ return this;
+ },
+
+ enable: function() {
+ return this._setOption( "disabled", false );
+ },
+ disable: function() {
+ return this._setOption( "disabled", true );
+ },
+
+ _on: function( suppressDisabledCheck, element, handlers ) {
+ var delegateElement,
+ instance = this;
+
+ // no suppressDisabledCheck flag, shuffle arguments
+ if ( typeof suppressDisabledCheck !== "boolean" ) {
+ handlers = element;
+ element = suppressDisabledCheck;
+ suppressDisabledCheck = false;
+ }
+
+ // no element argument, shuffle and use this.element
+ if ( !handlers ) {
+ handlers = element;
+ element = this.element;
+ delegateElement = this.widget();
+ } else {
+ // accept selectors, DOM elements
+ element = delegateElement = $( element );
+ this.bindings = this.bindings.add( element );
+ }
+
+ $.each( handlers, function( event, handler ) {
+ function handlerProxy() {
+ // allow widgets to customize the disabled handling
+ // - disabled as an array instead of boolean
+ // - disabled class as method for disabling individual parts
+ if ( !suppressDisabledCheck &&
+ ( instance.options.disabled === true ||
+ $( this ).hasClass( "ui-state-disabled" ) ) ) {
+ return;
+ }
+ return ( typeof handler === "string" ? instance[ handler ] : handler )
+ .apply( instance, arguments );
+ }
+
+ // copy the guid so direct unbinding works
+ if ( typeof handler !== "string" ) {
+ handlerProxy.guid = handler.guid =
+ handler.guid || handlerProxy.guid || $.guid++;
+ }
+
+ var match = event.match( /^(\w+)\s*(.*)$/ ),
+ eventName = match[1] + instance.eventNamespace,
+ selector = match[2];
+ if ( selector ) {
+ delegateElement.delegate( selector, eventName, handlerProxy );
+ } else {
+ element.bind( eventName, handlerProxy );
+ }
+ });
+ },
+
+ _off: function( element, eventName ) {
+ eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace;
+ element.unbind( eventName ).undelegate( eventName );
+ },
+
+ _delay: function( handler, delay ) {
+ function handlerProxy() {
+ return ( typeof handler === "string" ? instance[ handler ] : handler )
+ .apply( instance, arguments );
+ }
+ var instance = this;
+ return setTimeout( handlerProxy, delay || 0 );
+ },
+
+ _hoverable: function( element ) {
+ this.hoverable = this.hoverable.add( element );
+ this._on( element, {
+ mouseenter: function( event ) {
+ $( event.currentTarget ).addClass( "ui-state-hover" );
+ },
+ mouseleave: function( event ) {
+ $( event.currentTarget ).removeClass( "ui-state-hover" );
+ }
+ });
+ },
+
+ _focusable: function( element ) {
+ this.focusable = this.focusable.add( element );
+ this._on( element, {
+ focusin: function( event ) {
+ $( event.currentTarget ).addClass( "ui-state-focus" );
+ },
+ focusout: function( event ) {
+ $( event.currentTarget ).removeClass( "ui-state-focus" );
+ }
+ });
+ },
+
+ _trigger: function( type, event, data ) {
+ var prop, orig,
+ callback = this.options[ type ];
+
+ data = data || {};
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ // the original event may come from any element
+ // so we need to reset the target on the new event
+ event.target = this.element[ 0 ];
+
+ // copy original event properties over to the new event
+ orig = event.originalEvent;
+ if ( orig ) {
+ for ( prop in orig ) {
+ if ( !( prop in event ) ) {
+ event[ prop ] = orig[ prop ];
+ }
+ }
+ }
+
+ this.element.trigger( event, data );
+ return !( $.isFunction( callback ) &&
+ callback.apply( this.element[0], [ event ].concat( data ) ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
+
+$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) {
+ $.Widget.prototype[ "_" + method ] = function( element, options, callback ) {
+ if ( typeof options === "string" ) {
+ options = { effect: options };
+ }
+ var hasOptions,
+ effectName = !options ?
+ method :
+ options === true || typeof options === "number" ?
+ defaultEffect :
+ options.effect || defaultEffect;
+ options = options || {};
+ if ( typeof options === "number" ) {
+ options = { duration: options };
+ }
+ hasOptions = !$.isEmptyObject( options );
+ options.complete = callback;
+ if ( options.delay ) {
+ element.delay( options.delay );
+ }
+ if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) {
+ element[ method ]( options );
+ } else if ( effectName !== method && element[ effectName ] ) {
+ element[ effectName ]( options.duration, options.easing, callback );
+ } else {
+ element.queue(function( next ) {
+ $( this )[ method ]();
+ if ( callback ) {
+ callback.call( element[ 0 ] );
+ }
+ next();
+ });
+ }
+ };
+});
+
+})( jQuery );
+(function( $, undefined ) {
+
+var mouseHandled = false;
+$( document ).mouseup( function() {
+ mouseHandled = false;
+});
+
+$.widget("ui.mouse", {
+ version: "1.10.0",
+ options: {
+ cancel: "input,textarea,button,select,option",
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function() {
+ var that = this;
+
+ this.element
+ .bind("mousedown."+this.widgetName, function(event) {
+ return that._mouseDown(event);
+ })
+ .bind("click."+this.widgetName, function(event) {
+ if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) {
+ $.removeData(event.target, that.widgetName + ".preventClickEvent");
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind("."+this.widgetName);
+ if ( this._mouseMoveDelegate ) {
+ $(document)
+ .unbind("mousemove."+this.widgetName, this._mouseMoveDelegate)
+ .unbind("mouseup."+this.widgetName, this._mouseUpDelegate);
+ }
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ if( mouseHandled ) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var that = this,
+ btnIsLeft = (event.which === 1),
+ // event.target.nodeName works around a bug in IE 8 with
+ // disabled inputs (#7620)
+ elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ that.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // Click event may never have fired (Gecko & Opera)
+ if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) {
+ $.removeData(event.target, this.widgetName + ".preventClickEvent");
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return that._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return that._mouseUp(event);
+ };
+ $(document)
+ .bind("mousemove."+this.widgetName, this._mouseMoveDelegate)
+ .bind("mouseup."+this.widgetName, this._mouseUpDelegate);
+
+ event.preventDefault();
+
+ mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.ui.ie && ( !document.documentMode || document.documentMode < 9 ) && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind("mousemove."+this.widgetName, this._mouseMoveDelegate)
+ .unbind("mouseup."+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+
+ if (event.target === this._mouseDownEvent.target) {
+ $.data(event.target, this.widgetName + ".preventClickEvent", true);
+ }
+
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(/* event */) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(/* event */) {},
+ _mouseDrag: function(/* event */) {},
+ _mouseStop: function(/* event */) {},
+ _mouseCapture: function(/* event */) { return true; }
+});
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.ui = $.ui || {};
+
+var cachedScrollbarWidth,
+ max = Math.max,
+ abs = Math.abs,
+ round = Math.round,
+ rhorizontal = /left|center|right/,
+ rvertical = /top|center|bottom/,
+ roffset = /[\+\-]\d+%?/,
+ rposition = /^\w+/,
+ rpercent = /%$/,
+ _position = $.fn.position;
+
+function getOffsets( offsets, width, height ) {
+ return [
+ parseInt( offsets[ 0 ], 10 ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ),
+ parseInt( offsets[ 1 ], 10 ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 )
+ ];
+}
+
+function parseCss( element, property ) {
+ return parseInt( $.css( element, property ), 10 ) || 0;
+}
+
+function getDimensions( elem ) {
+ var raw = elem[0];
+ if ( raw.nodeType === 9 ) {
+ return {
+ width: elem.width(),
+ height: elem.height(),
+ offset: { top: 0, left: 0 }
+ };
+ }
+ if ( $.isWindow( raw ) ) {
+ return {
+ width: elem.width(),
+ height: elem.height(),
+ offset: { top: elem.scrollTop(), left: elem.scrollLeft() }
+ };
+ }
+ if ( raw.preventDefault ) {
+ return {
+ width: 0,
+ height: 0,
+ offset: { top: raw.pageY, left: raw.pageX }
+ };
+ }
+ return {
+ width: elem.outerWidth(),
+ height: elem.outerHeight(),
+ offset: elem.offset()
+ };
+}
+
+$.position = {
+ scrollbarWidth: function() {
+ if ( cachedScrollbarWidth !== undefined ) {
+ return cachedScrollbarWidth;
+ }
+ var w1, w2,
+ div = $( "<div style='display:block;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>" ),
+ innerDiv = div.children()[0];
+
+ $( "body" ).append( div );
+ w1 = innerDiv.offsetWidth;
+ div.css( "overflow", "scroll" );
+
+ w2 = innerDiv.offsetWidth;
+
+ if ( w1 === w2 ) {
+ w2 = div[0].clientWidth;
+ }
+
+ div.remove();
+
+ return (cachedScrollbarWidth = w1 - w2);
+ },
+ getScrollInfo: function( within ) {
+ var overflowX = within.isWindow ? "" : within.element.css( "overflow-x" ),
+ overflowY = within.isWindow ? "" : within.element.css( "overflow-y" ),
+ hasOverflowX = overflowX === "scroll" ||
+ ( overflowX === "auto" && within.width < within.element[0].scrollWidth ),
+ hasOverflowY = overflowY === "scroll" ||
+ ( overflowY === "auto" && within.height < within.element[0].scrollHeight );
+ return {
+ width: hasOverflowX ? $.position.scrollbarWidth() : 0,
+ height: hasOverflowY ? $.position.scrollbarWidth() : 0
+ };
+ },
+ getWithinInfo: function( element ) {
+ var withinElement = $( element || window ),
+ isWindow = $.isWindow( withinElement[0] );
+ return {
+ element: withinElement,
+ isWindow: isWindow,
+ offset: withinElement.offset() || { left: 0, top: 0 },
+ scrollLeft: withinElement.scrollLeft(),
+ scrollTop: withinElement.scrollTop(),
+ width: isWindow ? withinElement.width() : withinElement.outerWidth(),
+ height: isWindow ? withinElement.height() : withinElement.outerHeight()
+ };
+ }
+};
+
+$.fn.position = function( options ) {
+ if ( !options || !options.of ) {
+ return _position.apply( this, arguments );
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend( {}, options );
+
+ var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions,
+ target = $( options.of ),
+ within = $.position.getWithinInfo( options.within ),
+ scrollInfo = $.position.getScrollInfo( within ),
+ collision = ( options.collision || "flip" ).split( " " ),
+ offsets = {};
+
+ dimensions = getDimensions( target );
+ if ( target[0].preventDefault ) {
+ // force left top to allow flipping
+ options.at = "left top";
+ }
+ targetWidth = dimensions.width;
+ targetHeight = dimensions.height;
+ targetOffset = dimensions.offset;
+ // clone to reuse original targetOffset later
+ basePosition = $.extend( {}, targetOffset );
+
+ // force my and at to have valid horizontal and vertical positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each( [ "my", "at" ], function() {
+ var pos = ( options[ this ] || "" ).split( " " ),
+ horizontalOffset,
+ verticalOffset;
+
+ if ( pos.length === 1) {
+ pos = rhorizontal.test( pos[ 0 ] ) ?
+ pos.concat( [ "center" ] ) :
+ rvertical.test( pos[ 0 ] ) ?
+ [ "center" ].concat( pos ) :
+ [ "center", "center" ];
+ }
+ pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center";
+ pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center";
+
+ // calculate offsets
+ horizontalOffset = roffset.exec( pos[ 0 ] );
+ verticalOffset = roffset.exec( pos[ 1 ] );
+ offsets[ this ] = [
+ horizontalOffset ? horizontalOffset[ 0 ] : 0,
+ verticalOffset ? verticalOffset[ 0 ] : 0
+ ];
+
+ // reduce to just the positions without the offsets
+ options[ this ] = [
+ rposition.exec( pos[ 0 ] )[ 0 ],
+ rposition.exec( pos[ 1 ] )[ 0 ]
+ ];
+ });
+
+ // normalize collision option
+ if ( collision.length === 1 ) {
+ collision[ 1 ] = collision[ 0 ];
+ }
+
+ if ( options.at[ 0 ] === "right" ) {
+ basePosition.left += targetWidth;
+ } else if ( options.at[ 0 ] === "center" ) {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if ( options.at[ 1 ] === "bottom" ) {
+ basePosition.top += targetHeight;
+ } else if ( options.at[ 1 ] === "center" ) {
+ basePosition.top += targetHeight / 2;
+ }
+
+ atOffset = getOffsets( offsets.at, targetWidth, targetHeight );
+ basePosition.left += atOffset[ 0 ];
+ basePosition.top += atOffset[ 1 ];
+
+ return this.each(function() {
+ var collisionPosition, using,
+ elem = $( this ),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ marginLeft = parseCss( this, "marginLeft" ),
+ marginTop = parseCss( this, "marginTop" ),
+ collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width,
+ collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height,
+ position = $.extend( {}, basePosition ),
+ myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() );
+
+ if ( options.my[ 0 ] === "right" ) {
+ position.left -= elemWidth;
+ } else if ( options.my[ 0 ] === "center" ) {
+ position.left -= elemWidth / 2;
+ }
+
+ if ( options.my[ 1 ] === "bottom" ) {
+ position.top -= elemHeight;
+ } else if ( options.my[ 1 ] === "center" ) {
+ position.top -= elemHeight / 2;
+ }
+
+ position.left += myOffset[ 0 ];
+ position.top += myOffset[ 1 ];
+
+ // if the browser doesn't support fractions, then round for consistent results
+ if ( !$.support.offsetFractions ) {
+ position.left = round( position.left );
+ position.top = round( position.top );
+ }
+
+ collisionPosition = {
+ marginLeft: marginLeft,
+ marginTop: marginTop
+ };
+
+ $.each( [ "left", "top" ], function( i, dir ) {
+ if ( $.ui.position[ collision[ i ] ] ) {
+ $.ui.position[ collision[ i ] ][ dir ]( position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ collisionPosition: collisionPosition,
+ collisionWidth: collisionWidth,
+ collisionHeight: collisionHeight,
+ offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ],
+ my: options.my,
+ at: options.at,
+ within: within,
+ elem : elem
+ });
+ }
+ });
+
+ if ( options.using ) {
+ // adds feedback as second argument to using callback, if present
+ using = function( props ) {
+ var left = targetOffset.left - position.left,
+ right = left + targetWidth - elemWidth,
+ top = targetOffset.top - position.top,
+ bottom = top + targetHeight - elemHeight,
+ feedback = {
+ target: {
+ element: target,
+ left: targetOffset.left,
+ top: targetOffset.top,
+ width: targetWidth,
+ height: targetHeight
+ },
+ element: {
+ element: elem,
+ left: position.left,
+ top: position.top,
+ width: elemWidth,
+ height: elemHeight
+ },
+ horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
+ vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
+ };
+ if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) {
+ feedback.horizontal = "center";
+ }
+ if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) {
+ feedback.vertical = "middle";
+ }
+ if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) {
+ feedback.important = "horizontal";
+ } else {
+ feedback.important = "vertical";
+ }
+ options.using.call( this, props, feedback );
+ };
+ }
+
+ elem.offset( $.extend( position, { using: using } ) );
+ });
+};
+
+$.ui.position = {
+ fit: {
+ left: function( position, data ) {
+ var within = data.within,
+ withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
+ outerWidth = within.width,
+ collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+ overLeft = withinOffset - collisionPosLeft,
+ overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
+ newOverRight;
+
+ // element is wider than within
+ if ( data.collisionWidth > outerWidth ) {
+ // element is initially over the left side of within
+ if ( overLeft > 0 && overRight <= 0 ) {
+ newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset;
+ position.left += overLeft - newOverRight;
+ // element is initially over right side of within
+ } else if ( overRight > 0 && overLeft <= 0 ) {
+ position.left = withinOffset;
+ // element is initially over both left and right sides of within
+ } else {
+ if ( overLeft > overRight ) {
+ position.left = withinOffset + outerWidth - data.collisionWidth;
+ } else {
+ position.left = withinOffset;
+ }
+ }
+ // too far left -> align with left edge
+ } else if ( overLeft > 0 ) {
+ position.left += overLeft;
+ // too far right -> align with right edge
+ } else if ( overRight > 0 ) {
+ position.left -= overRight;
+ // adjust based on position and margin
+ } else {
+ position.left = max( position.left - collisionPosLeft, position.left );
+ }
+ },
+ top: function( position, data ) {
+ var within = data.within,
+ withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
+ outerHeight = data.within.height,
+ collisionPosTop = position.top - data.collisionPosition.marginTop,
+ overTop = withinOffset - collisionPosTop,
+ overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
+ newOverBottom;
+
+ // element is taller than within
+ if ( data.collisionHeight > outerHeight ) {
+ // element is initially over the top of within
+ if ( overTop > 0 && overBottom <= 0 ) {
+ newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset;
+ position.top += overTop - newOverBottom;
+ // element is initially over bottom of within
+ } else if ( overBottom > 0 && overTop <= 0 ) {
+ position.top = withinOffset;
+ // element is initially over both top and bottom of within
+ } else {
+ if ( overTop > overBottom ) {
+ position.top = withinOffset + outerHeight - data.collisionHeight;
+ } else {
+ position.top = withinOffset;
+ }
+ }
+ // too far up -> align with top
+ } else if ( overTop > 0 ) {
+ position.top += overTop;
+ // too far down -> align with bottom edge
+ } else if ( overBottom > 0 ) {
+ position.top -= overBottom;
+ // adjust based on position and margin
+ } else {
+ position.top = max( position.top - collisionPosTop, position.top );
+ }
+ }
+ },
+ flip: {
+ left: function( position, data ) {
+ var within = data.within,
+ withinOffset = within.offset.left + within.scrollLeft,
+ outerWidth = within.width,
+ offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
+ collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+ overLeft = collisionPosLeft - offsetLeft,
+ overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
+ myOffset = data.my[ 0 ] === "left" ?
+ -data.elemWidth :
+ data.my[ 0 ] === "right" ?
+ data.elemWidth :
+ 0,
+ atOffset = data.at[ 0 ] === "left" ?
+ data.targetWidth :
+ data.at[ 0 ] === "right" ?
+ -data.targetWidth :
+ 0,
+ offset = -2 * data.offset[ 0 ],
+ newOverRight,
+ newOverLeft;
+
+ if ( overLeft < 0 ) {
+ newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset;
+ if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) {
+ position.left += myOffset + atOffset + offset;
+ }
+ }
+ else if ( overRight > 0 ) {
+ newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft;
+ if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) {
+ position.left += myOffset + atOffset + offset;
+ }
+ }
+ },
+ top: function( position, data ) {
+ var within = data.within,
+ withinOffset = within.offset.top + within.scrollTop,
+ outerHeight = within.height,
+ offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
+ collisionPosTop = position.top - data.collisionPosition.marginTop,
+ overTop = collisionPosTop - offsetTop,
+ overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
+ top = data.my[ 1 ] === "top",
+ myOffset = top ?
+ -data.elemHeight :
+ data.my[ 1 ] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[ 1 ] === "top" ?
+ data.targetHeight :
+ data.at[ 1 ] === "bottom" ?
+ -data.targetHeight :
+ 0,
+ offset = -2 * data.offset[ 1 ],
+ newOverTop,
+ newOverBottom;
+ if ( overTop < 0 ) {
+ newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset;
+ if ( ( position.top + myOffset + atOffset + offset) > overTop && ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) ) {
+ position.top += myOffset + atOffset + offset;
+ }
+ }
+ else if ( overBottom > 0 ) {
+ newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop;
+ if ( ( position.top + myOffset + atOffset + offset) > overBottom && ( newOverTop > 0 || abs( newOverTop ) < overBottom ) ) {
+ position.top += myOffset + atOffset + offset;
+ }
+ }
+ }
+ },
+ flipfit: {
+ left: function() {
+ $.ui.position.flip.left.apply( this, arguments );
+ $.ui.position.fit.left.apply( this, arguments );
+ },
+ top: function() {
+ $.ui.position.flip.top.apply( this, arguments );
+ $.ui.position.fit.top.apply( this, arguments );
+ }
+ }
+};
+
+// fraction support test
+(function () {
+ var testElement, testElementParent, testElementStyle, offsetLeft, i,
+ body = document.getElementsByTagName( "body" )[ 0 ],
+ div = document.createElement( "div" );
+
+ //Create a "fake body" for testing based on method used in jQuery.support
+ testElement = document.createElement( body ? "div" : "body" );
+ testElementStyle = {
+ visibility: "hidden",
+ width: 0,
+ height: 0,
+ border: 0,
+ margin: 0,
+ background: "none"
+ };
+ if ( body ) {
+ $.extend( testElementStyle, {
+ position: "absolute",
+ left: "-1000px",
+ top: "-1000px"
+ });
+ }
+ for ( i in testElementStyle ) {
+ testElement.style[ i ] = testElementStyle[ i ];
+ }
+ testElement.appendChild( div );
+ testElementParent = body || document.documentElement;
+ testElementParent.insertBefore( testElement, testElementParent.firstChild );
+
+ div.style.cssText = "position: absolute; left: 10.7432222px;";
+
+ offsetLeft = $( div ).offset().left;
+ $.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11;
+
+ testElement.innerHTML = "";
+ testElementParent.removeChild( testElement );
+})();
+
+}( jQuery ) );
+(function( $, undefined ) {
+
+var uid = 0,
+ hideProps = {},
+ showProps = {};
+
+hideProps.height = hideProps.paddingTop = hideProps.paddingBottom =
+ hideProps.borderTopWidth = hideProps.borderBottomWidth = "hide";
+showProps.height = showProps.paddingTop = showProps.paddingBottom =
+ showProps.borderTopWidth = showProps.borderBottomWidth = "show";
+
+$.widget( "ui.accordion", {
+ version: "1.10.0",
+ options: {
+ active: 0,
+ animate: {},
+ collapsible: false,
+ event: "click",
+ header: "> li > :first-child,> :not(li):even",
+ heightStyle: "auto",
+ icons: {
+ activeHeader: "ui-icon-triangle-1-s",
+ header: "ui-icon-triangle-1-e"
+ },
+
+ // callbacks
+ activate: null,
+ beforeActivate: null
+ },
+
+ _create: function() {
+ var options = this.options;
+ this.prevShow = this.prevHide = $();
+ this.element.addClass( "ui-accordion ui-widget ui-helper-reset" )
+ // ARIA
+ .attr( "role", "tablist" );
+
+ // don't allow collapsible: false and active: false / null
+ if ( !options.collapsible && (options.active === false || options.active == null) ) {
+ options.active = 0;
+ }
+
+ this._processPanels();
+ // handle negative values
+ if ( options.active < 0 ) {
+ options.active += this.headers.length;
+ }
+ this._refresh();
+ },
+
+ _getCreateEventData: function() {
+ return {
+ header: this.active,
+ content: !this.active.length ? $() : this.active.next()
+ };
+ },
+
+ _createIcons: function() {
+ var icons = this.options.icons;
+ if ( icons ) {
+ $( "<span>" )
+ .addClass( "ui-accordion-header-icon ui-icon " + icons.header )
+ .prependTo( this.headers );
+ this.active.children( ".ui-accordion-header-icon" )
+ .removeClass( icons.header )
+ .addClass( icons.activeHeader );
+ this.headers.addClass( "ui-accordion-icons" );
+ }
+ },
+
+ _destroyIcons: function() {
+ this.headers
+ .removeClass( "ui-accordion-icons" )
+ .children( ".ui-accordion-header-icon" )
+ .remove();
+ },
+
+ _destroy: function() {
+ var contents;
+
+ // clean up main element
+ this.element
+ .removeClass( "ui-accordion ui-widget ui-helper-reset" )
+ .removeAttr( "role" );
+
+ // clean up headers
+ this.headers
+ .removeClass( "ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-selected" )
+ .removeAttr( "aria-controls" )
+ .removeAttr( "tabIndex" )
+ .each(function() {
+ if ( /^ui-accordion/.test( this.id ) ) {
+ this.removeAttribute( "id" );
+ }
+ });
+ this._destroyIcons();
+
+ // clean up content panels
+ contents = this.headers.next()
+ .css( "display", "" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "aria-hidden" )
+ .removeAttr( "aria-labelledby" )
+ .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled" )
+ .each(function() {
+ if ( /^ui-accordion/.test( this.id ) ) {
+ this.removeAttribute( "id" );
+ }
+ });
+ if ( this.options.heightStyle !== "content" ) {
+ contents.css( "height", "" );
+ }
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "active" ) {
+ // _activate() will handle invalid values and update this.options
+ this._activate( value );
+ return;
+ }
+
+ if ( key === "event" ) {
+ if ( this.options.event ) {
+ this._off( this.headers, this.options.event );
+ }
+ this._setupEvents( value );
+ }
+
+ this._super( key, value );
+
+ // setting collapsible: false while collapsed; open first panel
+ if ( key === "collapsible" && !value && this.options.active === false ) {
+ this._activate( 0 );
+ }
+
+ if ( key === "icons" ) {
+ this._destroyIcons();
+ if ( value ) {
+ this._createIcons();
+ }
+ }
+
+ // #5332 - opacity doesn't cascade to positioned elements in IE
+ // so we need to add the disabled class to the headers and panels
+ if ( key === "disabled" ) {
+ this.headers.add( this.headers.next() )
+ .toggleClass( "ui-state-disabled", !!value );
+ }
+ },
+
+ _keydown: function( event ) {
+ /*jshint maxcomplexity:15*/
+ if ( event.altKey || event.ctrlKey ) {
+ return;
+ }
+
+ var keyCode = $.ui.keyCode,
+ length = this.headers.length,
+ currentIndex = this.headers.index( event.target ),
+ toFocus = false;
+
+ switch ( event.keyCode ) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._eventHandler( event );
+ break;
+ case keyCode.HOME:
+ toFocus = this.headers[ 0 ];
+ break;
+ case keyCode.END:
+ toFocus = this.headers[ length - 1 ];
+ break;
+ }
+
+ if ( toFocus ) {
+ $( event.target ).attr( "tabIndex", -1 );
+ $( toFocus ).attr( "tabIndex", 0 );
+ toFocus.focus();
+ event.preventDefault();
+ }
+ },
+
+ _panelKeyDown : function( event ) {
+ if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) {
+ $( event.currentTarget ).prev().focus();
+ }
+ },
+
+ refresh: function() {
+ var options = this.options;
+ this._processPanels();
+
+ // was collapsed or no panel
+ if ( ( options.active === false && options.collapsible === true ) || !this.headers.length ) {
+ options.active = false;
+ this.active = $();
+ // active false only when collapsible is true
+ } if ( options.active === false ) {
+ this._activate( 0 );
+ // was active, but active panel is gone
+ } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
+ // all remaining panel are disabled
+ if ( this.headers.length === this.headers.find(".ui-state-disabled").length ) {
+ options.active = false;
+ this.active = $();
+ // activate previous panel
+ } else {
+ this._activate( Math.max( 0, options.active - 1 ) );
+ }
+ // was active, active panel still exists
+ } else {
+ // make sure active index is correct
+ options.active = this.headers.index( this.active );
+ }
+
+ this._destroyIcons();
+
+ this._refresh();
+ },
+
+ _processPanels: function() {
+ this.headers = this.element.find( this.options.header )
+ .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" );
+
+ this.headers.next()
+ .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" )
+ .filter(":not(.ui-accordion-content-active)")
+ .hide();
+ },
+
+ _refresh: function() {
+ var maxHeight,
+ options = this.options,
+ heightStyle = options.heightStyle,
+ parent = this.element.parent(),
+ accordionId = this.accordionId = "ui-accordion-" +
+ (this.element.attr( "id" ) || ++uid);
+
+ this.active = this._findActive( options.active )
+ .addClass( "ui-accordion-header-active ui-state-active" )
+ .toggleClass( "ui-corner-all ui-corner-top" );
+ this.active.next()
+ .addClass( "ui-accordion-content-active" )
+ .show();
+
+ this.headers
+ .attr( "role", "tab" )
+ .each(function( i ) {
+ var header = $( this ),
+ headerId = header.attr( "id" ),
+ panel = header.next(),
+ panelId = panel.attr( "id" );
+ if ( !headerId ) {
+ headerId = accordionId + "-header-" + i;
+ header.attr( "id", headerId );
+ }
+ if ( !panelId ) {
+ panelId = accordionId + "-panel-" + i;
+ panel.attr( "id", panelId );
+ }
+ header.attr( "aria-controls", panelId );
+ panel.attr( "aria-labelledby", headerId );
+ })
+ .next()
+ .attr( "role", "tabpanel" );
+
+ this.headers
+ .not( this.active )
+ .attr({
+ "aria-selected": "false",
+ tabIndex: -1
+ })
+ .next()
+ .attr({
+ "aria-expanded": "false",
+ "aria-hidden": "true"
+ })
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if ( !this.active.length ) {
+ this.headers.eq( 0 ).attr( "tabIndex", 0 );
+ } else {
+ this.active.attr({
+ "aria-selected": "true",
+ tabIndex: 0
+ })
+ .next()
+ .attr({
+ "aria-expanded": "true",
+ "aria-hidden": "false"
+ });
+ }
+
+ this._createIcons();
+
+ this._setupEvents( options.event );
+
+ if ( heightStyle === "fill" ) {
+ maxHeight = parent.height();
+ this.element.siblings( ":visible" ).each(function() {
+ var elem = $( this ),
+ position = elem.css( "position" );
+
+ if ( position === "absolute" || position === "fixed" ) {
+ return;
+ }
+ maxHeight -= elem.outerHeight( true );
+ });
+
+ this.headers.each(function() {
+ maxHeight -= $( this ).outerHeight( true );
+ });
+
+ this.headers.next()
+ .each(function() {
+ $( this ).height( Math.max( 0, maxHeight -
+ $( this ).innerHeight() + $( this ).height() ) );
+ })
+ .css( "overflow", "auto" );
+ } else if ( heightStyle === "auto" ) {
+ maxHeight = 0;
+ this.headers.next()
+ .each(function() {
+ maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() );
+ })
+ .height( maxHeight );
+ }
+ },
+
+ _activate: function( index ) {
+ var active = this._findActive( index )[ 0 ];
+
+ // trying to activate the already active panel
+ if ( active === this.active[ 0 ] ) {
+ return;
+ }
+
+ // trying to collapse, simulate a click on the currently active header
+ active = active || this.active[ 0 ];
+
+ this._eventHandler({
+ target: active,
+ currentTarget: active,
+ preventDefault: $.noop
+ });
+ },
+
+ _findActive: function( selector ) {
+ return typeof selector === "number" ? this.headers.eq( selector ) : $();
+ },
+
+ _setupEvents: function( event ) {
+ var events = {
+ keydown: "_keydown"
+ };
+ if ( event ) {
+ $.each( event.split(" "), function( index, eventName ) {
+ events[ eventName ] = "_eventHandler";
+ });
+ }
+
+ this._off( this.headers.add( this.headers.next() ) );
+ this._on( this.headers, events );
+ this._on( this.headers.next(), { keydown: "_panelKeyDown" });
+ this._hoverable( this.headers );
+ this._focusable( this.headers );
+ },
+
+ _eventHandler: function( event ) {
+ var options = this.options,
+ active = this.active,
+ clicked = $( event.currentTarget ),
+ clickedIsActive = clicked[ 0 ] === active[ 0 ],
+ collapsing = clickedIsActive && options.collapsible,
+ toShow = collapsing ? $() : clicked.next(),
+ toHide = active.next(),
+ eventData = {
+ oldHeader: active,
+ oldPanel: toHide,
+ newHeader: collapsing ? $() : clicked,
+ newPanel: toShow
+ };
+
+ event.preventDefault();
+
+ if (
+ // click on active header, but not collapsible
+ ( clickedIsActive && !options.collapsible ) ||
+ // allow canceling activation
+ ( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+ return;
+ }
+
+ options.active = collapsing ? false : this.headers.index( clicked );
+
+ // when the call to ._toggle() comes after the class changes
+ // it causes a very odd bug in IE 8 (see #6720)
+ this.active = clickedIsActive ? $() : clicked;
+ this._toggle( eventData );
+
+ // switch classes
+ // corner classes on the previously active header stay after the animation
+ active.removeClass( "ui-accordion-header-active ui-state-active" );
+ if ( options.icons ) {
+ active.children( ".ui-accordion-header-icon" )
+ .removeClass( options.icons.activeHeader )
+ .addClass( options.icons.header );
+ }
+
+ if ( !clickedIsActive ) {
+ clicked
+ .removeClass( "ui-corner-all" )
+ .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" );
+ if ( options.icons ) {
+ clicked.children( ".ui-accordion-header-icon" )
+ .removeClass( options.icons.header )
+ .addClass( options.icons.activeHeader );
+ }
+
+ clicked
+ .next()
+ .addClass( "ui-accordion-content-active" );
+ }
+ },
+
+ _toggle: function( data ) {
+ var toShow = data.newPanel,
+ toHide = this.prevShow.length ? this.prevShow : data.oldPanel;
+
+ // handle activating a panel during the animation for another activation
+ this.prevShow.add( this.prevHide ).stop( true, true );
+ this.prevShow = toShow;
+ this.prevHide = toHide;
+
+ if ( this.options.animate ) {
+ this._animate( toShow, toHide, data );
+ } else {
+ toHide.hide();
+ toShow.show();
+ this._toggleComplete( data );
+ }
+
+ toHide.attr({
+ "aria-expanded": "false",
+ "aria-hidden": "true"
+ });
+ toHide.prev().attr( "aria-selected", "false" );
+ // if we're switching panels, remove the old header from the tab order
+ // if we're opening from collapsed state, remove the previous header from the tab order
+ // if we're collapsing, then keep the collapsing header in the tab order
+ if ( toShow.length && toHide.length ) {
+ toHide.prev().attr( "tabIndex", -1 );
+ } else if ( toShow.length ) {
+ this.headers.filter(function() {
+ return $( this ).attr( "tabIndex" ) === 0;
+ })
+ .attr( "tabIndex", -1 );
+ }
+
+ toShow
+ .attr({
+ "aria-expanded": "true",
+ "aria-hidden": "false"
+ })
+ .prev()
+ .attr({
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ },
+
+ _animate: function( toShow, toHide, data ) {
+ var total, easing, duration,
+ that = this,
+ adjust = 0,
+ down = toShow.length &&
+ ( !toHide.length || ( toShow.index() < toHide.index() ) ),
+ animate = this.options.animate || {},
+ options = down && animate.down || animate,
+ complete = function() {
+ that._toggleComplete( data );
+ };
+
+ if ( typeof options === "number" ) {
+ duration = options;
+ }
+ if ( typeof options === "string" ) {
+ easing = options;
+ }
+ // fall back from options to animation in case of partial down settings
+ easing = easing || options.easing || animate.easing;
+ duration = duration || options.duration || animate.duration;
+
+ if ( !toHide.length ) {
+ return toShow.animate( showProps, duration, easing, complete );
+ }
+ if ( !toShow.length ) {
+ return toHide.animate( hideProps, duration, easing, complete );
+ }
+
+ total = toShow.show().outerHeight();
+ toHide.animate( hideProps, {
+ duration: duration,
+ easing: easing,
+ step: function( now, fx ) {
+ fx.now = Math.round( now );
+ }
+ });
+ toShow
+ .hide()
+ .animate( showProps, {
+ duration: duration,
+ easing: easing,
+ complete: complete,
+ step: function( now, fx ) {
+ fx.now = Math.round( now );
+ if ( fx.prop !== "height" ) {
+ adjust += fx.now;
+ } else if ( that.options.heightStyle !== "content" ) {
+ fx.now = Math.round( total - toHide.outerHeight() - adjust );
+ adjust = 0;
+ }
+ }
+ });
+ },
+
+ _toggleComplete: function( data ) {
+ var toHide = data.oldPanel;
+
+ toHide
+ .removeClass( "ui-accordion-content-active" )
+ .prev()
+ .removeClass( "ui-corner-top" )
+ .addClass( "ui-corner-all" );
+
+ // Work around for rendering bug in IE (#5421)
+ if ( toHide.length ) {
+ toHide.parent()[0].className = toHide.parent()[0].className;
+ }
+
+ this._trigger( "activate", null, data );
+ }
+});
+
+})( jQuery );
+(function( $, undefined ) {
+
+// used to prevent race conditions with remote data sources
+var requestIndex = 0;
+
+$.widget( "ui.autocomplete", {
+ version: "1.10.0",
+ defaultElement: "<input>",
+ options: {
+ appendTo: null,
+ autoFocus: false,
+ delay: 300,
+ minLength: 1,
+ position: {
+ my: "left top",
+ at: "left bottom",
+ collision: "none"
+ },
+ source: null,
+
+ // callbacks
+ change: null,
+ close: null,
+ focus: null,
+ open: null,
+ response: null,
+ search: null,
+ select: null
+ },
+
+ pending: 0,
+
+ _create: function() {
+ // Some browsers only repeat keydown events, not keypress events,
+ // so we use the suppressKeyPress flag to determine if we've already
+ // handled the keydown event. #7269
+ // Unfortunately the code for & in keypress is the same as the up arrow,
+ // so we use the suppressKeyPressRepeat flag to avoid handling keypress
+ // events when we know the keydown event was used to modify the
+ // search term. #7799
+ var suppressKeyPress, suppressKeyPressRepeat, suppressInput;
+
+ this.isMultiLine = this._isMultiLine();
+ this.valueMethod = this.element[ this.element.is( "input,textarea" ) ? "val" : "text" ];
+ this.isNewMenu = true;
+
+ this.element
+ .addClass( "ui-autocomplete-input" )
+ .attr( "autocomplete", "off" );
+
+ this._on( this.element, {
+ keydown: function( event ) {
+ /*jshint maxcomplexity:15*/
+ if ( this.element.prop( "readOnly" ) ) {
+ suppressKeyPress = true;
+ suppressInput = true;
+ suppressKeyPressRepeat = true;
+ return;
+ }
+
+ suppressKeyPress = false;
+ suppressInput = false;
+ suppressKeyPressRepeat = false;
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ suppressKeyPress = true;
+ this._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ suppressKeyPress = true;
+ this._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ suppressKeyPress = true;
+ this._keyEvent( "previous", event );
+ break;
+ case keyCode.DOWN:
+ suppressKeyPress = true;
+ this._keyEvent( "next", event );
+ break;
+ case keyCode.ENTER:
+ case keyCode.NUMPAD_ENTER:
+ // when menu is open and has focus
+ if ( this.menu.active ) {
+ // #6055 - Opera still allows the keypress to occur
+ // which causes forms to submit
+ suppressKeyPress = true;
+ event.preventDefault();
+ this.menu.select( event );
+ }
+ break;
+ case keyCode.TAB:
+ if ( this.menu.active ) {
+ this.menu.select( event );
+ }
+ break;
+ case keyCode.ESCAPE:
+ if ( this.menu.element.is( ":visible" ) ) {
+ this._value( this.term );
+ this.close( event );
+ // Different browsers have different default behavior for escape
+ // Single press can mean undo or clear
+ // Double press in IE means clear the whole form
+ event.preventDefault();
+ }
+ break;
+ default:
+ suppressKeyPressRepeat = true;
+ // search timeout should be triggered before the input value is changed
+ this._searchTimeout( event );
+ break;
+ }
+ },
+ keypress: function( event ) {
+ if ( suppressKeyPress ) {
+ suppressKeyPress = false;
+ event.preventDefault();
+ return;
+ }
+ if ( suppressKeyPressRepeat ) {
+ return;
+ }
+
+ // replicate some key handlers to allow them to repeat in Firefox and Opera
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ this._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ this._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ this._keyEvent( "previous", event );
+ break;
+ case keyCode.DOWN:
+ this._keyEvent( "next", event );
+ break;
+ }
+ },
+ input: function( event ) {
+ if ( suppressInput ) {
+ suppressInput = false;
+ event.preventDefault();
+ return;
+ }
+ this._searchTimeout( event );
+ },
+ focus: function() {
+ this.selectedItem = null;
+ this.previous = this._value();
+ },
+ blur: function( event ) {
+ if ( this.cancelBlur ) {
+ delete this.cancelBlur;
+ return;
+ }
+
+ clearTimeout( this.searching );
+ this.close( event );
+ this._change( event );
+ }
+ });
+
+ this._initSource();
+ this.menu = $( "<ul>" )
+ .addClass( "ui-autocomplete" )
+ .appendTo( this._appendTo() )
+ .menu({
+ // custom key handling for now
+ input: $(),
+ // disable ARIA support, the live region takes care of that
+ role: null
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ .hide()
+ .data( "ui-menu" );
+
+ this._on( this.menu.element, {
+ mousedown: function( event ) {
+ // prevent moving focus out of the text field
+ event.preventDefault();
+
+ // IE doesn't prevent moving focus even with event.preventDefault()
+ // so we set a flag to know when we should ignore the blur event
+ this.cancelBlur = true;
+ this._delay(function() {
+ delete this.cancelBlur;
+ });
+
+ // clicking on the scrollbar causes focus to shift to the body
+ // but we can't detect a mouseup or a click immediately afterward
+ // so we have to track the next mousedown and close the menu if
+ // the user clicks somewhere outside of the autocomplete
+ var menuElement = this.menu.element[ 0 ];
+ if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
+ this._delay(function() {
+ var that = this;
+ this.document.one( "mousedown", function( event ) {
+ if ( event.target !== that.element[ 0 ] &&
+ event.target !== menuElement &&
+ !$.contains( menuElement, event.target ) ) {
+ that.close();
+ }
+ });
+ });
+ }
+ },
+ menufocus: function( event, ui ) {
+ // #7024 - Prevent accidental activation of menu items in Firefox
+ if ( this.isNewMenu ) {
+ this.isNewMenu = false;
+ if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) {
+ this.menu.blur();
+
+ this.document.one( "mousemove", function() {
+ $( event.target ).trigger( event.originalEvent );
+ });
+
+ return;
+ }
+ }
+
+ var item = ui.item.data( "ui-autocomplete-item" );
+ if ( false !== this._trigger( "focus", event, { item: item } ) ) {
+ // use value to match what will end up in the input, if it was a key event
+ if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) {
+ this._value( item.value );
+ }
+ } else {
+ // Normally the input is populated with the item's value as the
+ // menu is navigated, causing screen readers to notice a change and
+ // announce the item. Since the focus event was canceled, this doesn't
+ // happen, so we update the live region so that screen readers can
+ // still notice the change and announce it.
+ this.liveRegion.text( item.value );
+ }
+ },
+ menuselect: function( event, ui ) {
+ var item = ui.item.data( "ui-autocomplete-item" ),
+ previous = this.previous;
+
+ // only trigger when focus was lost (click on menu)
+ if ( this.element[0] !== this.document[0].activeElement ) {
+ this.element.focus();
+ this.previous = previous;
+ // #6109 - IE triggers two focus events and the second
+ // is asynchronous, so we need to reset the previous
+ // term synchronously and asynchronously :-(
+ this._delay(function() {
+ this.previous = previous;
+ this.selectedItem = item;
+ });
+ }
+
+ if ( false !== this._trigger( "select", event, { item: item } ) ) {
+ this._value( item.value );
+ }
+ // reset the term after the select event
+ // this allows custom select handling to work properly
+ this.term = this._value();
+
+ this.close( event );
+ this.selectedItem = item;
+ }
+ });
+
+ this.liveRegion = $( "<span>", {
+ role: "status",
+ "aria-live": "polite"
+ })
+ .addClass( "ui-helper-hidden-accessible" )
+ .insertAfter( this.element );
+
+ // turning off autocomplete prevents the browser from remembering the
+ // value when navigating through history, so we re-enable autocomplete
+ // if the page is unloaded before the widget is destroyed. #7790
+ this._on( this.window, {
+ beforeunload: function() {
+ this.element.removeAttr( "autocomplete" );
+ }
+ });
+ },
+
+ _destroy: function() {
+ clearTimeout( this.searching );
+ this.element
+ .removeClass( "ui-autocomplete-input" )
+ .removeAttr( "autocomplete" );
+ this.menu.element.remove();
+ this.liveRegion.remove();
+ },
+
+ _setOption: function( key, value ) {
+ this._super( key, value );
+ if ( key === "source" ) {
+ this._initSource();
+ }
+ if ( key === "appendTo" ) {
+ this.menu.element.appendTo( this._appendTo() );
+ }
+ if ( key === "disabled" && value && this.xhr ) {
+ this.xhr.abort();
+ }
+ },
+
+ _appendTo: function() {
+ var element = this.options.appendTo;
+
+ if ( element ) {
+ element = element.jquery || element.nodeType ?
+ $( element ) :
+ this.document.find( element ).eq( 0 );
+ }
+
+ if ( !element ) {
+ element = this.element.closest( ".ui-front" );
+ }
+
+ if ( !element.length ) {
+ element = this.document[0].body;
+ }
+
+ return element;
+ },
+
+ _isMultiLine: function() {
+ // Textareas are always multi-line
+ if ( this.element.is( "textarea" ) ) {
+ return true;
+ }
+ // Inputs are always single-line, even if inside a contentEditable element
+ // IE also treats inputs as contentEditable
+ if ( this.element.is( "input" ) ) {
+ return false;
+ }
+ // All other element types are determined by whether or not they're contentEditable
+ return this.element.prop( "isContentEditable" );
+ },
+
+ _initSource: function() {
+ var array, url,
+ that = this;
+ if ( $.isArray(this.options.source) ) {
+ array = this.options.source;
+ this.source = function( request, response ) {
+ response( $.ui.autocomplete.filter( array, request.term ) );
+ };
+ } else if ( typeof this.options.source === "string" ) {
+ url = this.options.source;
+ this.source = function( request, response ) {
+ if ( that.xhr ) {
+ that.xhr.abort();
+ }
+ that.xhr = $.ajax({
+ url: url,
+ data: request,
+ dataType: "json",
+ success: function( data ) {
+ response( data );
+ },
+ error: function() {
+ response( [] );
+ }
+ });
+ };
+ } else {
+ this.source = this.options.source;
+ }
+ },
+
+ _searchTimeout: function( event ) {
+ clearTimeout( this.searching );
+ this.searching = this._delay(function() {
+ // only search if the value has changed
+ if ( this.term !== this._value() ) {
+ this.selectedItem = null;
+ this.search( null, event );
+ }
+ }, this.options.delay );
+ },
+
+ search: function( value, event ) {
+ value = value != null ? value : this._value();
+
+ // always save the actual value, not the one passed as an argument
+ this.term = this._value();
+
+ if ( value.length < this.options.minLength ) {
+ return this.close( event );
+ }
+
+ if ( this._trigger( "search", event ) === false ) {
+ return;
+ }
+
+ return this._search( value );
+ },
+
+ _search: function( value ) {
+ this.pending++;
+ this.element.addClass( "ui-autocomplete-loading" );
+ this.cancelSearch = false;
+
+ this.source( { term: value }, this._response() );
+ },
+
+ _response: function() {
+ var that = this,
+ index = ++requestIndex;
+
+ return function( content ) {
+ if ( index === requestIndex ) {
+ that.__response( content );
+ }
+
+ that.pending--;
+ if ( !that.pending ) {
+ that.element.removeClass( "ui-autocomplete-loading" );
+ }
+ };
+ },
+
+ __response: function( content ) {
+ if ( content ) {
+ content = this._normalize( content );
+ }
+ this._trigger( "response", null, { content: content } );
+ if ( !this.options.disabled && content && content.length && !this.cancelSearch ) {
+ this._suggest( content );
+ this._trigger( "open" );
+ } else {
+ // use ._close() instead of .close() so we don't cancel future searches
+ this._close();
+ }
+ },
+
+ close: function( event ) {
+ this.cancelSearch = true;
+ this._close( event );
+ },
+
+ _close: function( event ) {
+ if ( this.menu.element.is( ":visible" ) ) {
+ this.menu.element.hide();
+ this.menu.blur();
+ this.isNewMenu = true;
+ this._trigger( "close", event );
+ }
+ },
+
+ _change: function( event ) {
+ if ( this.previous !== this._value() ) {
+ this._trigger( "change", event, { item: this.selectedItem } );
+ }
+ },
+
+ _normalize: function( items ) {
+ // assume all items have the right format when the first item is complete
+ if ( items.length && items[0].label && items[0].value ) {
+ return items;
+ }
+ return $.map( items, function( item ) {
+ if ( typeof item === "string" ) {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({
+ label: item.label || item.value,
+ value: item.value || item.label
+ }, item );
+ });
+ },
+
+ _suggest: function( items ) {
+ var ul = this.menu.element
+ .empty()
+ .zIndex( this.element.zIndex() + 1 );
+ this._renderMenu( ul, items );
+ this.menu.refresh();
+
+ // size and position menu
+ ul.show();
+ this._resizeMenu();
+ ul.position( $.extend({
+ of: this.element
+ }, this.options.position ));
+
+ if ( this.options.autoFocus ) {
+ this.menu.next();
+ }
+ },
+
+ _resizeMenu: function() {
+ var ul = this.menu.element;
+ ul.outerWidth( Math.max(
+ // Firefox wraps long text (possibly a rounding bug)
+ // so we add 1px to avoid the wrapping (#7513)
+ ul.width( "" ).outerWidth() + 1,
+ this.element.outerWidth()
+ ) );
+ },
+
+ _renderMenu: function( ul, items ) {
+ var that = this;
+ $.each( items, function( index, item ) {
+ that._renderItemData( ul, item );
+ });
+ },
+
+ _renderItemData: function( ul, item ) {
+ return this._renderItem( ul, item ).data( "ui-autocomplete-item", item );
+ },
+
+ _renderItem: function( ul, item ) {
+ return $( "<li>" )
+ .append( $( "<a>" ).text( item.label ) )
+ .appendTo( ul );
+ },
+
+ _move: function( direction, event ) {
+ if ( !this.menu.element.is( ":visible" ) ) {
+ this.search( null, event );
+ return;
+ }
+ if ( this.menu.isFirstItem() && /^previous/.test( direction ) ||
+ this.menu.isLastItem() && /^next/.test( direction ) ) {
+ this._value( this.term );
+ this.menu.blur();
+ return;
+ }
+ this.menu[ direction ]( event );
+ },
+
+ widget: function() {
+ return this.menu.element;
+ },
+
+ _value: function() {
+ return this.valueMethod.apply( this.element, arguments );
+ },
+
+ _keyEvent: function( keyEvent, event ) {
+ if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
+ this._move( keyEvent, event );
+
+ // prevents moving cursor to beginning/end of the text field in some browsers
+ event.preventDefault();
+ }
+ }
+});
+
+$.extend( $.ui.autocomplete, {
+ escapeRegex: function( value ) {
+ return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&");
+ },
+ filter: function(array, term) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+ return $.grep( array, function(value) {
+ return matcher.test( value.label || value.value || value );
+ });
+ }
+});
+
+
+// live region extension, adding a `messages` option
+// NOTE: This is an experimental API. We are still investigating
+// a full solution for string manipulation and internationalization.
+$.widget( "ui.autocomplete", $.ui.autocomplete, {
+ options: {
+ messages: {
+ noResults: "No search results.",
+ results: function( amount ) {
+ return amount + ( amount > 1 ? " results are" : " result is" ) +
+ " available, use up and down arrow keys to navigate.";
+ }
+ }
+ },
+
+ __response: function( content ) {
+ var message;
+ this._superApply( arguments );
+ if ( this.options.disabled || this.cancelSearch ) {
+ return;
+ }
+ if ( content && content.length ) {
+ message = this.options.messages.results( content.length );
+ } else {
+ message = this.options.messages.noResults;
+ }
+ this.liveRegion.text( message );
+ }
+});
+
+}( jQuery ));
+(function( $, undefined ) {
+
+var lastActive, startXPos, startYPos, clickDragged,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ stateClasses = "ui-state-hover ui-state-active ",
+ typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
+ formResetHandler = function() {
+ var buttons = $( this ).find( ":ui-button" );
+ setTimeout(function() {
+ buttons.button( "refresh" );
+ }, 1 );
+ },
+ radioGroup = function( radio ) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $( [] );
+ if ( name ) {
+ name = name.replace( /'/g, "\\'" );
+ if ( form ) {
+ radios = $( form ).find( "[name='" + name + "']" );
+ } else {
+ radios = $( "[name='" + name + "']", radio.ownerDocument )
+ .filter(function() {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
+
+$.widget( "ui.button", {
+ version: "1.10.0",
+ defaultElement: "<button>",
+ options: {
+ disabled: null,
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function() {
+ this.element.closest( "form" )
+ .unbind( "reset" + this.eventNamespace )
+ .bind( "reset" + this.eventNamespace, formResetHandler );
+
+ if ( typeof this.options.disabled !== "boolean" ) {
+ this.options.disabled = !!this.element.prop( "disabled" );
+ } else {
+ this.element.prop( "disabled", this.options.disabled );
+ }
+
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr( "title" );
+
+ var that = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ activeClass = !toggleButton ? "ui-state-active" : "",
+ focusClass = "ui-state-focus";
+
+ if ( options.label === null ) {
+ options.label = (this.type === "input" ? this.buttonElement.val() : this.buttonElement.html());
+ }
+
+ this._hoverable( this.buttonElement );
+
+ this.buttonElement
+ .addClass( baseClasses )
+ .attr( "role", "button" )
+ .bind( "mouseenter" + this.eventNamespace, function() {
+ if ( options.disabled ) {
+ return;
+ }
+ if ( this === lastActive ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "mouseleave" + this.eventNamespace, function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( activeClass );
+ })
+ .bind( "click" + this.eventNamespace, function( event ) {
+ if ( options.disabled ) {
+ event.preventDefault();
+ event.stopImmediatePropagation();
+ }
+ });
+
+ this.element
+ .bind( "focus" + this.eventNamespace, function() {
+ // no need to check disabled, focus won't be triggered anyway
+ that.buttonElement.addClass( focusClass );
+ })
+ .bind( "blur" + this.eventNamespace, function() {
+ that.buttonElement.removeClass( focusClass );
+ });
+
+ if ( toggleButton ) {
+ this.element.bind( "change" + this.eventNamespace, function() {
+ if ( clickDragged ) {
+ return;
+ }
+ that.refresh();
+ });
+ // if mouse moves between mousedown and mouseup (drag) set clickDragged flag
+ // prevents issue where button state changes but checkbox/radio checked state
+ // does not in Firefox (see ticket #6970)
+ this.buttonElement
+ .bind( "mousedown" + this.eventNamespace, function( event ) {
+ if ( options.disabled ) {
+ return;
+ }
+ clickDragged = false;
+ startXPos = event.pageX;
+ startYPos = event.pageY;
+ })
+ .bind( "mouseup" + this.eventNamespace, function( event ) {
+ if ( options.disabled ) {
+ return;
+ }
+ if ( startXPos !== event.pageX || startYPos !== event.pageY ) {
+ clickDragged = true;
+ }
+ });
+ }
+
+ if ( this.type === "checkbox" ) {
+ this.buttonElement.bind( "click" + this.eventNamespace, function() {
+ if ( options.disabled || clickDragged ) {
+ return false;
+ }
+ });
+ } else if ( this.type === "radio" ) {
+ this.buttonElement.bind( "click" + this.eventNamespace, function() {
+ if ( options.disabled || clickDragged ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ that.buttonElement.attr( "aria-pressed", "true" );
+
+ var radio = that.element[ 0 ];
+ radioGroup( radio )
+ .not( radio )
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", "false" );
+ });
+ } else {
+ this.buttonElement
+ .bind( "mousedown" + this.eventNamespace, function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ lastActive = this;
+ that.document.one( "mouseup", function() {
+ lastActive = null;
+ });
+ })
+ .bind( "mouseup" + this.eventNamespace, function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).removeClass( "ui-state-active" );
+ })
+ .bind( "keydown" + this.eventNamespace, function(event) {
+ if ( options.disabled ) {
+ return false;
+ }
+ if ( event.keyCode === $.ui.keyCode.SPACE || event.keyCode === $.ui.keyCode.ENTER ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ // see #8559, we bind to blur here in case the button element loses
+ // focus between keydown and keyup, it would be left in an "active" state
+ .bind( "keyup" + this.eventNamespace + " blur" + this.eventNamespace, function() {
+ $( this ).removeClass( "ui-state-active" );
+ });
+
+ if ( this.buttonElement.is("a") ) {
+ this.buttonElement.keyup(function(event) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $( this ).click();
+ }
+ });
+ }
+ }
+
+ // TODO: pull out $.Widget's handling for the disabled option into
+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+ // be overridden by individual plugins
+ this._setOption( "disabled", options.disabled );
+ this._resetButton();
+ },
+
+ _determineButtonType: function() {
+ var ancestor, labelSelector, checked;
+
+ if ( this.element.is("[type=checkbox]") ) {
+ this.type = "checkbox";
+ } else if ( this.element.is("[type=radio]") ) {
+ this.type = "radio";
+ } else if ( this.element.is("input") ) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ ancestor = this.element.parents().last();
+ labelSelector = "label[for='" + this.element.attr("id") + "']";
+ this.buttonElement = ancestor.find( labelSelector );
+ if ( !this.buttonElement.length ) {
+ ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
+ this.buttonElement = ancestor.filter( labelSelector );
+ if ( !this.buttonElement.length ) {
+ this.buttonElement = ancestor.find( labelSelector );
+ }
+ }
+ this.element.addClass( "ui-helper-hidden-accessible" );
+
+ checked = this.element.is( ":checked" );
+ if ( checked ) {
+ this.buttonElement.addClass( "ui-state-active" );
+ }
+ this.buttonElement.prop( "aria-pressed", checked );
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
+
+ widget: function() {
+ return this.buttonElement;
+ },
+
+ _destroy: function() {
+ this.element
+ .removeClass( "ui-helper-hidden-accessible" );
+ this.buttonElement
+ .removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
+ .removeAttr( "role" )
+ .removeAttr( "aria-pressed" )
+ .html( this.buttonElement.find(".ui-button-text").html() );
+
+ if ( !this.hasTitle ) {
+ this.buttonElement.removeAttr( "title" );
+ }
+ },
+
+ _setOption: function( key, value ) {
+ this._super( key, value );
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.prop( "disabled", true );
+ } else {
+ this.element.prop( "disabled", false );
+ }
+ return;
+ }
+ this._resetButton();
+ },
+
+ refresh: function() {
+ //See #8237 & #8828
+ var isDisabled = this.element.is( "input, button" ) ? this.element.is( ":disabled" ) : this.element.hasClass( "ui-button-disabled" );
+
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOption( "disabled", isDisabled );
+ }
+ if ( this.type === "radio" ) {
+ radioGroup( this.element[0] ).each(function() {
+ if ( $( this ).is( ":checked" ) ) {
+ $( this ).button( "widget" )
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", "true" );
+ } else {
+ $( this ).button( "widget" )
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", "false" );
+ }
+ });
+ } else if ( this.type === "checkbox" ) {
+ if ( this.element.is( ":checked" ) ) {
+ this.buttonElement
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", "true" );
+ } else {
+ this.buttonElement
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", "false" );
+ }
+ }
+ },
+
+ _resetButton: function() {
+ if ( this.type === "input" ) {
+ if ( this.options.label ) {
+ this.element.val( this.options.label );
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement.removeClass( typeClasses ),
+ buttonText = $( "<span></span>", this.document[0] )
+ .addClass( "ui-button-text" )
+ .html( this.options.label )
+ .appendTo( buttonElement.empty() )
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary,
+ buttonClasses = [];
+
+ if ( icons.primary || icons.secondary ) {
+ if ( this.options.text ) {
+ buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
+ }
+
+ if ( icons.primary ) {
+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+ }
+
+ if ( icons.secondary ) {
+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+ }
+
+ if ( !this.options.text ) {
+ buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
+
+ if ( !this.hasTitle ) {
+ buttonElement.attr( "title", $.trim( buttonText ) );
+ }
+ }
+ } else {
+ buttonClasses.push( "ui-button-text-only" );
+ }
+ buttonElement.addClass( buttonClasses.join( " " ) );
+ }
+});
+
+$.widget( "ui.buttonset", {
+ version: "1.10.0",
+ options: {
+ items: "button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(ui-button)"
+ },
+
+ _create: function() {
+ this.element.addClass( "ui-buttonset" );
+ },
+
+ _init: function() {
+ this.refresh();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "disabled" ) {
+ this.buttons.button( "option", key, value );
+ }
+
+ this._super( key, value );
+ },
+
+ refresh: function() {
+ var rtl = this.element.css( "direction" ) === "rtl";
+
+ this.buttons = this.element.find( this.options.items )
+ .filter( ":ui-button" )
+ .button( "refresh" )
+ .end()
+ .not( ":ui-button" )
+ .button()
+ .end()
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+ .filter( ":first" )
+ .addClass( rtl ? "ui-corner-right" : "ui-corner-left" )
+ .end()
+ .filter( ":last" )
+ .addClass( rtl ? "ui-corner-left" : "ui-corner-right" )
+ .end()
+ .end();
+ },
+
+ _destroy: function() {
+ this.element.removeClass( "ui-buttonset" );
+ this.buttons
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-left ui-corner-right" )
+ .end()
+ .button( "destroy" );
+ }
+});
+
+}( jQuery ) );
+(function( $, undefined ) {
+
+$.extend($.ui, { datepicker: { version: "1.10.0" } });
+
+var PROP_NAME = "datepicker",
+ dpuuid = new Date().getTime(),
+ instActive;
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
+ this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
+ this._appendClass = "ui-datepicker-append"; // The name of the append marker class
+ this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
+ this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
+ this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
+ this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
+ this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
+ this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[""] = { // Default regional settings
+ closeText: "Done", // Display text for close link
+ prevText: "Prev", // Display text for previous month link
+ nextText: "Next", // Display text for next month link
+ currentText: "Today", // Display text for current month link
+ monthNames: ["January","February","March","April","May","June",
+ "July","August","September","October","November","December"], // Names of months for drop-down and formatting
+ monthNamesShort: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"], // For formatting
+ dayNames: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], // For formatting
+ dayNamesShort: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], // For formatting
+ dayNamesMin: ["Su","Mo","Tu","We","Th","Fr","Sa"], // Column headings for days starting at Sunday
+ weekHeader: "Wk", // Column header for week of the year
+ dateFormat: "mm/dd/yy", // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: "" // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: "focus", // "focus" for popup on focus,
+ // "button" for trigger button, or "both" for either
+ showAnim: "fadeIn", // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: "", // Display text following the input box, e.g. showing the format
+ buttonText: "...", // Text for trigger button
+ buttonImage: "", // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: "c-10:c+10", // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: "+10", // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with "+" for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: "fast", // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: "", // Selector for an alternate field to store selected dates into
+ altFormat: "", // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false, // True to size the input for the date format, false to leave as is
+ disabled: false // The initial disabled state
+ };
+ $.extend(this._defaults, this.regional[""]);
+ this.dpDiv = bindHover($("<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"));
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: "hasDatepicker",
+
+ //Keep track of the maximum number of rows displayed (see #7043)
+ maxRows: 4,
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ * @param settings object - the new settings to use as defaults (anonymous object)
+ * @return the manager object
+ */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param settings object - the new settings to use for this date picker instance (anonymous)
+ */
+ _attachDatepicker: function(target, settings) {
+ var nodeName, inline, inst;
+ nodeName = target.nodeName.toLowerCase();
+ inline = (nodeName === "div" || nodeName === "span");
+ if (!target.id) {
+ this.uuid += 1;
+ target.id = "dp" + this.uuid;
+ }
+ inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {});
+ if (nodeName === "input") {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g, "\\\\$1"); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ bindHover($("<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName)) {
+ return;
+ }
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp);
+ this._autoSize(inst);
+ $.data(target, PROP_NAME, inst);
+ //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
+ if( inst.settings.disabled ) {
+ this._disableDatepicker( target );
+ }
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function(input, inst) {
+ var showOn, buttonText, buttonImage,
+ appendText = this._get(inst, "appendText"),
+ isRTL = this._get(inst, "isRTL");
+
+ if (inst.append) {
+ inst.append.remove();
+ }
+ if (appendText) {
+ inst.append = $("<span class='" + this._appendClass + "'>" + appendText + "</span>");
+ input[isRTL ? "before" : "after"](inst.append);
+ }
+
+ input.unbind("focus", this._showDatepicker);
+
+ if (inst.trigger) {
+ inst.trigger.remove();
+ }
+
+ showOn = this._get(inst, "showOn");
+ if (showOn === "focus" || showOn === "both") { // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ }
+ if (showOn === "button" || showOn === "both") { // pop-up date picker when button clicked
+ buttonText = this._get(inst, "buttonText");
+ buttonImage = this._get(inst, "buttonImage");
+ inst.trigger = $(this._get(inst, "buttonImageOnly") ?
+ $("<img/>").addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $("<button type='button'></button>").addClass(this._triggerClass).
+ html(!buttonImage ? buttonText : $("<img/>").attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? "before" : "after"](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) {
+ $.datepicker._hideDatepicker();
+ } else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) {
+ $.datepicker._hideDatepicker();
+ $.datepicker._showDatepicker(input[0]);
+ } else {
+ $.datepicker._showDatepicker(input[0]);
+ }
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function(inst) {
+ if (this._get(inst, "autoSize") && !inst.inline) {
+ var findMax, max, maxI, i,
+ date = new Date(2009, 12 - 1, 20), // Ensure double digits
+ dateFormat = this._get(inst, "dateFormat");
+
+ if (dateFormat.match(/[DM]/)) {
+ findMax = function(names) {
+ max = 0;
+ maxI = 0;
+ for (i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ "monthNames" : "monthNamesShort"))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ "dayNames" : "dayNamesShort"))) + 20 - date.getDay());
+ }
+ inst.input.attr("size", this._formatDate(inst, date).length);
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName)) {
+ return;
+ }
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv);
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ //If disabled option is true, disable the datepicker before showing it (see ticket #5665)
+ if( inst.settings.disabled ) {
+ this._disableDatepicker( target );
+ }
+ // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
+ // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
+ inst.dpDiv.css( "display", "block" );
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ * @param input element - ignored
+ * @param date string or Date - the initial date to display
+ * @param onSelect function - the function to call when a date is selected
+ * @param settings object - update the dialog date picker instance's settings (anonymous object)
+ * @param pos int[2] - coordinates for the dialog's position within the screen or
+ * event - with x/y coordinates or
+ * leave empty for default (screen centre)
+ * @return the manager object
+ */
+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
+ var id, browserWidth, browserHeight, scrollX, scrollY,
+ inst = this._dialogInst; // internal instance
+
+ if (!inst) {
+ this.uuid += 1;
+ id = "dp" + this.uuid;
+ this._dialogInput = $("<input type='text' id='" + id +
+ "' style='position: absolute; top: -100px; width: 0px;'/>");
+ this._dialogInput.keydown(this._doKeyDown);
+ $("body").append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor === Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ browserWidth = document.documentElement.clientWidth;
+ browserHeight = document.documentElement.clientHeight;
+ scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px");
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI) {
+ $.blockUI(this.dpDiv);
+ }
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ * @param target element - the target input field or division or span
+ */
+ _destroyDatepicker: function(target) {
+ var nodeName,
+ $target = $(target),
+ inst = $.data(target, PROP_NAME);
+
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName === "input") {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind("focus", this._showDatepicker).
+ unbind("keydown", this._doKeyDown).
+ unbind("keypress", this._doKeyPress).
+ unbind("keyup", this._doKeyUp);
+ } else if (nodeName === "div" || nodeName === "span") {
+ $target.removeClass(this.markerClassName).empty();
+ }
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ */
+ _enableDatepicker: function(target) {
+ var nodeName, inline,
+ $target = $(target),
+ inst = $.data(target, PROP_NAME);
+
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ if (nodeName === "input") {
+ target.disabled = false;
+ inst.trigger.filter("button").
+ each(function() { this.disabled = false; }).end().
+ filter("img").css({opacity: "1.0", cursor: ""});
+ } else if (nodeName === "div" || nodeName === "span") {
+ inline = $target.children("." + this._inlineClass);
+ inline.children().removeClass("ui-state-disabled");
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ prop("disabled", false);
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value === target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ */
+ _disableDatepicker: function(target) {
+ var nodeName, inline,
+ $target = $(target),
+ inst = $.data(target, PROP_NAME);
+
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ if (nodeName === "input") {
+ target.disabled = true;
+ inst.trigger.filter("button").
+ each(function() { this.disabled = true; }).end().
+ filter("img").css({opacity: "0.5", cursor: "default"});
+ } else if (nodeName === "div" || nodeName === "span") {
+ inline = $target.children("." + this._inlineClass);
+ inline.children().addClass("ui-state-disabled");
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ prop("disabled", true);
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value === target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ * @param target element - the target input field or division or span
+ * @return boolean - true if disabled, false if enabled
+ */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] === target) {
+ return true;
+ }
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ * @param target element - the target input field or division or span
+ * @return object - the associated instance data
+ * @throws error if a jQuery problem getting data
+ */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw "Missing instance data for this datepicker";
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ * @param target element - the target input field or division or span
+ * @param name object - the new settings to update or
+ * string - the name of the setting to change or retrieve,
+ * when retrieving also "all" for all instance settings or
+ * "defaults" for all global defaults
+ * @param value any - the new value for the setting
+ * (omit if above is an object or to retrieve a value)
+ */
+ _optionDatepicker: function(target, name, value) {
+ var settings, date, minDate, maxDate,
+ inst = this._getInst(target);
+
+ if (arguments.length === 2 && typeof name === "string") {
+ return (name === "defaults" ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name === "all" ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+
+ settings = name || {};
+ if (typeof name === "string") {
+ settings = {};
+ settings[name] = value;
+ }
+
+ if (inst) {
+ if (this._curInst === inst) {
+ this._hideDatepicker();
+ }
+
+ date = this._getDateDatepicker(target, true);
+ minDate = this._getMinMaxDate(inst, "min");
+ maxDate = this._getMinMaxDate(inst, "max");
+ extendRemove(inst.settings, settings);
+ // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
+ if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) {
+ inst.settings.minDate = this._formatDate(inst, minDate);
+ }
+ if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) {
+ inst.settings.maxDate = this._formatDate(inst, maxDate);
+ }
+ if ( "disabled" in settings ) {
+ if ( settings.disabled ) {
+ this._disableDatepicker(target);
+ } else {
+ this._enableDatepicker(target);
+ }
+ }
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDate(inst, date);
+ this._updateAlternate(inst);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ * @param target element - the target input field or division or span
+ */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param date Date - the new date
+ */
+ _setDateDatepicker: function(target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param noDefault boolean - true if no default date is to be used
+ * @return Date - the current date
+ */
+ _getDateDatepicker: function(target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline) {
+ this._setDateFromField(inst, noDefault);
+ }
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var onSelect, dateStr, sel,
+ inst = $.datepicker._getInst(event.target),
+ handled = true,
+ isRTL = inst.dpDiv.is(".ui-datepicker-rtl");
+
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing) {
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: sel = $("td." + $.datepicker._dayOverClass + ":not(." +
+ $.datepicker._currentClass + ")", inst.dpDiv);
+ if (sel[0]) {
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ }
+
+ onSelect = $.datepicker._get(inst, "onSelect");
+ if (onSelect) {
+ dateStr = $.datepicker._formatDate(inst);
+
+ // trigger custom callback
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);
+ } else {
+ $.datepicker._hideDatepicker();
+ }
+
+ return false; // don't submit the form
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, "stepBigMonths") :
+ -$.datepicker._get(inst, "stepMonths")), "M");
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, "stepBigMonths") :
+ +$.datepicker._get(inst, "stepMonths")), "M");
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) {
+ $.datepicker._clearDate(event.target);
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) {
+ $.datepicker._gotoToday(event.target);
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) {
+ $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D");
+ }
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) {
+ $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, "stepBigMonths") :
+ -$.datepicker._get(inst, "stepMonths")), "M");
+ }
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) {
+ $.datepicker._adjustDate(event.target, -7, "D");
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) {
+ $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D");
+ }
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) {
+ $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, "stepBigMonths") :
+ +$.datepicker._get(inst, "stepMonths")), "M");
+ }
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) {
+ $.datepicker._adjustDate(event.target, +7, "D");
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ } else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ } else {
+ handled = false;
+ }
+
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var chars, chr,
+ inst = $.datepicker._getInst(event.target);
+
+ if ($.datepicker._get(inst, "constrainInput")) {
+ chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat"));
+ chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode);
+ return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function(event) {
+ var date,
+ inst = $.datepicker._getInst(event.target);
+
+ if (inst.input.val() !== inst.lastVal) {
+ try {
+ date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (err) {
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ * If false returned from beforeShow event handler do not show.
+ * @param input element - the input field attached to the date picker or
+ * event - if triggered by focus
+ */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger
+ input = $("input", input.parentNode)[0];
+ }
+
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) { // already here
+ return;
+ }
+
+ var inst, beforeShow, beforeShowSettings, isFixed,
+ offset, showAnim, duration;
+
+ inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst !== inst) {
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ if ( inst && $.datepicker._datepickerShowing ) {
+ $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] );
+ }
+ }
+
+ beforeShow = $.datepicker._get(inst, "beforeShow");
+ beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
+ if(beforeShowSettings === false){
+ return;
+ }
+ extendRemove(inst.settings, beforeShowSettings);
+
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+
+ if ($.datepicker._inDialog) { // hide cursor
+ input.value = "";
+ }
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+
+ isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css("position") === "fixed";
+ return !isFixed;
+ });
+
+ offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ //to avoid flashes on Firefox
+ inst.dpDiv.empty();
+ // determine sizing offscreen
+ inst.dpDiv.css({position: "absolute", display: "block", top: "-1000px"});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ "static" : (isFixed ? "fixed" : "absolute")), display: "none",
+ left: offset.left + "px", top: offset.top + "px"});
+
+ if (!inst.inline) {
+ showAnim = $.datepicker._get(inst, "showAnim");
+ duration = $.datepicker._get(inst, "duration");
+ inst.dpDiv.zIndex($(input).zIndex()+1);
+ $.datepicker._datepickerShowing = true;
+
+ if ( $.effects && $.effects.effect[ showAnim ] ) {
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration);
+ } else {
+ inst.dpDiv[showAnim || "show"](showAnim ? duration : null);
+ }
+
+ if (inst.input.is(":visible") && !inst.input.is(":disabled")) {
+ inst.input.focus();
+ }
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
+ instActive = inst; // for delegate hover events
+ inst.dpDiv.empty().append(this._generateHTML(inst));
+ this._attachHandlers(inst);
+ inst.dpDiv.find("." + this._dayOverClass + " a").mouseover();
+
+ var origyearshtml,
+ numMonths = this._getNumberOfMonths(inst),
+ cols = numMonths[1],
+ width = 17;
+
+ inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");
+ if (cols > 1) {
+ inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em");
+ }
+ inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") +
+ "Class"]("ui-datepicker-multi");
+ inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") +
+ "Class"]("ui-datepicker-rtl");
+
+ // #6694 - don't focus the input if it's already focused
+ // this breaks the change event in IE
+ if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
+ inst.input.is(":visible") && !inst.input.is(":disabled") && inst.input[0] !== document.activeElement) {
+ inst.input.focus();
+ }
+
+ // deffered render of the years select (to avoid flashes on Firefox)
+ if( inst.yearshtml ){
+ origyearshtml = inst.yearshtml;
+ setTimeout(function(){
+ //assure that inst.yearshtml didn't change.
+ if( origyearshtml === inst.yearshtml && inst.yearshtml ){
+ inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml);
+ }
+ origyearshtml = inst.yearshtml = null;
+ }, 0);
+ }
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ * @param elem (jQuery object) the element of interest
+ * @return (number[2]) the left and top borders
+ */
+ _getBorders: function(elem) {
+ var convert = function(value) {
+ return {thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css("border-left-width"))),
+ parseFloat(convert(elem.css("border-top-width")))];
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth(),
+ dpHeight = inst.dpDiv.outerHeight(),
+ inputWidth = inst.input ? inst.input.outerWidth() : 0,
+ inputHeight = inst.input ? inst.input.outerHeight() : 0,
+ viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()),
+ viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop());
+
+ offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ var position,
+ inst = this._getInst(obj),
+ isRTL = this._get(inst, "isRTL");
+
+ while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) {
+ obj = obj[isRTL ? "previousSibling" : "nextSibling"];
+ }
+
+ position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ * @param input element - the input field attached to the date picker
+ */
+ _hideDatepicker: function(input) {
+ var showAnim, duration, postProcess, onClose,
+ inst = this._curInst;
+
+ if (!inst || (input && inst !== $.data(input, PROP_NAME))) {
+ return;
+ }
+
+ if (this._datepickerShowing) {
+ showAnim = this._get(inst, "showAnim");
+ duration = this._get(inst, "duration");
+ postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ };
+
+ // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
+ if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) {
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess);
+ } else {
+ inst.dpDiv[(showAnim === "slideDown" ? "slideUp" :
+ (showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess);
+ }
+
+ if (!showAnim) {
+ postProcess();
+ }
+ this._datepickerShowing = false;
+
+ onClose = this._get(inst, "onClose");
+ if (onClose) {
+ onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]);
+ }
+
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: "absolute", left: "0", top: "-100px" });
+ if ($.blockUI) {
+ $.unblockUI();
+ $("body").append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar");
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst) {
+ return;
+ }
+
+ var $target = $(event.target),
+ inst = $.datepicker._getInst($target[0]);
+
+ if ( ( ( $target[0].id !== $.datepicker._mainDivId &&
+ $target.parents("#" + $.datepicker._mainDivId).length === 0 &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.closest("." + $.datepicker._triggerClass).length &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) ||
+ ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst ) ) {
+ $.datepicker._hideDatepicker();
+ }
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id),
+ inst = this._getInst(target[0]);
+
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var date,
+ target = $(id),
+ inst = this._getInst(target[0]);
+
+ if (this._get(inst, "gotoCurrent") && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ } else {
+ date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id),
+ inst = this._getInst(target[0]);
+
+ inst["selected" + (period === "M" ? "Month" : "Year")] =
+ inst["draw" + (period === "M" ? "Month" : "Year")] =
+ parseInt(select.options[select.selectedIndex].value,10);
+
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var inst,
+ target = $(id);
+
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+
+ inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $("a", td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ this._selectDate(target, "");
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var onSelect,
+ target = $(id),
+ inst = this._getInst(target[0]);
+
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input) {
+ inst.input.val(dateStr);
+ }
+ this._updateAlternate(inst);
+
+ onSelect = this._get(inst, "onSelect");
+ if (onSelect) {
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ } else if (inst.input) {
+ inst.input.trigger("change"); // fire the change event
+ }
+
+ if (inst.inline){
+ this._updateDatepicker(inst);
+ } else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) !== "object") {
+ inst.input.focus(); // restore focus
+ }
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altFormat, date, dateStr,
+ altField = this._get(inst, "altField");
+
+ if (altField) { // update alternate field too
+ altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat");
+ date = this._getDate(inst);
+ dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ * @param date Date - the date to customise
+ * @return [boolean, string] - is this date selectable?, what is its CSS class?
+ */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ""];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ * @param date Date - the date to get the week for
+ * @return number - the number of the week within the year that contains this date
+ */
+ iso8601Week: function(date) {
+ var time,
+ checkDate = new Date(date.getTime());
+
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+
+ time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ * See formatDate below for the possible formats.
+ *
+ * @param format string - the expected format of the date
+ * @param value string - the date in the above format
+ * @param settings Object - attributes include:
+ * shortYearCutoff number - the cutoff year for determining the century (optional)
+ * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ * dayNames string[7] - names of the days from Sunday (optional)
+ * monthNamesShort string[12] - abbreviated names of the months (optional)
+ * monthNames string[12] - names of the months (optional)
+ * @return Date - the extracted date value or null if value is blank
+ */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null) {
+ throw "Invalid arguments";
+ }
+
+ value = (typeof value === "object" ? value.toString() : value + "");
+ if (value === "") {
+ return null;
+ }
+
+ var iFormat, dim, extra,
+ iValue = 0,
+ shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff,
+ shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)),
+ dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
+ dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
+ monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
+ monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
+ year = -1,
+ month = -1,
+ day = -1,
+ doy = -1,
+ literal = false,
+ date,
+ // Check whether a format character is doubled
+ lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
+ if (matches) {
+ iFormat++;
+ }
+ return matches;
+ },
+ // Extract a number from the string value
+ getNumber = function(match) {
+ var isDoubled = lookAhead(match),
+ size = (match === "@" ? 14 : (match === "!" ? 20 :
+ (match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))),
+ digits = new RegExp("^\\d{1," + size + "}"),
+ num = value.substring(iValue).match(digits);
+ if (!num) {
+ throw "Missing number at position " + iValue;
+ }
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ },
+ // Extract a name from the string value and convert to an index
+ getName = function(match, shortNames, longNames) {
+ var index = -1,
+ names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
+ return [ [k, v] ];
+ }).sort(function (a, b) {
+ return -(a[1].length - b[1].length);
+ });
+
+ $.each(names, function (i, pair) {
+ var name = pair[1];
+ if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) {
+ index = pair[0];
+ iValue += name.length;
+ return false;
+ }
+ });
+ if (index !== -1) {
+ return index + 1;
+ } else {
+ throw "Unknown name at position " + iValue;
+ }
+ },
+ // Confirm that a literal character matches the string value
+ checkLiteral = function() {
+ if (value.charAt(iValue) !== format.charAt(iFormat)) {
+ throw "Unexpected literal at position " + iValue;
+ }
+ iValue++;
+ };
+
+ for (iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal) {
+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
+ literal = false;
+ } else {
+ checkLiteral();
+ }
+ } else {
+ switch (format.charAt(iFormat)) {
+ case "d":
+ day = getNumber("d");
+ break;
+ case "D":
+ getName("D", dayNamesShort, dayNames);
+ break;
+ case "o":
+ doy = getNumber("o");
+ break;
+ case "m":
+ month = getNumber("m");
+ break;
+ case "M":
+ month = getName("M", monthNamesShort, monthNames);
+ break;
+ case "y":
+ year = getNumber("y");
+ break;
+ case "@":
+ date = new Date(getNumber("@"));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "!":
+ date = new Date((getNumber("!") - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'")){
+ checkLiteral();
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ }
+
+ if (iValue < value.length){
+ extra = value.substr(iValue);
+ if (!/^\s+/.test(extra)) {
+ throw "Extra/unparsed characters found in date: " + extra;
+ }
+ }
+
+ if (year === -1) {
+ year = new Date().getFullYear();
+ } else if (year < 100) {
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ }
+
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim) {
+ break;
+ }
+ month++;
+ day -= dim;
+ } while (true);
+ }
+
+ date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) {
+ throw "Invalid date"; // E.g. 31/02/00
+ }
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
+ COOKIE: "D, dd M yy",
+ ISO_8601: "yy-mm-dd",
+ RFC_822: "D, d M y",
+ RFC_850: "DD, dd-M-y",
+ RFC_1036: "D, d M y",
+ RFC_1123: "D, d M yy",
+ RFC_2822: "D, d M yy",
+ RSS: "D, d M y", // RFC 822
+ TICKS: "!",
+ TIMESTAMP: "@",
+ W3C: "yy-mm-dd", // ISO 8601
+
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+ /* Format a date object into a string value.
+ * The format can be combinations of the following:
+ * d - day of month (no leading zero)
+ * dd - day of month (two digit)
+ * o - day of year (no leading zeros)
+ * oo - day of year (three digit)
+ * D - day name short
+ * DD - day name long
+ * m - month of year (no leading zero)
+ * mm - month of year (two digit)
+ * M - month name short
+ * MM - month name long
+ * y - year (two digit)
+ * yy - year (four digit)
+ * @ - Unix timestamp (ms since 01/01/1970)
+ * ! - Windows ticks (100ns since 01/01/0001)
+ * "..." - literal text
+ * '' - single quote
+ *
+ * @param format string - the desired format of the date
+ * @param date Date - the date value to format
+ * @param settings Object - attributes include:
+ * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ * dayNames string[7] - names of the days from Sunday (optional)
+ * monthNamesShort string[12] - abbreviated names of the months (optional)
+ * monthNames string[12] - names of the months (optional)
+ * @return string - the date in the above format
+ */
+ formatDate: function (format, date, settings) {
+ if (!date) {
+ return "";
+ }
+
+ var iFormat,
+ dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
+ dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
+ monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
+ monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
+ // Check whether a format character is doubled
+ lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
+ if (matches) {
+ iFormat++;
+ }
+ return matches;
+ },
+ // Format a number, with leading zero if necessary
+ formatNumber = function(match, value, len) {
+ var num = "" + value;
+ if (lookAhead(match)) {
+ while (num.length < len) {
+ num = "0" + num;
+ }
+ }
+ return num;
+ },
+ // Format a name, short or long as requested
+ formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ },
+ output = "",
+ literal = false;
+
+ if (date) {
+ for (iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal) {
+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
+ literal = false;
+ } else {
+ output += format.charAt(iFormat);
+ }
+ } else {
+ switch (format.charAt(iFormat)) {
+ case "d":
+ output += formatNumber("d", date.getDate(), 2);
+ break;
+ case "D":
+ output += formatName("D", date.getDay(), dayNamesShort, dayNames);
+ break;
+ case "o":
+ output += formatNumber("o",
+ Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
+ break;
+ case "m":
+ output += formatNumber("m", date.getMonth() + 1, 2);
+ break;
+ case "M":
+ output += formatName("M", date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case "y":
+ output += (lookAhead("y") ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? "0" : "") + date.getYear() % 100);
+ break;
+ case "@":
+ output += date.getTime();
+ break;
+ case "!":
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'")) {
+ output += "'";
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var iFormat,
+ chars = "",
+ literal = false,
+ // Check whether a format character is doubled
+ lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
+ if (matches) {
+ iFormat++;
+ }
+ return matches;
+ };
+
+ for (iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal) {
+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
+ literal = false;
+ } else {
+ chars += format.charAt(iFormat);
+ }
+ } else {
+ switch (format.charAt(iFormat)) {
+ case "d": case "m": case "y": case "@":
+ chars += "0123456789";
+ break;
+ case "D": case "M":
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'")) {
+ chars += "'";
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ }
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst, noDefault) {
+ if (inst.input.val() === inst.lastVal) {
+ return;
+ }
+
+ var dateFormat = this._get(inst, "dateFormat"),
+ dates = inst.lastVal = inst.input ? inst.input.val() : null,
+ defaultDate = this._getDefaultDate(inst),
+ date = defaultDate,
+ settings = this._getFormatConfig(inst);
+
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ dates = (noDefault ? "" : dates);
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, "defaultDate"), new Date()));
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(inst, date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ },
+ offsetString = function(offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
+ offset, $.datepicker._getFormatConfig(inst));
+ }
+ catch (e) {
+ // Ignore
+ }
+
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date(),
+ year = date.getFullYear(),
+ month = date.getMonth(),
+ day = date.getDate(),
+ pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
+ matches = pattern.exec(offset);
+
+ while (matches) {
+ switch (matches[2] || "d") {
+ case "d" : case "D" :
+ day += parseInt(matches[1],10); break;
+ case "w" : case "W" :
+ day += parseInt(matches[1],10) * 7; break;
+ case "m" : case "M" :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case "y": case "Y" :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ },
+ newDate = (date == null || date === "" ? defaultDate : (typeof date === "string" ? offsetString(date) :
+ (typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));
+
+ newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate);
+ if (newDate) {
+ newDate.setHours(0);
+ newDate.setMinutes(0);
+ newDate.setSeconds(0);
+ newDate.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(newDate);
+ },
+
+ /* Handle switch to/from daylight saving.
+ * Hours may be non-zero on daylight saving cut-over:
+ * > 12 when midnight changeover, but then cannot generate
+ * midnight datetime, so jump to 1AM, otherwise reset.
+ * @param date (Date) the date to check
+ * @return (Date) the corrected date
+ */
+ _daylightSavingAdjust: function(date) {
+ if (!date) {
+ return null;
+ }
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, noChange) {
+ var clear = !date,
+ origMonth = inst.selectedMonth,
+ origYear = inst.selectedYear,
+ newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+
+ inst.selectedDay = inst.currentDay = newDate.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
+ if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) {
+ this._notifyChange(inst);
+ }
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? "" : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Attach the onxxx handlers. These are declared statically so
+ * they work with static code transformers like Caja.
+ */
+ _attachHandlers: function(inst) {
+ var stepMonths = this._get(inst, "stepMonths"),
+ id = "#" + inst.id.replace( /\\\\/g, "\\" );
+ inst.dpDiv.find("[data-handler]").map(function () {
+ var handler = {
+ prev: function () {
+ window["DP_jQuery_" + dpuuid].datepicker._adjustDate(id, -stepMonths, "M");
+ },
+ next: function () {
+ window["DP_jQuery_" + dpuuid].datepicker._adjustDate(id, +stepMonths, "M");
+ },
+ hide: function () {
+ window["DP_jQuery_" + dpuuid].datepicker._hideDatepicker();
+ },
+ today: function () {
+ window["DP_jQuery_" + dpuuid].datepicker._gotoToday(id);
+ },
+ selectDay: function () {
+ window["DP_jQuery_" + dpuuid].datepicker._selectDay(id, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this);
+ return false;
+ },
+ selectMonth: function () {
+ window["DP_jQuery_" + dpuuid].datepicker._selectMonthYear(id, this, "M");
+ return false;
+ },
+ selectYear: function () {
+ window["DP_jQuery_" + dpuuid].datepicker._selectMonthYear(id, this, "Y");
+ return false;
+ }
+ };
+ $(this).bind(this.getAttribute("data-event"), handler[this.getAttribute("data-handler")]);
+ });
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var maxDraw, prevText, prev, nextText, next, currentText, gotoDate,
+ controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin,
+ monthNames, monthNamesShort, beforeShowDay, showOtherMonths,
+ selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate,
+ cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows,
+ printDate, dRow, tbody, daySettings, otherMonth, unselectable,
+ tempDate = new Date(),
+ today = this._daylightSavingAdjust(
+ new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())), // clear time
+ isRTL = this._get(inst, "isRTL"),
+ showButtonPanel = this._get(inst, "showButtonPanel"),
+ hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"),
+ navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"),
+ numMonths = this._getNumberOfMonths(inst),
+ showCurrentAtPos = this._get(inst, "showCurrentAtPos"),
+ stepMonths = this._get(inst, "stepMonths"),
+ isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1),
+ currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay))),
+ minDate = this._getMinMaxDate(inst, "min"),
+ maxDate = this._getMinMaxDate(inst, "max"),
+ drawMonth = inst.drawMonth - showCurrentAtPos,
+ drawYear = inst.drawYear;
+
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+
+ prevText = this._get(inst, "prevText");
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+
+ prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
+ " title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w") + "'>" + prevText + "</span></a>" :
+ (hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='"+ prevText +"'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w") + "'>" + prevText + "</span></a>"));
+
+ nextText = this._get(inst, "nextText");
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+
+ next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
+ " title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e") + "'>" + nextText + "</span></a>" :
+ (hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='"+ nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e") + "'>" + nextText + "</span></a>"));
+
+ currentText = this._get(inst, "currentText");
+ gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+
+ controls = (!inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
+ this._get(inst, "closeText") + "</button>" : "");
+
+ buttonPanel = (showButtonPanel) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + (isRTL ? controls : "") +
+ (this._isInRange(inst, gotoDate) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
+ ">" + currentText + "</button>" : "") + (isRTL ? "" : controls) + "</div>" : "";
+
+ firstDay = parseInt(this._get(inst, "firstDay"),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+
+ showWeek = this._get(inst, "showWeek");
+ dayNames = this._get(inst, "dayNames");
+ dayNamesMin = this._get(inst, "dayNamesMin");
+ monthNames = this._get(inst, "monthNames");
+ monthNamesShort = this._get(inst, "monthNamesShort");
+ beforeShowDay = this._get(inst, "beforeShowDay");
+ showOtherMonths = this._get(inst, "showOtherMonths");
+ selectOtherMonths = this._get(inst, "selectOtherMonths");
+ defaultDate = this._getDefaultDate(inst);
+ html = "";
+ dow;
+ for (row = 0; row < numMonths[0]; row++) {
+ group = "";
+ this.maxRows = 4;
+ for (col = 0; col < numMonths[1]; col++) {
+ selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ cornerClass = " ui-corner-all";
+ calender = "";
+ if (isMultiMonth) {
+ calender += "<div class='ui-datepicker-group";
+ if (numMonths[1] > 1) {
+ switch (col) {
+ case 0: calender += " ui-datepicker-group-first";
+ cornerClass = " ui-corner-" + (isRTL ? "right" : "left"); break;
+ case numMonths[1]-1: calender += " ui-datepicker-group-last";
+ cornerClass = " ui-corner-" + (isRTL ? "left" : "right"); break;
+ default: calender += " ui-datepicker-group-middle"; cornerClass = ""; break;
+ }
+ }
+ calender += "'>";
+ }
+ calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" +
+ (/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : "") +
+ (/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : "") +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ "</div><table class='ui-datepicker-calendar'><thead>" +
+ "<tr>";
+ thead = (showWeek ? "<th class='ui-datepicker-week-col'>" + this._get(inst, "weekHeader") + "</th>" : "");
+ for (dow = 0; dow < 7; dow++) { // days of the week
+ day = (dow + firstDay) % 7;
+ thead += "<th" + ((dow + firstDay + 6) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "") + ">" +
+ "<span title='" + dayNames[day] + "'>" + dayNamesMin[day] + "</span></th>";
+ }
+ calender += thead + "</tr></thead><tbody>";
+ daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) {
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ }
+ leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate
+ numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043)
+ this.maxRows = numRows;
+ printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += "<tr>";
+ tbody = (!showWeek ? "" : "<td class='ui-datepicker-week-col'>" +
+ this._get(inst, "calculateWeek")(printDate) + "</td>");
+ for (dow = 0; dow < 7; dow++) { // create date picker days
+ daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, ""]);
+ otherMonth = (printDate.getMonth() !== drawMonth);
+ unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += "<td class='" +
+ ((dow + firstDay + 6) % 7 >= 5 ? " ui-datepicker-week-end" : "") + // highlight weekends
+ (otherMonth ? " ui-datepicker-other-month" : "") + // highlight days from other months
+ ((printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ " " + this._dayOverClass : "") + // highlight selected day
+ (unselectable ? " " + this._unselectableClass + " ui-state-disabled": "") + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? "" : " " + daySettings[1] + // highlight custom dates
+ (printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "") + // highlight selected day
+ (printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "")) + "'" + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? " title='" + daySettings[2] + "'" : "") + // cell title
+ (unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'") + ">" + // actions
+ (otherMonth && !showOtherMonths ? "&#xa0;" : // display for other months
+ (unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" +
+ (printDate.getTime() === today.getTime() ? " ui-state-highlight" : "") +
+ (printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "") + // highlight selected day
+ (otherMonth ? " ui-priority-secondary" : "") + // distinguish dates from other months
+ "' href='#'>" + printDate.getDate() + "</a>")) + "</td>"; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + "</tr>";
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += "</tbody></table>" + (isMultiMonth ? "</div>" +
+ ((numMonths[0] > 0 && col === numMonths[1]-1) ? "<div class='ui-datepicker-row-break'></div>" : "") : "");
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel;
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+
+ var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear,
+ changeMonth = this._get(inst, "changeMonth"),
+ changeYear = this._get(inst, "changeYear"),
+ showMonthAfterYear = this._get(inst, "showMonthAfterYear"),
+ html = "<div class='ui-datepicker-title'>",
+ monthHtml = "";
+
+ // month selection
+ if (secondary || !changeMonth) {
+ monthHtml += "<span class='ui-datepicker-month'>" + monthNames[drawMonth] + "</span>";
+ } else {
+ inMinYear = (minDate && minDate.getFullYear() === drawYear);
+ inMaxYear = (maxDate && maxDate.getFullYear() === drawYear);
+ monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>";
+ for ( month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) && (!inMaxYear || month <= maxDate.getMonth())) {
+ monthHtml += "<option value='" + month + "'" +
+ (month === drawMonth ? " selected='selected'" : "") +
+ ">" + monthNamesShort[month] + "</option>";
+ }
+ }
+ monthHtml += "</select>";
+ }
+
+ if (!showMonthAfterYear) {
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? "&#xa0;" : "");
+ }
+
+ // year selection
+ if ( !inst.yearshtml ) {
+ inst.yearshtml = "";
+ if (secondary || !changeYear) {
+ html += "<span class='ui-datepicker-year'>" + drawYear + "</span>";
+ } else {
+ // determine range of years to display
+ years = this._get(inst, "yearRange").split(":");
+ thisYear = new Date().getFullYear();
+ determineYear = function(value) {
+ var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ year = determineYear(years[0]);
+ endYear = Math.max(year, determineYear(years[1] || ""));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";
+ for (; year <= endYear; year++) {
+ inst.yearshtml += "<option value='" + year + "'" +
+ (year === drawYear ? " selected='selected'" : "") +
+ ">" + year + "</option>";
+ }
+ inst.yearshtml += "</select>";
+
+ html += inst.yearshtml;
+ inst.yearshtml = null;
+ }
+ }
+
+ html += this._get(inst, "yearSuffix");
+ if (showMonthAfterYear) {
+ html += (secondary || !(changeMonth && changeYear) ? "&#xa0;" : "") + monthHtml;
+ }
+ html += "</div>"; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period === "Y" ? offset : 0),
+ month = inst.drawMonth + (period === "M" ? offset : 0),
+ day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (period === "D" ? offset : 0),
+ date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day)));
+
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period === "M" || period === "Y") {
+ this._notifyChange(inst);
+ }
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, "min"),
+ maxDate = this._getMinMaxDate(inst, "max"),
+ newDate = (minDate && date < minDate ? minDate : date);
+ return (maxDate && newDate > maxDate ? maxDate : newDate);
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, "onChangeMonthYear");
+ if (onChange) {
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ }
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, "numberOfMonths");
+ return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function(inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + "Date"), null);
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst),
+ date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+
+ if (offset < 0) {
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ }
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ var yearSplit, currentYear,
+ minDate = this._getMinMaxDate(inst, "min"),
+ maxDate = this._getMinMaxDate(inst, "max"),
+ minYear = null,
+ maxYear = null,
+ years = this._get(inst, "yearRange");
+ if (years){
+ yearSplit = years.split(":");
+ currentYear = new Date().getFullYear();
+ minYear = parseInt(yearSplit[0], 10) + currentYear;
+ maxYear = parseInt(yearSplit[1], 10) + currentYear;
+ }
+
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()) &&
+ (!minYear || date.getFullYear() >= minYear) &&
+ (!maxYear || date.getFullYear() <= maxYear));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, "shortYearCutoff");
+ shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, "dayNamesShort"), dayNames: this._get(inst, "dayNames"),
+ monthNamesShort: this._get(inst, "monthNamesShort"), monthNames: this._get(inst, "monthNames")};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day === "object" ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(inst));
+ }
+});
+
+/*
+ * Bind hover events for datepicker elements.
+ * Done via delegate so the binding only occurs once in the lifetime of the parent div.
+ * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
+ */
+function bindHover(dpDiv) {
+ var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
+ return dpDiv.delegate(selector, "mouseout", function() {
+ $(this).removeClass("ui-state-hover");
+ if (this.className.indexOf("ui-datepicker-prev") !== -1) {
+ $(this).removeClass("ui-datepicker-prev-hover");
+ }
+ if (this.className.indexOf("ui-datepicker-next") !== -1) {
+ $(this).removeClass("ui-datepicker-next-hover");
+ }
+ })
+ .delegate(selector, "mouseover", function(){
+ if (!$.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0])) {
+ $(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");
+ $(this).addClass("ui-state-hover");
+ if (this.className.indexOf("ui-datepicker-prev") !== -1) {
+ $(this).addClass("ui-datepicker-prev-hover");
+ }
+ if (this.className.indexOf("ui-datepicker-next") !== -1) {
+ $(this).addClass("ui-datepicker-next-hover");
+ }
+ }
+ });
+}
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props) {
+ if (props[name] == null) {
+ target[name] = props[name];
+ }
+ }
+ return target;
+}
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Verify an empty collection wasn't passed - Fixes #6976 */
+ if ( !this.length ) {
+ return this;
+ }
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick);
+ $.datepicker.initialized = true;
+ }
+
+ /* Append datepicker main container to body if not exist. */
+ if ($("#"+$.datepicker._mainDivId).length === 0) {
+ $("body").append($.datepicker.dpDiv);
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options === "string" && (options === "isDisabled" || options === "getDate" || options === "widget")) {
+ return $.datepicker["_" + options + "Datepicker"].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ }
+ if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") {
+ return $.datepicker["_" + options + "Datepicker"].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ }
+ return this.each(function() {
+ typeof options === "string" ?
+ $.datepicker["_" + options + "Datepicker"].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.10.0";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window["DP_jQuery_" + dpuuid] = $;
+
+})(jQuery);
+(function( $, undefined ) {
+
+var sizeRelatedOptions = {
+ buttons: true,
+ height: true,
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true,
+ width: true
+ },
+ resizableRelatedOptions = {
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true
+ };
+
+$.widget( "ui.dialog", {
+ version: "1.10.0",
+ options: {
+ appendTo: "body",
+ autoOpen: true,
+ buttons: [],
+ closeOnEscape: true,
+ closeText: "close",
+ dialogClass: "",
+ draggable: true,
+ hide: null,
+ height: "auto",
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: {
+ my: "center",
+ at: "center",
+ of: window,
+ collision: "fit",
+ // Ensure the titlebar is always visible
+ using: function( pos ) {
+ var topOffset = $( this ).css( pos ).offset().top;
+ if ( topOffset < 0 ) {
+ $( this ).css( "top", pos.top - topOffset );
+ }
+ }
+ },
+ resizable: true,
+ show: null,
+ title: null,
+ width: 300,
+
+ // callbacks
+ beforeClose: null,
+ close: null,
+ drag: null,
+ dragStart: null,
+ dragStop: null,
+ focus: null,
+ open: null,
+ resize: null,
+ resizeStart: null,
+ resizeStop: null
+ },
+
+ _create: function() {
+ this.originalCss = {
+ display: this.element[0].style.display,
+ width: this.element[0].style.width,
+ minHeight: this.element[0].style.minHeight,
+ maxHeight: this.element[0].style.maxHeight,
+ height: this.element[0].style.height
+ };
+ this.originalPosition = {
+ parent: this.element.parent(),
+ index: this.element.parent().children().index( this.element )
+ };
+ this.originalTitle = this.element.attr("title");
+ this.options.title = this.options.title || this.originalTitle;
+
+ this._createWrapper();
+
+ this.element
+ .show()
+ .removeAttr("title")
+ .addClass("ui-dialog-content ui-widget-content")
+ .appendTo( this.uiDialog );
+
+ this._createTitlebar();
+ this._createButtonPane();
+
+ if ( this.options.draggable && $.fn.draggable ) {
+ this._makeDraggable();
+ }
+ if ( this.options.resizable && $.fn.resizable ) {
+ this._makeResizable();
+ }
+
+ this._isOpen = false;
+ },
+
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
+
+ _appendTo: function() {
+ var element = this.options.appendTo;
+ if ( element && (element.jquery || element.nodeType) ) {
+ return $( element );
+ }
+ return this.document.find( element || "body" ).eq( 0 );
+ },
+
+ _destroy: function() {
+ var next,
+ originalPosition = this.originalPosition;
+
+ this._destroyOverlay();
+
+ this.element
+ .removeUniqueId()
+ .removeClass("ui-dialog-content ui-widget-content")
+ .css( this.originalCss )
+ // Without detaching first, the following becomes really slow
+ .detach();
+
+ this.uiDialog.stop( true, true ).remove();
+
+ if ( this.originalTitle ) {
+ this.element.attr( "title", this.originalTitle );
+ }
+
+ next = originalPosition.parent.children().eq( originalPosition.index );
+ // Don't try to place the dialog next to itself (#8613)
+ if ( next.length && next[0] !== this.element[0] ) {
+ next.before( this.element );
+ } else {
+ originalPosition.parent.append( this.element );
+ }
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
+
+ disable: $.noop,
+ enable: $.noop,
+
+ close: function( event ) {
+ var that = this;
+
+ if ( !this._isOpen || this._trigger( "beforeClose", event ) === false ) {
+ return;
+ }
+
+ this._isOpen = false;
+ this._destroyOverlay();
+
+ if ( !this.opener.filter(":focusable").focus().length ) {
+ // Hiding a focused element doesn't trigger blur in WebKit
+ // so in case we have nothing to focus on, explicitly blur the active element
+ // https://bugs.webkit.org/show_bug.cgi?id=47182
+ $( this.document[0].activeElement ).blur();
+ }
+
+ this._hide( this.uiDialog, this.options.hide, function() {
+ that._trigger( "close", event );
+ });
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ moveToTop: function() {
+ this._moveToTop();
+ },
+
+ _moveToTop: function( event, silent ) {
+ var moved = !!this.uiDialog.nextAll(":visible").insertBefore( this.uiDialog ).length;
+ if ( moved && !silent ) {
+ this._trigger( "focus", event );
+ }
+ return moved;
+ },
+
+ open: function() {
+ if ( this._isOpen ) {
+ if ( this._moveToTop() ) {
+ this._focusTabbable();
+ }
+ return;
+ }
+
+ this.opener = $( this.document[0].activeElement );
+
+ this._size();
+ this._position();
+ this._createOverlay();
+ this._moveToTop( null, true );
+ this._show( this.uiDialog, this.options.show );
+
+ this._focusTabbable();
+
+ this._isOpen = true;
+ this._trigger("open");
+ this._trigger("focus");
+ },
+
+ _focusTabbable: function() {
+ // Set focus to the first match:
+ // 1. First element inside the dialog matching [autofocus]
+ // 2. Tabbable element inside the content element
+ // 3. Tabbable element inside the buttonpane
+ // 4. The close button
+ // 5. The dialog itself
+ var hasFocus = this.element.find("[autofocus]");
+ if ( !hasFocus.length ) {
+ hasFocus = this.element.find(":tabbable");
+ }
+ if ( !hasFocus.length ) {
+ hasFocus = this.uiDialogButtonPane.find(":tabbable");
+ }
+ if ( !hasFocus.length ) {
+ hasFocus = this.uiDialogTitlebarClose.filter(":tabbable");
+ }
+ if ( !hasFocus.length ) {
+ hasFocus = this.uiDialog;
+ }
+ hasFocus.eq( 0 ).focus();
+ },
+
+ _keepFocus: function( event ) {
+ function checkFocus() {
+ var activeElement = this.document[0].activeElement,
+ isActive = this.uiDialog[0] === activeElement ||
+ $.contains( this.uiDialog[0], activeElement );
+ if ( !isActive ) {
+ this._focusTabbable();
+ }
+ }
+ event.preventDefault();
+ checkFocus.call( this );
+ // support: IE
+ // IE <= 8 doesn't prevent moving focus even with event.preventDefault()
+ // so we check again later
+ this._delay( checkFocus );
+ },
+
+ _createWrapper: function() {
+ this.uiDialog = $("<div>")
+ .addClass( "ui-dialog ui-widget ui-widget-content ui-corner-all ui-front " +
+ this.options.dialogClass )
+ .hide()
+ .attr({
+ // Setting tabIndex makes the div focusable
+ tabIndex: -1,
+ role: "dialog"
+ })
+ .appendTo( this._appendTo() );
+
+ this._on( this.uiDialog, {
+ keydown: function( event ) {
+ if ( this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE ) {
+ event.preventDefault();
+ this.close( event );
+ return;
+ }
+
+ // prevent tabbing out of dialogs
+ if ( event.keyCode !== $.ui.keyCode.TAB ) {
+ return;
+ }
+ var tabbables = this.uiDialog.find(":tabbable"),
+ first = tabbables.filter(":first"),
+ last = tabbables.filter(":last");
+
+ if ( ( event.target === last[0] || event.target === this.uiDialog[0] ) && !event.shiftKey ) {
+ first.focus( 1 );
+ event.preventDefault();
+ } else if ( ( event.target === first[0] || event.target === this.uiDialog[0] ) && event.shiftKey ) {
+ last.focus( 1 );
+ event.preventDefault();
+ }
+ },
+ mousedown: function( event ) {
+ if ( this._moveToTop( event ) ) {
+ this._focusTabbable();
+ }
+ }
+ });
+
+ // We assume that any existing aria-describedby attribute means
+ // that the dialog content is marked up properly
+ // otherwise we brute force the content as the description
+ if ( !this.element.find("[aria-describedby]").length ) {
+ this.uiDialog.attr({
+ "aria-describedby": this.element.uniqueId().attr("id")
+ });
+ }
+ },
+
+ _createTitlebar: function() {
+ var uiDialogTitle;
+
+ this.uiDialogTitlebar = $("<div>")
+ .addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix")
+ .prependTo( this.uiDialog );
+ this._on( this.uiDialogTitlebar, {
+ mousedown: function( event ) {
+ // Don't prevent click on close button (#8838)
+ // Focusing a dialog that is partially scrolled out of view
+ // causes the browser to scroll it into view, preventing the click event
+ if ( !$( event.target ).closest(".ui-dialog-titlebar-close") ) {
+ // Dialog isn't getting focus when dragging (#8063)
+ this.uiDialog.focus();
+ }
+ }
+ });
+
+ this.uiDialogTitlebarClose = $("<button></button>")
+ .button({
+ label: this.options.closeText,
+ icons: {
+ primary: "ui-icon-closethick"
+ },
+ text: false
+ })
+ .addClass("ui-dialog-titlebar-close")
+ .appendTo( this.uiDialogTitlebar );
+ this._on( this.uiDialogTitlebarClose, {
+ click: function( event ) {
+ event.preventDefault();
+ this.close( event );
+ }
+ });
+
+ uiDialogTitle = $("<span>")
+ .uniqueId()
+ .addClass("ui-dialog-title")
+ .prependTo( this.uiDialogTitlebar );
+ this._title( uiDialogTitle );
+
+ this.uiDialog.attr({
+ "aria-labelledby": uiDialogTitle.attr("id")
+ });
+ },
+
+ _title: function( title ) {
+ if ( !this.options.title ) {
+ title.html("&#160;");
+ }
+ title.text( this.options.title );
+ },
+
+ _createButtonPane: function() {
+ this.uiDialogButtonPane = $("<div>")
+ .addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");
+
+ this.uiButtonSet = $("<div>")
+ .addClass("ui-dialog-buttonset")
+ .appendTo( this.uiDialogButtonPane );
+
+ this._createButtons();
+ },
+
+ _createButtons: function() {
+ var that = this,
+ buttons = this.options.buttons;
+
+ // if we already have a button pane, remove it
+ this.uiDialogButtonPane.remove();
+ this.uiButtonSet.empty();
+
+ if ( $.isEmptyObject( buttons ) ) {
+ this.uiDialog.removeClass("ui-dialog-buttons");
+ return;
+ }
+
+ $.each( buttons, function( name, props ) {
+ var click, buttonOptions;
+ props = $.isFunction( props ) ?
+ { click: props, text: name } :
+ props;
+ // Default to a non-submitting button
+ props = $.extend( { type: "button" }, props );
+ // Change the context for the click callback to be the main element
+ click = props.click;
+ props.click = function() {
+ click.apply( that.element[0], arguments );
+ };
+ buttonOptions = {
+ icons: props.icons,
+ text: props.showText
+ };
+ delete props.icons;
+ delete props.showText;
+ $( "<button></button>", props )
+ .button( buttonOptions )
+ .appendTo( that.uiButtonSet );
+ });
+ this.uiDialog.addClass("ui-dialog-buttons");
+ this.uiDialogButtonPane.appendTo( this.uiDialog );
+ },
+
+ _makeDraggable: function() {
+ var that = this,
+ options = this.options;
+
+ function filteredUi( ui ) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ this.uiDialog.draggable({
+ cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
+ handle: ".ui-dialog-titlebar",
+ containment: "document",
+ start: function( event, ui ) {
+ $( this ).addClass("ui-dialog-dragging");
+ that._trigger( "dragStart", event, filteredUi( ui ) );
+ },
+ drag: function( event, ui ) {
+ that._trigger( "drag", event, filteredUi( ui ) );
+ },
+ stop: function( event, ui ) {
+ options.position = [
+ ui.position.left - that.document.scrollLeft(),
+ ui.position.top - that.document.scrollTop()
+ ];
+ $( this ).removeClass("ui-dialog-dragging");
+ that._trigger( "dragStop", event, filteredUi( ui ) );
+ }
+ });
+ },
+
+ _makeResizable: function() {
+ var that = this,
+ options = this.options,
+ handles = options.resizable,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = this.uiDialog.css("position"),
+ resizeHandles = typeof handles === "string" ?
+ handles :
+ "n,e,s,w,se,sw,ne,nw";
+
+ function filteredUi( ui ) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ this.uiDialog.resizable({
+ cancel: ".ui-dialog-content",
+ containment: "document",
+ alsoResize: this.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: this._minHeight(),
+ handles: resizeHandles,
+ start: function( event, ui ) {
+ $( this ).addClass("ui-dialog-resizing");
+ that._trigger( "resizeStart", event, filteredUi( ui ) );
+ },
+ resize: function( event, ui ) {
+ that._trigger( "resize", event, filteredUi( ui ) );
+ },
+ stop: function( event, ui ) {
+ options.height = $( this ).height();
+ options.width = $( this ).width();
+ $( this ).removeClass("ui-dialog-resizing");
+ that._trigger( "resizeStop", event, filteredUi( ui ) );
+ }
+ })
+ .css( "position", position );
+ },
+
+ _minHeight: function() {
+ var options = this.options;
+
+ return options.height === "auto" ?
+ options.minHeight :
+ Math.min( options.minHeight, options.height );
+ },
+
+ _position: function() {
+ // Need to show the dialog to get the actual offset in the position plugin
+ var isVisible = this.uiDialog.is(":visible");
+ if ( !isVisible ) {
+ this.uiDialog.show();
+ }
+ this.uiDialog.position( this.options.position );
+ if ( !isVisible ) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOptions: function( options ) {
+ var that = this,
+ resize = false,
+ resizableOptions = {};
+
+ $.each( options, function( key, value ) {
+ that._setOption( key, value );
+
+ if ( key in sizeRelatedOptions ) {
+ resize = true;
+ }
+ if ( key in resizableRelatedOptions ) {
+ resizableOptions[ key ] = value;
+ }
+ });
+
+ if ( resize ) {
+ this._size();
+ this._position();
+ }
+ if ( this.uiDialog.is(":data(ui-resizable)") ) {
+ this.uiDialog.resizable( "option", resizableOptions );
+ }
+ },
+
+ _setOption: function( key, value ) {
+ /*jshint maxcomplexity:15*/
+ var isDraggable, isResizable,
+ uiDialog = this.uiDialog;
+
+ if ( key === "dialogClass" ) {
+ uiDialog
+ .removeClass( this.options.dialogClass )
+ .addClass( value );
+ }
+
+ if ( key === "disabled" ) {
+ return;
+ }
+
+ this._super( key, value );
+
+ if ( key === "appendTo" ) {
+ this.uiDialog.appendTo( this._appendTo() );
+ }
+
+ if ( key === "buttons" ) {
+ this._createButtons();
+ }
+
+ if ( key === "closeText" ) {
+ this.uiDialogTitlebarClose.button({
+ // Ensure that we always pass a string
+ label: "" + value
+ });
+ }
+
+ if ( key === "draggable" ) {
+ isDraggable = uiDialog.is(":data(ui-draggable)");
+ if ( isDraggable && !value ) {
+ uiDialog.draggable("destroy");
+ }
+
+ if ( !isDraggable && value ) {
+ this._makeDraggable();
+ }
+ }
+
+ if ( key === "position" ) {
+ this._position();
+ }
+
+ if ( key === "resizable" ) {
+ // currently resizable, becoming non-resizable
+ isResizable = uiDialog.is(":data(ui-resizable)");
+ if ( isResizable && !value ) {
+ uiDialog.resizable("destroy");
+ }
+
+ // currently resizable, changing handles
+ if ( isResizable && typeof value === "string" ) {
+ uiDialog.resizable( "option", "handles", value );
+ }
+
+ // currently non-resizable, becoming resizable
+ if ( !isResizable && value !== false ) {
+ this._makeResizable();
+ }
+ }
+
+ if ( key === "title" ) {
+ this._title( this.uiDialogTitlebar.find(".ui-dialog-title") );
+ }
+ },
+
+ _size: function() {
+ // If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ // divs will both have width and height set, so we need to reset them
+ var nonContentHeight, minContentHeight, maxContentHeight,
+ options = this.options;
+
+ // Reset content sizing
+ this.element.show().css({
+ width: "auto",
+ minHeight: 0,
+ maxHeight: "none",
+ height: 0
+ });
+
+ if ( options.minWidth > options.width ) {
+ options.width = options.minWidth;
+ }
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: "auto",
+ width: options.width
+ })
+ .outerHeight();
+ minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+ maxContentHeight = typeof options.maxHeight === "number" ?
+ Math.max( 0, options.maxHeight - nonContentHeight ) :
+ "none";
+
+ if ( options.height === "auto" ) {
+ this.element.css({
+ minHeight: minContentHeight,
+ maxHeight: maxContentHeight,
+ height: "auto"
+ });
+ } else {
+ this.element.height( Math.max( 0, options.height - nonContentHeight ) );
+ }
+
+ if (this.uiDialog.is(":data(ui-resizable)") ) {
+ this.uiDialog.resizable( "option", "minHeight", this._minHeight() );
+ }
+ },
+
+ _createOverlay: function() {
+ if ( !this.options.modal ) {
+ return;
+ }
+
+ if ( !$.ui.dialog.overlayInstances ) {
+ // Prevent use of anchors and inputs.
+ // We use a delay in case the overlay is created from an
+ // event that we're going to be cancelling. (#2804)
+ this._delay(function() {
+ // Handle .dialog().dialog("close") (#4065)
+ if ( $.ui.dialog.overlayInstances ) {
+ this._on( this.document, {
+ focusin: function( event ) {
+ if ( !$( event.target ).closest(".ui-dialog").length ) {
+ event.preventDefault();
+ $(".ui-dialog:visible:last .ui-dialog-content")
+ .data("ui-dialog")._focusTabbable();
+ }
+ }
+ });
+ }
+ });
+ }
+
+ this.overlay = $("<div>")
+ .addClass("ui-widget-overlay ui-front")
+ .appendTo( this.document[0].body );
+ this._on( this.overlay, {
+ mousedown: "_keepFocus"
+ });
+ $.ui.dialog.overlayInstances++;
+ },
+
+ _destroyOverlay: function() {
+ if ( !this.options.modal ) {
+ return;
+ }
+
+ $.ui.dialog.overlayInstances--;
+ if ( !$.ui.dialog.overlayInstances ) {
+ this._off( this.document, "focusin" );
+ }
+ this.overlay.remove();
+ }
+});
+
+$.ui.dialog.overlayInstances = 0;
+
+// DEPRECATED
+if ( $.uiBackCompat !== false ) {
+ // position option with array notation
+ // just override with old implementation
+ $.widget( "ui.dialog", $.ui.dialog, {
+ _position: function() {
+ var position = this.options.position,
+ myAt = [],
+ offset = [ 0, 0 ],
+ isVisible;
+
+ if ( position ) {
+ if ( typeof position === "string" || (typeof position === "object" && "0" in position ) ) {
+ myAt = position.split ? position.split(" ") : [ position[0], position[1] ];
+ if ( myAt.length === 1 ) {
+ myAt[1] = myAt[0];
+ }
+
+ $.each( [ "left", "top" ], function( i, offsetPosition ) {
+ if ( +myAt[ i ] === myAt[ i ] ) {
+ offset[ i ] = myAt[ i ];
+ myAt[ i ] = offsetPosition;
+ }
+ });
+
+ position = {
+ my: myAt[0] + (offset[0] < 0 ? offset[0] : "+" + offset[0]) + " " +
+ myAt[1] + (offset[1] < 0 ? offset[1] : "+" + offset[1]),
+ at: myAt.join(" ")
+ };
+ }
+
+ position = $.extend( {}, $.ui.dialog.prototype.options.position, position );
+ } else {
+ position = $.ui.dialog.prototype.options.position;
+ }
+
+ // need to show the dialog to get the actual offset in the position plugin
+ isVisible = this.uiDialog.is(":visible");
+ if ( !isVisible ) {
+ this.uiDialog.show();
+ }
+ this.uiDialog.position( position );
+ if ( !isVisible ) {
+ this.uiDialog.hide();
+ }
+ }
+ });
+}
+
+}( jQuery ) );
+(function( $, undefined ) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+ version: "1.10.0",
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false,
+
+ // callbacks
+ drag: null,
+ start: null,
+ stop: null
+ },
+ _create: function() {
+
+ if (this.options.helper === "original" && !(/^(?:r|a|f)/).test(this.element.css("position"))) {
+ this.element[0].style.position = "relative";
+ }
+ if (this.options.addClasses){
+ this.element.addClass("ui-draggable");
+ }
+ if (this.options.disabled){
+ this.element.addClass("ui-draggable-disabled");
+ }
+
+ this._mouseInit();
+
+ },
+
+ _destroy: function() {
+ this.element.removeClass( "ui-draggable ui-draggable-dragging ui-draggable-disabled" );
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ // among others, prevent a drag on a resizable-handle
+ if (this.helper || o.disabled || $(event.target).closest(".ui-resizable-handle").length > 0) {
+ return false;
+ }
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle) {
+ return false;
+ }
+
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $("<div class='ui-draggable-iframeFix' style='background: #fff;'></div>")
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ this.helper.addClass("ui-draggable-dragging");
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager) {
+ $.ui.ddmanager.current = this;
+ }
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.positionAbs = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Set a containment if given in the options
+ if(o.containment) {
+ this._setContainment();
+ }
+
+ //Trigger event + callbacks
+ if(this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour) {
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+
+ //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
+ if ( $.ui.ddmanager ) {
+ $.ui.ddmanager.dragStart(this, event);
+ }
+
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ if(this._trigger("drag", event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis !== "y") {
+ this.helper[0].style.left = this.position.left+"px";
+ }
+ if(!this.options.axis || this.options.axis !== "x") {
+ this.helper[0].style.top = this.position.top+"px";
+ }
+ if($.ui.ddmanager) {
+ $.ui.ddmanager.drag(this, event);
+ }
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var element,
+ that = this,
+ elementInDom = false,
+ dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour) {
+ dropped = $.ui.ddmanager.drop(this, event);
+ }
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ //if the original element is no longer in the DOM don't bother to continue (see #8269)
+ element = this.element[0];
+ while ( element && (element = element.parentNode) ) {
+ if (element === document ) {
+ elementInDom = true;
+ }
+ }
+ if ( !elementInDom && this.options.helper === "original" ) {
+ return false;
+ }
+
+ if((this.options.revert === "invalid" && !dropped) || (this.options.revert === "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ if(that._trigger("stop", event) !== false) {
+ that._clear();
+ }
+ });
+ } else {
+ if(this._trigger("stop", event) !== false) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ _mouseUp: function(event) {
+ //Remove frame helpers
+ $("div.ui-draggable-iframeFix").each(function() {
+ this.parentNode.removeChild(this);
+ });
+
+ //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
+ if( $.ui.ddmanager ) {
+ $.ui.ddmanager.dragStop(this, event);
+ }
+
+ return $.ui.mouse.prototype._mouseUp.call(this, event);
+ },
+
+ cancel: function() {
+
+ if(this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .addBack()
+ .each(function() {
+ if(this === event.target) {
+ handle = true;
+ }
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options,
+ helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper === "clone" ? this.element.clone().removeAttr("id") : this.element);
+
+ if(!helper.parents("body").length) {
+ helper.appendTo((o.appendTo === "parent" ? this.element[0].parentNode : o.appendTo));
+ }
+
+ if(helper[0] !== this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) {
+ helper.css("position", "absolute");
+ }
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj === "string") {
+ obj = obj.split(" ");
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ("left" in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ("right" in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ("top" in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ("bottom" in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ //Ugly IE fix
+ if((this.offsetParent[0] === document.body) ||
+ (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
+ po = { top: 0, left: 0 };
+ }
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition === "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0),
+ right: (parseInt(this.element.css("marginRight"),10) || 0),
+ bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var over, c, ce,
+ o = this.options;
+
+ if(o.containment === "parent") {
+ o.containment = this.helper[0].parentNode;
+ }
+ if(o.containment === "document" || o.containment === "window") {
+ this.containment = [
+ o.containment === "document" ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
+ o.containment === "document" ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
+ (o.containment === "document" ? 0 : $(window).scrollLeft()) + $(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left,
+ (o.containment === "document" ? 0 : $(window).scrollTop()) + ($(o.containment === "document" ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor !== Array) {
+ c = $(o.containment);
+ ce = c[0];
+
+ if(!ce) {
+ return;
+ }
+
+ over = ($(ce).css("overflow") !== "hidden");
+
+ this.containment = [
+ (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
+ (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
+ (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
+ (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
+ ];
+ this.relative_container = c;
+
+ } else if(o.containment.constructor === Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) {
+ pos = this.position;
+ }
+
+ var mod = d === "absolute" ? 1 : -1,
+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top + // The absolute mouse position
+ this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left + // The absolute mouse position
+ this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var containment, co, top, left,
+ o = this.options,
+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent,
+ scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName),
+ pageX = event.pageX,
+ pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+ if(this.containment) {
+ if (this.relative_container){
+ co = this.relative_container.offset();
+ containment = [ this.containment[0] + co.left,
+ this.containment[1] + co.top,
+ this.containment[2] + co.left,
+ this.containment[3] + co.top ];
+ }
+ else {
+ containment = this.containment;
+ }
+
+ if(event.pageX - this.offset.click.left < containment[0]) {
+ pageX = containment[0] + this.offset.click.left;
+ }
+ if(event.pageY - this.offset.click.top < containment[1]) {
+ pageY = containment[1] + this.offset.click.top;
+ }
+ if(event.pageX - this.offset.click.left > containment[2]) {
+ pageX = containment[2] + this.offset.click.left;
+ }
+ if(event.pageY - this.offset.click.top > containment[3]) {
+ pageY = containment[3] + this.offset.click.top;
+ }
+ }
+
+ if(o.grid) {
+ //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
+ top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
+ pageY = containment ? ((top - this.offset.click.top >= containment[1] || top - this.offset.click.top > containment[3]) ? top : ((top - this.offset.click.top >= containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
+ pageX = containment ? ((left - this.offset.click.left >= containment[0] || left - this.offset.click.left > containment[2]) ? left : ((left - this.offset.click.left >= containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY - // The absolute mouse position
+ this.offset.click.top - // Click offset (relative to the element)
+ this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top + // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX - // The absolute mouse position
+ this.offset.click.left - // Click offset (relative to the element)
+ this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left + // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) {
+ this.helper.remove();
+ }
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ //The absolute position has to be recalculated after plugins
+ if(type === "drag") {
+ this.positionAbs = this._convertPositionTo("absolute");
+ }
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function() {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("ui-draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, "ui-sortable");
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("ui-draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: "valid/invalid"
+ if(this.shouldRevert) {
+ this.instance.options.revert = true;
+ }
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper === "original") {
+ this.instance.currentItem.css({ top: "auto", left: "auto" });
+ }
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("ui-draggable"), that = this;
+
+ $.each(inst.sortables, function() {
+
+ var innermostIntersecting = false,
+ thisSortable = this;
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+ innermostIntersecting = true;
+ $.each(inst.sortables, function () {
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+ if (this !== thisSortable &&
+ this.instance._intersectsWith(this.instance.containerCache) &&
+ $.ui.contains(thisSortable.instance.element[0], this.instance.element[0])
+ ) {
+ innermostIntersecting = false;
+ }
+ return innermostIntersecting;
+ });
+ }
+
+
+ if(innermostIntersecting) {
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(that).clone().removeAttr("id").appendTo(this.instance.element).data("ui-sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) {
+ this.instance._mouseDrag(event);
+ }
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger("out", event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) {
+ this.instance.placeholder.remove();
+ }
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ }
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function() {
+ var t = $("body"), o = $(this).data("ui-draggable").options;
+ if (t.css("cursor")) {
+ o._cursor = t.css("cursor");
+ }
+ t.css("cursor", o.cursor);
+ },
+ stop: function() {
+ var o = $(this).data("ui-draggable").options;
+ if (o._cursor) {
+ $("body").css("cursor", o._cursor);
+ }
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("ui-draggable").options;
+ if(t.css("opacity")) {
+ o._opacity = t.css("opacity");
+ }
+ t.css("opacity", o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("ui-draggable").options;
+ if(o._opacity) {
+ $(ui.helper).css("opacity", o._opacity);
+ }
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function() {
+ var i = $(this).data("ui-draggable");
+ if(i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") {
+ i.overflowOffset = i.scrollParent.offset();
+ }
+ },
+ drag: function( event ) {
+
+ var i = $(this).data("ui-draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") {
+
+ if(!o.axis || o.axis !== "x") {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) {
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ } else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) {
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+ }
+
+ if(!o.axis || o.axis !== "y") {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) {
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ } else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) {
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+ }
+
+ } else {
+
+ if(!o.axis || o.axis !== "x") {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ } else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) {
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+ }
+
+ if(!o.axis || o.axis !== "y") {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ } else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) {
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
+ $.ui.ddmanager.prepareOffsets(i, event);
+ }
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function() {
+
+ var i = $(this).data("ui-draggable"),
+ o = i.options;
+
+ i.snapElements = [];
+
+ $(o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap).each(function() {
+ var $t = $(this),
+ $o = $t.offset();
+ if(this !== i.element[0]) {
+ i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ }
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var ts, bs, ls, rs, l, r, t, b, i, first,
+ inst = $(this).data("ui-draggable"),
+ o = inst.options,
+ d = o.snapTolerance,
+ x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (i = inst.snapElements.length - 1; i >= 0; i--){
+
+ l = inst.snapElements[i].left;
+ r = l + inst.snapElements[i].width;
+ t = inst.snapElements[i].top;
+ b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) {
+ (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ }
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode !== "inner") {
+ ts = Math.abs(t - y2) <= d;
+ bs = Math.abs(b - y1) <= d;
+ ls = Math.abs(l - x2) <= d;
+ rs = Math.abs(r - x1) <= d;
+ if(ts) {
+ ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ }
+ if(bs) {
+ ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ }
+ if(ls) {
+ ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ }
+ if(rs) {
+ ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+ }
+
+ first = (ts || bs || ls || rs);
+
+ if(o.snapMode !== "outer") {
+ ts = Math.abs(t - y1) <= d;
+ bs = Math.abs(b - y2) <= d;
+ ls = Math.abs(l - x1) <= d;
+ rs = Math.abs(r - x2) <= d;
+ if(ts) {
+ ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ }
+ if(bs) {
+ ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ }
+ if(ls) {
+ ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ }
+ if(rs) {
+ ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) {
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ }
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ }
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function() {
+
+ var min,
+ o = $(this).data("ui-draggable").options,
+ group = $.makeArray($(o.stack)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+ });
+
+ if (!group.length) { return; }
+
+ min = parseInt(group[0].style.zIndex, 10) || 0;
+ $(group).each(function(i) {
+ this.style.zIndex = min + i;
+ });
+
+ this[0].style.zIndex = min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("ui-draggable").options;
+ if(t.css("zIndex")) {
+ o._zIndex = t.css("zIndex");
+ }
+ t.css("zIndex", o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("ui-draggable").options;
+ if(o._zIndex) {
+ $(ui.helper).css("zIndex", o._zIndex);
+ }
+ }
+});
+
+})(jQuery);
+(function( $, undefined ) {
+
+function isOverAxis( x, reference, size ) {
+ return ( x > reference ) && ( x < ( reference + size ) );
+}
+
+$.widget("ui.droppable", {
+ version: "1.10.0",
+ widgetEventPrefix: "drop",
+ options: {
+ accept: "*",
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: "default",
+ tolerance: "intersect",
+
+ // callbacks
+ activate: null,
+ deactivate: null,
+ drop: null,
+ out: null,
+ over: null
+ },
+ _create: function() {
+
+ var o = this.options,
+ accept = o.accept;
+
+ this.isover = false;
+ this.isout = true;
+
+ this.accept = $.isFunction(accept) ? accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+ $.ui.ddmanager.droppables[o.scope].push(this);
+
+ (o.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ _destroy: function() {
+ var i = 0,
+ drop = $.ui.ddmanager.droppables[this.options.scope];
+
+ for ( ; i < drop.length; i++ ) {
+ if ( drop[i] === this ) {
+ drop.splice(i, 1);
+ }
+ }
+
+ this.element.removeClass("ui-droppable ui-droppable-disabled");
+ },
+
+ _setOption: function(key, value) {
+
+ if(key === "accept") {
+ this.accept = $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ }
+ $.Widget.prototype._setOption.apply(this, arguments);
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) {
+ this.element.addClass(this.options.activeClass);
+ }
+ if(draggable){
+ this._trigger("activate", event, this.ui(draggable));
+ }
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) {
+ this.element.removeClass(this.options.activeClass);
+ }
+ if(draggable){
+ this._trigger("deactivate", event, this.ui(draggable));
+ }
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+
+ // Bail if draggable and droppable are same element
+ if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
+ return;
+ }
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) {
+ this.element.addClass(this.options.hoverClass);
+ }
+ this._trigger("over", event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+
+ // Bail if draggable and droppable are same element
+ if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
+ return;
+ }
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) {
+ this.element.removeClass(this.options.hoverClass);
+ }
+ this._trigger("out", event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current,
+ childrenIntersection = false;
+
+ // Bail if draggable and droppable are same element
+ if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
+ return false;
+ }
+
+ this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, "ui-droppable");
+ if(
+ inst.options.greedy &&
+ !inst.options.disabled &&
+ inst.options.scope === draggable.options.scope &&
+ inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) &&
+ $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+ ) { childrenIntersection = true; return false; }
+ });
+ if(childrenIntersection) {
+ return false;
+ }
+
+ if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) {
+ this.element.removeClass(this.options.activeClass);
+ }
+ if(this.options.hoverClass) {
+ this.element.removeClass(this.options.hoverClass);
+ }
+ this._trigger("drop", event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) {
+ return false;
+ }
+
+ var draggableLeft, draggableTop,
+ x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height,
+ l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case "fit":
+ return (l <= x1 && x2 <= r && t <= y1 && y2 <= b);
+ case "intersect":
+ return (l < x1 + (draggable.helperProportions.width / 2) && // Right Half
+ x2 - (draggable.helperProportions.width / 2) < r && // Left Half
+ t < y1 + (draggable.helperProportions.height / 2) && // Bottom Half
+ y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ case "pointer":
+ draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left);
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top);
+ return isOverAxis( draggableTop, t, droppable.proportions.height ) && isOverAxis( draggableLeft, l, droppable.proportions.width );
+ case "touch":
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ default:
+ return false;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { "default": [] },
+ prepareOffsets: function(t, event) {
+
+ var i, j,
+ m = $.ui.ddmanager.droppables[t.options.scope] || [],
+ type = event ? event.type : null, // workaround for #2317
+ list = (t.currentItem || t.element).find(":data(ui-droppable)").addBack();
+
+ droppablesLoop: for (i = 0; i < m.length; i++) {
+
+ //No disabled and non-accepted
+ if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) {
+ continue;
+ }
+
+ // Filter out elements in the current dragged item
+ for (j=0; j < list.length; j++) {
+ if(list[j] === m[i].element[0]) {
+ m[i].proportions.height = 0;
+ continue droppablesLoop;
+ }
+ }
+
+ m[i].visible = m[i].element.css("display") !== "none";
+ if(!m[i].visible) {
+ continue;
+ }
+
+ //Activate the droppable if used directly from draggables
+ if(type === "mousedown") {
+ m[i]._activate.call(m[i], event);
+ }
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(!this.options) {
+ return;
+ }
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) {
+ dropped = this._drop.call(this, event) || dropped;
+ }
+
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = true;
+ this.isover = false;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ dragStart: function( draggable, event ) {
+ //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
+ draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() {
+ if( !draggable.options.refreshPositions ) {
+ $.ui.ddmanager.prepareOffsets( draggable, event );
+ }
+ });
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) {
+ $.ui.ddmanager.prepareOffsets(draggable, event);
+ }
+
+ //Run through all droppables and check their positions based on specific tolerance options
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) {
+ return;
+ }
+
+ var parentInstance, scope, parent,
+ intersects = $.ui.intersect(draggable, this, this.options.tolerance),
+ c = !intersects && this.isover ? "isout" : (intersects && !this.isover ? "isover" : null);
+ if(!c) {
+ return;
+ }
+
+ if (this.options.greedy) {
+ // find droppable parents with same scope
+ scope = this.options.scope;
+ parent = this.element.parents(":data(ui-droppable)").filter(function () {
+ return $.data(this, "ui-droppable").options.scope === scope;
+ });
+
+ if (parent.length) {
+ parentInstance = $.data(parent[0], "ui-droppable");
+ parentInstance.greedyChild = (c === "isover");
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c === "isover") {
+ parentInstance.isover = false;
+ parentInstance.isout = true;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = true;
+ this[c === "isout" ? "isover" : "isout"] = false;
+ this[c === "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c === "isout") {
+ parentInstance.isout = false;
+ parentInstance.isover = true;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ },
+ dragStop: function( draggable, event ) {
+ draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" );
+ //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
+ if( !draggable.options.refreshPositions ) {
+ $.ui.ddmanager.prepareOffsets( draggable, event );
+ }
+ }
+};
+
+})(jQuery);
+;(jQuery.effects || (function($, undefined) {
+
+var dataSpace = "ui-effects-";
+
+$.effects = {
+ effect: {}
+};
+
+/*!
+ * jQuery Color Animations v2.1.2
+ * https://github.com/jquery/jquery-color
+ *
+ * Copyright 2013 jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * Date: Wed Jan 16 08:47:09 2013 -0600
+ */
+(function( jQuery, undefined ) {
+
+ var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",
+
+ // plusequals test for += 100 -= 100
+ rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
+ // a set of RE's that can match strings and generate color tuples.
+ stringParsers = [{
+ re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ],
+ execResult[ 2 ],
+ execResult[ 3 ],
+ execResult[ 4 ]
+ ];
+ }
+ }, {
+ re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ] * 2.55,
+ execResult[ 2 ] * 2.55,
+ execResult[ 3 ] * 2.55,
+ execResult[ 4 ]
+ ];
+ }
+ }, {
+ // this regex ignores A-F because it's compared against an already lowercased string
+ re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
+ parse: function( execResult ) {
+ return [
+ parseInt( execResult[ 1 ], 16 ),
+ parseInt( execResult[ 2 ], 16 ),
+ parseInt( execResult[ 3 ], 16 )
+ ];
+ }
+ }, {
+ // this regex ignores A-F because it's compared against an already lowercased string
+ re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
+ parse: function( execResult ) {
+ return [
+ parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ),
+ parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ),
+ parseInt( execResult[ 3 ] + execResult[ 3 ], 16 )
+ ];
+ }
+ }, {
+ re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ space: "hsla",
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ],
+ execResult[ 2 ] / 100,
+ execResult[ 3 ] / 100,
+ execResult[ 4 ]
+ ];
+ }
+ }],
+
+ // jQuery.Color( )
+ color = jQuery.Color = function( color, green, blue, alpha ) {
+ return new jQuery.Color.fn.parse( color, green, blue, alpha );
+ },
+ spaces = {
+ rgba: {
+ props: {
+ red: {
+ idx: 0,
+ type: "byte"
+ },
+ green: {
+ idx: 1,
+ type: "byte"
+ },
+ blue: {
+ idx: 2,
+ type: "byte"
+ }
+ }
+ },
+
+ hsla: {
+ props: {
+ hue: {
+ idx: 0,
+ type: "degrees"
+ },
+ saturation: {
+ idx: 1,
+ type: "percent"
+ },
+ lightness: {
+ idx: 2,
+ type: "percent"
+ }
+ }
+ }
+ },
+ propTypes = {
+ "byte": {
+ floor: true,
+ max: 255
+ },
+ "percent": {
+ max: 1
+ },
+ "degrees": {
+ mod: 360,
+ floor: true
+ }
+ },
+ support = color.support = {},
+
+ // element for support tests
+ supportElem = jQuery( "<p>" )[ 0 ],
+
+ // colors = jQuery.Color.names
+ colors,
+
+ // local aliases of functions called often
+ each = jQuery.each;
+
+// determine rgba support immediately
+supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
+support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1;
+
+// define cache name and alpha properties
+// for rgba and hsla spaces
+each( spaces, function( spaceName, space ) {
+ space.cache = "_" + spaceName;
+ space.props.alpha = {
+ idx: 3,
+ type: "percent",
+ def: 1
+ };
+});
+
+function clamp( value, prop, allowEmpty ) {
+ var type = propTypes[ prop.type ] || {};
+
+ if ( value == null ) {
+ return (allowEmpty || !prop.def) ? null : prop.def;
+ }
+
+ // ~~ is an short way of doing floor for positive numbers
+ value = type.floor ? ~~value : parseFloat( value );
+
+ // IE will pass in empty strings as value for alpha,
+ // which will hit this case
+ if ( isNaN( value ) ) {
+ return prop.def;
+ }
+
+ if ( type.mod ) {
+ // we add mod before modding to make sure that negatives values
+ // get converted properly: -10 -> 350
+ return (value + type.mod) % type.mod;
+ }
+
+ // for now all property types without mod have min and max
+ return 0 > value ? 0 : type.max < value ? type.max : value;
+}
+
+function stringParse( string ) {
+ var inst = color(),
+ rgba = inst._rgba = [];
+
+ string = string.toLowerCase();
+
+ each( stringParsers, function( i, parser ) {
+ var parsed,
+ match = parser.re.exec( string ),
+ values = match && parser.parse( match ),
+ spaceName = parser.space || "rgba";
+
+ if ( values ) {
+ parsed = inst[ spaceName ]( values );
+
+ // if this was an rgba parse the assignment might happen twice
+ // oh well....
+ inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ];
+ rgba = inst._rgba = parsed._rgba;
+
+ // exit each( stringParsers ) here because we matched
+ return false;
+ }
+ });
+
+ // Found a stringParser that handled it
+ if ( rgba.length ) {
+
+ // if this came from a parsed string, force "transparent" when alpha is 0
+ // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
+ if ( rgba.join() === "0,0,0,0" ) {
+ jQuery.extend( rgba, colors.transparent );
+ }
+ return inst;
+ }
+
+ // named colors
+ return colors[ string ];
+}
+
+color.fn = jQuery.extend( color.prototype, {
+ parse: function( red, green, blue, alpha ) {
+ if ( red === undefined ) {
+ this._rgba = [ null, null, null, null ];
+ return this;
+ }
+ if ( red.jquery || red.nodeType ) {
+ red = jQuery( red ).css( green );
+ green = undefined;
+ }
+
+ var inst = this,
+ type = jQuery.type( red ),
+ rgba = this._rgba = [];
+
+ // more than 1 argument specified - assume ( red, green, blue, alpha )
+ if ( green !== undefined ) {
+ red = [ red, green, blue, alpha ];
+ type = "array";
+ }
+
+ if ( type === "string" ) {
+ return this.parse( stringParse( red ) || colors._default );
+ }
+
+ if ( type === "array" ) {
+ each( spaces.rgba.props, function( key, prop ) {
+ rgba[ prop.idx ] = clamp( red[ prop.idx ], prop );
+ });
+ return this;
+ }
+
+ if ( type === "object" ) {
+ if ( red instanceof color ) {
+ each( spaces, function( spaceName, space ) {
+ if ( red[ space.cache ] ) {
+ inst[ space.cache ] = red[ space.cache ].slice();
+ }
+ });
+ } else {
+ each( spaces, function( spaceName, space ) {
+ var cache = space.cache;
+ each( space.props, function( key, prop ) {
+
+ // if the cache doesn't exist, and we know how to convert
+ if ( !inst[ cache ] && space.to ) {
+
+ // if the value was null, we don't need to copy it
+ // if the key was alpha, we don't need to copy it either
+ if ( key === "alpha" || red[ key ] == null ) {
+ return;
+ }
+ inst[ cache ] = space.to( inst._rgba );
+ }
+
+ // this is the only case where we allow nulls for ALL properties.
+ // call clamp with alwaysAllowEmpty
+ inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true );
+ });
+
+ // everything defined but alpha?
+ if ( inst[ cache ] && jQuery.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) {
+ // use the default of 1
+ inst[ cache ][ 3 ] = 1;
+ if ( space.from ) {
+ inst._rgba = space.from( inst[ cache ] );
+ }
+ }
+ });
+ }
+ return this;
+ }
+ },
+ is: function( compare ) {
+ var is = color( compare ),
+ same = true,
+ inst = this;
+
+ each( spaces, function( _, space ) {
+ var localCache,
+ isCache = is[ space.cache ];
+ if (isCache) {
+ localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || [];
+ each( space.props, function( _, prop ) {
+ if ( isCache[ prop.idx ] != null ) {
+ same = ( isCache[ prop.idx ] === localCache[ prop.idx ] );
+ return same;
+ }
+ });
+ }
+ return same;
+ });
+ return same;
+ },
+ _space: function() {
+ var used = [],
+ inst = this;
+ each( spaces, function( spaceName, space ) {
+ if ( inst[ space.cache ] ) {
+ used.push( spaceName );
+ }
+ });
+ return used.pop();
+ },
+ transition: function( other, distance ) {
+ var end = color( other ),
+ spaceName = end._space(),
+ space = spaces[ spaceName ],
+ startColor = this.alpha() === 0 ? color( "transparent" ) : this,
+ start = startColor[ space.cache ] || space.to( startColor._rgba ),
+ result = start.slice();
+
+ end = end[ space.cache ];
+ each( space.props, function( key, prop ) {
+ var index = prop.idx,
+ startValue = start[ index ],
+ endValue = end[ index ],
+ type = propTypes[ prop.type ] || {};
+
+ // if null, don't override start value
+ if ( endValue === null ) {
+ return;
+ }
+ // if null - use end
+ if ( startValue === null ) {
+ result[ index ] = endValue;
+ } else {
+ if ( type.mod ) {
+ if ( endValue - startValue > type.mod / 2 ) {
+ startValue += type.mod;
+ } else if ( startValue - endValue > type.mod / 2 ) {
+ startValue -= type.mod;
+ }
+ }
+ result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop );
+ }
+ });
+ return this[ spaceName ]( result );
+ },
+ blend: function( opaque ) {
+ // if we are already opaque - return ourself
+ if ( this._rgba[ 3 ] === 1 ) {
+ return this;
+ }
+
+ var rgb = this._rgba.slice(),
+ a = rgb.pop(),
+ blend = color( opaque )._rgba;
+
+ return color( jQuery.map( rgb, function( v, i ) {
+ return ( 1 - a ) * blend[ i ] + a * v;
+ }));
+ },
+ toRgbaString: function() {
+ var prefix = "rgba(",
+ rgba = jQuery.map( this._rgba, function( v, i ) {
+ return v == null ? ( i > 2 ? 1 : 0 ) : v;
+ });
+
+ if ( rgba[ 3 ] === 1 ) {
+ rgba.pop();
+ prefix = "rgb(";
+ }
+
+ return prefix + rgba.join() + ")";
+ },
+ toHslaString: function() {
+ var prefix = "hsla(",
+ hsla = jQuery.map( this.hsla(), function( v, i ) {
+ if ( v == null ) {
+ v = i > 2 ? 1 : 0;
+ }
+
+ // catch 1 and 2
+ if ( i && i < 3 ) {
+ v = Math.round( v * 100 ) + "%";
+ }
+ return v;
+ });
+
+ if ( hsla[ 3 ] === 1 ) {
+ hsla.pop();
+ prefix = "hsl(";
+ }
+ return prefix + hsla.join() + ")";
+ },
+ toHexString: function( includeAlpha ) {
+ var rgba = this._rgba.slice(),
+ alpha = rgba.pop();
+
+ if ( includeAlpha ) {
+ rgba.push( ~~( alpha * 255 ) );
+ }
+
+ return "#" + jQuery.map( rgba, function( v ) {
+
+ // default to 0 when nulls exist
+ v = ( v || 0 ).toString( 16 );
+ return v.length === 1 ? "0" + v : v;
+ }).join("");
+ },
+ toString: function() {
+ return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString();
+ }
+});
+color.fn.parse.prototype = color.fn;
+
+// hsla conversions adapted from:
+// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021
+
+function hue2rgb( p, q, h ) {
+ h = ( h + 1 ) % 1;
+ if ( h * 6 < 1 ) {
+ return p + (q - p) * h * 6;
+ }
+ if ( h * 2 < 1) {
+ return q;
+ }
+ if ( h * 3 < 2 ) {
+ return p + (q - p) * ((2/3) - h) * 6;
+ }
+ return p;
+}
+
+spaces.hsla.to = function ( rgba ) {
+ if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) {
+ return [ null, null, null, rgba[ 3 ] ];
+ }
+ var r = rgba[ 0 ] / 255,
+ g = rgba[ 1 ] / 255,
+ b = rgba[ 2 ] / 255,
+ a = rgba[ 3 ],
+ max = Math.max( r, g, b ),
+ min = Math.min( r, g, b ),
+ diff = max - min,
+ add = max + min,
+ l = add * 0.5,
+ h, s;
+
+ if ( min === max ) {
+ h = 0;
+ } else if ( r === max ) {
+ h = ( 60 * ( g - b ) / diff ) + 360;
+ } else if ( g === max ) {
+ h = ( 60 * ( b - r ) / diff ) + 120;
+ } else {
+ h = ( 60 * ( r - g ) / diff ) + 240;
+ }
+
+ // chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
+ // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
+ if ( diff === 0 ) {
+ s = 0;
+ } else if ( l <= 0.5 ) {
+ s = diff / add;
+ } else {
+ s = diff / ( 2 - add );
+ }
+ return [ Math.round(h) % 360, s, l, a == null ? 1 : a ];
+};
+
+spaces.hsla.from = function ( hsla ) {
+ if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) {
+ return [ null, null, null, hsla[ 3 ] ];
+ }
+ var h = hsla[ 0 ] / 360,
+ s = hsla[ 1 ],
+ l = hsla[ 2 ],
+ a = hsla[ 3 ],
+ q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s,
+ p = 2 * l - q;
+
+ return [
+ Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ),
+ Math.round( hue2rgb( p, q, h ) * 255 ),
+ Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ),
+ a
+ ];
+};
+
+
+each( spaces, function( spaceName, space ) {
+ var props = space.props,
+ cache = space.cache,
+ to = space.to,
+ from = space.from;
+
+ // makes rgba() and hsla()
+ color.fn[ spaceName ] = function( value ) {
+
+ // generate a cache for this space if it doesn't exist
+ if ( to && !this[ cache ] ) {
+ this[ cache ] = to( this._rgba );
+ }
+ if ( value === undefined ) {
+ return this[ cache ].slice();
+ }
+
+ var ret,
+ type = jQuery.type( value ),
+ arr = ( type === "array" || type === "object" ) ? value : arguments,
+ local = this[ cache ].slice();
+
+ each( props, function( key, prop ) {
+ var val = arr[ type === "object" ? key : prop.idx ];
+ if ( val == null ) {
+ val = local[ prop.idx ];
+ }
+ local[ prop.idx ] = clamp( val, prop );
+ });
+
+ if ( from ) {
+ ret = color( from( local ) );
+ ret[ cache ] = local;
+ return ret;
+ } else {
+ return color( local );
+ }
+ };
+
+ // makes red() green() blue() alpha() hue() saturation() lightness()
+ each( props, function( key, prop ) {
+ // alpha is included in more than one space
+ if ( color.fn[ key ] ) {
+ return;
+ }
+ color.fn[ key ] = function( value ) {
+ var vtype = jQuery.type( value ),
+ fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ),
+ local = this[ fn ](),
+ cur = local[ prop.idx ],
+ match;
+
+ if ( vtype === "undefined" ) {
+ return cur;
+ }
+
+ if ( vtype === "function" ) {
+ value = value.call( this, cur );
+ vtype = jQuery.type( value );
+ }
+ if ( value == null && prop.empty ) {
+ return this;
+ }
+ if ( vtype === "string" ) {
+ match = rplusequals.exec( value );
+ if ( match ) {
+ value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 );
+ }
+ }
+ local[ prop.idx ] = value;
+ return this[ fn ]( local );
+ };
+ });
+});
+
+// add cssHook and .fx.step function for each named hook.
+// accept a space separated string of properties
+color.hook = function( hook ) {
+ var hooks = hook.split( " " );
+ each( hooks, function( i, hook ) {
+ jQuery.cssHooks[ hook ] = {
+ set: function( elem, value ) {
+ var parsed, curElem,
+ backgroundColor = "";
+
+ if ( value !== "transparent" && ( jQuery.type( value ) !== "string" || ( parsed = stringParse( value ) ) ) ) {
+ value = color( parsed || value );
+ if ( !support.rgba && value._rgba[ 3 ] !== 1 ) {
+ curElem = hook === "backgroundColor" ? elem.parentNode : elem;
+ while (
+ (backgroundColor === "" || backgroundColor === "transparent") &&
+ curElem && curElem.style
+ ) {
+ try {
+ backgroundColor = jQuery.css( curElem, "backgroundColor" );
+ curElem = curElem.parentNode;
+ } catch ( e ) {
+ }
+ }
+
+ value = value.blend( backgroundColor && backgroundColor !== "transparent" ?
+ backgroundColor :
+ "_default" );
+ }
+
+ value = value.toRgbaString();
+ }
+ try {
+ elem.style[ hook ] = value;
+ } catch( e ) {
+ // wrapped to prevent IE from throwing errors on "invalid" values like 'auto' or 'inherit'
+ }
+ }
+ };
+ jQuery.fx.step[ hook ] = function( fx ) {
+ if ( !fx.colorInit ) {
+ fx.start = color( fx.elem, hook );
+ fx.end = color( fx.end );
+ fx.colorInit = true;
+ }
+ jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) );
+ };
+ });
+
+};
+
+color.hook( stepHooks );
+
+jQuery.cssHooks.borderColor = {
+ expand: function( value ) {
+ var expanded = {};
+
+ each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) {
+ expanded[ "border" + part + "Color" ] = value;
+ });
+ return expanded;
+ }
+};
+
+// Basic color names only.
+// Usage of any of the other color names requires adding yourself or including
+// jquery.color.svg-names.js.
+colors = jQuery.Color.names = {
+ // 4.1. Basic color keywords
+ aqua: "#00ffff",
+ black: "#000000",
+ blue: "#0000ff",
+ fuchsia: "#ff00ff",
+ gray: "#808080",
+ green: "#008000",
+ lime: "#00ff00",
+ maroon: "#800000",
+ navy: "#000080",
+ olive: "#808000",
+ purple: "#800080",
+ red: "#ff0000",
+ silver: "#c0c0c0",
+ teal: "#008080",
+ white: "#ffffff",
+ yellow: "#ffff00",
+
+ // 4.2.3. "transparent" color keyword
+ transparent: [ null, null, null, 0 ],
+
+ _default: "#ffffff"
+};
+
+})( jQuery );
+
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+(function() {
+
+var classAnimationActions = [ "add", "remove", "toggle" ],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+
+$.each([ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ], function( _, prop ) {
+ $.fx.step[ prop ] = function( fx ) {
+ if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) {
+ jQuery.style( fx.elem, prop, fx.end );
+ fx.setAttr = true;
+ }
+ };
+});
+
+function getElementStyles( elem ) {
+ var key, len,
+ style = elem.ownerDocument.defaultView ?
+ elem.ownerDocument.defaultView.getComputedStyle( elem, null ) :
+ elem.currentStyle,
+ styles = {};
+
+ if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) {
+ len = style.length;
+ while ( len-- ) {
+ key = style[ len ];
+ if ( typeof style[ key ] === "string" ) {
+ styles[ $.camelCase( key ) ] = style[ key ];
+ }
+ }
+ // support: Opera, IE <9
+ } else {
+ for ( key in style ) {
+ if ( typeof style[ key ] === "string" ) {
+ styles[ key ] = style[ key ];
+ }
+ }
+ }
+
+ return styles;
+}
+
+
+function styleDifference( oldStyle, newStyle ) {
+ var diff = {},
+ name, value;
+
+ for ( name in newStyle ) {
+ value = newStyle[ name ];
+ if ( oldStyle[ name ] !== value ) {
+ if ( !shorthandStyles[ name ] ) {
+ if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) {
+ diff[ name ] = value;
+ }
+ }
+ }
+ }
+
+ return diff;
+}
+
+// support: jQuery <1.8
+if ( !$.fn.addBack ) {
+ $.fn.addBack = function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter( selector )
+ );
+ };
+}
+
+$.effects.animateClass = function( value, duration, easing, callback ) {
+ var o = $.speed( duration, easing, callback );
+
+ return this.queue( function() {
+ var animated = $( this ),
+ baseClass = animated.attr( "class" ) || "",
+ applyClassChange,
+ allAnimations = o.children ? animated.find( "*" ).addBack() : animated;
+
+ // map the animated objects to store the original styles.
+ allAnimations = allAnimations.map(function() {
+ var el = $( this );
+ return {
+ el: el,
+ start: getElementStyles( this )
+ };
+ });
+
+ // apply class change
+ applyClassChange = function() {
+ $.each( classAnimationActions, function(i, action) {
+ if ( value[ action ] ) {
+ animated[ action + "Class" ]( value[ action ] );
+ }
+ });
+ };
+ applyClassChange();
+
+ // map all animated objects again - calculate new styles and diff
+ allAnimations = allAnimations.map(function() {
+ this.end = getElementStyles( this.el[ 0 ] );
+ this.diff = styleDifference( this.start, this.end );
+ return this;
+ });
+
+ // apply original class
+ animated.attr( "class", baseClass );
+
+ // map all animated objects again - this time collecting a promise
+ allAnimations = allAnimations.map(function() {
+ var styleInfo = this,
+ dfd = $.Deferred(),
+ opts = $.extend({}, o, {
+ queue: false,
+ complete: function() {
+ dfd.resolve( styleInfo );
+ }
+ });
+
+ this.el.animate( this.diff, opts );
+ return dfd.promise();
+ });
+
+ // once all animations have completed:
+ $.when.apply( $, allAnimations.get() ).done(function() {
+
+ // set the final class
+ applyClassChange();
+
+ // for each animated element,
+ // clear all css properties that were animated
+ $.each( arguments, function() {
+ var el = this.el;
+ $.each( this.diff, function(key) {
+ el.css( key, "" );
+ });
+ });
+
+ // this is guarnteed to be there if you use jQuery.speed()
+ // it also handles dequeuing the next anim...
+ o.complete.call( animated[ 0 ] );
+ });
+ });
+};
+
+$.fn.extend({
+ _addClass: $.fn.addClass,
+ addClass: function( classNames, speed, easing, callback ) {
+ return speed ?
+ $.effects.animateClass.call( this,
+ { add: classNames }, speed, easing, callback ) :
+ this._addClass( classNames );
+ },
+
+ _removeClass: $.fn.removeClass,
+ removeClass: function( classNames, speed, easing, callback ) {
+ return speed ?
+ $.effects.animateClass.call( this,
+ { remove: classNames }, speed, easing, callback ) :
+ this._removeClass( classNames );
+ },
+
+ _toggleClass: $.fn.toggleClass,
+ toggleClass: function( classNames, force, speed, easing, callback ) {
+ if ( typeof force === "boolean" || force === undefined ) {
+ if ( !speed ) {
+ // without speed parameter
+ return this._toggleClass( classNames, force );
+ } else {
+ return $.effects.animateClass.call( this,
+ (force ? { add: classNames } : { remove: classNames }),
+ speed, easing, callback );
+ }
+ } else {
+ // without force parameter
+ return $.effects.animateClass.call( this,
+ { toggle: classNames }, force, speed, easing );
+ }
+ },
+
+ switchClass: function( remove, add, speed, easing, callback) {
+ return $.effects.animateClass.call( this, {
+ add: add,
+ remove: remove
+ }, speed, easing, callback );
+ }
+});
+
+})();
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+(function() {
+
+$.extend( $.effects, {
+ version: "1.10.0",
+
+ // Saves a set of properties in a data storage
+ save: function( element, set ) {
+ for( var i=0; i < set.length; i++ ) {
+ if ( set[ i ] !== null ) {
+ element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] );
+ }
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function( element, set ) {
+ var val, i;
+ for( i=0; i < set.length; i++ ) {
+ if ( set[ i ] !== null ) {
+ val = element.data( dataSpace + set[ i ] );
+ // support: jQuery 1.6.2
+ // http://bugs.jquery.com/ticket/9917
+ // jQuery 1.6.2 incorrectly returns undefined for any falsy value.
+ // We can't differentiate between "" and 0 here, so we just assume
+ // empty string since it's likely to be a more common value...
+ if ( val === undefined ) {
+ val = "";
+ }
+ element.css( set[ i ], val );
+ }
+ }
+ },
+
+ setMode: function( el, mode ) {
+ if (mode === "toggle") {
+ mode = el.is( ":hidden" ) ? "show" : "hide";
+ }
+ return mode;
+ },
+
+ // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ getBaseline: function( origin, original ) {
+ var y, x;
+ switch ( origin[ 0 ] ) {
+ case "top": y = 0; break;
+ case "middle": y = 0.5; break;
+ case "bottom": y = 1; break;
+ default: y = origin[ 0 ] / original.height;
+ }
+ switch ( origin[ 1 ] ) {
+ case "left": x = 0; break;
+ case "center": x = 0.5; break;
+ case "right": x = 1; break;
+ default: x = origin[ 1 ] / original.width;
+ }
+ return {
+ x: x,
+ y: y
+ };
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function( element ) {
+
+ // if the element is already wrapped, return it
+ if ( element.parent().is( ".ui-effects-wrapper" )) {
+ return element.parent();
+ }
+
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ "float": element.css( "float" )
+ },
+ wrapper = $( "<div></div>" )
+ .addClass( "ui-effects-wrapper" )
+ .css({
+ fontSize: "100%",
+ background: "transparent",
+ border: "none",
+ margin: 0,
+ padding: 0
+ }),
+ // Store the size in case width/height are defined in % - Fixes #5245
+ size = {
+ width: element.width(),
+ height: element.height()
+ },
+ active = document.activeElement;
+
+ // support: Firefox
+ // Firefox incorrectly exposes anonymous content
+ // https://bugzilla.mozilla.org/show_bug.cgi?id=561664
+ try {
+ active.id;
+ } catch( e ) {
+ active = document.body;
+ }
+
+ element.wrap( wrapper );
+
+ // Fixes #7595 - Elements lose focus when wrapped.
+ if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+ $( active ).focus();
+ }
+
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element
+
+ // transfer positioning properties to the wrapper
+ if ( element.css( "position" ) === "static" ) {
+ wrapper.css({ position: "relative" });
+ element.css({ position: "relative" });
+ } else {
+ $.extend( props, {
+ position: element.css( "position" ),
+ zIndex: element.css( "z-index" )
+ });
+ $.each([ "top", "left", "bottom", "right" ], function(i, pos) {
+ props[ pos ] = element.css( pos );
+ if ( isNaN( parseInt( props[ pos ], 10 ) ) ) {
+ props[ pos ] = "auto";
+ }
+ });
+ element.css({
+ position: "relative",
+ top: 0,
+ left: 0,
+ right: "auto",
+ bottom: "auto"
+ });
+ }
+ element.css(size);
+
+ return wrapper.css( props ).show();
+ },
+
+ removeWrapper: function( element ) {
+ var active = document.activeElement;
+
+ if ( element.parent().is( ".ui-effects-wrapper" ) ) {
+ element.parent().replaceWith( element );
+
+ // Fixes #7595 - Elements lose focus when wrapped.
+ if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+ $( active ).focus();
+ }
+ }
+
+
+ return element;
+ },
+
+ setTransition: function( element, list, factor, value ) {
+ value = value || {};
+ $.each( list, function( i, x ) {
+ var unit = element.cssUnit( x );
+ if ( unit[ 0 ] > 0 ) {
+ value[ x ] = unit[ 0 ] * factor + unit[ 1 ];
+ }
+ });
+ return value;
+ }
+});
+
+// return an effect options object for the given parameters:
+function _normalizeArguments( effect, options, speed, callback ) {
+
+ // allow passing all options as the first parameter
+ if ( $.isPlainObject( effect ) ) {
+ options = effect;
+ effect = effect.effect;
+ }
+
+ // convert to an object
+ effect = { effect: effect };
+
+ // catch (effect, null, ...)
+ if ( options == null ) {
+ options = {};
+ }
+
+ // catch (effect, callback)
+ if ( $.isFunction( options ) ) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+
+ // catch (effect, speed, ?)
+ if ( typeof options === "number" || $.fx.speeds[ options ] ) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
+
+ // catch (effect, options, callback)
+ if ( $.isFunction( speed ) ) {
+ callback = speed;
+ speed = null;
+ }
+
+ // add options to effect
+ if ( options ) {
+ $.extend( effect, options );
+ }
+
+ speed = speed || options.duration;
+ effect.duration = $.fx.off ? 0 :
+ typeof speed === "number" ? speed :
+ speed in $.fx.speeds ? $.fx.speeds[ speed ] :
+ $.fx.speeds._default;
+
+ effect.complete = callback || options.complete;
+
+ return effect;
+}
+
+function standardSpeed( speed ) {
+ // valid standard speeds
+ if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) {
+ return true;
+ }
+
+ // invalid strings - treat as "normal" speed
+ return typeof speed === "string" && !$.effects.effect[ speed ];
+}
+
+$.fn.extend({
+ effect: function( /* effect, options, speed, callback */ ) {
+ var args = _normalizeArguments.apply( this, arguments ),
+ mode = args.mode,
+ queue = args.queue,
+ effectMethod = $.effects.effect[ args.effect ];
+
+ if ( $.fx.off || !effectMethod ) {
+ // delegate to the original method (e.g., .show()) if possible
+ if ( mode ) {
+ return this[ mode ]( args.duration, args.complete );
+ } else {
+ return this.each( function() {
+ if ( args.complete ) {
+ args.complete.call( this );
+ }
+ });
+ }
+ }
+
+ function run( next ) {
+ var elem = $( this ),
+ complete = args.complete,
+ mode = args.mode;
+
+ function done() {
+ if ( $.isFunction( complete ) ) {
+ complete.call( elem[0] );
+ }
+ if ( $.isFunction( next ) ) {
+ next();
+ }
+ }
+
+ // if the element is hiddden and mode is hide,
+ // or element is visible and mode is show
+ if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) {
+ done();
+ } else {
+ effectMethod.call( elem[0], args, done );
+ }
+ }
+
+ return queue === false ? this.each( run ) : this.queue( queue || "fx", run );
+ },
+
+ _show: $.fn.show,
+ show: function( speed ) {
+ if ( standardSpeed( speed ) ) {
+ return this._show.apply( this, arguments );
+ } else {
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "show";
+ return this.effect.call( this, args );
+ }
+ },
+
+ _hide: $.fn.hide,
+ hide: function( speed ) {
+ if ( standardSpeed( speed ) ) {
+ return this._hide.apply( this, arguments );
+ } else {
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "hide";
+ return this.effect.call( this, args );
+ }
+ },
+
+ // jQuery core overloads toggle and creates _toggle
+ __toggle: $.fn.toggle,
+ toggle: function( speed ) {
+ if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) {
+ return this.__toggle.apply( this, arguments );
+ } else {
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "toggle";
+ return this.effect.call( this, args );
+ }
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css( key ),
+ val = [];
+
+ $.each( [ "em", "px", "%", "pt" ], function( i, unit ) {
+ if ( style.indexOf( unit ) > 0 ) {
+ val = [ parseFloat( style ), unit ];
+ }
+ });
+ return val;
+ }
+});
+
+})();
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+(function() {
+
+// based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
+
+var baseEasings = {};
+
+$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) {
+ baseEasings[ name ] = function( p ) {
+ return Math.pow( p, i + 2 );
+ };
+});
+
+$.extend( baseEasings, {
+ Sine: function ( p ) {
+ return 1 - Math.cos( p * Math.PI / 2 );
+ },
+ Circ: function ( p ) {
+ return 1 - Math.sqrt( 1 - p * p );
+ },
+ Elastic: function( p ) {
+ return p === 0 || p === 1 ? p :
+ -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 );
+ },
+ Back: function( p ) {
+ return p * p * ( 3 * p - 2 );
+ },
+ Bounce: function ( p ) {
+ var pow2,
+ bounce = 4;
+
+ while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {}
+ return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 );
+ }
+});
+
+$.each( baseEasings, function( name, easeIn ) {
+ $.easing[ "easeIn" + name ] = easeIn;
+ $.easing[ "easeOut" + name ] = function( p ) {
+ return 1 - easeIn( 1 - p );
+ };
+ $.easing[ "easeInOut" + name ] = function( p ) {
+ return p < 0.5 ?
+ easeIn( p * 2 ) / 2 :
+ 1 - easeIn( p * -2 + 2 ) / 2;
+ };
+});
+
+})();
+
+})(jQuery));
+(function( $, undefined ) {
+
+var rvertical = /up|down|vertical/,
+ rpositivemotion = /up|left|vertical|horizontal/;
+
+$.effects.effect.blind = function( o, done ) {
+ // Create element
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ direction = o.direction || "up",
+ vertical = rvertical.test( direction ),
+ ref = vertical ? "height" : "width",
+ ref2 = vertical ? "top" : "left",
+ motion = rpositivemotion.test( direction ),
+ animation = {},
+ show = mode === "show",
+ wrapper, distance, margin;
+
+ // if already wrapped, the wrapper's properties are my property. #6245
+ if ( el.parent().is( ".ui-effects-wrapper" ) ) {
+ $.effects.save( el.parent(), props );
+ } else {
+ $.effects.save( el, props );
+ }
+ el.show();
+ wrapper = $.effects.createWrapper( el ).css({
+ overflow: "hidden"
+ });
+
+ distance = wrapper[ ref ]();
+ margin = parseFloat( wrapper.css( ref2 ) ) || 0;
+
+ animation[ ref ] = show ? distance : 0;
+ if ( !motion ) {
+ el
+ .css( vertical ? "bottom" : "right", 0 )
+ .css( vertical ? "top" : "left", "auto" )
+ .css({ position: "absolute" });
+
+ animation[ ref2 ] = show ? margin : distance + margin;
+ }
+
+ // start at 0 if we are showing
+ if ( show ) {
+ wrapper.css( ref, 0 );
+ if ( ! motion ) {
+ wrapper.css( ref2, margin + distance );
+ }
+ }
+
+ // Animate
+ wrapper.animate( animation, {
+ duration: o.duration,
+ easing: o.easing,
+ queue: false,
+ complete: function() {
+ if ( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.bounce = function( o, done ) {
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+
+ // defaults:
+ mode = $.effects.setMode( el, o.mode || "effect" ),
+ hide = mode === "hide",
+ show = mode === "show",
+ direction = o.direction || "up",
+ distance = o.distance,
+ times = o.times || 5,
+
+ // number of internal animations
+ anims = times * 2 + ( show || hide ? 1 : 0 ),
+ speed = o.duration / anims,
+ easing = o.easing,
+
+ // utility:
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ motion = ( direction === "up" || direction === "left" ),
+ i,
+ upAnim,
+ downAnim,
+
+ // we will need to re-assemble the queue to stack our animations in place
+ queue = el.queue(),
+ queuelen = queue.length;
+
+ // Avoid touching opacity to prevent clearType and PNG issues in IE
+ if ( show || hide ) {
+ props.push( "opacity" );
+ }
+
+ $.effects.save( el, props );
+ el.show();
+ $.effects.createWrapper( el ); // Create Wrapper
+
+ // default distance for the BIGGEST bounce is the outer Distance / 3
+ if ( !distance ) {
+ distance = el[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3;
+ }
+
+ if ( show ) {
+ downAnim = { opacity: 1 };
+ downAnim[ ref ] = 0;
+
+ // if we are showing, force opacity 0 and set the initial position
+ // then do the "first" animation
+ el.css( "opacity", 0 )
+ .css( ref, motion ? -distance * 2 : distance * 2 )
+ .animate( downAnim, speed, easing );
+ }
+
+ // start at the smallest distance if we are hiding
+ if ( hide ) {
+ distance = distance / Math.pow( 2, times - 1 );
+ }
+
+ downAnim = {};
+ downAnim[ ref ] = 0;
+ // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
+ for ( i = 0; i < times; i++ ) {
+ upAnim = {};
+ upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
+
+ el.animate( upAnim, speed, easing )
+ .animate( downAnim, speed, easing );
+
+ distance = hide ? distance * 2 : distance / 2;
+ }
+
+ // Last Bounce when Hiding
+ if ( hide ) {
+ upAnim = { opacity: 0 };
+ upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
+
+ el.animate( upAnim, speed, easing );
+ }
+
+ el.queue(function() {
+ if ( hide ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ });
+
+ // inject all the animations we just queued to be first in line (after "inprogress")
+ if ( queuelen > 1) {
+ queue.splice.apply( queue,
+ [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) );
+ }
+ el.dequeue();
+
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.clip = function( o, done ) {
+ // Create element
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ show = mode === "show",
+ direction = o.direction || "vertical",
+ vert = direction === "vertical",
+ size = vert ? "height" : "width",
+ position = vert ? "top" : "left",
+ animation = {},
+ wrapper, animate, distance;
+
+ // Save & Show
+ $.effects.save( el, props );
+ el.show();
+
+ // Create Wrapper
+ wrapper = $.effects.createWrapper( el ).css({
+ overflow: "hidden"
+ });
+ animate = ( el[0].tagName === "IMG" ) ? wrapper : el;
+ distance = animate[ size ]();
+
+ // Shift
+ if ( show ) {
+ animate.css( size, 0 );
+ animate.css( position, distance / 2 );
+ }
+
+ // Create Animation Object:
+ animation[ size ] = show ? distance : 0;
+ animation[ position ] = show ? 0 : distance / 2;
+
+ // Animate
+ animate.animate( animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( !show ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.drop = function( o, done ) {
+
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "opacity", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ show = mode === "show",
+ direction = o.direction || "left",
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ motion = ( direction === "up" || direction === "left" ) ? "pos" : "neg",
+ animation = {
+ opacity: show ? 1 : 0
+ },
+ distance;
+
+ // Adjust
+ $.effects.save( el, props );
+ el.show();
+ $.effects.createWrapper( el );
+
+ distance = o.distance || el[ ref === "top" ? "outerHeight": "outerWidth" ]( true ) / 2;
+
+ if ( show ) {
+ el
+ .css( "opacity", 0 )
+ .css( ref, motion === "pos" ? -distance : distance );
+ }
+
+ // Animation
+ animation[ ref ] = ( show ?
+ ( motion === "pos" ? "+=" : "-=" ) :
+ ( motion === "pos" ? "-=" : "+=" ) ) +
+ distance;
+
+ // Animate
+ el.animate( animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.explode = function( o, done ) {
+
+ var rows = o.pieces ? Math.round( Math.sqrt( o.pieces ) ) : 3,
+ cells = rows,
+ el = $( this ),
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ show = mode === "show",
+
+ // show and then visibility:hidden the element before calculating offset
+ offset = el.show().css( "visibility", "hidden" ).offset(),
+
+ // width and height of a piece
+ width = Math.ceil( el.outerWidth() / cells ),
+ height = Math.ceil( el.outerHeight() / rows ),
+ pieces = [],
+
+ // loop
+ i, j, left, top, mx, my;
+
+ // children animate complete:
+ function childComplete() {
+ pieces.push( this );
+ if ( pieces.length === rows * cells ) {
+ animComplete();
+ }
+ }
+
+ // clone the element for each row and cell.
+ for( i = 0; i < rows ; i++ ) { // ===>
+ top = offset.top + i * height;
+ my = i - ( rows - 1 ) / 2 ;
+
+ for( j = 0; j < cells ; j++ ) { // |||
+ left = offset.left + j * width;
+ mx = j - ( cells - 1 ) / 2 ;
+
+ // Create a clone of the now hidden main element that will be absolute positioned
+ // within a wrapper div off the -left and -top equal to size of our pieces
+ el
+ .clone()
+ .appendTo( "body" )
+ .wrap( "<div></div>" )
+ .css({
+ position: "absolute",
+ visibility: "visible",
+ left: -j * width,
+ top: -i * height
+ })
+
+ // select the wrapper - make it overflow: hidden and absolute positioned based on
+ // where the original was located +left and +top equal to the size of pieces
+ .parent()
+ .addClass( "ui-effects-explode" )
+ .css({
+ position: "absolute",
+ overflow: "hidden",
+ width: width,
+ height: height,
+ left: left + ( show ? mx * width : 0 ),
+ top: top + ( show ? my * height : 0 ),
+ opacity: show ? 0 : 1
+ }).animate({
+ left: left + ( show ? 0 : mx * width ),
+ top: top + ( show ? 0 : my * height ),
+ opacity: show ? 1 : 0
+ }, o.duration || 500, o.easing, childComplete );
+ }
+ }
+
+ function animComplete() {
+ el.css({
+ visibility: "visible"
+ });
+ $( pieces ).remove();
+ if ( !show ) {
+ el.hide();
+ }
+ done();
+ }
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.fade = function( o, done ) {
+ var el = $( this ),
+ mode = $.effects.setMode( el, o.mode || "toggle" );
+
+ el.animate({
+ opacity: mode
+ }, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: done
+ });
+};
+
+})( jQuery );
+(function( $, undefined ) {
+
+$.effects.effect.fold = function( o, done ) {
+
+ // Create element
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ show = mode === "show",
+ hide = mode === "hide",
+ size = o.size || 15,
+ percent = /([0-9]+)%/.exec( size ),
+ horizFirst = !!o.horizFirst,
+ widthFirst = show !== horizFirst,
+ ref = widthFirst ? [ "width", "height" ] : [ "height", "width" ],
+ duration = o.duration / 2,
+ wrapper, distance,
+ animation1 = {},
+ animation2 = {};
+
+ $.effects.save( el, props );
+ el.show();
+
+ // Create Wrapper
+ wrapper = $.effects.createWrapper( el ).css({
+ overflow: "hidden"
+ });
+ distance = widthFirst ?
+ [ wrapper.width(), wrapper.height() ] :
+ [ wrapper.height(), wrapper.width() ];
+
+ if ( percent ) {
+ size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ];
+ }
+ if ( show ) {
+ wrapper.css( horizFirst ? {
+ height: 0,
+ width: size
+ } : {
+ height: size,
+ width: 0
+ });
+ }
+
+ // Animation
+ animation1[ ref[ 0 ] ] = show ? distance[ 0 ] : size;
+ animation2[ ref[ 1 ] ] = show ? distance[ 1 ] : 0;
+
+ // Animate
+ wrapper
+ .animate( animation1, duration, o.easing )
+ .animate( animation2, duration, o.easing, function() {
+ if ( hide ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ });
+
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.highlight = function( o, done ) {
+ var elem = $( this ),
+ props = [ "backgroundImage", "backgroundColor", "opacity" ],
+ mode = $.effects.setMode( elem, o.mode || "show" ),
+ animation = {
+ backgroundColor: elem.css( "backgroundColor" )
+ };
+
+ if (mode === "hide") {
+ animation.opacity = 0;
+ }
+
+ $.effects.save( elem, props );
+
+ elem
+ .show()
+ .css({
+ backgroundImage: "none",
+ backgroundColor: o.color || "#ffff99"
+ })
+ .animate( animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( mode === "hide" ) {
+ elem.hide();
+ }
+ $.effects.restore( elem, props );
+ done();
+ }
+ });
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.pulsate = function( o, done ) {
+ var elem = $( this ),
+ mode = $.effects.setMode( elem, o.mode || "show" ),
+ show = mode === "show",
+ hide = mode === "hide",
+ showhide = ( show || mode === "hide" ),
+
+ // showing or hiding leaves of the "last" animation
+ anims = ( ( o.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ),
+ duration = o.duration / anims,
+ animateTo = 0,
+ queue = elem.queue(),
+ queuelen = queue.length,
+ i;
+
+ if ( show || !elem.is(":visible")) {
+ elem.css( "opacity", 0 ).show();
+ animateTo = 1;
+ }
+
+ // anims - 1 opacity "toggles"
+ for ( i = 1; i < anims; i++ ) {
+ elem.animate({
+ opacity: animateTo
+ }, duration, o.easing );
+ animateTo = 1 - animateTo;
+ }
+
+ elem.animate({
+ opacity: animateTo
+ }, duration, o.easing);
+
+ elem.queue(function() {
+ if ( hide ) {
+ elem.hide();
+ }
+ done();
+ });
+
+ // We just queued up "anims" animations, we need to put them next in the queue
+ if ( queuelen > 1 ) {
+ queue.splice.apply( queue,
+ [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) );
+ }
+ elem.dequeue();
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.puff = function( o, done ) {
+ var elem = $( this ),
+ mode = $.effects.setMode( elem, o.mode || "hide" ),
+ hide = mode === "hide",
+ percent = parseInt( o.percent, 10 ) || 150,
+ factor = percent / 100,
+ original = {
+ height: elem.height(),
+ width: elem.width(),
+ outerHeight: elem.outerHeight(),
+ outerWidth: elem.outerWidth()
+ };
+
+ $.extend( o, {
+ effect: "scale",
+ queue: false,
+ fade: true,
+ mode: mode,
+ complete: done,
+ percent: hide ? percent : 100,
+ from: hide ?
+ original :
+ {
+ height: original.height * factor,
+ width: original.width * factor,
+ outerHeight: original.outerHeight * factor,
+ outerWidth: original.outerWidth * factor
+ }
+ });
+
+ elem.effect( o );
+};
+
+$.effects.effect.scale = function( o, done ) {
+
+ // Create element
+ var el = $( this ),
+ options = $.extend( true, {}, o ),
+ mode = $.effects.setMode( el, o.mode || "effect" ),
+ percent = parseInt( o.percent, 10 ) ||
+ ( parseInt( o.percent, 10 ) === 0 ? 0 : ( mode === "hide" ? 0 : 100 ) ),
+ direction = o.direction || "both",
+ origin = o.origin,
+ original = {
+ height: el.height(),
+ width: el.width(),
+ outerHeight: el.outerHeight(),
+ outerWidth: el.outerWidth()
+ },
+ factor = {
+ y: direction !== "horizontal" ? (percent / 100) : 1,
+ x: direction !== "vertical" ? (percent / 100) : 1
+ };
+
+ // We are going to pass this effect to the size effect:
+ options.effect = "size";
+ options.queue = false;
+ options.complete = done;
+
+ // Set default origin and restore for show/hide
+ if ( mode !== "effect" ) {
+ options.origin = origin || ["middle","center"];
+ options.restore = true;
+ }
+
+ options.from = o.from || ( mode === "show" ? {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ } : original );
+ options.to = {
+ height: original.height * factor.y,
+ width: original.width * factor.x,
+ outerHeight: original.outerHeight * factor.y,
+ outerWidth: original.outerWidth * factor.x
+ };
+
+ // Fade option to support puff
+ if ( options.fade ) {
+ if ( mode === "show" ) {
+ options.from.opacity = 0;
+ options.to.opacity = 1;
+ }
+ if ( mode === "hide" ) {
+ options.from.opacity = 1;
+ options.to.opacity = 0;
+ }
+ }
+
+ // Animate
+ el.effect( options );
+
+};
+
+$.effects.effect.size = function( o, done ) {
+
+ // Create element
+ var original, baseline, factor,
+ el = $( this ),
+ props0 = [ "position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity" ],
+
+ // Always restore
+ props1 = [ "position", "top", "bottom", "left", "right", "overflow", "opacity" ],
+
+ // Copy for children
+ props2 = [ "width", "height", "overflow" ],
+ cProps = [ "fontSize" ],
+ vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ],
+ hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ],
+
+ // Set options
+ mode = $.effects.setMode( el, o.mode || "effect" ),
+ restore = o.restore || mode !== "effect",
+ scale = o.scale || "both",
+ origin = o.origin || [ "middle", "center" ],
+ position = el.css( "position" ),
+ props = restore ? props0 : props1,
+ zero = {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ };
+
+ if ( mode === "show" ) {
+ el.show();
+ }
+ original = {
+ height: el.height(),
+ width: el.width(),
+ outerHeight: el.outerHeight(),
+ outerWidth: el.outerWidth()
+ };
+
+ if ( o.mode === "toggle" && mode === "show" ) {
+ el.from = o.to || zero;
+ el.to = o.from || original;
+ } else {
+ el.from = o.from || ( mode === "show" ? zero : original );
+ el.to = o.to || ( mode === "hide" ? zero : original );
+ }
+
+ // Set scaling factor
+ factor = {
+ from: {
+ y: el.from.height / original.height,
+ x: el.from.width / original.width
+ },
+ to: {
+ y: el.to.height / original.height,
+ x: el.to.width / original.width
+ }
+ };
+
+ // Scale the css box
+ if ( scale === "box" || scale === "both" ) {
+
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ props = props.concat( vProps );
+ el.from = $.effects.setTransition( el, vProps, factor.from.y, el.from );
+ el.to = $.effects.setTransition( el, vProps, factor.to.y, el.to );
+ }
+
+ // Horizontal props scaling
+ if ( factor.from.x !== factor.to.x ) {
+ props = props.concat( hProps );
+ el.from = $.effects.setTransition( el, hProps, factor.from.x, el.from );
+ el.to = $.effects.setTransition( el, hProps, factor.to.x, el.to );
+ }
+ }
+
+ // Scale the content
+ if ( scale === "content" || scale === "both" ) {
+
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ props = props.concat( cProps ).concat( props2 );
+ el.from = $.effects.setTransition( el, cProps, factor.from.y, el.from );
+ el.to = $.effects.setTransition( el, cProps, factor.to.y, el.to );
+ }
+ }
+
+ $.effects.save( el, props );
+ el.show();
+ $.effects.createWrapper( el );
+ el.css( "overflow", "hidden" ).css( el.from );
+
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ baseline = $.effects.getBaseline( origin, original );
+ el.from.top = ( original.outerHeight - el.outerHeight() ) * baseline.y;
+ el.from.left = ( original.outerWidth - el.outerWidth() ) * baseline.x;
+ el.to.top = ( original.outerHeight - el.to.outerHeight ) * baseline.y;
+ el.to.left = ( original.outerWidth - el.to.outerWidth ) * baseline.x;
+ }
+ el.css( el.from ); // set top & left
+
+ // Animate
+ if ( scale === "content" || scale === "both" ) { // Scale the children
+
+ // Add margins/font-size
+ vProps = vProps.concat([ "marginTop", "marginBottom" ]).concat(cProps);
+ hProps = hProps.concat([ "marginLeft", "marginRight" ]);
+ props2 = props0.concat(vProps).concat(hProps);
+
+ el.find( "*[width]" ).each( function(){
+ var child = $( this ),
+ c_original = {
+ height: child.height(),
+ width: child.width(),
+ outerHeight: child.outerHeight(),
+ outerWidth: child.outerWidth()
+ };
+ if (restore) {
+ $.effects.save(child, props2);
+ }
+
+ child.from = {
+ height: c_original.height * factor.from.y,
+ width: c_original.width * factor.from.x,
+ outerHeight: c_original.outerHeight * factor.from.y,
+ outerWidth: c_original.outerWidth * factor.from.x
+ };
+ child.to = {
+ height: c_original.height * factor.to.y,
+ width: c_original.width * factor.to.x,
+ outerHeight: c_original.height * factor.to.y,
+ outerWidth: c_original.width * factor.to.x
+ };
+
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ child.from = $.effects.setTransition( child, vProps, factor.from.y, child.from );
+ child.to = $.effects.setTransition( child, vProps, factor.to.y, child.to );
+ }
+
+ // Horizontal props scaling
+ if ( factor.from.x !== factor.to.x ) {
+ child.from = $.effects.setTransition( child, hProps, factor.from.x, child.from );
+ child.to = $.effects.setTransition( child, hProps, factor.to.x, child.to );
+ }
+
+ // Animate children
+ child.css( child.from );
+ child.animate( child.to, o.duration, o.easing, function() {
+
+ // Restore children
+ if ( restore ) {
+ $.effects.restore( child, props2 );
+ }
+ });
+ });
+ }
+
+ // Animate
+ el.animate( el.to, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( el.to.opacity === 0 ) {
+ el.css( "opacity", el.from.opacity );
+ }
+ if( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ if ( !restore ) {
+
+ // we need to calculate our new positioning based on the scaling
+ if ( position === "static" ) {
+ el.css({
+ position: "relative",
+ top: el.to.top,
+ left: el.to.left
+ });
+ } else {
+ $.each([ "top", "left" ], function( idx, pos ) {
+ el.css( pos, function( _, str ) {
+ var val = parseInt( str, 10 ),
+ toRef = idx ? el.to.left : el.to.top;
+
+ // if original was "auto", recalculate the new value from wrapper
+ if ( str === "auto" ) {
+ return toRef + "px";
+ }
+
+ return val + toRef + "px";
+ });
+ });
+ }
+ }
+
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.shake = function( o, done ) {
+
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "effect" ),
+ direction = o.direction || "left",
+ distance = o.distance || 20,
+ times = o.times || 3,
+ anims = times * 2 + 1,
+ speed = Math.round(o.duration/anims),
+ ref = (direction === "up" || direction === "down") ? "top" : "left",
+ positiveMotion = (direction === "up" || direction === "left"),
+ animation = {},
+ animation1 = {},
+ animation2 = {},
+ i,
+
+ // we will need to re-assemble the queue to stack our animations in place
+ queue = el.queue(),
+ queuelen = queue.length;
+
+ $.effects.save( el, props );
+ el.show();
+ $.effects.createWrapper( el );
+
+ // Animation
+ animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance;
+ animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2;
+ animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2;
+
+ // Animate
+ el.animate( animation, speed, o.easing );
+
+ // Shakes
+ for ( i = 1; i < times; i++ ) {
+ el.animate( animation1, speed, o.easing ).animate( animation2, speed, o.easing );
+ }
+ el
+ .animate( animation1, speed, o.easing )
+ .animate( animation, speed / 2, o.easing )
+ .queue(function() {
+ if ( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ });
+
+ // inject all the animations we just queued to be first in line (after "inprogress")
+ if ( queuelen > 1) {
+ queue.splice.apply( queue,
+ [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) );
+ }
+ el.dequeue();
+
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.slide = function( o, done ) {
+
+ // Create element
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "width", "height" ],
+ mode = $.effects.setMode( el, o.mode || "show" ),
+ show = mode === "show",
+ direction = o.direction || "left",
+ ref = (direction === "up" || direction === "down") ? "top" : "left",
+ positiveMotion = (direction === "up" || direction === "left"),
+ distance,
+ animation = {};
+
+ // Adjust
+ $.effects.save( el, props );
+ el.show();
+ distance = o.distance || el[ ref === "top" ? "outerHeight" : "outerWidth" ]( true );
+
+ $.effects.createWrapper( el ).css({
+ overflow: "hidden"
+ });
+
+ if ( show ) {
+ el.css( ref, positiveMotion ? (isNaN(distance) ? "-" + distance : -distance) : distance );
+ }
+
+ // Animation
+ animation[ ref ] = ( show ?
+ ( positiveMotion ? "+=" : "-=") :
+ ( positiveMotion ? "-=" : "+=")) +
+ distance;
+
+ // Animate
+ el.animate( animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.effects.effect.transfer = function( o, done ) {
+ var elem = $( this ),
+ target = $( o.to ),
+ targetFixed = target.css( "position" ) === "fixed",
+ body = $("body"),
+ fixTop = targetFixed ? body.scrollTop() : 0,
+ fixLeft = targetFixed ? body.scrollLeft() : 0,
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top - fixTop ,
+ left: endPosition.left - fixLeft ,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $( "<div class='ui-effects-transfer'></div>" )
+ .appendTo( document.body )
+ .addClass( o.className )
+ .css({
+ top: startPosition.top - fixTop ,
+ left: startPosition.left - fixLeft ,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: targetFixed ? "fixed" : "absolute"
+ })
+ .animate( animation, o.duration, o.easing, function() {
+ transfer.remove();
+ done();
+ });
+};
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.widget( "ui.menu", {
+ version: "1.10.0",
+ defaultElement: "<ul>",
+ delay: 300,
+ options: {
+ icons: {
+ submenu: "ui-icon-carat-1-e"
+ },
+ menus: "ul",
+ position: {
+ my: "left top",
+ at: "right top"
+ },
+ role: "menu",
+
+ // callbacks
+ blur: null,
+ focus: null,
+ select: null
+ },
+
+ _create: function() {
+ this.activeMenu = this.element;
+ // flag used to prevent firing of the click handler
+ // as the event bubbles up through nested menus
+ this.mouseHandled = false;
+ this.element
+ .uniqueId()
+ .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" )
+ .toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length )
+ .attr({
+ role: this.options.role,
+ tabIndex: 0
+ })
+ // need to catch all clicks on disabled menu
+ // not possible through _on
+ .bind( "click" + this.eventNamespace, $.proxy(function( event ) {
+ if ( this.options.disabled ) {
+ event.preventDefault();
+ }
+ }, this ));
+
+ if ( this.options.disabled ) {
+ this.element
+ .addClass( "ui-state-disabled" )
+ .attr( "aria-disabled", "true" );
+ }
+
+ this._on({
+ // Prevent focus from sticking to links inside menu after clicking
+ // them (focus should always stay on UL during navigation).
+ "mousedown .ui-menu-item > a": function( event ) {
+ event.preventDefault();
+ },
+ "click .ui-state-disabled > a": function( event ) {
+ event.preventDefault();
+ },
+ "click .ui-menu-item:has(a)": function( event ) {
+ var target = $( event.target ).closest( ".ui-menu-item" );
+ if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) {
+ this.mouseHandled = true;
+
+ this.select( event );
+ // Open submenu on click
+ if ( target.has( ".ui-menu" ).length ) {
+ this.expand( event );
+ } else if ( !this.element.is( ":focus" ) ) {
+ // Redirect focus to the menu
+ this.element.trigger( "focus", [ true ] );
+
+ // If the active item is on the top level, let it stay active.
+ // Otherwise, blur the active item since it is no longer visible.
+ if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) {
+ clearTimeout( this.timer );
+ }
+ }
+ }
+ },
+ "mouseenter .ui-menu-item": function( event ) {
+ var target = $( event.currentTarget );
+ // Remove ui-state-active class from siblings of the newly focused menu item
+ // to avoid a jump caused by adjacent elements both having a class with a border
+ target.siblings().children( ".ui-state-active" ).removeClass( "ui-state-active" );
+ this.focus( event, target );
+ },
+ mouseleave: "collapseAll",
+ "mouseleave .ui-menu": "collapseAll",
+ focus: function( event, keepActiveItem ) {
+ // If there's already an active item, keep it active
+ // If not, activate the first item
+ var item = this.active || this.element.children( ".ui-menu-item" ).eq( 0 );
+
+ if ( !keepActiveItem ) {
+ this.focus( event, item );
+ }
+ },
+ blur: function( event ) {
+ this._delay(function() {
+ if ( !$.contains( this.element[0], this.document[0].activeElement ) ) {
+ this.collapseAll( event );
+ }
+ });
+ },
+ keydown: "_keydown"
+ });
+
+ this.refresh();
+
+ // Clicks outside of a menu collapse any open menus
+ this._on( this.document, {
+ click: function( event ) {
+ if ( !$( event.target ).closest( ".ui-menu" ).length ) {
+ this.collapseAll( event );
+ }
+
+ // Reset the mouseHandled flag
+ this.mouseHandled = false;
+ }
+ });
+ },
+
+ _destroy: function() {
+ // Destroy (sub)menus
+ this.element
+ .removeAttr( "aria-activedescendant" )
+ .find( ".ui-menu" ).addBack()
+ .removeClass( "ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons" )
+ .removeAttr( "role" )
+ .removeAttr( "tabIndex" )
+ .removeAttr( "aria-labelledby" )
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "aria-hidden" )
+ .removeAttr( "aria-disabled" )
+ .removeUniqueId()
+ .show();
+
+ // Destroy menu items
+ this.element.find( ".ui-menu-item" )
+ .removeClass( "ui-menu-item" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-disabled" )
+ .children( "a" )
+ .removeUniqueId()
+ .removeClass( "ui-corner-all ui-state-hover" )
+ .removeAttr( "tabIndex" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-haspopup" )
+ .children().each( function() {
+ var elem = $( this );
+ if ( elem.data( "ui-menu-submenu-carat" ) ) {
+ elem.remove();
+ }
+ });
+
+ // Destroy menu dividers
+ this.element.find( ".ui-menu-divider" ).removeClass( "ui-menu-divider ui-widget-content" );
+ },
+
+ _keydown: function( event ) {
+ /*jshint maxcomplexity:20*/
+ var match, prev, character, skip, regex,
+ preventDefault = true;
+
+ function escape( value ) {
+ return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" );
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.PAGE_UP:
+ this.previousPage( event );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ this.nextPage( event );
+ break;
+ case $.ui.keyCode.HOME:
+ this._move( "first", "first", event );
+ break;
+ case $.ui.keyCode.END:
+ this._move( "last", "last", event );
+ break;
+ case $.ui.keyCode.UP:
+ this.previous( event );
+ break;
+ case $.ui.keyCode.DOWN:
+ this.next( event );
+ break;
+ case $.ui.keyCode.LEFT:
+ this.collapse( event );
+ break;
+ case $.ui.keyCode.RIGHT:
+ if ( this.active && !this.active.is( ".ui-state-disabled" ) ) {
+ this.expand( event );
+ }
+ break;
+ case $.ui.keyCode.ENTER:
+ case $.ui.keyCode.SPACE:
+ this._activate( event );
+ break;
+ case $.ui.keyCode.ESCAPE:
+ this.collapse( event );
+ break;
+ default:
+ preventDefault = false;
+ prev = this.previousFilter || "";
+ character = String.fromCharCode( event.keyCode );
+ skip = false;
+
+ clearTimeout( this.filterTimer );
+
+ if ( character === prev ) {
+ skip = true;
+ } else {
+ character = prev + character;
+ }
+
+ regex = new RegExp( "^" + escape( character ), "i" );
+ match = this.activeMenu.children( ".ui-menu-item" ).filter(function() {
+ return regex.test( $( this ).children( "a" ).text() );
+ });
+ match = skip && match.index( this.active.next() ) !== -1 ?
+ this.active.nextAll( ".ui-menu-item" ) :
+ match;
+
+ // If no matches on the current filter, reset to the last character pressed
+ // to move down the menu to the first item that starts with that character
+ if ( !match.length ) {
+ character = String.fromCharCode( event.keyCode );
+ regex = new RegExp( "^" + escape( character ), "i" );
+ match = this.activeMenu.children( ".ui-menu-item" ).filter(function() {
+ return regex.test( $( this ).children( "a" ).text() );
+ });
+ }
+
+ if ( match.length ) {
+ this.focus( event, match );
+ if ( match.length > 1 ) {
+ this.previousFilter = character;
+ this.filterTimer = this._delay(function() {
+ delete this.previousFilter;
+ }, 1000 );
+ } else {
+ delete this.previousFilter;
+ }
+ } else {
+ delete this.previousFilter;
+ }
+ }
+
+ if ( preventDefault ) {
+ event.preventDefault();
+ }
+ },
+
+ _activate: function( event ) {
+ if ( !this.active.is( ".ui-state-disabled" ) ) {
+ if ( this.active.children( "a[aria-haspopup='true']" ).length ) {
+ this.expand( event );
+ } else {
+ this.select( event );
+ }
+ }
+ },
+
+ refresh: function() {
+ var menus,
+ icon = this.options.icons.submenu,
+ submenus = this.element.find( this.options.menus );
+
+ // Initialize nested menus
+ submenus.filter( ":not(.ui-menu)" )
+ .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" )
+ .hide()
+ .attr({
+ role: this.options.role,
+ "aria-hidden": "true",
+ "aria-expanded": "false"
+ })
+ .each(function() {
+ var menu = $( this ),
+ item = menu.prev( "a" ),
+ submenuCarat = $( "<span>" )
+ .addClass( "ui-menu-icon ui-icon " + icon )
+ .data( "ui-menu-submenu-carat", true );
+
+ item
+ .attr( "aria-haspopup", "true" )
+ .prepend( submenuCarat );
+ menu.attr( "aria-labelledby", item.attr( "id" ) );
+ });
+
+ menus = submenus.add( this.element );
+
+ // Don't refresh list items that are already adapted
+ menus.children( ":not(.ui-menu-item):has(a)" )
+ .addClass( "ui-menu-item" )
+ .attr( "role", "presentation" )
+ .children( "a" )
+ .uniqueId()
+ .addClass( "ui-corner-all" )
+ .attr({
+ tabIndex: -1,
+ role: this._itemRole()
+ });
+
+ // Initialize unlinked menu-items containing spaces and/or dashes only as dividers
+ menus.children( ":not(.ui-menu-item)" ).each(function() {
+ var item = $( this );
+ // hyphen, em dash, en dash
+ if ( !/[^\-—–\s]/.test( item.text() ) ) {
+ item.addClass( "ui-widget-content ui-menu-divider" );
+ }
+ });
+
+ // Add aria-disabled attribute to any disabled menu item
+ menus.children( ".ui-state-disabled" ).attr( "aria-disabled", "true" );
+
+ // If the active item has been removed, blur the menu
+ if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
+ this.blur();
+ }
+ },
+
+ _itemRole: function() {
+ return {
+ menu: "menuitem",
+ listbox: "option"
+ }[ this.options.role ];
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "icons" ) {
+ this.element.find( ".ui-menu-icon" )
+ .removeClass( this.options.icons.submenu )
+ .addClass( value.submenu );
+ }
+ this._super( key, value );
+ },
+
+ focus: function( event, item ) {
+ var nested, focused;
+ this.blur( event, event && event.type === "focus" );
+
+ this._scrollIntoView( item );
+
+ this.active = item.first();
+ focused = this.active.children( "a" ).addClass( "ui-state-focus" );
+ // Only update aria-activedescendant if there's a role
+ // otherwise we assume focus is managed elsewhere
+ if ( this.options.role ) {
+ this.element.attr( "aria-activedescendant", focused.attr( "id" ) );
+ }
+
+ // Highlight active parent menu item, if any
+ this.active
+ .parent()
+ .closest( ".ui-menu-item" )
+ .children( "a:first" )
+ .addClass( "ui-state-active" );
+
+ if ( event && event.type === "keydown" ) {
+ this._close();
+ } else {
+ this.timer = this._delay(function() {
+ this._close();
+ }, this.delay );
+ }
+
+ nested = item.children( ".ui-menu" );
+ if ( nested.length && ( /^mouse/.test( event.type ) ) ) {
+ this._startOpening(nested);
+ }
+ this.activeMenu = item.parent();
+
+ this._trigger( "focus", event, { item: item } );
+ },
+
+ _scrollIntoView: function( item ) {
+ var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight;
+ if ( this._hasScroll() ) {
+ borderTop = parseFloat( $.css( this.activeMenu[0], "borderTopWidth" ) ) || 0;
+ paddingTop = parseFloat( $.css( this.activeMenu[0], "paddingTop" ) ) || 0;
+ offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop;
+ scroll = this.activeMenu.scrollTop();
+ elementHeight = this.activeMenu.height();
+ itemHeight = item.height();
+
+ if ( offset < 0 ) {
+ this.activeMenu.scrollTop( scroll + offset );
+ } else if ( offset + itemHeight > elementHeight ) {
+ this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight );
+ }
+ }
+ },
+
+ blur: function( event, fromFocus ) {
+ if ( !fromFocus ) {
+ clearTimeout( this.timer );
+ }
+
+ if ( !this.active ) {
+ return;
+ }
+
+ this.active.children( "a" ).removeClass( "ui-state-focus" );
+ this.active = null;
+
+ this._trigger( "blur", event, { item: this.active } );
+ },
+
+ _startOpening: function( submenu ) {
+ clearTimeout( this.timer );
+
+ // Don't open if already open fixes a Firefox bug that caused a .5 pixel
+ // shift in the submenu position when mousing over the carat icon
+ if ( submenu.attr( "aria-hidden" ) !== "true" ) {
+ return;
+ }
+
+ this.timer = this._delay(function() {
+ this._close();
+ this._open( submenu );
+ }, this.delay );
+ },
+
+ _open: function( submenu ) {
+ var position = $.extend({
+ of: this.active
+ }, this.options.position );
+
+ clearTimeout( this.timer );
+ this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) )
+ .hide()
+ .attr( "aria-hidden", "true" );
+
+ submenu
+ .show()
+ .removeAttr( "aria-hidden" )
+ .attr( "aria-expanded", "true" )
+ .position( position );
+ },
+
+ collapseAll: function( event, all ) {
+ clearTimeout( this.timer );
+ this.timer = this._delay(function() {
+ // If we were passed an event, look for the submenu that contains the event
+ var currentMenu = all ? this.element :
+ $( event && event.target ).closest( this.element.find( ".ui-menu" ) );
+
+ // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway
+ if ( !currentMenu.length ) {
+ currentMenu = this.element;
+ }
+
+ this._close( currentMenu );
+
+ this.blur( event );
+ this.activeMenu = currentMenu;
+ }, this.delay );
+ },
+
+ // With no arguments, closes the currently active menu - if nothing is active
+ // it closes all menus. If passed an argument, it will search for menus BELOW
+ _close: function( startMenu ) {
+ if ( !startMenu ) {
+ startMenu = this.active ? this.active.parent() : this.element;
+ }
+
+ startMenu
+ .find( ".ui-menu" )
+ .hide()
+ .attr( "aria-hidden", "true" )
+ .attr( "aria-expanded", "false" )
+ .end()
+ .find( "a.ui-state-active" )
+ .removeClass( "ui-state-active" );
+ },
+
+ collapse: function( event ) {
+ var newItem = this.active &&
+ this.active.parent().closest( ".ui-menu-item", this.element );
+ if ( newItem && newItem.length ) {
+ this._close();
+ this.focus( event, newItem );
+ }
+ },
+
+ expand: function( event ) {
+ var newItem = this.active &&
+ this.active
+ .children( ".ui-menu " )
+ .children( ".ui-menu-item" )
+ .first();
+
+ if ( newItem && newItem.length ) {
+ this._open( newItem.parent() );
+
+ // Delay so Firefox will not hide activedescendant change in expanding submenu from AT
+ this._delay(function() {
+ this.focus( event, newItem );
+ });
+ }
+ },
+
+ next: function( event ) {
+ this._move( "next", "first", event );
+ },
+
+ previous: function( event ) {
+ this._move( "prev", "last", event );
+ },
+
+ isFirstItem: function() {
+ return this.active && !this.active.prevAll( ".ui-menu-item" ).length;
+ },
+
+ isLastItem: function() {
+ return this.active && !this.active.nextAll( ".ui-menu-item" ).length;
+ },
+
+ _move: function( direction, filter, event ) {
+ var next;
+ if ( this.active ) {
+ if ( direction === "first" || direction === "last" ) {
+ next = this.active
+ [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" )
+ .eq( -1 );
+ } else {
+ next = this.active
+ [ direction + "All" ]( ".ui-menu-item" )
+ .eq( 0 );
+ }
+ }
+ if ( !next || !next.length || !this.active ) {
+ next = this.activeMenu.children( ".ui-menu-item" )[ filter ]();
+ }
+
+ this.focus( event, next );
+ },
+
+ nextPage: function( event ) {
+ var item, base, height;
+
+ if ( !this.active ) {
+ this.next( event );
+ return;
+ }
+ if ( this.isLastItem() ) {
+ return;
+ }
+ if ( this._hasScroll() ) {
+ base = this.active.offset().top;
+ height = this.element.height();
+ this.active.nextAll( ".ui-menu-item" ).each(function() {
+ item = $( this );
+ return item.offset().top - base - height < 0;
+ });
+
+ this.focus( event, item );
+ } else {
+ this.focus( event, this.activeMenu.children( ".ui-menu-item" )
+ [ !this.active ? "first" : "last" ]() );
+ }
+ },
+
+ previousPage: function( event ) {
+ var item, base, height;
+ if ( !this.active ) {
+ this.next( event );
+ return;
+ }
+ if ( this.isFirstItem() ) {
+ return;
+ }
+ if ( this._hasScroll() ) {
+ base = this.active.offset().top;
+ height = this.element.height();
+ this.active.prevAll( ".ui-menu-item" ).each(function() {
+ item = $( this );
+ return item.offset().top - base + height > 0;
+ });
+
+ this.focus( event, item );
+ } else {
+ this.focus( event, this.activeMenu.children( ".ui-menu-item" ).first() );
+ }
+ },
+
+ _hasScroll: function() {
+ return this.element.outerHeight() < this.element.prop( "scrollHeight" );
+ },
+
+ select: function( event ) {
+ // TODO: It should never be possible to not have an active item at this
+ // point, but the tests don't trigger mouseenter before click.
+ this.active = this.active || $( event.target ).closest( ".ui-menu-item" );
+ var ui = { item: this.active };
+ if ( !this.active.has( ".ui-menu" ).length ) {
+ this.collapseAll( event, true );
+ }
+ this._trigger( "select", event, ui );
+ }
+});
+
+}( jQuery ));
+(function( $, undefined ) {
+
+$.widget( "ui.progressbar", {
+ version: "1.10.0",
+ options: {
+ max: 100,
+ value: 0,
+
+ change: null,
+ complete: null
+ },
+
+ min: 0,
+
+ _create: function() {
+ // Constrain initial value
+ this.oldValue = this.options.value = this._constrainedValue();
+
+ this.element
+ .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .attr({
+ // Only set static values, aria-valuenow and aria-valuemax are
+ // set inside _refreshValue()
+ role: "progressbar",
+ "aria-valuemin": this.min
+ });
+
+ this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+ .appendTo( this.element );
+
+ this._refreshValue();
+ },
+
+ _destroy: function() {
+ this.element
+ .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+
+ this.valueDiv.remove();
+ },
+
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
+ return this.options.value;
+ }
+
+ this.options.value = this._constrainedValue( newValue );
+ this._refreshValue();
+ },
+
+ _constrainedValue: function( newValue ) {
+ if ( newValue === undefined ) {
+ newValue = this.options.value;
+ }
+
+ this.indeterminate = newValue === false;
+
+ // sanitize value
+ if ( typeof newValue !== "number" ) {
+ newValue = 0;
+ }
+
+ return this.indeterminate ? false :
+ Math.min( this.options.max, Math.max( this.min, newValue ) );
+ },
+
+ _setOptions: function( options ) {
+ // Ensure "value" option is set after other values (like max)
+ var value = options.value;
+ delete options.value;
+
+ this._super( options );
+
+ this.options.value = this._constrainedValue( value );
+ this._refreshValue();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "max" ) {
+ // Don't allow a max less than min
+ value = Math.max( this.min, value );
+ }
+
+ this._super( key, value );
+ },
+
+ _percentage: function() {
+ return this.indeterminate ? 100 : 100 * ( this.options.value - this.min ) / ( this.options.max - this.min );
+ },
+
+ _refreshValue: function() {
+ var value = this.options.value,
+ percentage = this._percentage();
+
+ this.valueDiv
+ .toggle( this.indeterminate || value > this.min )
+ .toggleClass( "ui-corner-right", value === this.options.max )
+ .width( percentage.toFixed(0) + "%" );
+
+ this.element.toggleClass( "ui-progressbar-indeterminate", this.indeterminate );
+
+ if ( this.indeterminate ) {
+ this.element.removeAttr( "aria-valuenow" );
+ if ( !this.overlayDiv ) {
+ this.overlayDiv = $( "<div class='ui-progressbar-overlay'></div>" ).appendTo( this.valueDiv );
+ }
+ } else {
+ this.element.attr({
+ "aria-valuemax": this.options.max,
+ "aria-valuenow": value
+ });
+ if ( this.overlayDiv ) {
+ this.overlayDiv.remove();
+ this.overlayDiv = null;
+ }
+ }
+
+ if ( this.oldValue !== value ) {
+ this.oldValue = value;
+ this._trigger( "change" );
+ }
+ if ( value === this.options.max ) {
+ this._trigger( "complete" );
+ }
+ }
+});
+
+})( jQuery );
+(function( $, undefined ) {
+
+function num(v) {
+ return parseInt(v, 10) || 0;
+}
+
+function isNumber(value) {
+ return !isNaN(parseInt(value, 10));
+}
+
+$.widget("ui.resizable", $.ui.mouse, {
+ version: "1.10.0",
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ // See #7960
+ zIndex: 90,
+
+ // callbacks
+ resize: null,
+ start: null,
+ stop: null
+ },
+ _create: function() {
+
+ var n, i, handle, axis, hname,
+ that = this,
+ o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({
+ position: this.element.css("position"),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css("top"),
+ left: this.element.css("left")
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "ui-resizable", this.element.data("ui-resizable")
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css("resize");
+ this.originalElement.css("resize", "none");
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: "static", zoom: 1, display: "block" }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css("margin") });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$(".ui-resizable-handle", this.element).length ? "e,s,se" : { n: ".ui-resizable-n", e: ".ui-resizable-e", s: ".ui-resizable-s", w: ".ui-resizable-w", se: ".ui-resizable-se", sw: ".ui-resizable-sw", ne: ".ui-resizable-ne", nw: ".ui-resizable-nw" });
+ if(this.handles.constructor === String) {
+
+ if ( this.handles === "all") {
+ this.handles = "n,e,s,w,se,sw,ne,nw";
+ }
+
+ n = this.handles.split(",");
+ this.handles = {};
+
+ for(i = 0; i < n.length; i++) {
+
+ handle = $.trim(n[i]);
+ hname = "ui-resizable-"+handle;
+ axis = $("<div class='ui-resizable-handle " + hname + "'></div>");
+
+ // Apply zIndex to all handles - see #7960
+ axis.css({ zIndex: o.zIndex });
+
+ //TODO : What's going on here?
+ if ("se" === handle) {
+ axis.addClass("ui-icon ui-icon-gripsmall-diagonal-se");
+ }
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = ".ui-resizable-"+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ var i, axis, padPos, padWrapper;
+
+ target = target || this.element;
+
+ for(i in this.handles) {
+
+ if(this.handles[i].constructor === String) {
+ this.handles[i] = $(this.handles[i], this.element).show();
+ }
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ axis = $(this.handles[i], this.element);
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ padPos = [ "padding",
+ /ne|nw|n/.test(i) ? "Top" :
+ /se|sw|s/.test(i) ? "Bottom" :
+ /^e$/.test(i) ? "Right" : "Left" ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length) {
+ continue;
+ }
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $(".ui-resizable-handle", this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!that.resizing) {
+ if (this.className) {
+ axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ }
+ //Axis, default = se
+ that.axis = axis && axis[1] ? axis[1] : "se";
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .mouseenter(function() {
+ if (o.disabled) {
+ return;
+ }
+ $(this).removeClass("ui-resizable-autohide");
+ that._handles.show();
+ })
+ .mouseleave(function(){
+ if (o.disabled) {
+ return;
+ }
+ if (!that.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ that._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ _destroy: function() {
+
+ this._mouseDestroy();
+
+ var wrapper,
+ _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ wrapper = this.element;
+ this.originalElement.css({
+ position: wrapper.css("position"),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css("top"),
+ left: wrapper.css("left")
+ }).insertAfter( wrapper );
+ wrapper.remove();
+ }
+
+ this.originalElement.css("resize", this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+ var i, handle,
+ capture = false;
+
+ for (i in this.handles) {
+ handle = $(this.handles[i])[0];
+ if (handle === event.target || $.contains(handle, event.target)) {
+ capture = true;
+ }
+ }
+
+ return !this.options.disabled && capture;
+ },
+
+ _mouseStart: function(event) {
+
+ var curleft, curtop, cursor,
+ o = this.options,
+ iniPos = this.element.position(),
+ el = this.element;
+
+ this.resizing = true;
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if ( (/absolute/).test( el.css("position") ) ) {
+ el.css({ position: "absolute", top: el.css("top"), left: el.css("left") });
+ } else if (el.is(".ui-draggable")) {
+ el.css({ position: "absolute", top: iniPos.top, left: iniPos.left });
+ }
+
+ this._renderProxy();
+
+ curleft = num(this.helper.css("left"));
+ curtop = num(this.helper.css("top"));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio === "number") ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ cursor = $(".ui-resizable-" + this.axis).css("cursor");
+ $("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var data,
+ el = this.helper, props = {},
+ smp = this.originalMousePosition,
+ a = this.axis,
+ prevTop = this.position.top,
+ prevLeft = this.position.left,
+ prevWidth = this.size.width,
+ prevHeight = this.size.height,
+ dx = (event.pageX-smp.left)||0,
+ dy = (event.pageY-smp.top)||0,
+ trigger = this._change[a];
+
+ if (!trigger) {
+ return false;
+ }
+
+ // Calculate the attrs that will be change
+ data = trigger.apply(this, [event, dx, dy]);
+
+ // Put this in the mouseDrag handler since the user can start pressing shift while resizing
+ this._updateVirtualBoundaries(event.shiftKey);
+ if (this._aspectRatio || event.shiftKey) {
+ data = this._updateRatio(data, event);
+ }
+
+ data = this._respectSize(data, event);
+
+ this._updateCache(data);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ if (this.position.top !== prevTop) {
+ props.top = this.position.top + "px";
+ }
+ if (this.position.left !== prevLeft) {
+ props.left = this.position.left + "px";
+ }
+ if (this.size.width !== prevWidth) {
+ props.width = this.size.width + "px";
+ }
+ if (this.size.height !== prevHeight) {
+ props.height = this.size.height + "px";
+ }
+ el.css(props);
+
+ if (!this._helper && this._proportionallyResizeElements.length) {
+ this._proportionallyResize();
+ }
+
+ // Call the user callback if the element was resized
+ if ( ! $.isEmptyObject(props) ) {
+ this._trigger("resize", event, this.ui());
+ }
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var pr, ista, soffseth, soffsetw, s, left, top,
+ o = this.options, that = this;
+
+ if(this._helper) {
+
+ pr = this._proportionallyResizeElements;
+ ista = pr.length && (/textarea/i).test(pr[0].nodeName);
+ soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height;
+ soffsetw = ista ? 0 : that.sizeDiff.width;
+
+ s = { width: (that.helper.width() - soffsetw), height: (that.helper.height() - soffseth) };
+ left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) || null;
+ top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) || null;
+
+ if (!o.animate) {
+ this.element.css($.extend(s, { top: top, left: left }));
+ }
+
+ that.helper.height(that.size.height);
+ that.helper.width(that.size.width);
+
+ if (this._helper && !o.animate) {
+ this._proportionallyResize();
+ }
+ }
+
+ $("body").css("cursor", "auto");
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) {
+ this.helper.remove();
+ }
+
+ return false;
+
+ },
+
+ _updateVirtualBoundaries: function(forceAspectRatio) {
+ var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
+ o = this.options;
+
+ b = {
+ minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
+ maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
+ minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
+ maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
+ };
+
+ if(this._aspectRatio || forceAspectRatio) {
+ // We want to create an enclosing box whose aspect ration is the requested one
+ // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
+ pMinWidth = b.minHeight * this.aspectRatio;
+ pMinHeight = b.minWidth / this.aspectRatio;
+ pMaxWidth = b.maxHeight * this.aspectRatio;
+ pMaxHeight = b.maxWidth / this.aspectRatio;
+
+ if(pMinWidth > b.minWidth) {
+ b.minWidth = pMinWidth;
+ }
+ if(pMinHeight > b.minHeight) {
+ b.minHeight = pMinHeight;
+ }
+ if(pMaxWidth < b.maxWidth) {
+ b.maxWidth = pMaxWidth;
+ }
+ if(pMaxHeight < b.maxHeight) {
+ b.maxHeight = pMaxHeight;
+ }
+ }
+ this._vBoundaries = b;
+ },
+
+ _updateCache: function(data) {
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) {
+ this.position.left = data.left;
+ }
+ if (isNumber(data.top)) {
+ this.position.top = data.top;
+ }
+ if (isNumber(data.height)) {
+ this.size.height = data.height;
+ }
+ if (isNumber(data.width)) {
+ this.size.width = data.width;
+ }
+ },
+
+ _updateRatio: function( data ) {
+
+ var cpos = this.position,
+ csize = this.size,
+ a = this.axis;
+
+ if (isNumber(data.height)) {
+ data.width = (data.height * this.aspectRatio);
+ } else if (isNumber(data.width)) {
+ data.height = (data.width / this.aspectRatio);
+ }
+
+ if (a === "sw") {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a === "nw") {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function( data ) {
+
+ var o = this._vBoundaries,
+ a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height),
+ dw = this.originalPosition.left + this.originalSize.width,
+ dh = this.position.top + this.size.height,
+ cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+ if (isminw) {
+ data.width = o.minWidth;
+ }
+ if (isminh) {
+ data.height = o.minHeight;
+ }
+ if (ismaxw) {
+ data.width = o.maxWidth;
+ }
+ if (ismaxh) {
+ data.height = o.maxHeight;
+ }
+
+ if (isminw && cw) {
+ data.left = dw - o.minWidth;
+ }
+ if (ismaxw && cw) {
+ data.left = dw - o.maxWidth;
+ }
+ if (isminh && ch) {
+ data.top = dh - o.minHeight;
+ }
+ if (ismaxh && ch) {
+ data.top = dh - o.maxHeight;
+ }
+
+ // fixing jump error on top/left - bug #2330
+ if (!data.width && !data.height && !data.left && data.top) {
+ data.top = null;
+ } else if (!data.width && !data.height && !data.top && data.left) {
+ data.left = null;
+ }
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ if (!this._proportionallyResizeElements.length) {
+ return;
+ }
+
+ var i, j, borders, paddings, prel,
+ element = this.helper || this.element;
+
+ for ( i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ this.borderDif = [];
+ borders = [prel.css("borderTopWidth"), prel.css("borderRightWidth"), prel.css("borderBottomWidth"), prel.css("borderLeftWidth")];
+ paddings = [prel.css("paddingTop"), prel.css("paddingRight"), prel.css("paddingBottom"), prel.css("paddingLeft")];
+
+ for ( j = 0; j < borders.length; j++ ) {
+ this.borderDif[ j ] = ( parseInt( borders[ j ], 10 ) || 0 ) + ( parseInt( paddings[ j ], 10 ) || 0 );
+ }
+ }
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ }
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $("<div style='overflow:hidden;'></div>");
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() - 1,
+ height: this.element.outerHeight() - 1,
+ position: "absolute",
+ left: this.elementOffset.left +"px",
+ top: this.elementOffset.top +"px",
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx) {
+ var cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n !== "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function( event ) {
+ var that = $(this).data("ui-resizable"),
+ o = that.options,
+ pr = that._proportionallyResizeElements,
+ ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height,
+ soffsetw = ista ? 0 : that.sizeDiff.width,
+ style = { width: (that.size.width - soffsetw), height: (that.size.height - soffseth) },
+ left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) || null,
+ top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) || null;
+
+ that.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(that.element.css("width"), 10),
+ height: parseInt(that.element.css("height"), 10),
+ top: parseInt(that.element.css("top"), 10),
+ left: parseInt(that.element.css("left"), 10)
+ };
+
+ if (pr && pr.length) {
+ $(pr[0]).css({ width: data.width, height: data.height });
+ }
+
+ // propagating resize, and updating values for each animation step
+ that._updateCache(data);
+ that._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function() {
+ var element, p, co, ch, cw, width, height,
+ that = $(this).data("ui-resizable"),
+ o = that.options,
+ el = that.element,
+ oc = o.containment,
+ ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+
+ if (!ce) {
+ return;
+ }
+
+ that.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc === document) {
+ that.containerOffset = { left: 0, top: 0 };
+ that.containerPosition = { left: 0, top: 0 };
+
+ that.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ element = $(ce);
+ p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ that.containerOffset = element.offset();
+ that.containerPosition = element.position();
+ that.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ co = that.containerOffset;
+ ch = that.containerSize.height;
+ cw = that.containerSize.width;
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw );
+ height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ that.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function( event ) {
+ var woset, hoset, isParent, isOffsetRelative,
+ that = $(this).data("ui-resizable"),
+ o = that.options,
+ co = that.containerOffset, cp = that.position,
+ pRatio = that._aspectRatio || event.shiftKey,
+ cop = { top:0, left:0 }, ce = that.containerElement;
+
+ if (ce[0] !== document && (/static/).test(ce.css("position"))) {
+ cop = co;
+ }
+
+ if (cp.left < (that._helper ? co.left : 0)) {
+ that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left));
+ if (pRatio) {
+ that.size.height = that.size.width / that.aspectRatio;
+ }
+ that.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (that._helper ? co.top : 0)) {
+ that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top);
+ if (pRatio) {
+ that.size.width = that.size.height * that.aspectRatio;
+ }
+ that.position.top = that._helper ? co.top : 0;
+ }
+
+ that.offset.left = that.parentData.left+that.position.left;
+ that.offset.top = that.parentData.top+that.position.top;
+
+ woset = Math.abs( (that._helper ? that.offset.left - cop.left : (that.offset.left - cop.left)) + that.sizeDiff.width );
+ hoset = Math.abs( (that._helper ? that.offset.top - cop.top : (that.offset.top - co.top)) + that.sizeDiff.height );
+
+ isParent = that.containerElement.get(0) === that.element.parent().get(0);
+ isOffsetRelative = /relative|absolute/.test(that.containerElement.css("position"));
+
+ if(isParent && isOffsetRelative) {
+ woset -= that.parentData.left;
+ }
+
+ if (woset + that.size.width >= that.parentData.width) {
+ that.size.width = that.parentData.width - woset;
+ if (pRatio) {
+ that.size.height = that.size.width / that.aspectRatio;
+ }
+ }
+
+ if (hoset + that.size.height >= that.parentData.height) {
+ that.size.height = that.parentData.height - hoset;
+ if (pRatio) {
+ that.size.width = that.size.height * that.aspectRatio;
+ }
+ }
+ },
+
+ stop: function(){
+ var that = $(this).data("ui-resizable"),
+ o = that.options,
+ co = that.containerOffset,
+ cop = that.containerPosition,
+ ce = that.containerElement,
+ helper = $(that.helper),
+ ho = helper.offset(),
+ w = helper.outerWidth() - that.sizeDiff.width,
+ h = helper.outerHeight() - that.sizeDiff.height;
+
+ if (that._helper && !o.animate && (/relative/).test(ce.css("position"))) {
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+ }
+
+ if (that._helper && !o.animate && (/static/).test(ce.css("position"))) {
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+ }
+
+ }
+});
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function () {
+ var that = $(this).data("ui-resizable"),
+ o = that.options,
+ _store = function (exp) {
+ $(exp).each(function() {
+ var el = $(this);
+ el.data("ui-resizable-alsoresize", {
+ width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
+ left: parseInt(el.css("left"), 10), top: parseInt(el.css("top"), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) === "object" && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function (event, ui) {
+ var that = $(this).data("ui-resizable"),
+ o = that.options,
+ os = that.originalSize,
+ op = that.originalPosition,
+ delta = {
+ height: (that.size.height - os.height) || 0, width: (that.size.width - os.width) || 0,
+ top: (that.position.top - op.top) || 0, left: (that.position.left - op.left) || 0
+ },
+
+ _alsoResize = function (exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("ui-resizable-alsoresize"), style = {},
+ css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ["width", "height"] : ["width", "height", "top", "left"];
+
+ $.each(css, function (i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0) {
+ style[prop] = sum || null;
+ }
+ });
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) === "object" && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function () {
+ $(this).removeData("resizable-alsoresize");
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function() {
+
+ var that = $(this).data("ui-resizable"), o = that.options, cs = that.size;
+
+ that.ghost = that.originalElement.clone();
+ that.ghost
+ .css({ opacity: 0.25, display: "block", position: "relative", height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass("ui-resizable-ghost")
+ .addClass(typeof o.ghost === "string" ? o.ghost : "");
+
+ that.ghost.appendTo(that.helper);
+
+ },
+
+ resize: function(){
+ var that = $(this).data("ui-resizable");
+ if (that.ghost) {
+ that.ghost.css({ position: "relative", height: that.size.height, width: that.size.width });
+ }
+ },
+
+ stop: function() {
+ var that = $(this).data("ui-resizable");
+ if (that.ghost && that.helper) {
+ that.helper.get(0).removeChild(that.ghost.get(0));
+ }
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function() {
+ var that = $(this).data("ui-resizable"),
+ o = that.options,
+ cs = that.size,
+ os = that.originalSize,
+ op = that.originalPosition,
+ a = that.axis,
+ grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid,
+ gridX = (grid[0]||1),
+ gridY = (grid[1]||1),
+ ox = Math.round((cs.width - os.width) / gridX) * gridX,
+ oy = Math.round((cs.height - os.height) / gridY) * gridY,
+ newWidth = os.width + ox,
+ newHeight = os.height + oy,
+ isMaxWidth = o.maxWidth && (o.maxWidth < newWidth),
+ isMaxHeight = o.maxHeight && (o.maxHeight < newHeight),
+ isMinWidth = o.minWidth && (o.minWidth > newWidth),
+ isMinHeight = o.minHeight && (o.minHeight > newHeight);
+
+ o.grid = grid;
+
+ if (isMinWidth) {
+ newWidth = newWidth + gridX;
+ }
+ if (isMinHeight) {
+ newHeight = newHeight + gridY;
+ }
+ if (isMaxWidth) {
+ newWidth = newWidth - gridX;
+ }
+ if (isMaxHeight) {
+ newHeight = newHeight - gridY;
+ }
+
+ if (/^(se|s|e)$/.test(a)) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ } else if (/^(ne)$/.test(a)) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ that.position.top = op.top - oy;
+ } else if (/^(sw)$/.test(a)) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ that.position.left = op.left - ox;
+ } else {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ that.position.top = op.top - oy;
+ that.position.left = op.left - ox;
+ }
+ }
+
+});
+
+})(jQuery);
+(function( $, undefined ) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+ version: "1.10.0",
+ options: {
+ appendTo: "body",
+ autoRefresh: true,
+ distance: 0,
+ filter: "*",
+ tolerance: "touch",
+
+ // callbacks
+ selected: null,
+ selecting: null,
+ start: null,
+ stop: null,
+ unselected: null,
+ unselecting: null
+ },
+ _create: function() {
+ var selectees,
+ that = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ this.refresh = function() {
+ selectees = $(that.options.filter, that.element[0]);
+ selectees.addClass("ui-selectee");
+ selectees.each(function() {
+ var $this = $(this),
+ pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass("ui-selected"),
+ selecting: $this.hasClass("ui-selecting"),
+ unselecting: $this.hasClass("ui-unselecting")
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $("<div class='ui-selectable-helper'></div>");
+ },
+
+ _destroy: function() {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled");
+ this._mouseDestroy();
+ },
+
+ _mouseStart: function(event) {
+ var that = this,
+ options = this.options;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled) {
+ return;
+ }
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "left": event.pageX,
+ "top": event.pageY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter(".ui-selected").each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey && !event.ctrlKey) {
+ selectee.$element.removeClass("ui-selected");
+ selectee.selected = false;
+ selectee.$element.addClass("ui-unselecting");
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ that._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().addBack().each(function() {
+ var doSelect,
+ selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass("ui-selected");
+ selectee.$element
+ .removeClass(doSelect ? "ui-unselecting" : "ui-selected")
+ .addClass(doSelect ? "ui-selecting" : "ui-unselecting");
+ selectee.unselecting = !doSelect;
+ selectee.selecting = doSelect;
+ selectee.selected = doSelect;
+ // selectable (UN)SELECTING callback
+ if (doSelect) {
+ that._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ } else {
+ that._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+
+ this.dragged = true;
+
+ if (this.options.disabled) {
+ return;
+ }
+
+ var tmp,
+ that = this,
+ options = this.options,
+ x1 = this.opos[0],
+ y1 = this.opos[1],
+ x2 = event.pageX,
+ y2 = event.pageY;
+
+ if (x1 > x2) { tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item"),
+ hit = false;
+
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element === that.element[0]) {
+ return;
+ }
+
+ if (options.tolerance === "touch") {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance === "fit") {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass("ui-selected");
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass("ui-unselecting");
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass("ui-selecting");
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ that._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
+ selectee.$element.removeClass("ui-selecting");
+ selectee.selecting = false;
+ selectee.$element.addClass("ui-selected");
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass("ui-selecting");
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass("ui-unselecting");
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ that._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
+ selectee.$element.removeClass("ui-selected");
+ selectee.selected = false;
+
+ selectee.$element.addClass("ui-unselecting");
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ that._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var that = this;
+
+ this.dragged = false;
+
+ $(".ui-unselecting", this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass("ui-unselecting");
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ that._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $(".ui-selecting", this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass("ui-selecting").addClass("ui-selected");
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ that._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+});
+
+})(jQuery);
+(function( $, undefined ) {
+
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
+
+$.widget( "ui.slider", $.ui.mouse, {
+ version: "1.10.0",
+ widgetEventPrefix: "slide",
+
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null,
+
+ // callbacks
+ change: null,
+ slide: null,
+ start: null,
+ stop: null
+ },
+
+ _create: function() {
+ var i, handleCount,
+ o = this.options,
+ existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
+ handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
+ handles = [];
+
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass( "ui-slider" +
+ " ui-slider-" + this.orientation +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all");
+
+ this.range = $([]);
+
+ if ( o.range ) {
+ if ( o.range === true ) {
+ if ( !o.values ) {
+ o.values = [ this._valueMin(), this._valueMin() ];
+ } else if ( o.values.length && o.values.length !== 2 ) {
+ o.values = [ o.values[0], o.values[0] ];
+ } else if ( $.isArray( o.values ) ) {
+ o.values = o.values.slice(0);
+ }
+ }
+
+ this.range = $( "<div></div>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-range" +
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ " ui-widget-header" +
+ ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
+ }
+
+ handleCount = ( o.values && o.values.length ) || 1;
+
+ for ( i = existingHandles.length; i < handleCount; i++ ) {
+ handles.push( handle );
+ }
+
+ this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) );
+
+ this.handle = this.handles.eq( 0 );
+
+ this.handles.add( this.range ).filter( "a" )
+ .click(function( event ) {
+ event.preventDefault();
+ })
+ .mouseenter(function() {
+ if ( !o.disabled ) {
+ $( this ).addClass( "ui-state-hover" );
+ }
+ })
+ .mouseleave(function() {
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .focus(function() {
+ if ( !o.disabled ) {
+ $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
+ $( this ).addClass( "ui-state-focus" );
+ } else {
+ $( this ).blur();
+ }
+ })
+ .blur(function() {
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ this.handles.each(function( i ) {
+ $( this ).data( "ui-slider-handle-index", i );
+ });
+
+ this._setOption( "disabled", o.disabled );
+
+ this._on( this.handles, this._handleEvents );
+
+ this._refreshValue();
+
+ this._animateOff = false;
+ },
+
+ _destroy: function() {
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass( "ui-slider" +
+ " ui-slider-horizontal" +
+ " ui-slider-vertical" +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" );
+
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function( event ) {
+ var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle,
+ that = this,
+ o = this.options;
+
+ if ( o.disabled ) {
+ return false;
+ }
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ position = { x: event.pageX, y: event.pageY };
+ normValue = this._normValueFromMouse( position );
+ distance = this._valueMax() - this._valueMin() + 1;
+ this.handles.each(function( i ) {
+ var thisDistance = Math.abs( normValue - that.values(i) );
+ if (( distance > thisDistance ) ||
+ ( distance === thisDistance &&
+ (i === that._lastChangedValue || that.values(i) === o.min ))) {
+ distance = thisDistance;
+ closestHandle = $( this );
+ index = i;
+ }
+ });
+
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return false;
+ }
+ this._mouseSliding = true;
+
+ this._handleIndex = index;
+
+ closestHandle
+ .addClass( "ui-state-active" )
+ .focus();
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$( event.target ).parents().addBack().is( ".ui-slider-handle" );
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
+ ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
+ ( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+ };
+
+ if ( !this.handles.hasClass( "ui-state-hover" ) ) {
+ this._slide( event, index, normValue );
+ }
+ this._animateOff = true;
+ return true;
+ },
+
+ _mouseStart: function() {
+ return true;
+ },
+
+ _mouseDrag: function( event ) {
+ var position = { x: event.pageX, y: event.pageY },
+ normValue = this._normValueFromMouse( position );
+
+ this._slide( event, this._handleIndex, normValue );
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+ this.handles.removeClass( "ui-state-active" );
+ this._mouseSliding = false;
+
+ this._stop( event, this._handleIndex );
+ this._change( event, this._handleIndex );
+
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
+
+ return false;
+ },
+
+ _detectOrientation: function() {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+ },
+
+ _normValueFromMouse: function( position ) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
+
+ if ( this.orientation === "horizontal" ) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
+
+ percentMouse = ( pixelMouse / pixelTotal );
+ if ( percentMouse > 1 ) {
+ percentMouse = 1;
+ }
+ if ( percentMouse < 0 ) {
+ percentMouse = 0;
+ }
+ if ( this.orientation === "vertical" ) {
+ percentMouse = 1 - percentMouse;
+ }
+
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+ return this._trimAlignValue( valueMouse );
+ },
+
+ _start: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+ return this._trigger( "start", event, uiHash );
+ },
+
+ _slide: function( event, index, newVal ) {
+ var otherVal,
+ newValues,
+ allowed;
+
+ if ( this.options.values && this.options.values.length ) {
+ otherVal = this.values( index ? 0 : 1 );
+
+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
+ ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+ ) {
+ newVal = otherVal;
+ }
+
+ if ( newVal !== this.values( index ) ) {
+ newValues = this.values();
+ newValues[ index ] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal,
+ values: newValues
+ } );
+ otherVal = this.values( index ? 0 : 1 );
+ if ( allowed !== false ) {
+ this.values( index, newVal, true );
+ }
+ }
+ } else {
+ if ( newVal !== this.value() ) {
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal
+ } );
+ if ( allowed !== false ) {
+ this.value( newVal );
+ }
+ }
+ }
+ },
+
+ _stop: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "stop", event, uiHash );
+ },
+
+ _change: function( event, index ) {
+ if ( !this._keySliding && !this._mouseSliding ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ //store the last changed value index for reference when handles overlap
+ this._lastChangedValue = index;
+
+ this._trigger( "change", event, uiHash );
+ }
+ },
+
+ value: function( newValue ) {
+ if ( arguments.length ) {
+ this.options.value = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, 0 );
+ return;
+ }
+
+ return this._value();
+ },
+
+ values: function( index, newValue ) {
+ var vals,
+ newValues,
+ i;
+
+ if ( arguments.length > 1 ) {
+ this.options.values[ index ] = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, index );
+ return;
+ }
+
+ if ( arguments.length ) {
+ if ( $.isArray( arguments[ 0 ] ) ) {
+ vals = this.options.values;
+ newValues = arguments[ 0 ];
+ for ( i = 0; i < vals.length; i += 1 ) {
+ vals[ i ] = this._trimAlignValue( newValues[ i ] );
+ this._change( null, i );
+ }
+ this._refreshValue();
+ } else {
+ if ( this.options.values && this.options.values.length ) {
+ return this._values( index );
+ } else {
+ return this.value();
+ }
+ }
+ } else {
+ return this._values();
+ }
+ },
+
+ _setOption: function( key, value ) {
+ var i,
+ valsLength = 0;
+
+ if ( $.isArray( this.options.values ) ) {
+ valsLength = this.options.values.length;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ switch ( key ) {
+ case "disabled":
+ if ( value ) {
+ this.handles.filter( ".ui-state-focus" ).blur();
+ this.handles.removeClass( "ui-state-hover" );
+ this.handles.prop( "disabled", true );
+ } else {
+ this.handles.prop( "disabled", false );
+ }
+ break;
+ case "orientation":
+ this._detectOrientation();
+ this.element
+ .removeClass( "ui-slider-horizontal ui-slider-vertical" )
+ .addClass( "ui-slider-" + this.orientation );
+ this._refreshValue();
+ break;
+ case "value":
+ this._animateOff = true;
+ this._refreshValue();
+ this._change( null, 0 );
+ this._animateOff = false;
+ break;
+ case "values":
+ this._animateOff = true;
+ this._refreshValue();
+ for ( i = 0; i < valsLength; i += 1 ) {
+ this._change( null, i );
+ }
+ this._animateOff = false;
+ break;
+ case "min":
+ case "max":
+ this._animateOff = true;
+ this._refreshValue();
+ this._animateOff = false;
+ break;
+ }
+ },
+
+ //internal value getter
+ // _value() returns value trimmed by min and max, aligned by step
+ _value: function() {
+ var val = this.options.value;
+ val = this._trimAlignValue( val );
+
+ return val;
+ },
+
+ //internal values getter
+ // _values() returns array of values trimmed by min and max, aligned by step
+ // _values( index ) returns single value trimmed by min and max, aligned by step
+ _values: function( index ) {
+ var val,
+ vals,
+ i;
+
+ if ( arguments.length ) {
+ val = this.options.values[ index ];
+ val = this._trimAlignValue( val );
+
+ return val;
+ } else {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ vals = this.options.values.slice();
+ for ( i = 0; i < vals.length; i+= 1) {
+ vals[ i ] = this._trimAlignValue( vals[ i ] );
+ }
+
+ return vals;
+ }
+ },
+
+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function( val ) {
+ if ( val <= this._valueMin() ) {
+ return this._valueMin();
+ }
+ if ( val >= this._valueMax() ) {
+ return this._valueMax();
+ }
+ var step = ( this.options.step > 0 ) ? this.options.step : 1,
+ valModStep = (val - this._valueMin()) % step,
+ alignValue = val - valModStep;
+
+ if ( Math.abs(valModStep) * 2 >= step ) {
+ alignValue += ( valModStep > 0 ) ? step : ( -step );
+ }
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat( alignValue.toFixed(5) );
+ },
+
+ _valueMin: function() {
+ return this.options.min;
+ },
+
+ _valueMax: function() {
+ return this.options.max;
+ },
+
+ _refreshValue: function() {
+ var lastValPercent, valPercent, value, valueMin, valueMax,
+ oRange = this.options.range,
+ o = this.options,
+ that = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ _set = {};
+
+ if ( this.options.values && this.options.values.length ) {
+ this.handles.each(function( i ) {
+ valPercent = ( that.values(i) - that._valueMin() ) / ( that._valueMax() - that._valueMin() ) * 100;
+ _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ if ( that.options.range === true ) {
+ if ( that.orientation === "horizontal" ) {
+ if ( i === 0 ) {
+ that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ that.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ } else {
+ if ( i === 0 ) {
+ that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ that.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+ if ( oRange === "min" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "horizontal" ) {
+ this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ if ( oRange === "min" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "vertical" ) {
+ this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ },
+
+ _handleEvents: {
+ keydown: function( event ) {
+ /*jshint maxcomplexity:25*/
+ var allowed, curVal, newVal, step,
+ index = $( event.target ).data( "ui-slider-handle-index" );
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ event.preventDefault();
+ if ( !this._keySliding ) {
+ this._keySliding = true;
+ $( event.target ).addClass( "ui-state-active" );
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = this.options.step;
+ if ( this.options.values && this.options.values.length ) {
+ curVal = newVal = this.values( index );
+ } else {
+ curVal = newVal = this.value();
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ newVal = this._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = this._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = this._trimAlignValue( curVal + ( (this._valueMax() - this._valueMin()) / numPages ) );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = this._trimAlignValue( curVal - ( (this._valueMax() - this._valueMin()) / numPages ) );
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if ( curVal === this._valueMax() ) {
+ return;
+ }
+ newVal = this._trimAlignValue( curVal + step );
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if ( curVal === this._valueMin() ) {
+ return;
+ }
+ newVal = this._trimAlignValue( curVal - step );
+ break;
+ }
+
+ this._slide( event, index, newVal );
+ },
+ keyup: function( event ) {
+ var index = $( event.target ).data( "ui-slider-handle-index" );
+
+ if ( this._keySliding ) {
+ this._keySliding = false;
+ this._stop( event, index );
+ this._change( event, index );
+ $( event.target ).removeClass( "ui-state-active" );
+ }
+ }
+ }
+
+});
+
+}(jQuery));
+(function( $, undefined ) {
+
+/*jshint loopfunc: true */
+
+function isOverAxis( x, reference, size ) {
+ return ( x > reference ) && ( x < ( reference + size ) );
+}
+
+$.widget("ui.sortable", $.ui.mouse, {
+ version: "1.10.0",
+ widgetEventPrefix: "sort",
+ ready: false,
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: "> *",
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000,
+
+ // callbacks
+ activate: null,
+ beforeStop: null,
+ change: null,
+ deactivate: null,
+ out: null,
+ over: null,
+ receive: null,
+ remove: null,
+ sort: null,
+ start: null,
+ stop: null,
+ update: null
+ },
+ _create: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are being displayed horizontally
+ this.floating = this.items.length ? o.axis === "x" || (/left|right/).test(this.items[0].item.css("float")) || (/inline|table-cell/).test(this.items[0].item.css("display")) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ //We're ready to go
+ this.ready = true;
+
+ },
+
+ _destroy: function() {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- ) {
+ this.items[i].item.removeData(this.widgetName + "-item");
+ }
+
+ return this;
+ },
+
+ _setOption: function(key, value){
+ if ( key === "disabled" ) {
+ this.options[ key ] = value;
+
+ this.widget().toggleClass( "ui-sortable-disabled", !!value );
+ } else {
+ // Don't call widget base _setOption for disable as it adds ui-state-disabled class
+ $.Widget.prototype._setOption.apply(this, arguments);
+ }
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+ var currentItem = null,
+ validHandle = false,
+ that = this;
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type === "static") {
+ return false;
+ }
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ $(event.target).parents().each(function() {
+ if($.data(this, that.widgetName + "-item") === that) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, that.widgetName + "-item") === that) {
+ currentItem = $(event.target);
+ }
+
+ if(!currentItem) {
+ return false;
+ }
+ if(this.options.handle && !overrideHandle) {
+ $(this.options.handle, currentItem).find("*").addBack().each(function() {
+ if(this === event.target) {
+ validHandle = true;
+ }
+ });
+ if(!validHandle) {
+ return false;
+ }
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var i,
+ o = this.options;
+
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] !== this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment) {
+ this._setContainment();
+ }
+
+ if(o.cursor) { // cursor option
+ if ($("body").css("cursor")) {
+ this._storedCursor = $("body").css("cursor");
+ }
+ $("body").css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) {
+ this._storedOpacity = this.helper.css("opacity");
+ }
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) {
+ this._storedZIndex = this.helper.css("zIndex");
+ }
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") {
+ this.overflowOffset = this.scrollParent.offset();
+ }
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions) {
+ this._cacheHelperProportions();
+ }
+
+
+ //Post "activate" events to possible containers
+ if( !noActivation ) {
+ for ( i = this.containers.length - 1; i >= 0; i-- ) {
+ this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) );
+ }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager) {
+ $.ui.ddmanager.current = this;
+ }
+
+ if ($.ui.ddmanager && !o.dropBehaviour) {
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+ var i, item, itemElement, intersection,
+ o = this.options,
+ scrolled = false;
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ if(this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) {
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ } else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) {
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) {
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ } else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) {
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ } else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) {
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ } else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) {
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis !== "y") {
+ this.helper[0].style.left = this.position.left+"px";
+ }
+ if(!this.options.axis || this.options.axis !== "x") {
+ this.helper[0].style.top = this.position.top+"px";
+ }
+
+ //Rearrange
+ for (i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ item = this.items[i];
+ itemElement = item.item[0];
+ intersection = this._intersectsWithPointer(item);
+ if (!intersection) {
+ continue;
+ }
+
+ // Only put the placeholder inside the current Container, skip all
+ // items form other containers. This works because when moving
+ // an item from one container to another the
+ // currentContainer is switched before the placeholder is moved.
+ //
+ // Without this moving items in "sub-sortables" can cause the placeholder to jitter
+ // beetween the outer and inner container.
+ if (item.instance !== this.currentContainer) {
+ continue;
+ }
+
+ // cannot intersect with itself
+ // no useless actions that have been done before
+ // no action if the item moved is the parent of the item checked
+ if (itemElement !== this.currentItem[0] &&
+ this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !== itemElement &&
+ !$.contains(this.placeholder[0], itemElement) &&
+ (this.options.type === "semi-dynamic" ? !$.contains(this.element[0], itemElement) : true)
+ ) {
+
+ this.direction = intersection === 1 ? "down" : "up";
+
+ if (this.options.tolerance === "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) {
+ $.ui.ddmanager.drag(this, event);
+ }
+
+ //Call callbacks
+ this._trigger("sort", event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) {
+ return;
+ }
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour) {
+ $.ui.ddmanager.drop(this, event);
+ }
+
+ if(this.options.revert) {
+ var that = this,
+ cur = this.placeholder.offset();
+
+ this.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ that._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ if(this.dragging) {
+
+ this._mouseUp({ target: null });
+
+ if(this.options.helper === "original") {
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, this._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ if (this.placeholder) {
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) {
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ }
+ if(this.options.helper !== "original" && this.helper && this.helper[0].parentNode) {
+ this.helper.remove();
+ }
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+ }
+
+ return this;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected),
+ str = [];
+ o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || "id") || "").match(o.expression || (/(.+)[\-=_](.+)/));
+ if (res) {
+ str.push((o.key || res[1]+"[]")+"="+(o.key && o.expression ? res[1] : res[2]));
+ }
+ });
+
+ if(!str.length && o.key) {
+ str.push(o.key + "=");
+ }
+
+ return str.join("&");
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected),
+ ret = [];
+
+ o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || "id") || ""); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height,
+ l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height,
+ dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left,
+ isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if ( this.options.tolerance === "pointer" ||
+ this.options.forcePointerForContainers ||
+ (this.options.tolerance !== "pointer" && this.helperProportions[this.floating ? "width" : "height"] > item[this.floating ? "width" : "height"])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) && // Right Half
+ x2 - (this.helperProportions.width / 2) < r && // Left Half
+ t < y1 + (this.helperProportions.height / 2) && // Bottom Half
+ y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = (this.options.axis === "x") || isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = (this.options.axis === "y") || isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement) {
+ return false;
+ }
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection === "right") || verticalDirection === "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection === "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection === "right" && isOverRightHalf) || (horizontalDirection === "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection === "down" && isOverBottomHalf) || (verticalDirection === "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta !== 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta !== 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ return this;
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor === String ? [options.connectWith] : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var i, j, cur, inst,
+ items = [],
+ queries = [],
+ connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (i = connectWith.length - 1; i >= 0; i--){
+ cur = $(connectWith[i]);
+ for ( j = cur.length - 1; j >= 0; j--){
+ inst = $.data(cur[j], this.widgetFullName);
+ if(inst && inst !== this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), inst]);
+ }
+ }
+ }
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), this]);
+
+ for (i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ }
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
+
+ this.items = $.grep(this.items, function (item) {
+ for (var j=0; j < list.length; j++) {
+ if(list[j] === item.item[0]) {
+ return false;
+ }
+ }
+ return true;
+ });
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+
+ var i, j, cur, inst, targetData, _queries, item, queriesLength,
+ items = this.items,
+ queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]],
+ connectWith = this._connectWith();
+
+ if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down
+ for (i = connectWith.length - 1; i >= 0; i--){
+ cur = $(connectWith[i]);
+ for (j = cur.length - 1; j >= 0; j--){
+ inst = $.data(cur[j], this.widgetFullName);
+ if(inst && inst !== this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ }
+ }
+ }
+
+ for (i = queries.length - 1; i >= 0; i--) {
+ targetData = queries[i][1];
+ _queries = queries[i][0];
+
+ for (j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ item = $(_queries[j]);
+
+ item.data(this.widgetName + "-item", targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ }
+ }
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ var i, item, t, p;
+
+ for (i = this.items.length - 1; i >= 0; i--){
+ item = this.items[i];
+
+ //We ignore calculating positions of all connected containers when we're not over them
+ if(item.instance !== this.currentContainer && this.currentContainer && item.item[0] !== this.currentItem[0]) {
+ continue;
+ }
+
+ t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ }
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (i = this.containers.length - 1; i >= 0; i--){
+ p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ }
+ }
+
+ return this;
+ },
+
+ _createPlaceholder: function(that) {
+ that = that || this;
+ var className,
+ o = that.options;
+
+ if(!o.placeholder || o.placeholder.constructor === String) {
+ className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(that.currentItem[0].nodeName))
+ .addClass(className || that.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className) {
+ el.style.visibility = "hidden";
+ }
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) {
+ return;
+ }
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css("paddingTop")||0, 10) - parseInt(that.currentItem.css("paddingBottom")||0, 10)); }
+ if(!p.width()) { p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css("paddingLeft")||0, 10) - parseInt(that.currentItem.css("paddingRight")||0, 10)); }
+ }
+ };
+ }
+
+ //Create the placeholder
+ that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem));
+
+ //Append it after the actual current item
+ that.currentItem.after(that.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(that, that.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+ var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, base, cur, nearBottom,
+ innermostContainer = null,
+ innermostIndex = null;
+
+ // get innermost container that intersects with item
+ for (i = this.containers.length - 1; i >= 0; i--) {
+
+ // never consider a container that's located within the item itself
+ if($.contains(this.currentItem[0], this.containers[i].element[0])) {
+ continue;
+ }
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0])) {
+ continue;
+ }
+
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
+ } else {
+ // container doesn't intersect. trigger "out" event if necessary
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) {
+ return;
+ }
+
+ // move the item into the container if it's not there already
+ if(this.containers.length === 1) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ } else {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ dist = 10000;
+ itemWithLeastDistance = null;
+ posProperty = this.containers[innermostIndex].floating ? "left" : "top";
+ sizeProperty = this.containers[innermostIndex].floating ? "width" : "height";
+ base = this.positionAbs[posProperty] + this.offset.click[posProperty];
+ for (j = this.items.length - 1; j >= 0; j--) {
+ if(!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) {
+ continue;
+ }
+ if(this.items[j].item[0] === this.currentItem[0]) {
+ continue;
+ }
+ cur = this.items[j].item.offset()[posProperty];
+ nearBottom = false;
+ if(Math.abs(cur - base) > Math.abs(cur + this.items[j][sizeProperty] - base)){
+ nearBottom = true;
+ cur += this.items[j][sizeProperty];
+ }
+
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ this.direction = nearBottom ? "up": "down";
+ }
+ }
+
+ //Check if dropOnEmpty is enabled
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) {
+ return;
+ }
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options,
+ helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper === "clone" ? this.currentItem.clone() : this.currentItem);
+
+ //Add the helper to the DOM if that didn't happen already
+ if(!helper.parents("body").length) {
+ $(o.appendTo !== "parent" ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+ }
+
+ if(helper[0] === this.currentItem[0]) {
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+ }
+
+ if(!helper[0].style.width || o.forceHelperSize) {
+ helper.width(this.currentItem.width());
+ }
+ if(!helper[0].style.height || o.forceHelperSize) {
+ helper.height(this.currentItem.height());
+ }
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj === "string") {
+ obj = obj.split(" ");
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ("left" in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ("right" in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ("top" in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ("bottom" in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ // This needs to be actually done for all browsers, since pageX/pageY includes this information
+ // with an ugly IE fix
+ if( this.offsetParent[0] === document.body || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
+ po = { top: 0, left: 0 };
+ }
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition === "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var ce, co, over,
+ o = this.options;
+ if(o.containment === "parent") {
+ o.containment = this.helper[0].parentNode;
+ }
+ if(o.containment === "document" || o.containment === "window") {
+ this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment === "document" ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ ce = $(o.containment)[0];
+ co = $(o.containment).offset();
+ over = ($(ce).css("overflow") !== "hidden");
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) {
+ pos = this.position;
+ }
+ var mod = d === "absolute" ? 1 : -1,
+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent,
+ scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top + // The absolute mouse position
+ this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left + // The absolute mouse position
+ this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var top, left,
+ o = this.options,
+ pageX = event.pageX,
+ pageY = event.pageY,
+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition === "relative" && !(this.scrollParent[0] !== document && this.scrollParent[0] !== this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) {
+ pageX = this.containment[0] + this.offset.click.left;
+ }
+ if(event.pageY - this.offset.click.top < this.containment[1]) {
+ pageY = this.containment[1] + this.offset.click.top;
+ }
+ if(event.pageX - this.offset.click.left > this.containment[2]) {
+ pageX = this.containment[2] + this.offset.click.left;
+ }
+ if(event.pageY - this.offset.click.top > this.containment[3]) {
+ pageY = this.containment[3] + this.offset.click.top;
+ }
+ }
+
+ if(o.grid) {
+ top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? ( (top - this.offset.click.top >= this.containment[1] && top - this.offset.click.top <= this.containment[3]) ? top : ((top - this.offset.click.top >= this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? ( (left - this.offset.click.left >= this.containment[0] && left - this.offset.click.left <= this.containment[2]) ? left : ((left - this.offset.click.left >= this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY - // The absolute mouse position
+ this.offset.click.top - // Click offset (relative to the element)
+ this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top + // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX - // The absolute mouse position
+ this.offset.click.left - // Click offset (relative to the element)
+ this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left + // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction === "down" ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var counter = this.counter;
+
+ this._delay(function() {
+ if(counter === this.counter) {
+ this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ }
+ });
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var i,
+ delayedTriggers = [];
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem.parent().length) {
+ this.placeholder.before(this.currentItem);
+ }
+ this._noFinalSort = null;
+
+ if(this.helper[0] === this.currentItem[0]) {
+ for(i in this._storedCSS) {
+ if(this._storedCSS[i] === "auto" || this._storedCSS[i] === "static") {
+ this._storedCSS[i] = "";
+ }
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) {
+ delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ }
+ if((this.fromOutside || this.domPosition.prev !== this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent !== this.currentItem.parent()[0]) && !noPropagation) {
+ delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ }
+
+ // Check if the items Container has Changed and trigger appropriate
+ // events.
+ if (this !== this.currentContainer) {
+ if(!noPropagation) {
+ delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer));
+ }
+ }
+
+
+ //Post events to containers
+ for (i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) {
+ $("body").css("cursor", this._storedCursor);
+ }
+ if(this._storedOpacity) {
+ this.helper.css("opacity", this._storedOpacity);
+ }
+ if(this._storedZIndex) {
+ this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex);
+ }
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (i=0; i < delayedTriggers.length; i++) {
+ delayedTriggers[i].call(this, event);
+ } //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return false;
+ }
+
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ }
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] !== this.currentItem[0]) {
+ this.helper.remove();
+ }
+ this.helper = null;
+
+ if(!noPropagation) {
+ for (i=0; i < delayedTriggers.length; i++) {
+ delayedTriggers[i].call(this, event);
+ } //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(_inst) {
+ var inst = _inst || this;
+ return {
+ helper: inst.helper,
+ placeholder: inst.placeholder || $([]),
+ position: inst.position,
+ originalPosition: inst.originalPosition,
+ offset: inst.positionAbs,
+ item: inst.currentItem,
+ sender: _inst ? _inst.element : null
+ };
+ }
+
+});
+
+})(jQuery);
+(function( $ ) {
+
+function modifier( fn ) {
+ return function() {
+ var previous = this.element.val();
+ fn.apply( this, arguments );
+ this._refresh();
+ if ( previous !== this.element.val() ) {
+ this._trigger( "change" );
+ }
+ };
+}
+
+$.widget( "ui.spinner", {
+ version: "1.10.0",
+ defaultElement: "<input>",
+ widgetEventPrefix: "spin",
+ options: {
+ culture: null,
+ icons: {
+ down: "ui-icon-triangle-1-s",
+ up: "ui-icon-triangle-1-n"
+ },
+ incremental: true,
+ max: null,
+ min: null,
+ numberFormat: null,
+ page: 10,
+ step: 1,
+
+ change: null,
+ spin: null,
+ start: null,
+ stop: null
+ },
+
+ _create: function() {
+ // handle string values that need to be parsed
+ this._setOption( "max", this.options.max );
+ this._setOption( "min", this.options.min );
+ this._setOption( "step", this.options.step );
+
+ // format the value, but don't constrain
+ this._value( this.element.val(), true );
+
+ this._draw();
+ this._on( this._events );
+ this._refresh();
+
+ // turning off autocomplete prevents the browser from remembering the
+ // value when navigating through history, so we re-enable autocomplete
+ // if the page is unloaded before the widget is destroyed. #7790
+ this._on( this.window, {
+ beforeunload: function() {
+ this.element.removeAttr( "autocomplete" );
+ }
+ });
+ },
+
+ _getCreateOptions: function() {
+ var options = {},
+ element = this.element;
+
+ $.each( [ "min", "max", "step" ], function( i, option ) {
+ var value = element.attr( option );
+ if ( value !== undefined && value.length ) {
+ options[ option ] = value;
+ }
+ });
+
+ return options;
+ },
+
+ _events: {
+ keydown: function( event ) {
+ if ( this._start( event ) && this._keydown( event ) ) {
+ event.preventDefault();
+ }
+ },
+ keyup: "_stop",
+ focus: function() {
+ this.previous = this.element.val();
+ },
+ blur: function( event ) {
+ if ( this.cancelBlur ) {
+ delete this.cancelBlur;
+ return;
+ }
+
+ this._refresh();
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event );
+ }
+ },
+ mousewheel: function( event, delta ) {
+ if ( !delta ) {
+ return;
+ }
+ if ( !this.spinning && !this._start( event ) ) {
+ return false;
+ }
+
+ this._spin( (delta > 0 ? 1 : -1) * this.options.step, event );
+ clearTimeout( this.mousewheelTimer );
+ this.mousewheelTimer = this._delay(function() {
+ if ( this.spinning ) {
+ this._stop( event );
+ }
+ }, 100 );
+ event.preventDefault();
+ },
+ "mousedown .ui-spinner-button": function( event ) {
+ var previous;
+
+ // We never want the buttons to have focus; whenever the user is
+ // interacting with the spinner, the focus should be on the input.
+ // If the input is focused then this.previous is properly set from
+ // when the input first received focus. If the input is not focused
+ // then we need to set this.previous based on the value before spinning.
+ previous = this.element[0] === this.document[0].activeElement ?
+ this.previous : this.element.val();
+ function checkFocus() {
+ var isActive = this.element[0] === this.document[0].activeElement;
+ if ( !isActive ) {
+ this.element.focus();
+ this.previous = previous;
+ // support: IE
+ // IE sets focus asynchronously, so we need to check if focus
+ // moved off of the input because the user clicked on the button.
+ this._delay(function() {
+ this.previous = previous;
+ });
+ }
+ }
+
+ // ensure focus is on (or stays on) the text field
+ event.preventDefault();
+ checkFocus.call( this );
+
+ // support: IE
+ // IE doesn't prevent moving focus even with event.preventDefault()
+ // so we set a flag to know when we should ignore the blur event
+ // and check (again) if focus moved off of the input.
+ this.cancelBlur = true;
+ this._delay(function() {
+ delete this.cancelBlur;
+ checkFocus.call( this );
+ });
+
+ if ( this._start( event ) === false ) {
+ return;
+ }
+
+ this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+ },
+ "mouseup .ui-spinner-button": "_stop",
+ "mouseenter .ui-spinner-button": function( event ) {
+ // button will add ui-state-active if mouse was down while mouseleave and kept down
+ if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) {
+ return;
+ }
+
+ if ( this._start( event ) === false ) {
+ return false;
+ }
+ this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+ },
+ // TODO: do we really want to consider this a stop?
+ // shouldn't we just stop the repeater and wait until mouseup before
+ // we trigger the stop event?
+ "mouseleave .ui-spinner-button": "_stop"
+ },
+
+ _draw: function() {
+ var uiSpinner = this.uiSpinner = this.element
+ .addClass( "ui-spinner-input" )
+ .attr( "autocomplete", "off" )
+ .wrap( this._uiSpinnerHtml() )
+ .parent()
+ // add buttons
+ .append( this._buttonHtml() );
+
+ this.element.attr( "role", "spinbutton" );
+
+ // button bindings
+ this.buttons = uiSpinner.find( ".ui-spinner-button" )
+ .attr( "tabIndex", -1 )
+ .button()
+ .removeClass( "ui-corner-all" );
+
+ // IE 6 doesn't understand height: 50% for the buttons
+ // unless the wrapper has an explicit height
+ if ( this.buttons.height() > Math.ceil( uiSpinner.height() * 0.5 ) &&
+ uiSpinner.height() > 0 ) {
+ uiSpinner.height( uiSpinner.height() );
+ }
+
+ // disable spinner if element was already disabled
+ if ( this.options.disabled ) {
+ this.disable();
+ }
+ },
+
+ _keydown: function( event ) {
+ var options = this.options,
+ keyCode = $.ui.keyCode;
+
+ switch ( event.keyCode ) {
+ case keyCode.UP:
+ this._repeat( null, 1, event );
+ return true;
+ case keyCode.DOWN:
+ this._repeat( null, -1, event );
+ return true;
+ case keyCode.PAGE_UP:
+ this._repeat( null, options.page, event );
+ return true;
+ case keyCode.PAGE_DOWN:
+ this._repeat( null, -options.page, event );
+ return true;
+ }
+
+ return false;
+ },
+
+ _uiSpinnerHtml: function() {
+ return "<span class='ui-spinner ui-widget ui-widget-content ui-corner-all'></span>";
+ },
+
+ _buttonHtml: function() {
+ return "" +
+ "<a class='ui-spinner-button ui-spinner-up ui-corner-tr'>" +
+ "<span class='ui-icon " + this.options.icons.up + "'>&#9650;</span>" +
+ "</a>" +
+ "<a class='ui-spinner-button ui-spinner-down ui-corner-br'>" +
+ "<span class='ui-icon " + this.options.icons.down + "'>&#9660;</span>" +
+ "</a>";
+ },
+
+ _start: function( event ) {
+ if ( !this.spinning && this._trigger( "start", event ) === false ) {
+ return false;
+ }
+
+ if ( !this.counter ) {
+ this.counter = 1;
+ }
+ this.spinning = true;
+ return true;
+ },
+
+ _repeat: function( i, steps, event ) {
+ i = i || 500;
+
+ clearTimeout( this.timer );
+ this.timer = this._delay(function() {
+ this._repeat( 40, steps, event );
+ }, i );
+
+ this._spin( steps * this.options.step, event );
+ },
+
+ _spin: function( step, event ) {
+ var value = this.value() || 0;
+
+ if ( !this.counter ) {
+ this.counter = 1;
+ }
+
+ value = this._adjustValue( value + step * this._increment( this.counter ) );
+
+ if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false) {
+ this._value( value );
+ this.counter++;
+ }
+ },
+
+ _increment: function( i ) {
+ var incremental = this.options.incremental;
+
+ if ( incremental ) {
+ return $.isFunction( incremental ) ?
+ incremental( i ) :
+ Math.floor( i*i*i/50000 - i*i/500 + 17*i/200 + 1 );
+ }
+
+ return 1;
+ },
+
+ _precision: function() {
+ var precision = this._precisionOf( this.options.step );
+ if ( this.options.min !== null ) {
+ precision = Math.max( precision, this._precisionOf( this.options.min ) );
+ }
+ return precision;
+ },
+
+ _precisionOf: function( num ) {
+ var str = num.toString(),
+ decimal = str.indexOf( "." );
+ return decimal === -1 ? 0 : str.length - decimal - 1;
+ },
+
+ _adjustValue: function( value ) {
+ var base, aboveMin,
+ options = this.options;
+
+ // make sure we're at a valid step
+ // - find out where we are relative to the base (min or 0)
+ base = options.min !== null ? options.min : 0;
+ aboveMin = value - base;
+ // - round to the nearest step
+ aboveMin = Math.round(aboveMin / options.step) * options.step;
+ // - rounding is based on 0, so adjust back to our base
+ value = base + aboveMin;
+
+ // fix precision from bad JS floating point math
+ value = parseFloat( value.toFixed( this._precision() ) );
+
+ // clamp the value
+ if ( options.max !== null && value > options.max) {
+ return options.max;
+ }
+ if ( options.min !== null && value < options.min ) {
+ return options.min;
+ }
+
+ return value;
+ },
+
+ _stop: function( event ) {
+ if ( !this.spinning ) {
+ return;
+ }
+
+ clearTimeout( this.timer );
+ clearTimeout( this.mousewheelTimer );
+ this.counter = 0;
+ this.spinning = false;
+ this._trigger( "stop", event );
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "culture" || key === "numberFormat" ) {
+ var prevValue = this._parse( this.element.val() );
+ this.options[ key ] = value;
+ this.element.val( this._format( prevValue ) );
+ return;
+ }
+
+ if ( key === "max" || key === "min" || key === "step" ) {
+ if ( typeof value === "string" ) {
+ value = this._parse( value );
+ }
+ }
+ if ( key === "icons" ) {
+ this.buttons.first().find( ".ui-icon" )
+ .removeClass( this.options.icons.up )
+ .addClass( value.up );
+ this.buttons.last().find( ".ui-icon" )
+ .removeClass( this.options.icons.down )
+ .addClass( value.down );
+ }
+
+ this._super( key, value );
+
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.prop( "disabled", true );
+ this.buttons.button( "disable" );
+ } else {
+ this.element.prop( "disabled", false );
+ this.buttons.button( "enable" );
+ }
+ }
+ },
+
+ _setOptions: modifier(function( options ) {
+ this._super( options );
+ this._value( this.element.val() );
+ }),
+
+ _parse: function( val ) {
+ if ( typeof val === "string" && val !== "" ) {
+ val = window.Globalize && this.options.numberFormat ?
+ Globalize.parseFloat( val, 10, this.options.culture ) : +val;
+ }
+ return val === "" || isNaN( val ) ? null : val;
+ },
+
+ _format: function( value ) {
+ if ( value === "" ) {
+ return "";
+ }
+ return window.Globalize && this.options.numberFormat ?
+ Globalize.format( value, this.options.numberFormat, this.options.culture ) :
+ value;
+ },
+
+ _refresh: function() {
+ this.element.attr({
+ "aria-valuemin": this.options.min,
+ "aria-valuemax": this.options.max,
+ // TODO: what should we do with values that can't be parsed?
+ "aria-valuenow": this._parse( this.element.val() )
+ });
+ },
+
+ // update the value without triggering change
+ _value: function( value, allowAny ) {
+ var parsed;
+ if ( value !== "" ) {
+ parsed = this._parse( value );
+ if ( parsed !== null ) {
+ if ( !allowAny ) {
+ parsed = this._adjustValue( parsed );
+ }
+ value = this._format( parsed );
+ }
+ }
+ this.element.val( value );
+ this._refresh();
+ },
+
+ _destroy: function() {
+ this.element
+ .removeClass( "ui-spinner-input" )
+ .prop( "disabled", false )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+ this.uiSpinner.replaceWith( this.element );
+ },
+
+ stepUp: modifier(function( steps ) {
+ this._stepUp( steps );
+ }),
+ _stepUp: function( steps ) {
+ if ( this._start() ) {
+ this._spin( (steps || 1) * this.options.step );
+ this._stop();
+ }
+ },
+
+ stepDown: modifier(function( steps ) {
+ this._stepDown( steps );
+ }),
+ _stepDown: function( steps ) {
+ if ( this._start() ) {
+ this._spin( (steps || 1) * -this.options.step );
+ this._stop();
+ }
+ },
+
+ pageUp: modifier(function( pages ) {
+ this._stepUp( (pages || 1) * this.options.page );
+ }),
+
+ pageDown: modifier(function( pages ) {
+ this._stepDown( (pages || 1) * this.options.page );
+ }),
+
+ value: function( newVal ) {
+ if ( !arguments.length ) {
+ return this._parse( this.element.val() );
+ }
+ modifier( this._value ).call( this, newVal );
+ },
+
+ widget: function() {
+ return this.uiSpinner;
+ }
+});
+
+}( jQuery ) );
+(function( $, undefined ) {
+
+var tabId = 0,
+ rhash = /#.*$/;
+
+function getNextTabId() {
+ return ++tabId;
+}
+
+function isLocal( anchor ) {
+ return anchor.hash.length > 1 &&
+ decodeURIComponent( anchor.href.replace( rhash, "" ) ) ===
+ decodeURIComponent( location.href.replace( rhash, "" ) );
+}
+
+$.widget( "ui.tabs", {
+ version: "1.10.0",
+ delay: 300,
+ options: {
+ active: null,
+ collapsible: false,
+ event: "click",
+ heightStyle: "content",
+ hide: null,
+ show: null,
+
+ // callbacks
+ activate: null,
+ beforeActivate: null,
+ beforeLoad: null,
+ load: null
+ },
+
+ _create: function() {
+ var that = this,
+ options = this.options;
+
+ this.running = false;
+
+ this.element
+ .addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" )
+ .toggleClass( "ui-tabs-collapsible", options.collapsible )
+ // Prevent users from focusing disabled tabs via click
+ .delegate( ".ui-tabs-nav > li", "mousedown" + this.eventNamespace, function( event ) {
+ if ( $( this ).is( ".ui-state-disabled" ) ) {
+ event.preventDefault();
+ }
+ })
+ // support: IE <9
+ // Preventing the default action in mousedown doesn't prevent IE
+ // from focusing the element, so if the anchor gets focused, blur.
+ // We don't have to worry about focusing the previously focused
+ // element since clicking on a non-focusable element should focus
+ // the body anyway.
+ .delegate( ".ui-tabs-anchor", "focus" + this.eventNamespace, function() {
+ if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) {
+ this.blur();
+ }
+ });
+
+ this._processTabs();
+ options.active = this._initialActive();
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ if ( $.isArray( options.disabled ) ) {
+ options.disabled = $.unique( options.disabled.concat(
+ $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) {
+ return that.tabs.index( li );
+ })
+ ) ).sort();
+ }
+
+ // check for length avoids error when initializing empty list
+ if ( this.options.active !== false && this.anchors.length ) {
+ this.active = this._findActive( options.active );
+ } else {
+ this.active = $();
+ }
+
+ this._refresh();
+
+ if ( this.active.length ) {
+ this.load( options.active );
+ }
+ },
+
+ _initialActive: function() {
+ var active = this.options.active,
+ collapsible = this.options.collapsible,
+ locationHash = location.hash.substring( 1 );
+
+ if ( active === null ) {
+ // check the fragment identifier in the URL
+ if ( locationHash ) {
+ this.tabs.each(function( i, tab ) {
+ if ( $( tab ).attr( "aria-controls" ) === locationHash ) {
+ active = i;
+ return false;
+ }
+ });
+ }
+
+ // check for a tab marked active via a class
+ if ( active === null ) {
+ active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) );
+ }
+
+ // no active tab, set to false
+ if ( active === null || active === -1 ) {
+ active = this.tabs.length ? 0 : false;
+ }
+ }
+
+ // handle numbers: negative, out of range
+ if ( active !== false ) {
+ active = this.tabs.index( this.tabs.eq( active ) );
+ if ( active === -1 ) {
+ active = collapsible ? false : 0;
+ }
+ }
+
+ // don't allow collapsible: false and active: false
+ if ( !collapsible && active === false && this.anchors.length ) {
+ active = 0;
+ }
+
+ return active;
+ },
+
+ _getCreateEventData: function() {
+ return {
+ tab: this.active,
+ panel: !this.active.length ? $() : this._getPanelForTab( this.active )
+ };
+ },
+
+ _tabKeydown: function( event ) {
+ /*jshint maxcomplexity:15*/
+ var focusedTab = $( this.document[0].activeElement ).closest( "li" ),
+ selectedIndex = this.tabs.index( focusedTab ),
+ goingForward = true;
+
+ if ( this._handlePageNav( event ) ) {
+ return;
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ selectedIndex++;
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.LEFT:
+ goingForward = false;
+ selectedIndex--;
+ break;
+ case $.ui.keyCode.END:
+ selectedIndex = this.anchors.length - 1;
+ break;
+ case $.ui.keyCode.HOME:
+ selectedIndex = 0;
+ break;
+ case $.ui.keyCode.SPACE:
+ // Activate only, no collapsing
+ event.preventDefault();
+ clearTimeout( this.activating );
+ this._activate( selectedIndex );
+ return;
+ case $.ui.keyCode.ENTER:
+ // Toggle (cancel delayed activation, allow collapsing)
+ event.preventDefault();
+ clearTimeout( this.activating );
+ // Determine if we should collapse or activate
+ this._activate( selectedIndex === this.options.active ? false : selectedIndex );
+ return;
+ default:
+ return;
+ }
+
+ // Focus the appropriate tab, based on which key was pressed
+ event.preventDefault();
+ clearTimeout( this.activating );
+ selectedIndex = this._focusNextTab( selectedIndex, goingForward );
+
+ // Navigating with control key will prevent automatic activation
+ if ( !event.ctrlKey ) {
+ // Update aria-selected immediately so that AT think the tab is already selected.
+ // Otherwise AT may confuse the user by stating that they need to activate the tab,
+ // but the tab will already be activated by the time the announcement finishes.
+ focusedTab.attr( "aria-selected", "false" );
+ this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" );
+
+ this.activating = this._delay(function() {
+ this.option( "active", selectedIndex );
+ }, this.delay );
+ }
+ },
+
+ _panelKeydown: function( event ) {
+ if ( this._handlePageNav( event ) ) {
+ return;
+ }
+
+ // Ctrl+up moves focus to the current tab
+ if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) {
+ event.preventDefault();
+ this.active.focus();
+ }
+ },
+
+ // Alt+page up/down moves focus to the previous/next tab (and activates)
+ _handlePageNav: function( event ) {
+ if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) {
+ this._activate( this._focusNextTab( this.options.active - 1, false ) );
+ return true;
+ }
+ if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) {
+ this._activate( this._focusNextTab( this.options.active + 1, true ) );
+ return true;
+ }
+ },
+
+ _findNextTab: function( index, goingForward ) {
+ var lastTabIndex = this.tabs.length - 1;
+
+ function constrain() {
+ if ( index > lastTabIndex ) {
+ index = 0;
+ }
+ if ( index < 0 ) {
+ index = lastTabIndex;
+ }
+ return index;
+ }
+
+ while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) {
+ index = goingForward ? index + 1 : index - 1;
+ }
+
+ return index;
+ },
+
+ _focusNextTab: function( index, goingForward ) {
+ index = this._findNextTab( index, goingForward );
+ this.tabs.eq( index ).focus();
+ return index;
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "active" ) {
+ // _activate() will handle invalid values and update this.options
+ this._activate( value );
+ return;
+ }
+
+ if ( key === "disabled" ) {
+ // don't use the widget factory's disabled handling
+ this._setupDisabled( value );
+ return;
+ }
+
+ this._super( key, value);
+
+ if ( key === "collapsible" ) {
+ this.element.toggleClass( "ui-tabs-collapsible", value );
+ // Setting collapsible: false while collapsed; open first panel
+ if ( !value && this.options.active === false ) {
+ this._activate( 0 );
+ }
+ }
+
+ if ( key === "event" ) {
+ this._setupEvents( value );
+ }
+
+ if ( key === "heightStyle" ) {
+ this._setupHeightStyle( value );
+ }
+ },
+
+ _tabId: function( tab ) {
+ return tab.attr( "aria-controls" ) || "ui-tabs-" + getNextTabId();
+ },
+
+ _sanitizeSelector: function( hash ) {
+ return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : "";
+ },
+
+ refresh: function() {
+ var options = this.options,
+ lis = this.tablist.children( ":has(a[href])" );
+
+ // get disabled tabs from class attribute from HTML
+ // this will get converted to a boolean if needed in _refresh()
+ options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) {
+ return lis.index( tab );
+ });
+
+ this._processTabs();
+
+ // was collapsed or no tabs
+ if ( options.active === false || !this.anchors.length ) {
+ options.active = false;
+ this.active = $();
+ // was active, but active tab is gone
+ } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) {
+ // all remaining tabs are disabled
+ if ( this.tabs.length === options.disabled.length ) {
+ options.active = false;
+ this.active = $();
+ // activate previous tab
+ } else {
+ this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) );
+ }
+ // was active, active tab still exists
+ } else {
+ // make sure active index is correct
+ options.active = this.tabs.index( this.active );
+ }
+
+ this._refresh();
+ },
+
+ _refresh: function() {
+ this._setupDisabled( this.options.disabled );
+ this._setupEvents( this.options.event );
+ this._setupHeightStyle( this.options.heightStyle );
+
+ this.tabs.not( this.active ).attr({
+ "aria-selected": "false",
+ tabIndex: -1
+ });
+ this.panels.not( this._getPanelForTab( this.active ) )
+ .hide()
+ .attr({
+ "aria-expanded": "false",
+ "aria-hidden": "true"
+ });
+
+ // Make sure one tab is in the tab order
+ if ( !this.active.length ) {
+ this.tabs.eq( 0 ).attr( "tabIndex", 0 );
+ } else {
+ this.active
+ .addClass( "ui-tabs-active ui-state-active" )
+ .attr({
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ this._getPanelForTab( this.active )
+ .show()
+ .attr({
+ "aria-expanded": "true",
+ "aria-hidden": "false"
+ });
+ }
+ },
+
+ _processTabs: function() {
+ var that = this;
+
+ this.tablist = this._getList()
+ .addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" )
+ .attr( "role", "tablist" );
+
+ this.tabs = this.tablist.find( "> li:has(a[href])" )
+ .addClass( "ui-state-default ui-corner-top" )
+ .attr({
+ role: "tab",
+ tabIndex: -1
+ });
+
+ this.anchors = this.tabs.map(function() {
+ return $( "a", this )[ 0 ];
+ })
+ .addClass( "ui-tabs-anchor" )
+ .attr({
+ role: "presentation",
+ tabIndex: -1
+ });
+
+ this.panels = $();
+
+ this.anchors.each(function( i, anchor ) {
+ var selector, panel, panelId,
+ anchorId = $( anchor ).uniqueId().attr( "id" ),
+ tab = $( anchor ).closest( "li" ),
+ originalAriaControls = tab.attr( "aria-controls" );
+
+ // inline tab
+ if ( isLocal( anchor ) ) {
+ selector = anchor.hash;
+ panel = that.element.find( that._sanitizeSelector( selector ) );
+ // remote tab
+ } else {
+ panelId = that._tabId( tab );
+ selector = "#" + panelId;
+ panel = that.element.find( selector );
+ if ( !panel.length ) {
+ panel = that._createPanel( panelId );
+ panel.insertAfter( that.panels[ i - 1 ] || that.tablist );
+ }
+ panel.attr( "aria-live", "polite" );
+ }
+
+ if ( panel.length) {
+ that.panels = that.panels.add( panel );
+ }
+ if ( originalAriaControls ) {
+ tab.data( "ui-tabs-aria-controls", originalAriaControls );
+ }
+ tab.attr({
+ "aria-controls": selector.substring( 1 ),
+ "aria-labelledby": anchorId
+ });
+ panel.attr( "aria-labelledby", anchorId );
+ });
+
+ this.panels
+ .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+ .attr( "role", "tabpanel" );
+ },
+
+ // allow overriding how to find the list for rare usage scenarios (#7715)
+ _getList: function() {
+ return this.element.find( "ol,ul" ).eq( 0 );
+ },
+
+ _createPanel: function( id ) {
+ return $( "<div>" )
+ .attr( "id", id )
+ .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+ .data( "ui-tabs-destroy", true );
+ },
+
+ _setupDisabled: function( disabled ) {
+ if ( $.isArray( disabled ) ) {
+ if ( !disabled.length ) {
+ disabled = false;
+ } else if ( disabled.length === this.anchors.length ) {
+ disabled = true;
+ }
+ }
+
+ // disable tabs
+ for ( var i = 0, li; ( li = this.tabs[ i ] ); i++ ) {
+ if ( disabled === true || $.inArray( i, disabled ) !== -1 ) {
+ $( li )
+ .addClass( "ui-state-disabled" )
+ .attr( "aria-disabled", "true" );
+ } else {
+ $( li )
+ .removeClass( "ui-state-disabled" )
+ .removeAttr( "aria-disabled" );
+ }
+ }
+
+ this.options.disabled = disabled;
+ },
+
+ _setupEvents: function( event ) {
+ var events = {
+ click: function( event ) {
+ event.preventDefault();
+ }
+ };
+ if ( event ) {
+ $.each( event.split(" "), function( index, eventName ) {
+ events[ eventName ] = "_eventHandler";
+ });
+ }
+
+ this._off( this.anchors.add( this.tabs ).add( this.panels ) );
+ this._on( this.anchors, events );
+ this._on( this.tabs, { keydown: "_tabKeydown" } );
+ this._on( this.panels, { keydown: "_panelKeydown" } );
+
+ this._focusable( this.tabs );
+ this._hoverable( this.tabs );
+ },
+
+ _setupHeightStyle: function( heightStyle ) {
+ var maxHeight,
+ parent = this.element.parent();
+
+ if ( heightStyle === "fill" ) {
+ maxHeight = parent.height();
+ maxHeight -= this.element.outerHeight() - this.element.height();
+
+ this.element.siblings( ":visible" ).each(function() {
+ var elem = $( this ),
+ position = elem.css( "position" );
+
+ if ( position === "absolute" || position === "fixed" ) {
+ return;
+ }
+ maxHeight -= elem.outerHeight( true );
+ });
+
+ this.element.children().not( this.panels ).each(function() {
+ maxHeight -= $( this ).outerHeight( true );
+ });
+
+ this.panels.each(function() {
+ $( this ).height( Math.max( 0, maxHeight -
+ $( this ).innerHeight() + $( this ).height() ) );
+ })
+ .css( "overflow", "auto" );
+ } else if ( heightStyle === "auto" ) {
+ maxHeight = 0;
+ this.panels.each(function() {
+ maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+ }).height( maxHeight );
+ }
+ },
+
+ _eventHandler: function( event ) {
+ var options = this.options,
+ active = this.active,
+ anchor = $( event.currentTarget ),
+ tab = anchor.closest( "li" ),
+ clickedIsActive = tab[ 0 ] === active[ 0 ],
+ collapsing = clickedIsActive && options.collapsible,
+ toShow = collapsing ? $() : this._getPanelForTab( tab ),
+ toHide = !active.length ? $() : this._getPanelForTab( active ),
+ eventData = {
+ oldTab: active,
+ oldPanel: toHide,
+ newTab: collapsing ? $() : tab,
+ newPanel: toShow
+ };
+
+ event.preventDefault();
+
+ if ( tab.hasClass( "ui-state-disabled" ) ||
+ // tab is already loading
+ tab.hasClass( "ui-tabs-loading" ) ||
+ // can't switch durning an animation
+ this.running ||
+ // click on active header, but not collapsible
+ ( clickedIsActive && !options.collapsible ) ||
+ // allow canceling activation
+ ( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+ return;
+ }
+
+ options.active = collapsing ? false : this.tabs.index( tab );
+
+ this.active = clickedIsActive ? $() : tab;
+ if ( this.xhr ) {
+ this.xhr.abort();
+ }
+
+ if ( !toHide.length && !toShow.length ) {
+ $.error( "jQuery UI Tabs: Mismatching fragment identifier." );
+ }
+
+ if ( toShow.length ) {
+ this.load( this.tabs.index( tab ), event );
+ }
+ this._toggle( event, eventData );
+ },
+
+ // handles show/hide for selecting tabs
+ _toggle: function( event, eventData ) {
+ var that = this,
+ toShow = eventData.newPanel,
+ toHide = eventData.oldPanel;
+
+ this.running = true;
+
+ function complete() {
+ that.running = false;
+ that._trigger( "activate", event, eventData );
+ }
+
+ function show() {
+ eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" );
+
+ if ( toShow.length && that.options.show ) {
+ that._show( toShow, that.options.show, complete );
+ } else {
+ toShow.show();
+ complete();
+ }
+ }
+
+ // start out by hiding, then showing, then completing
+ if ( toHide.length && this.options.hide ) {
+ this._hide( toHide, this.options.hide, function() {
+ eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" );
+ show();
+ });
+ } else {
+ eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" );
+ toHide.hide();
+ show();
+ }
+
+ toHide.attr({
+ "aria-expanded": "false",
+ "aria-hidden": "true"
+ });
+ eventData.oldTab.attr( "aria-selected", "false" );
+ // If we're switching tabs, remove the old tab from the tab order.
+ // If we're opening from collapsed state, remove the previous tab from the tab order.
+ // If we're collapsing, then keep the collapsing tab in the tab order.
+ if ( toShow.length && toHide.length ) {
+ eventData.oldTab.attr( "tabIndex", -1 );
+ } else if ( toShow.length ) {
+ this.tabs.filter(function() {
+ return $( this ).attr( "tabIndex" ) === 0;
+ })
+ .attr( "tabIndex", -1 );
+ }
+
+ toShow.attr({
+ "aria-expanded": "true",
+ "aria-hidden": "false"
+ });
+ eventData.newTab.attr({
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ },
+
+ _activate: function( index ) {
+ var anchor,
+ active = this._findActive( index );
+
+ // trying to activate the already active panel
+ if ( active[ 0 ] === this.active[ 0 ] ) {
+ return;
+ }
+
+ // trying to collapse, simulate a click on the current active header
+ if ( !active.length ) {
+ active = this.active;
+ }
+
+ anchor = active.find( ".ui-tabs-anchor" )[ 0 ];
+ this._eventHandler({
+ target: anchor,
+ currentTarget: anchor,
+ preventDefault: $.noop
+ });
+ },
+
+ _findActive: function( index ) {
+ return index === false ? $() : this.tabs.eq( index );
+ },
+
+ _getIndex: function( index ) {
+ // meta-function to give users option to provide a href string instead of a numerical index.
+ if ( typeof index === "string" ) {
+ index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) );
+ }
+
+ return index;
+ },
+
+ _destroy: function() {
+ if ( this.xhr ) {
+ this.xhr.abort();
+ }
+
+ this.element.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" );
+
+ this.tablist
+ .removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" )
+ .removeAttr( "role" );
+
+ this.anchors
+ .removeClass( "ui-tabs-anchor" )
+ .removeAttr( "role" )
+ .removeAttr( "tabIndex" )
+ .removeUniqueId();
+
+ this.tabs.add( this.panels ).each(function() {
+ if ( $.data( this, "ui-tabs-destroy" ) ) {
+ $( this ).remove();
+ } else {
+ $( this )
+ .removeClass( "ui-state-default ui-state-active ui-state-disabled " +
+ "ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel" )
+ .removeAttr( "tabIndex" )
+ .removeAttr( "aria-live" )
+ .removeAttr( "aria-busy" )
+ .removeAttr( "aria-selected" )
+ .removeAttr( "aria-labelledby" )
+ .removeAttr( "aria-hidden" )
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "role" );
+ }
+ });
+
+ this.tabs.each(function() {
+ var li = $( this ),
+ prev = li.data( "ui-tabs-aria-controls" );
+ if ( prev ) {
+ li
+ .attr( "aria-controls", prev )
+ .removeData( "ui-tabs-aria-controls" );
+ } else {
+ li.removeAttr( "aria-controls" );
+ }
+ });
+
+ this.panels.show();
+
+ if ( this.options.heightStyle !== "content" ) {
+ this.panels.css( "height", "" );
+ }
+ },
+
+ enable: function( index ) {
+ var disabled = this.options.disabled;
+ if ( disabled === false ) {
+ return;
+ }
+
+ if ( index === undefined ) {
+ disabled = false;
+ } else {
+ index = this._getIndex( index );
+ if ( $.isArray( disabled ) ) {
+ disabled = $.map( disabled, function( num ) {
+ return num !== index ? num : null;
+ });
+ } else {
+ disabled = $.map( this.tabs, function( li, num ) {
+ return num !== index ? num : null;
+ });
+ }
+ }
+ this._setupDisabled( disabled );
+ },
+
+ disable: function( index ) {
+ var disabled = this.options.disabled;
+ if ( disabled === true ) {
+ return;
+ }
+
+ if ( index === undefined ) {
+ disabled = true;
+ } else {
+ index = this._getIndex( index );
+ if ( $.inArray( index, disabled ) !== -1 ) {
+ return;
+ }
+ if ( $.isArray( disabled ) ) {
+ disabled = $.merge( [ index ], disabled ).sort();
+ } else {
+ disabled = [ index ];
+ }
+ }
+ this._setupDisabled( disabled );
+ },
+
+ load: function( index, event ) {
+ index = this._getIndex( index );
+ var that = this,
+ tab = this.tabs.eq( index ),
+ anchor = tab.find( ".ui-tabs-anchor" ),
+ panel = this._getPanelForTab( tab ),
+ eventData = {
+ tab: tab,
+ panel: panel
+ };
+
+ // not remote
+ if ( isLocal( anchor[ 0 ] ) ) {
+ return;
+ }
+
+ this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) );
+
+ // support: jQuery <1.8
+ // jQuery <1.8 returns false if the request is canceled in beforeSend,
+ // but as of 1.8, $.ajax() always returns a jqXHR object.
+ if ( this.xhr && this.xhr.statusText !== "canceled" ) {
+ tab.addClass( "ui-tabs-loading" );
+ panel.attr( "aria-busy", "true" );
+
+ this.xhr
+ .success(function( response ) {
+ // support: jQuery <1.8
+ // http://bugs.jquery.com/ticket/11778
+ setTimeout(function() {
+ panel.html( response );
+ that._trigger( "load", event, eventData );
+ }, 1 );
+ })
+ .complete(function( jqXHR, status ) {
+ // support: jQuery <1.8
+ // http://bugs.jquery.com/ticket/11778
+ setTimeout(function() {
+ if ( status === "abort" ) {
+ that.panels.stop( false, true );
+ }
+
+ tab.removeClass( "ui-tabs-loading" );
+ panel.removeAttr( "aria-busy" );
+
+ if ( jqXHR === that.xhr ) {
+ delete that.xhr;
+ }
+ }, 1 );
+ });
+ }
+ },
+
+ _ajaxSettings: function( anchor, event, eventData ) {
+ var that = this;
+ return {
+ url: anchor.attr( "href" ),
+ beforeSend: function( jqXHR, settings ) {
+ return that._trigger( "beforeLoad", event,
+ $.extend( { jqXHR : jqXHR, ajaxSettings: settings }, eventData ) );
+ }
+ };
+ },
+
+ _getPanelForTab: function( tab ) {
+ var id = $( tab ).attr( "aria-controls" );
+ return this.element.find( this._sanitizeSelector( "#" + id ) );
+ }
+});
+
+})( jQuery );
+(function( $ ) {
+
+var increments = 0;
+
+function addDescribedBy( elem, id ) {
+ var describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ );
+ describedby.push( id );
+ elem
+ .data( "ui-tooltip-id", id )
+ .attr( "aria-describedby", $.trim( describedby.join( " " ) ) );
+}
+
+function removeDescribedBy( elem ) {
+ var id = elem.data( "ui-tooltip-id" ),
+ describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ),
+ index = $.inArray( id, describedby );
+ if ( index !== -1 ) {
+ describedby.splice( index, 1 );
+ }
+
+ elem.removeData( "ui-tooltip-id" );
+ describedby = $.trim( describedby.join( " " ) );
+ if ( describedby ) {
+ elem.attr( "aria-describedby", describedby );
+ } else {
+ elem.removeAttr( "aria-describedby" );
+ }
+}
+
+$.widget( "ui.tooltip", {
+ version: "1.10.0",
+ options: {
+ content: function() {
+ // support: IE<9, Opera in jQuery <1.7
+ // .text() can't accept undefined, so coerce to a string
+ var title = $( this ).attr( "title" ) || "";
+ // Escape title, since we're going from an attribute to raw HTML
+ return $( "<a>" ).text( title ).html();
+ },
+ hide: true,
+ // Disabled elements have inconsistent behavior across browsers (#8661)
+ items: "[title]:not([disabled])",
+ position: {
+ my: "left top+15",
+ at: "left bottom",
+ collision: "flipfit flip"
+ },
+ show: true,
+ tooltipClass: null,
+ track: false,
+
+ // callbacks
+ close: null,
+ open: null
+ },
+
+ _create: function() {
+ this._on({
+ mouseover: "open",
+ focusin: "open"
+ });
+
+ // IDs of generated tooltips, needed for destroy
+ this.tooltips = {};
+ // IDs of parent tooltips where we removed the title attribute
+ this.parents = {};
+
+ if ( this.options.disabled ) {
+ this._disable();
+ }
+ },
+
+ _setOption: function( key, value ) {
+ var that = this;
+
+ if ( key === "disabled" ) {
+ this[ value ? "_disable" : "_enable" ]();
+ this.options[ key ] = value;
+ // disable element style changes
+ return;
+ }
+
+ this._super( key, value );
+
+ if ( key === "content" ) {
+ $.each( this.tooltips, function( id, element ) {
+ that._updateContent( element );
+ });
+ }
+ },
+
+ _disable: function() {
+ var that = this;
+
+ // close open tooltips
+ $.each( this.tooltips, function( id, element ) {
+ var event = $.Event( "blur" );
+ event.target = event.currentTarget = element[0];
+ that.close( event, true );
+ });
+
+ // remove title attributes to prevent native tooltips
+ this.element.find( this.options.items ).addBack().each(function() {
+ var element = $( this );
+ if ( element.is( "[title]" ) ) {
+ element
+ .data( "ui-tooltip-title", element.attr( "title" ) )
+ .attr( "title", "" );
+ }
+ });
+ },
+
+ _enable: function() {
+ // restore title attributes
+ this.element.find( this.options.items ).addBack().each(function() {
+ var element = $( this );
+ if ( element.data( "ui-tooltip-title" ) ) {
+ element.attr( "title", element.data( "ui-tooltip-title" ) );
+ }
+ });
+ },
+
+ open: function( event ) {
+ var that = this,
+ target = $( event ? event.target : this.element )
+ // we need closest here due to mouseover bubbling,
+ // but always pointing at the same event target
+ .closest( this.options.items );
+
+ // No element to show a tooltip for or the tooltip is already open
+ if ( !target.length || target.data( "ui-tooltip-id" ) ) {
+ return;
+ }
+
+ if ( target.attr( "title" ) ) {
+ target.data( "ui-tooltip-title", target.attr( "title" ) );
+ }
+
+ target.data( "ui-tooltip-open", true );
+
+ // kill parent tooltips, custom or native, for hover
+ if ( event && event.type === "mouseover" ) {
+ target.parents().each(function() {
+ var parent = $( this ),
+ blurEvent;
+ if ( parent.data( "ui-tooltip-open" ) ) {
+ blurEvent = $.Event( "blur" );
+ blurEvent.target = blurEvent.currentTarget = this;
+ that.close( blurEvent, true );
+ }
+ if ( parent.attr( "title" ) ) {
+ parent.uniqueId();
+ that.parents[ this.id ] = {
+ element: this,
+ title: parent.attr( "title" )
+ };
+ parent.attr( "title", "" );
+ }
+ });
+ }
+
+ this._updateContent( target, event );
+ },
+
+ _updateContent: function( target, event ) {
+ var content,
+ contentOption = this.options.content,
+ that = this,
+ eventType = event ? event.type : null;
+
+ if ( typeof contentOption === "string" ) {
+ return this._open( event, target, contentOption );
+ }
+
+ content = contentOption.call( target[0], function( response ) {
+ // ignore async response if tooltip was closed already
+ if ( !target.data( "ui-tooltip-open" ) ) {
+ return;
+ }
+ // IE may instantly serve a cached response for ajax requests
+ // delay this call to _open so the other call to _open runs first
+ that._delay(function() {
+ // jQuery creates a special event for focusin when it doesn't
+ // exist natively. To improve performance, the native event
+ // object is reused and the type is changed. Therefore, we can't
+ // rely on the type being correct after the event finished
+ // bubbling, so we set it back to the previous value. (#8740)
+ if ( event ) {
+ event.type = eventType;
+ }
+ this._open( event, target, response );
+ });
+ });
+ if ( content ) {
+ this._open( event, target, content );
+ }
+ },
+
+ _open: function( event, target, content ) {
+ var tooltip, events, delayedShow,
+ positionOption = $.extend( {}, this.options.position );
+
+ if ( !content ) {
+ return;
+ }
+
+ // Content can be updated multiple times. If the tooltip already
+ // exists, then just update the content and bail.
+ tooltip = this._find( target );
+ if ( tooltip.length ) {
+ tooltip.find( ".ui-tooltip-content" ).html( content );
+ return;
+ }
+
+ // if we have a title, clear it to prevent the native tooltip
+ // we have to check first to avoid defining a title if none exists
+ // (we don't want to cause an element to start matching [title])
+ //
+ // We use removeAttr only for key events, to allow IE to export the correct
+ // accessible attributes. For mouse events, set to empty string to avoid
+ // native tooltip showing up (happens only when removing inside mouseover).
+ if ( target.is( "[title]" ) ) {
+ if ( event && event.type === "mouseover" ) {
+ target.attr( "title", "" );
+ } else {
+ target.removeAttr( "title" );
+ }
+ }
+
+ tooltip = this._tooltip( target );
+ addDescribedBy( target, tooltip.attr( "id" ) );
+ tooltip.find( ".ui-tooltip-content" ).html( content );
+
+ function position( event ) {
+ positionOption.of = event;
+ if ( tooltip.is( ":hidden" ) ) {
+ return;
+ }
+ tooltip.position( positionOption );
+ }
+ if ( this.options.track && event && /^mouse/.test( event.type ) ) {
+ this._on( this.document, {
+ mousemove: position
+ });
+ // trigger once to override element-relative positioning
+ position( event );
+ } else {
+ tooltip.position( $.extend({
+ of: target
+ }, this.options.position ) );
+ }
+
+ tooltip.hide();
+
+ this._show( tooltip, this.options.show );
+ // Handle tracking tooltips that are shown with a delay (#8644). As soon
+ // as the tooltip is visible, position the tooltip using the most recent
+ // event.
+ if ( this.options.show && this.options.show.delay ) {
+ delayedShow = this.delayedShow = setInterval(function() {
+ if ( tooltip.is( ":visible" ) ) {
+ position( positionOption.of );
+ clearInterval( delayedShow );
+ }
+ }, $.fx.interval );
+ }
+
+ this._trigger( "open", event, { tooltip: tooltip } );
+
+ events = {
+ keyup: function( event ) {
+ if ( event.keyCode === $.ui.keyCode.ESCAPE ) {
+ var fakeEvent = $.Event(event);
+ fakeEvent.currentTarget = target[0];
+ this.close( fakeEvent, true );
+ }
+ },
+ remove: function() {
+ this._removeTooltip( tooltip );
+ }
+ };
+ if ( !event || event.type === "mouseover" ) {
+ events.mouseleave = "close";
+ }
+ if ( !event || event.type === "focusin" ) {
+ events.focusout = "close";
+ }
+ this._on( true, target, events );
+ },
+
+ close: function( event ) {
+ var that = this,
+ target = $( event ? event.currentTarget : this.element ),
+ tooltip = this._find( target );
+
+ // disabling closes the tooltip, so we need to track when we're closing
+ // to avoid an infinite loop in case the tooltip becomes disabled on close
+ if ( this.closing ) {
+ return;
+ }
+
+ // Clear the interval for delayed tracking tooltips
+ clearInterval( this.delayedShow );
+
+ // only set title if we had one before (see comment in _open())
+ if ( target.data( "ui-tooltip-title" ) ) {
+ target.attr( "title", target.data( "ui-tooltip-title" ) );
+ }
+
+ removeDescribedBy( target );
+
+ tooltip.stop( true );
+ this._hide( tooltip, this.options.hide, function() {
+ that._removeTooltip( $( this ) );
+ });
+
+ target.removeData( "ui-tooltip-open" );
+ this._off( target, "mouseleave focusout keyup" );
+ // Remove 'remove' binding only on delegated targets
+ if ( target[0] !== this.element[0] ) {
+ this._off( target, "remove" );
+ }
+ this._off( this.document, "mousemove" );
+
+ if ( event && event.type === "mouseleave" ) {
+ $.each( this.parents, function( id, parent ) {
+ $( parent.element ).attr( "title", parent.title );
+ delete that.parents[ id ];
+ });
+ }
+
+ this.closing = true;
+ this._trigger( "close", event, { tooltip: tooltip } );
+ this.closing = false;
+ },
+
+ _tooltip: function( element ) {
+ var id = "ui-tooltip-" + increments++,
+ tooltip = $( "<div>" )
+ .attr({
+ id: id,
+ role: "tooltip"
+ })
+ .addClass( "ui-tooltip ui-widget ui-corner-all ui-widget-content " +
+ ( this.options.tooltipClass || "" ) );
+ $( "<div>" )
+ .addClass( "ui-tooltip-content" )
+ .appendTo( tooltip );
+ tooltip.appendTo( this.document[0].body );
+ this.tooltips[ id ] = element;
+ return tooltip;
+ },
+
+ _find: function( target ) {
+ var id = target.data( "ui-tooltip-id" );
+ return id ? $( "#" + id ) : $();
+ },
+
+ _removeTooltip: function( tooltip ) {
+ tooltip.remove();
+ delete this.tooltips[ tooltip.attr( "id" ) ];
+ },
+
+ _destroy: function() {
+ var that = this;
+
+ // close open tooltips
+ $.each( this.tooltips, function( id, element ) {
+ // Delegate to close method to handle common cleanup
+ var event = $.Event( "blur" );
+ event.target = event.currentTarget = element[0];
+ that.close( event, true );
+
+ // Remove immediately; destroying an open tooltip doesn't use the
+ // hide animation
+ $( "#" + id ).remove();
+
+ // Restore the title
+ if ( element.data( "ui-tooltip-title" ) ) {
+ element.attr( "title", element.data( "ui-tooltip-title" ) );
+ element.removeData( "ui-tooltip-title" );
+ }
+ });
+ }
+});
+
+}( jQuery ) );
diff --git a/lib/jquery.MultiFile.js b/lib/jquery.MultiFile.js
deleted file mode 100644
index c74083e5..00000000
--- a/lib/jquery.MultiFile.js
+++ /dev/null
@@ -1,11 +0,0 @@
-/*
- ### jQuery Multiple File Upload Plugin v1.3 - 2008-09-30 ###
- * http://www.fyneworks.com/ - diego@fyneworks.com
- * Dual licensed under the MIT and GPL licenses:
- * http://www.opensource.org/licenses/mit-license.php
- * http://www.gnu.org/licenses/gpl.html
- ###
- Project: http://jquery.com/plugins/project/MultiFile/
- Website: http://www.fyneworks.com/jquery/multiple-file-upload/
-*/
-eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}(';2(K.1k)(3($){$.B($,{6:3(o){7 $("16:q.2L").6(o)}});$.B($.6,{18:{j:\'\',l:-1,1u:3(s){2($.1F){$.1F({2j:s.x(/\\n/m,\'<2i/>\'),19:{17:\'2K\',2s:\'2J\',2y:\'12.2I\',21:\'#1Q\',1P:\'#1O\',20:\'.8\',\'-1Z-17-1j\':\'1G\',\'-2f-17-1j\':\'1G\'}});K.2e($.2d,2h)}1m{2g(s)}},1p:\'$H\',y:{J:\'J\',1v:\'2r 2n 2q a $W q.\\2v 2x...\',T:\'2D T: $q\',1E:\'2E q 2H 1L 1J T:\\n$q\'}}});$.B($.6,{Z:3(a){p o=[];$(\'16:q\').M(3(){2($(5).X()==\'\')o[o.11]=5});7 $(o).M(3(){5.P=U}).1t(a||\'1w\')},1a:3(a){a=a||\'1w\';7 $(\'16:q.\'+a).1W(a).M(3(){5.P=t})},O:[\'28\',\'24\',\'27\'],1b:{},1H:3(b,c,d){p e,k;d=d||[];2(d.1l.1s().1o("1n")<0)d=[d];2(14(b)==\'3\'){$.6.Z();k=b.1r(c||K,d);$.6.1a();7 k};2(b.1l.1s().1o("1n")<0)b=[b];1q(p i=0;i<b.11;i++){e=b[i]+\'\';2(e)(3(a){$.6.1b[a]=$.15[a]||3(){};$.15[a]=3(){$.6.Z();k=$.6.1b[a].1r(5,2m);$.6.1a();7 k}})(e)}}});$.B($.15,{1c:3(){7 5.M(3(){2l{5.1c()}2k(e){}})},6:3(h){2($.6.O){$.6.1H($.6.O);$.6.O=L};7 $(5).M(3(e){2(5.1x)7;5.1x=U;K.6=(K.6||0)+1;e=K.6;p g={e:5,E:$(5),N:$(5).N()};2(14 h==\'2p\')h={l:h};2(14 h==\'2o\')h={j:h};p o=$.B({},$.6.18,h||{},($.2u?g.E.2t():($.1B?g.E.1B():L))||{});2(!(o.l>0)){o.l=g.E.D(\'2w\');2(!(o.l>0)){o.l=(u(g.e.1D.C(/\\b(l|2A)\\-([0-9]+)\\b/m)||[\'\']).C(/[0-9]+/m)||[\'\'])[0];2(!(o.l>0))o.l=-1;1m o.l=u(o.l).C(/[0-9]+/m)[0]}};o.l=Y 2C(o.l);o.j=o.j||g.E.D(\'j\')||\'\';2(!o.j){o.j=(g.e.1D.C(/\\b(j\\-[\\w\\|]+)\\b/m))||\'\';o.j=Y u(o.j).x(/^(j|W)\\-/i,\'\')};$.B(g,o||{});g.y=$.B({},$.6.18.y,g.y);$.B(g,{n:0,F:[],2G:[],1d:g.e.A||\'6\'+u(e),1e:3(z){7 g.1d+(z>0?\'1I\'+u(z):\'\')},G:3(a,b){p c=g[a],k=$(b).D(\'k\');2(c){p d=c(b,k,g);2(d!=L)7 d}7 U}});2(u(g.j).11>1){g.1f=Y 1K(\'\\\\.(\'+(g.j?g.j:\'\')+\')$\',\'m\')};g.I=g.1d+\'1N\';g.E.1M(\'<S A="\'+g.I+\'"></S>\');g.1g=$(\'#\'+g.I+\'\');g.e.H=g.e.H||\'q\'+e+\'[]\';g.1g.10(\'<R A="\'+g.I+\'1h"></R>\');g.13=$(\'#\'+g.I+\'1h\');g.V=3(c,d){g.n++;c.1i=g;c.i=d;2(c.i>0)c.A=c.H=L;c.A=c.A||g.1e(c.i);c.H=u(g.1p.x(/\\$H/m,g.E.D(\'H\')).x(/\\$A/m,g.E.D(\'A\')).x(/\\$g/m,(e>0?e:\'\')).x(/\\$i/m,(d>0?d:\'\')));$(c).X(\'\').D(\'k\',\'\')[0].k=\'\';2((g.l>0)&&((g.n-1)>(g.l)))c.P=U;g.Q=g.F[c.i]=c;c=$(c);$(c).1R(3(){$(5).1T();2(!g.G(\'1S\',5,g))7 t;p a=\'\',v=u(5.k||\'\');2(g.j&&v&&!v.C(g.1f))a=g.y.1v.x(\'$W\',u(v.C(/\\.\\w{1,4}$/m)));1q(p f 1U g.F)2(g.F[f]&&g.F[f]!=5)2(g.F[f].k==v)a=g.y.1E.x(\'$q\',v.C(/[^\\/\\\\]+$/m));p b=$(g.N).N();b.1t(\'6\');2(a!=\'\'){g.1u(a);g.n--;g.V(b[0],5.i);c.1y().1V(b);c.J();7 t};$(5).19({1A:\'1Y\',1z:\'-1X\'});g.13.22(b);g.1C(5);g.V(b[0],5.i+1);2(!g.G(\'23\',5,g))7 t})};g.1C=3(c){2(!g.G(\'2z\',c,g))7 t;p r=$(\'<S></S>\'),v=u(c.k||\'\'),a=$(\'<R 25="q" 26="\'+g.y.T.x(\'$q\',v)+\'">\'+v.C(/[^\\/\\\\]+$/m)[0]+\'</R>\'),b=$(\'<a 2B="#\'+g.I+\'">\'+g.y.J+\'</a>\');g.13.10(r.10(\'[\',b,\']&2b;\',a));b.29(3(){2(!g.G(\'2a\',c,g))7 t;g.n--;g.Q.P=t;g.F[c.i]=L;$(c).J();$(5).1y().J();$(g.Q).19({1A:\'\',1z:\'\'});$(g.Q).1c().X(\'\').D(\'k\',\'\')[0].k=\'\';2(!g.G(\'2F\',c,g))7 t;7 t});2(!g.G(\'2c\',c,g))7 t};2(!g.1i)g.V(g.e,0);g.n++})}});$(3(){$.6()})})(1k);',62,172,'||if|function||this|MultiFile|return||||||||||||accept|value|max|gi|||var|file|||false|String|||replace|STRING||id|extend|match|attr||slaves|trigger|name|wrapID|remove|window|null|each|clone|autoIntercept|disabled|current|span|div|selected|true|addSlave|ext|val|new|disableEmpty|append|length||labels|typeof|fn|input|border|options|css|reEnableEmpty|intercepted|reset|instanceKey|generateID|rxAccept|wrapper|_labels|MF|radius|jQuery|constructor|else|Array|indexOf|namePattern|for|apply|toString|addClass|error|denied|mfD|_MultiFile|parent|top|position|metadata|addToList|className|duplicate|blockUI|10px|intercept|_F|been|RegExp|already|wrap|_wrap|fff|color|900|change|onFileSelect|blur|in|prepend|removeClass|3000px|absolute|webkit|opacity|backgroundColor|before|afterFileSelect|ajaxSubmit|class|title|validate|submit|click|onFileRemove|nbsp|afterFileAppend|unblockUI|setTimeout|moz|alert|2000|br|message|catch|try|arguments|cannot|string|number|select|You|padding|data|meta|nTry|maxlength|again|size|onFileAppend|limit|href|Number|File|This|afterFileRemove|files|has|0pt|15px|none|multi'.split('|'),0,{})) \ No newline at end of file
diff --git a/lib/jquery.autocomplete.css b/lib/jquery.autocomplete.css
deleted file mode 100644
index ca425822..00000000
--- a/lib/jquery.autocomplete.css
+++ /dev/null
@@ -1,49 +0,0 @@
-.ac_results {
- padding: 0px;
- border: 1px solid black;
- background-color: white;
- overflow: hidden;
- z-index: 99999;
- text-align: left;
-}
-
-.ac_results ul {
- width: 100%;
- list-style-position: outside;
- list-style: none;
- padding: 0;
- margin: 0;
-}
-
-.ac_results li {
- margin: 0px;
- padding: 2px 5px;
- cursor: default;
- display: block;
- /*
- if width will be 100% horizontal scrollbar will apear
- when scroll mode will be used
- */
- /*width: 100%;*/
- font: menu;
- font-size: 12px;
- /*
- it is very important, if line-height not setted or setted
- in relative units scroll will be broken in firefox
- */
- line-height: 16px;
- overflow: hidden;
-}
-
-.ac_loading {
- background: white url('images/loading-small.gif') right center no-repeat;
-}
-
-.ac_odd {
- background-color: #eee;
-}
-
-.ac_over {
- background-color: #0A246A;
- color: white;
-}
diff --git a/lib/jquery.autocomplete.js b/lib/jquery.autocomplete.js
deleted file mode 100644
index 02f2b54d..00000000
--- a/lib/jquery.autocomplete.js
+++ /dev/null
@@ -1,13 +0,0 @@
-/*
- * Autocomplete - jQuery plugin 1.0.2
- *
- * Copyright (c) 2007 Dylan Verheul, Dan G. Switzer, Anjesh Tuladhar, Jörn Zaefferer
- *
- * Dual licensed under the MIT and GPL licenses:
- * http://www.opensource.org/licenses/mit-license.php
- * http://www.gnu.org/licenses/gpl.html
- *
- * Revision: $Id: jquery.autocomplete.js 5747 2008-06-25 18:30:55Z joern.zaefferer $
- *
- */
-eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}(';(3($){$.31.1o({12:3(b,d){5 c=Y b=="1w";d=$.1o({},$.D.1L,{11:c?b:14,w:c?14:b,1D:c?$.D.1L.1D:10,Z:d&&!d.1x?10:3U},d);d.1t=d.1t||3(a){6 a};d.1q=d.1q||d.1K;6 I.K(3(){1E $.D(I,d)})},M:3(a){6 I.X("M",a)},1y:3(a){6 I.15("1y",[a])},20:3(){6 I.15("20")},1Y:3(a){6 I.15("1Y",[a])},1X:3(){6 I.15("1X")}});$.D=3(o,r){5 t={2N:38,2I:40,2D:46,2x:9,2v:13,2q:27,2d:3x,2j:33,2o:34,2e:8};5 u=$(o).3f("12","3c").P(r.24);5 p;5 m="";5 n=$.D.2W(r);5 s=0;5 k;5 h={1z:B};5 l=$.D.2Q(r,o,1U,h);5 j;$.1T.2L&&$(o.2K).X("3S.12",3(){4(j){j=B;6 B}});u.X(($.1T.2L?"3Q":"3N")+".12",3(a){k=a.2F;3L(a.2F){Q t.2N:a.1d();4(l.L()){l.2y()}A{W(0,C)}N;Q t.2I:a.1d();4(l.L()){l.2u()}A{W(0,C)}N;Q t.2j:a.1d();4(l.L()){l.2t()}A{W(0,C)}N;Q t.2o:a.1d();4(l.L()){l.2s()}A{W(0,C)}N;Q r.19&&$.1p(r.R)==","&&t.2d:Q t.2x:Q t.2v:4(1U()){a.1d();j=C;6 B}N;Q t.2q:l.U();N;3A:1I(p);p=1H(W,r.1D);N}}).1G(3(){s++}).3v(3(){s=0;4(!h.1z){2k()}}).2i(3(){4(s++>1&&!l.L()){W(0,C)}}).X("1y",3(){5 c=(1n.7>1)?1n[1]:14;3 23(q,a){5 b;4(a&&a.7){16(5 i=0;i<a.7;i++){4(a[i].M.O()==q.O()){b=a[i];N}}}4(Y c=="3")c(b);A u.15("M",b&&[b.w,b.H])}$.K(1g(u.J()),3(i,a){1R(a,23,23)})}).X("20",3(){n.18()}).X("1Y",3(){$.1o(r,1n[1]);4("w"2G 1n[1])n.1f()}).X("1X",3(){l.1u();u.1u();$(o.2K).1u(".12")});3 1U(){5 b=l.26();4(!b)6 B;5 v=b.M;m=v;4(r.19){5 a=1g(u.J());4(a.7>1){v=a.17(0,a.7-1).2Z(r.R)+r.R+v}v+=r.R}u.J(v);1l();u.15("M",[b.w,b.H]);6 C}3 W(b,c){4(k==t.2D){l.U();6}5 a=u.J();4(!c&&a==m)6;m=a;a=1k(a);4(a.7>=r.22){u.P(r.21);4(!r.1C)a=a.O();1R(a,2V,1l)}A{1B();l.U()}};3 1g(b){4(!b){6[""]}5 d=b.1Z(r.R);5 c=[];$.K(d,3(i,a){4($.1p(a))c[i]=$.1p(a)});6 c}3 1k(a){4(!r.19)6 a;5 b=1g(a);6 b[b.7-1]}3 1A(q,a){4(r.1A&&(1k(u.J()).O()==q.O())&&k!=t.2e){u.J(u.J()+a.48(1k(m).7));$.D.1N(o,m.7,m.7+a.7)}};3 2k(){1I(p);p=1H(1l,47)};3 1l(){5 c=l.L();l.U();1I(p);1B();4(r.2U){u.1y(3(a){4(!a){4(r.19){5 b=1g(u.J()).17(0,-1);u.J(b.2Z(r.R)+(b.7?r.R:""))}A u.J("")}})}4(c)$.D.1N(o,o.H.7,o.H.7)};3 2V(q,a){4(a&&a.7&&s){1B();l.2T(a,q);1A(q,a[0].H);l.1W()}A{1l()}};3 1R(f,d,g){4(!r.1C)f=f.O();5 e=n.2S(f);4(e&&e.7){d(f,e)}A 4((Y r.11=="1w")&&(r.11.7>0)){5 c={45:+1E 44()};$.K(r.2R,3(a,b){c[a]=Y b=="3"?b():b});$.43({42:"41",3Z:"12"+o.3Y,2M:r.2M,11:r.11,w:$.1o({q:1k(f),3X:r.Z},c),3W:3(a){5 b=r.1r&&r.1r(a)||1r(a);n.1h(f,b);d(f,b)}})}A{l.2J();g(f)}};3 1r(c){5 d=[];5 b=c.1Z("\\n");16(5 i=0;i<b.7;i++){5 a=$.1p(b[i]);4(a){a=a.1Z("|");d[d.7]={w:a,H:a[0],M:r.1v&&r.1v(a,a[0])||a[0]}}}6 d};3 1B(){u.1e(r.21)}};$.D.1L={24:"3R",2H:"3P",21:"3O",22:1,1D:3M,1C:B,1a:C,1V:B,1j:10,Z:3K,2U:B,2R:{},1S:C,1K:3(a){6 a[0]},1q:14,1A:B,E:0,19:B,R:", ",1t:3(b,a){6 b.2C(1E 3J("(?![^&;]+;)(?!<[^<>]*)("+a.2C(/([\\^\\$\\(\\)\\[\\]\\{\\}\\*\\.\\+\\?\\|\\\\])/2A,"\\\\$1")+")(?![^<>]*>)(?![^&;]+;)","2A"),"<2z>$1</2z>")},1x:C,1s:3I};$.D.2W=3(g){5 h={};5 j=0;3 1a(s,a){4(!g.1C)s=s.O();5 i=s.3H(a);4(i==-1)6 B;6 i==0||g.1V};3 1h(q,a){4(j>g.1j){18()}4(!h[q]){j++}h[q]=a}3 1f(){4(!g.w)6 B;5 f={},2w=0;4(!g.11)g.1j=1;f[""]=[];16(5 i=0,30=g.w.7;i<30;i++){5 c=g.w[i];c=(Y c=="1w")?[c]:c;5 d=g.1q(c,i+1,g.w.7);4(d===B)1P;5 e=d.3G(0).O();4(!f[e])f[e]=[];5 b={H:d,w:c,M:g.1v&&g.1v(c)||d};f[e].1O(b);4(2w++<g.Z){f[""].1O(b)}};$.K(f,3(i,a){g.1j++;1h(i,a)})}1H(1f,25);3 18(){h={};j=0}6{18:18,1h:1h,1f:1f,2S:3(q){4(!g.1j||!j)6 14;4(!g.11&&g.1V){5 a=[];16(5 k 2G h){4(k.7>0){5 c=h[k];$.K(c,3(i,x){4(1a(x.H,q)){a.1O(x)}})}}6 a}A 4(h[q]){6 h[q]}A 4(g.1a){16(5 i=q.7-1;i>=g.22;i--){5 c=h[q.3F(0,i)];4(c){5 a=[];$.K(c,3(i,x){4(1a(x.H,q)){a[a.7]=x}});6 a}}}6 14}}};$.D.2Q=3(e,g,f,k){5 h={G:"3E"};5 j,y=-1,w,1m="",1M=C,F,z;3 2r(){4(!1M)6;F=$("<3D/>").U().P(e.2H).T("3C","3B").1J(2p.2n);z=$("<3z/>").1J(F).3y(3(a){4(V(a).2m&&V(a).2m.3w()==\'2l\'){y=$("1F",z).1e(h.G).3u(V(a));$(V(a)).P(h.G)}}).2i(3(a){$(V(a)).P(h.G);f();g.1G();6 B}).3t(3(){k.1z=C}).3s(3(){k.1z=B});4(e.E>0)F.T("E",e.E);1M=B}3 V(a){5 b=a.V;3r(b&&b.3q!="2l")b=b.3p;4(!b)6[];6 b}3 S(b){j.17(y,y+1).1e(h.G);2h(b);5 a=j.17(y,y+1).P(h.G);4(e.1x){5 c=0;j.17(0,y).K(3(){c+=I.1i});4((c+a[0].1i-z.1c())>z[0].3o){z.1c(c+a[0].1i-z.3n())}A 4(c<z.1c()){z.1c(c)}}};3 2h(a){y+=a;4(y<0){y=j.1b()-1}A 4(y>=j.1b()){y=0}}3 2g(a){6 e.Z&&e.Z<a?e.Z:a}3 2f(){z.2B();5 b=2g(w.7);16(5 i=0;i<b;i++){4(!w[i])1P;5 a=e.1K(w[i].w,i+1,b,w[i].H,1m);4(a===B)1P;5 c=$("<1F/>").3m(e.1t(a,1m)).P(i%2==0?"3l":"3k").1J(z)[0];$.w(c,"2c",w[i])}j=z.3j("1F");4(e.1S){j.17(0,1).P(h.G);y=0}4($.31.2b)z.2b()}6{2T:3(d,q){2r();w=d;1m=q;2f()},2u:3(){S(1)},2y:3(){S(-1)},2t:3(){4(y!=0&&y-8<0){S(-y)}A{S(-8)}},2s:3(){4(y!=j.1b()-1&&y+8>j.1b()){S(j.1b()-1-y)}A{S(8)}},U:3(){F&&F.U();j&&j.1e(h.G);y=-1},L:3(){6 F&&F.3i(":L")},3h:3(){6 I.L()&&(j.2a("."+h.G)[0]||e.1S&&j[0])},1W:3(){5 a=$(g).3g();F.T({E:Y e.E=="1w"||e.E>0?e.E:$(g).E(),2E:a.2E+g.1i,1Q:a.1Q}).1W();4(e.1x){z.1c(0);z.T({29:e.1s,3e:\'3d\'});4($.1T.3b&&Y 2p.2n.3T.29==="3a"){5 c=0;j.K(3(){c+=I.1i});5 b=c>e.1s;z.T(\'3V\',b?e.1s:c);4(!b){j.E(z.E()-28(j.T("32-1Q"))-28(j.T("32-39")))}}}},26:3(){5 a=j&&j.2a("."+h.G).1e(h.G);6 a&&a.7&&$.w(a[0],"2c")},2J:3(){z&&z.2B()},1u:3(){F&&F.37()}}};$.D.1N=3(b,a,c){4(b.2O){5 d=b.2O();d.36(C);d.35("2P",a);d.4c("2P",c);d.4b()}A 4(b.2Y){b.2Y(a,c)}A{4(b.2X){b.2X=a;b.4a=c}}b.1G()}})(49);',62,261,'|||function|if|var|return|length|||||||||||||||||||||||||data||active|list|else|false|true|Autocompleter|width|element|ACTIVE|value|this|val|each|visible|result|break|toLowerCase|addClass|case|multipleSeparator|moveSelect|css|hide|target|onChange|bind|typeof|max||url|autocomplete||null|trigger|for|slice|flush|multiple|matchSubset|size|scrollTop|preventDefault|removeClass|populate|trimWords|add|offsetHeight|cacheLength|lastWord|hideResultsNow|term|arguments|extend|trim|formatMatch|parse|scrollHeight|highlight|unbind|formatResult|string|scroll|search|mouseDownOnSelect|autoFill|stopLoading|matchCase|delay|new|li|focus|setTimeout|clearTimeout|appendTo|formatItem|defaults|needsInit|Selection|push|continue|left|request|selectFirst|browser|selectCurrent|matchContains|show|unautocomplete|setOptions|split|flushCache|loadingClass|minChars|findValueCallback|inputClass||selected||parseInt|maxHeight|filter|bgiframe|ac_data|COMMA|BACKSPACE|fillList|limitNumberOfItems|movePosition|click|PAGEUP|hideResults|LI|nodeName|body|PAGEDOWN|document|ESC|init|pageDown|pageUp|next|RETURN|nullData|TAB|prev|strong|gi|empty|replace|DEL|top|keyCode|in|resultsClass|DOWN|emptyList|form|opera|dataType|UP|createTextRange|character|Select|extraParams|load|display|mustMatch|receiveData|Cache|selectionStart|setSelectionRange|join|ol|fn|padding|||moveStart|collapse|remove||right|undefined|msie|off|auto|overflow|attr|offset|current|is|find|ac_odd|ac_even|html|innerHeight|clientHeight|parentNode|tagName|while|mouseup|mousedown|index|blur|toUpperCase|188|mouseover|ul|default|absolute|position|div|ac_over|substr|charAt|indexOf|180|RegExp|100|switch|400|keydown|ac_loading|ac_results|keypress|ac_input|submit|style|150|height|success|limit|name|port||abort|mode|ajax|Date|timestamp||200|substring|jQuery|selectionEnd|select|moveEnd'.split('|'),0,{}));
diff --git a/lib/jquery.cookie.js b/lib/jquery.cookie.js
deleted file mode 100644
index 6df1faca..00000000
--- a/lib/jquery.cookie.js
+++ /dev/null
@@ -1,96 +0,0 @@
-/**
- * Cookie plugin
- *
- * Copyright (c) 2006 Klaus Hartl (stilbuero.de)
- * Dual licensed under the MIT and GPL licenses:
- * http://www.opensource.org/licenses/mit-license.php
- * http://www.gnu.org/licenses/gpl.html
- *
- */
-
-/**
- * Create a cookie with the given name and value and other optional parameters.
- *
- * @example $.cookie('the_cookie', 'the_value');
- * @desc Set the value of a cookie.
- * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true });
- * @desc Create a cookie with all available options.
- * @example $.cookie('the_cookie', 'the_value');
- * @desc Create a session cookie.
- * @example $.cookie('the_cookie', null);
- * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain
- * used when the cookie was set.
- *
- * @param String name The name of the cookie.
- * @param String value The value of the cookie.
- * @param Object options An object literal containing key/value pairs to provide optional cookie attributes.
- * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object.
- * If a negative value is specified (e.g. a date in the past), the cookie will be deleted.
- * If set to null or omitted, the cookie will be a session cookie and will not be retained
- * when the the browser exits.
- * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie).
- * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie).
- * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will
- * require a secure protocol (like HTTPS).
- * @type undefined
- *
- * @name $.cookie
- * @cat Plugins/Cookie
- * @author Klaus Hartl/klaus.hartl@stilbuero.de
- */
-
-/**
- * Get the value of a cookie with the given name.
- *
- * @example $.cookie('the_cookie');
- * @desc Get the value of a cookie.
- *
- * @param String name The name of the cookie.
- * @return The value of the cookie.
- * @type String
- *
- * @name $.cookie
- * @cat Plugins/Cookie
- * @author Klaus Hartl/klaus.hartl@stilbuero.de
- */
-jQuery.cookie = function(name, value, options) {
- if (typeof value != 'undefined') { // name and value given, set cookie
- options = options || {};
- if (value === null) {
- value = '';
- options.expires = -1;
- }
- var expires = '';
- if (options.expires && (typeof options.expires == 'number' || options.expires.toUTCString)) {
- var date;
- if (typeof options.expires == 'number') {
- date = new Date();
- date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000));
- } else {
- date = options.expires;
- }
- expires = '; expires=' + date.toUTCString(); // use expires attribute, max-age is not supported by IE
- }
- // CAUTION: Needed to parenthesize options.path and options.domain
- // in the following expressions, otherwise they evaluate to undefined
- // in the packed version for some reason...
- var path = options.path ? '; path=' + (options.path) : '';
- var domain = options.domain ? '; domain=' + (options.domain) : '';
- var secure = options.secure ? '; secure' : '';
- document.cookie = [name, '=', encodeURIComponent(value), expires, path, domain, secure].join('');
- } else { // only name given, get cookie
- var cookieValue = null;
- if (document.cookie && document.cookie != '') {
- var cookies = document.cookie.split(';');
- for (var i = 0; i < cookies.length; i++) {
- var cookie = jQuery.trim(cookies[i]);
- // Does this cookie string begin with the name we want?
- if (cookie.substring(0, name.length + 1) == (name + '=')) {
- cookieValue = decodeURIComponent(cookie.substring(name.length + 1));
- break;
- }
- }
- }
- return cookieValue;
- }
-}; \ No newline at end of file
diff --git a/lib/jquery.form.js b/lib/jquery.form.js
index 40fb8b1f..64a91606 100644
--- a/lib/jquery.form.js
+++ b/lib/jquery.form.js
@@ -1,28 +1,31 @@
-/*
+/*!
* jQuery Form Plugin
- * version: 2.28 (10-MAY-2009)
- * @requires jQuery v1.2.2 or later
+ * version: 3.26.0-2013.01.28
+ * @requires jQuery v1.5 or later
*
* Examples and documentation at: http://malsup.com/jquery/form/
+ * Project repository: https://github.com/malsup/form
* Dual licensed under the MIT and GPL licenses:
- * http://www.opensource.org/licenses/mit-license.php
- * http://www.gnu.org/licenses/gpl.html
+ * http://malsup.github.com/mit-license.txt
+ * http://malsup.github.com/gpl-license-v2.txt
*/
+/*global ActiveXObject alert */
;(function($) {
+"use strict";
/*
Usage Note:
-----------
Do not use both ajaxSubmit and ajaxForm on the same form. These
- functions are intended to be exclusive. Use ajaxSubmit if you want
+ functions are mutually exclusive. Use ajaxSubmit if you want
to bind your own submit handler to the form. For example,
$(document).ready(function() {
- $('#myForm').bind('submit', function() {
+ $('#myForm').on('submit', function(e) {
+ e.preventDefault(); // <-- important
$(this).ajaxSubmit({
target: '#output'
});
- return false; // <-- important!
});
});
@@ -35,35 +38,59 @@
});
});
+ You can also use ajaxForm with delegation (requires jQuery v1.7+), so the
+ form does not have to exist when you invoke ajaxForm:
+
+ $('#myForm').ajaxForm({
+ delegation: true,
+ target: '#output'
+ });
+
When using ajaxForm, the ajaxSubmit function will be invoked for you
at the appropriate time.
*/
/**
+ * Feature detection
+ */
+var feature = {};
+feature.fileapi = $("<input type='file'/>").get(0).files !== undefined;
+feature.formdata = window.FormData !== undefined;
+
+/**
* ajaxSubmit() provides a mechanism for immediately submitting
* an HTML form using AJAX.
*/
$.fn.ajaxSubmit = function(options) {
+ /*jshint scripturl:true */
+
// fast fail if nothing selected (http://dev.jquery.com/ticket/2752)
if (!this.length) {
log('ajaxSubmit: skipping submit process - no element selected');
return this;
}
- if (typeof options == 'function')
+ var method, action, url, $form = this;
+
+ if (typeof options == 'function') {
options = { success: options };
+ }
- var url = $.trim(this.attr('action'));
+ method = this.attr('method');
+ action = this.attr('action');
+ url = (typeof action === 'string') ? $.trim(action) : '';
+ url = url || window.location.href || '';
if (url) {
- // clean url (don't include hash vaue)
- url = (url.match(/^([^#]+)/)||[])[1];
- }
- url = url || window.location.href || ''
+ // clean url (don't include hash vaue)
+ url = (url.match(/^([^#]+)/)||[])[1];
+ }
- options = $.extend({
+ options = $.extend(true, {
url: url,
- type: this.attr('method') || 'GET'
- }, options || {});
+ success: $.ajaxSettings.success,
+ type: method || 'GET',
+ iframeSrc: /^https/i.test(window.location.href || '') ? 'javascript:false' : 'about:blank'
+ }, options);
// hook for manipulating the form data before it is extracted;
// convenient for use with rich editors like tinyMCE or FCKEditor
@@ -80,17 +107,16 @@ $.fn.ajaxSubmit = function(options) {
return this;
}
- var a = this.formToArray(options.semantic);
+ var traditional = options.traditional;
+ if ( traditional === undefined ) {
+ traditional = $.ajaxSettings.traditional;
+ }
+
+ var elements = [];
+ var qx, a = this.formToArray(options.semantic, elements);
if (options.data) {
options.extraData = options.data;
- for (var n in options.data) {
- if(options.data[n] instanceof Array) {
- for (var k in options.data[n])
- a.push( { name: n, value: options.data[n][k] } );
- }
- else
- a.push( { name: n, value: options.data[n] } );
- }
+ qx = $.param(options.data, traditional);
}
// give pre-submit callback an opportunity to abort the submit
@@ -106,83 +132,197 @@ $.fn.ajaxSubmit = function(options) {
return this;
}
- var q = $.param(a);
-
+ var q = $.param(a, traditional);
+ if (qx) {
+ q = ( q ? (q + '&' + qx) : qx );
+ }
if (options.type.toUpperCase() == 'GET') {
options.url += (options.url.indexOf('?') >= 0 ? '&' : '?') + q;
options.data = null; // data is null for 'get'
}
- else
+ else {
options.data = q; // data is the query string for 'post'
+ }
- var $form = this, callbacks = [];
- if (options.resetForm) callbacks.push(function() { $form.resetForm(); });
- if (options.clearForm) callbacks.push(function() { $form.clearForm(); });
+ var callbacks = [];
+ if (options.resetForm) {
+ callbacks.push(function() { $form.resetForm(); });
+ }
+ if (options.clearForm) {
+ callbacks.push(function() { $form.clearForm(options.includeHidden); });
+ }
// perform a load on the target only if dataType is not provided
if (!options.dataType && options.target) {
var oldSuccess = options.success || function(){};
callbacks.push(function(data) {
- $(options.target).html(data).each(oldSuccess, arguments);
+ var fn = options.replaceTarget ? 'replaceWith' : 'html';
+ $(options.target)[fn](data).each(oldSuccess, arguments);
});
}
- else if (options.success)
+ else if (options.success) {
callbacks.push(options.success);
+ }
- options.success = function(data, status) {
- for (var i=0, max=callbacks.length; i < max; i++)
- callbacks[i].apply(options, [data, status, $form]);
+ options.success = function(data, status, xhr) { // jQuery 1.4+ passes xhr as 3rd arg
+ var context = options.context || this ; // jQuery 1.4+ supports scope context
+ for (var i=0, max=callbacks.length; i < max; i++) {
+ callbacks[i].apply(context, [data, status, xhr || $form, $form]);
+ }
};
// are there files to upload?
- var files = $('input:file', this).fieldValue();
- var found = false;
- for (var j=0; j < files.length; j++)
- if (files[j])
- found = true;
- var multipart = false;
-// var mp = 'multipart/form-data';
-// multipart = ($form.attr('enctype') == mp || $form.attr('encoding') == mp);
+ // [value] (issue #113), also see comment:
+ // https://github.com/malsup/form/commit/588306aedba1de01388032d5f42a60159eea9228#commitcomment-2180219
+ var fileInputs = $('input[type=file]:enabled[value!=""]', this);
+
+ var hasFileInputs = fileInputs.length > 0;
+ var mp = 'multipart/form-data';
+ var multipart = ($form.attr('enctype') == mp || $form.attr('encoding') == mp);
+
+ var fileAPI = feature.fileapi && feature.formdata;
+ log("fileAPI :" + fileAPI);
+ var shouldUseFrame = (hasFileInputs || multipart) && !fileAPI;
+
+ var jqxhr;
// options.iframe allows user to force iframe mode
- if (options.iframe || found || multipart) {
- // hack to fix Safari hang (thanks to Tim Molendijk for this)
- // see: http://groups.google.com/group/jquery-dev/browse_thread/thread/36395b7ab510dd5d
- if (options.closeKeepAlive)
- $.get(options.closeKeepAlive, fileUpload);
- else
- fileUpload();
- }
- else
- $.ajax(options);
+ // 06-NOV-09: now defaulting to iframe mode if file input is detected
+ if (options.iframe !== false && (options.iframe || shouldUseFrame)) {
+ // hack to fix Safari hang (thanks to Tim Molendijk for this)
+ // see: http://groups.google.com/group/jquery-dev/browse_thread/thread/36395b7ab510dd5d
+ if (options.closeKeepAlive) {
+ $.get(options.closeKeepAlive, function() {
+ jqxhr = fileUploadIframe(a);
+ });
+ }
+ else {
+ jqxhr = fileUploadIframe(a);
+ }
+ }
+ else if ((hasFileInputs || multipart) && fileAPI) {
+ jqxhr = fileUploadXhr(a);
+ }
+ else {
+ jqxhr = $.ajax(options);
+ }
+
+ $form.removeData('jqxhr').data('jqxhr', jqxhr);
+
+ // clear element array
+ for (var k=0; k < elements.length; k++)
+ elements[k] = null;
// fire 'notify' event
this.trigger('form-submit-notify', [this, options]);
return this;
+ // utility fn for deep serialization
+ function deepSerialize(extraData){
+ var serialized = $.param(extraData).split('&');
+ var len = serialized.length;
+ var result = [];
+ var i, part;
+ for (i=0; i < len; i++) {
+ // #252; undo param space replacement
+ serialized[i] = serialized[i].replace(/\+/g,' ');
+ part = serialized[i].split('=');
+ // #278; use array instead of object storage, favoring array serializations
+ result.push([decodeURIComponent(part[0]), decodeURIComponent(part[1])]);
+ }
+ return result;
+ }
- // private function for handling file uploads (hat tip to YAHOO!)
- function fileUpload() {
- var form = $form[0];
+ // XMLHttpRequest Level 2 file uploads (big hat tip to francois2metz)
+ function fileUploadXhr(a) {
+ var formdata = new FormData();
- /* (this breaks the watermark form uploader, turn it off for now)
- if ($(':input[name=submit]', form).length) {
- alert('Error: Form elements must not be named "submit".');
- return;
+ for (var i=0; i < a.length; i++) {
+ formdata.append(a[i].name, a[i].value);
}
- */
- var opts = $.extend({}, $.ajaxSettings, options);
- var s = $.extend(true, {}, $.extend(true, {}, $.ajaxSettings), opts);
+ if (options.extraData) {
+ var serializedData = deepSerialize(options.extraData);
+ for (i=0; i < serializedData.length; i++)
+ if (serializedData[i])
+ formdata.append(serializedData[i][0], serializedData[i][1]);
+ }
+
+ options.data = null;
+
+ var s = $.extend(true, {}, $.ajaxSettings, options, {
+ contentType: false,
+ processData: false,
+ cache: false,
+ type: method || 'POST'
+ });
+
+ if (options.uploadProgress) {
+ // workaround because jqXHR does not expose upload property
+ s.xhr = function() {
+ var xhr = jQuery.ajaxSettings.xhr();
+ if (xhr.upload) {
+ xhr.upload.onprogress = function(event) {
+ var percent = 0;
+ var position = event.loaded || event.position; /*event.position is deprecated*/
+ var total = event.total;
+ if (event.lengthComputable) {
+ percent = Math.ceil(position / total * 100);
+ }
+ options.uploadProgress(event, position, total, percent);
+ };
+ }
+ return xhr;
+ };
+ }
- var id = 'jqFormIO' + (new Date().getTime());
- var $io = $('<iframe id="' + id + '" name="' + id + '" src="about:blank" />');
- var io = $io[0];
+ s.data = null;
+ var beforeSend = s.beforeSend;
+ s.beforeSend = function(xhr, o) {
+ o.data = formdata;
+ if(beforeSend)
+ beforeSend.call(this, xhr, o);
+ };
+ return $.ajax(s);
+ }
- $io.css({ position: 'absolute', top: '-1000px', left: '-1000px' });
+ // private function for handling file uploads (hat tip to YAHOO!)
+ function fileUploadIframe(a) {
+ var form = $form[0], el, i, s, g, id, $io, io, xhr, sub, n, timedOut, timeoutHandle;
+ var useProp = !!$.fn.prop;
+ var deferred = $.Deferred();
- var xhr = { // mock object
+ if (a) {
+ // ensure that every serialized input is still enabled
+ for (i=0; i < elements.length; i++) {
+ el = $(elements[i]);
+ if ( useProp )
+ el.prop('disabled', false);
+ else
+ el.removeAttr('disabled');
+ }
+ }
+
+ s = $.extend(true, {}, $.ajaxSettings, options);
+ s.context = s.context || s;
+ id = 'jqFormIO' + (new Date().getTime());
+ if (s.iframeTarget) {
+ $io = $(s.iframeTarget);
+ n = $io.attr('name');
+ if (!n)
+ $io.attr('name', id);
+ else
+ id = n;
+ }
+ else {
+ $io = $('<iframe name="' + id + '" src="'+ s.iframeSrc +'" />');
+ $io.css({ position: 'absolute', top: '-1000px', left: '-1000px' });
+ }
+ io = $io[0];
+
+
+ xhr = { // mock object
aborted: 0,
responseText: null,
responseXML: null,
@@ -191,55 +331,96 @@ $.fn.ajaxSubmit = function(options) {
getAllResponseHeaders: function() {},
getResponseHeader: function() {},
setRequestHeader: function() {},
- abort: function() {
+ abort: function(status) {
+ var e = (status === 'timeout' ? 'timeout' : 'aborted');
+ log('aborting upload... ' + e);
this.aborted = 1;
- $io.attr('src','about:blank'); // abort op in progress
+
+ try { // #214, #257
+ if (io.contentWindow.document.execCommand) {
+ io.contentWindow.document.execCommand('Stop');
+ }
+ }
+ catch(ignore) {}
+
+ $io.attr('src', s.iframeSrc); // abort op in progress
+ xhr.error = e;
+ if (s.error)
+ s.error.call(s.context, xhr, e, status);
+ if (g)
+ $.event.trigger("ajaxError", [xhr, s, e]);
+ if (s.complete)
+ s.complete.call(s.context, xhr, e);
}
};
- var g = opts.global;
+ g = s.global;
// trigger ajax global events so that activity/block indicators work like normal
- if (g && ! $.active++) $.event.trigger("ajaxStart");
- if (g) $.event.trigger("ajaxSend", [xhr, opts]);
-
- if (s.beforeSend && s.beforeSend(xhr, s) === false) {
- s.global && $.active--;
- return;
+ if (g && 0 === $.active++) {
+ $.event.trigger("ajaxStart");
+ }
+ if (g) {
+ $.event.trigger("ajaxSend", [xhr, s]);
}
- if (xhr.aborted)
- return;
- var cbInvoked = 0;
- var timedOut = 0;
+ if (s.beforeSend && s.beforeSend.call(s.context, xhr, s) === false) {
+ if (s.global) {
+ $.active--;
+ }
+ deferred.reject();
+ return deferred;
+ }
+ if (xhr.aborted) {
+ deferred.reject();
+ return deferred;
+ }
// add submitting element to data if we know it
- var sub = form.clk;
+ sub = form.clk;
if (sub) {
- var n = sub.name;
+ n = sub.name;
if (n && !sub.disabled) {
- options.extraData = options.extraData || {};
- options.extraData[n] = sub.value;
+ s.extraData = s.extraData || {};
+ s.extraData[n] = sub.value;
if (sub.type == "image") {
- options.extraData[name+'.x'] = form.clk_x;
- options.extraData[name+'.y'] = form.clk_y;
+ s.extraData[n+'.x'] = form.clk_x;
+ s.extraData[n+'.y'] = form.clk_y;
}
}
}
+ var CLIENT_TIMEOUT_ABORT = 1;
+ var SERVER_ABORT = 2;
+
+ function getDoc(frame) {
+ var doc = frame.contentWindow ? frame.contentWindow.document : frame.contentDocument ? frame.contentDocument : frame.document;
+ return doc;
+ }
+
+ // Rails CSRF hack (thanks to Yvan Barthelemy)
+ var csrf_token = $('meta[name=csrf-token]').attr('content');
+ var csrf_param = $('meta[name=csrf-param]').attr('content');
+ if (csrf_param && csrf_token) {
+ s.extraData = s.extraData || {};
+ s.extraData[csrf_param] = csrf_token;
+ }
+
// take a breath so that pending repaints get some cpu time before the upload starts
- setTimeout(function() {
+ function doSubmit() {
// make sure form attrs are set
var t = $form.attr('target'), a = $form.attr('action');
- // update form attrs in IE friendly way
- form.setAttribute('target',id);
- if (form.getAttribute('method') != 'POST')
- form.setAttribute('method', 'POST');
- if (form.getAttribute('action') != opts.url)
- form.setAttribute('action', opts.url);
+ // update form attrs in IE friendly way
+ form.setAttribute('target',id);
+ if (!method) {
+ form.setAttribute('method', 'POST');
+ }
+ if (a != s.url) {
+ form.setAttribute('action', s.url);
+ }
// ie borks in some cases when setting encoding
- if (! options.skipEncodingOverride) {
+ if (! s.skipEncodingOverride && (!method || /post/i.test(method))) {
$form.attr({
encoding: 'multipart/form-data',
enctype: 'multipart/form-data'
@@ -247,103 +428,281 @@ $.fn.ajaxSubmit = function(options) {
}
// support timout
- if (opts.timeout)
- setTimeout(function() { timedOut = true; cb(); }, opts.timeout);
+ if (s.timeout) {
+ timeoutHandle = setTimeout(function() { timedOut = true; cb(CLIENT_TIMEOUT_ABORT); }, s.timeout);
+ }
+
+ // look for server aborts
+ function checkState() {
+ try {
+ var state = getDoc(io).readyState;
+ log('state = ' + state);
+ if (state && state.toLowerCase() == 'uninitialized')
+ setTimeout(checkState,50);
+ }
+ catch(e) {
+ log('Server abort: ' , e, ' (', e.name, ')');
+ cb(SERVER_ABORT);
+ if (timeoutHandle)
+ clearTimeout(timeoutHandle);
+ timeoutHandle = undefined;
+ }
+ }
// add "extra" data to form if provided in options
var extraInputs = [];
try {
- if (options.extraData)
- for (var n in options.extraData)
- extraInputs.push(
- $('<input type="hidden" name="'+n+'" value="'+options.extraData[n]+'" />')
- .appendTo(form)[0]);
+ if (s.extraData) {
+ for (var n in s.extraData) {
+ if (s.extraData.hasOwnProperty(n)) {
+ // if using the $.param format that allows for multiple values with the same name
+ if($.isPlainObject(s.extraData[n]) && s.extraData[n].hasOwnProperty('name') && s.extraData[n].hasOwnProperty('value')) {
+ extraInputs.push(
+ $('<input type="hidden" name="'+s.extraData[n].name+'">').val(s.extraData[n].value)
+ .appendTo(form)[0]);
+ } else {
+ extraInputs.push(
+ $('<input type="hidden" name="'+n+'">').val(s.extraData[n])
+ .appendTo(form)[0]);
+ }
+ }
+ }
+ }
- // add iframe to doc and submit the form
- $io.appendTo('body');
- io.attachEvent ? io.attachEvent('onload', cb) : io.addEventListener('load', cb, false);
- form.submit();
+ if (!s.iframeTarget) {
+ // add iframe to doc and submit the form
+ $io.appendTo('body');
+ if (io.attachEvent)
+ io.attachEvent('onload', cb);
+ else
+ io.addEventListener('load', cb, false);
+ }
+ setTimeout(checkState,15);
+ // just in case form has element with name/id of 'submit'
+ var submitFn = document.createElement('form').submit;
+ submitFn.apply(form);
}
finally {
// reset attrs and remove "extra" input elements
- form.setAttribute('action',a);
- t ? form.setAttribute('target', t) : $form.removeAttr('target');
+ form.setAttribute('action',a);
+ if(t) {
+ form.setAttribute('target', t);
+ } else {
+ $form.removeAttr('target');
+ }
$(extraInputs).remove();
}
- }, 10);
-
- var nullCheckFlag = 0;
+ }
- function cb() {
- if (cbInvoked++) return;
+ if (s.forceSync) {
+ doSubmit();
+ }
+ else {
+ setTimeout(doSubmit, 10); // this lets dom updates render
+ }
- io.detachEvent ? io.detachEvent('onload', cb) : io.removeEventListener('load', cb, false);
+ var data, doc, domCheckCount = 50, callbackProcessed;
- var ok = true;
+ function cb(e) {
+ if (xhr.aborted || callbackProcessed) {
+ return;
+ }
try {
- if (timedOut) throw 'timeout';
- // extract the server response from the iframe
- var data, doc;
-
- doc = io.contentWindow ? io.contentWindow.document : io.contentDocument ? io.contentDocument : io.document;
+ doc = getDoc(io);
+ }
+ catch(ex) {
+ log('cannot access response document: ', ex);
+ e = SERVER_ABORT;
+ }
+ if (e === CLIENT_TIMEOUT_ABORT && xhr) {
+ xhr.abort('timeout');
+ deferred.reject(xhr, 'timeout');
+ return;
+ }
+ else if (e == SERVER_ABORT && xhr) {
+ xhr.abort('server abort');
+ deferred.reject(xhr, 'error', 'server abort');
+ return;
+ }
- if ((doc.body == null || doc.body.innerHTML == '') && !nullCheckFlag) {
- // in some browsers (cough, Opera 9.2.x) the iframe DOM is not always traversable when
- // the onload callback fires, so we give them a 2nd chance
- nullCheckFlag = 1;
- cbInvoked--;
- setTimeout(cb, 100);
+ if (!doc || doc.location.href == s.iframeSrc) {
+ // response not received yet
+ if (!timedOut)
return;
+ }
+ if (io.detachEvent)
+ io.detachEvent('onload', cb);
+ else
+ io.removeEventListener('load', cb, false);
+
+ var status = 'success', errMsg;
+ try {
+ if (timedOut) {
+ throw 'timeout';
+ }
+
+ var isXml = s.dataType == 'xml' || doc.XMLDocument || $.isXMLDoc(doc);
+ log('isXml='+isXml);
+ if (!isXml && window.opera && (doc.body === null || !doc.body.innerHTML)) {
+ if (--domCheckCount) {
+ // in some browsers (Opera) the iframe DOM is not always traversable when
+ // the onload callback fires, so we loop a bit to accommodate
+ log('requeing onLoad callback, DOM not available');
+ setTimeout(cb, 250);
+ return;
+ }
+ // let this fall through because server response could be an empty document
+ //log('Could not access iframe DOM after mutiple tries.');
+ //throw 'DOMException: not available';
}
- xhr.responseText = doc.body ? doc.body.innerHTML : null;
+ //log('response detected');
+ var docRoot = doc.body ? doc.body : doc.documentElement;
+ xhr.responseText = docRoot ? docRoot.innerHTML : null;
xhr.responseXML = doc.XMLDocument ? doc.XMLDocument : doc;
+ if (isXml)
+ s.dataType = 'xml';
xhr.getResponseHeader = function(header){
- var headers = {'content-type': opts.dataType};
+ var headers = {'content-type': s.dataType};
return headers[header];
};
+ // support for XHR 'status' & 'statusText' emulation :
+ if (docRoot) {
+ xhr.status = Number( docRoot.getAttribute('status') ) || xhr.status;
+ xhr.statusText = docRoot.getAttribute('statusText') || xhr.statusText;
+ }
- if (opts.dataType == 'json' || opts.dataType == 'script') {
+ var dt = (s.dataType || '').toLowerCase();
+ var scr = /(json|script|text)/.test(dt);
+ if (scr || s.textarea) {
+ // see if user embedded response in textarea
var ta = doc.getElementsByTagName('textarea')[0];
- xhr.responseText = ta ? ta.value : xhr.responseText;
+ if (ta) {
+ xhr.responseText = ta.value;
+ // support for XHR 'status' & 'statusText' emulation :
+ xhr.status = Number( ta.getAttribute('status') ) || xhr.status;
+ xhr.statusText = ta.getAttribute('statusText') || xhr.statusText;
+ }
+ else if (scr) {
+ // account for browsers injecting pre around json response
+ var pre = doc.getElementsByTagName('pre')[0];
+ var b = doc.getElementsByTagName('body')[0];
+ if (pre) {
+ xhr.responseText = pre.textContent ? pre.textContent : pre.innerText;
+ }
+ else if (b) {
+ xhr.responseText = b.textContent ? b.textContent : b.innerText;
+ }
+ }
}
- else if (opts.dataType == 'xml' && !xhr.responseXML && xhr.responseText != null) {
+ else if (dt == 'xml' && !xhr.responseXML && xhr.responseText) {
xhr.responseXML = toXml(xhr.responseText);
}
- data = $.httpData(xhr, opts.dataType);
+
+ try {
+ data = httpData(xhr, dt, s);
+ }
+ catch (e) {
+ status = 'parsererror';
+ xhr.error = errMsg = (e || status);
+ }
+ }
+ catch (e) {
+ log('error caught: ',e);
+ status = 'error';
+ xhr.error = errMsg = (e || status);
+ }
+
+ if (xhr.aborted) {
+ log('upload aborted');
+ status = null;
}
- catch(e){
- ok = false;
- $.handleError(opts, xhr, 'error', e);
+
+ if (xhr.status) { // we've set xhr.status
+ status = (xhr.status >= 200 && xhr.status < 300 || xhr.status === 304) ? 'success' : 'error';
}
// ordering of these callbacks/triggers is odd, but that's how $.ajax does it
- if (ok) {
- opts.success(data, 'success');
- if (g) $.event.trigger("ajaxSuccess", [xhr, opts]);
+ if (status === 'success') {
+ if (s.success)
+ s.success.call(s.context, data, 'success', xhr);
+ deferred.resolve(xhr.responseText, 'success', xhr);
+ if (g)
+ $.event.trigger("ajaxSuccess", [xhr, s]);
+ }
+ else if (status) {
+ if (errMsg === undefined)
+ errMsg = xhr.statusText;
+ if (s.error)
+ s.error.call(s.context, xhr, status, errMsg);
+ deferred.reject(xhr, 'error', errMsg);
+ if (g)
+ $.event.trigger("ajaxError", [xhr, s, errMsg]);
+ }
+
+ if (g)
+ $.event.trigger("ajaxComplete", [xhr, s]);
+
+ if (g && ! --$.active) {
+ $.event.trigger("ajaxStop");
}
- if (g) $.event.trigger("ajaxComplete", [xhr, opts]);
- if (g && ! --$.active) $.event.trigger("ajaxStop");
- if (opts.complete) opts.complete(xhr, ok ? 'success' : 'error');
+
+ if (s.complete)
+ s.complete.call(s.context, xhr, status);
+
+ callbackProcessed = true;
+ if (s.timeout)
+ clearTimeout(timeoutHandle);
// clean up
setTimeout(function() {
- $io.remove();
+ if (!s.iframeTarget)
+ $io.remove();
xhr.responseXML = null;
}, 100);
- };
+ }
- function toXml(s, doc) {
+ var toXml = $.parseXML || function(s, doc) { // use parseXML if available (jQuery 1.5+)
if (window.ActiveXObject) {
doc = new ActiveXObject('Microsoft.XMLDOM');
doc.async = 'false';
doc.loadXML(s);
}
- else
+ else {
doc = (new DOMParser()).parseFromString(s, 'text/xml');
- return (doc && doc.documentElement && doc.documentElement.tagName != 'parsererror') ? doc : null;
+ }
+ return (doc && doc.documentElement && doc.documentElement.nodeName != 'parsererror') ? doc : null;
};
- };
+ var parseJSON = $.parseJSON || function(s) {
+ /*jslint evil:true */
+ return window['eval']('(' + s + ')');
+ };
+
+ var httpData = function( xhr, type, s ) { // mostly lifted from jq1.4.4
+
+ var ct = xhr.getResponseHeader('content-type') || '',
+ xml = type === 'xml' || !type && ct.indexOf('xml') >= 0,
+ data = xml ? xhr.responseXML : xhr.responseText;
+
+ if (xml && data.documentElement.nodeName === 'parsererror') {
+ if ($.error)
+ $.error('parsererror');
+ }
+ if (s && s.dataFilter) {
+ data = s.dataFilter(data, type);
+ }
+ if (typeof data === 'string') {
+ if (type === 'json' || !type && ct.indexOf('json') >= 0) {
+ data = parseJSON(data);
+ } else if (type === "script" || !type && ct.indexOf("javascript") >= 0) {
+ $.globalEval(data);
+ }
+ }
+ return data;
+ };
+
+ return deferred;
+ }
};
/**
@@ -362,40 +721,83 @@ $.fn.ajaxSubmit = function(options) {
* the form itself.
*/
$.fn.ajaxForm = function(options) {
- return this.ajaxFormUnbind().bind('submit.form-plugin',function() {
- $(this).ajaxSubmit(options);
- return false;
- }).each(function() {
- // store options in hash
- $(":submit,input:image", this).bind('click.form-plugin',function(e) {
- var form = this.form;
- form.clk = this;
- if (this.type == 'image') {
- if (e.offsetX != undefined) {
- form.clk_x = e.offsetX;
- form.clk_y = e.offsetY;
- } else if (typeof $.fn.offset == 'function') { // try to use dimensions plugin
- var offset = $(this).offset();
- form.clk_x = e.pageX - offset.left;
- form.clk_y = e.pageY - offset.top;
- } else {
- form.clk_x = e.pageX - this.offsetLeft;
- form.clk_y = e.pageY - this.offsetTop;
- }
- }
- // clear form vars
- setTimeout(function() { form.clk = form.clk_x = form.clk_y = null; }, 10);
- });
- });
+ options = options || {};
+ options.delegation = options.delegation && $.isFunction($.fn.on);
+
+ // in jQuery 1.3+ we can fix mistakes with the ready state
+ if (!options.delegation && this.length === 0) {
+ var o = { s: this.selector, c: this.context };
+ if (!$.isReady && o.s) {
+ log('DOM not ready, queuing ajaxForm');
+ $(function() {
+ $(o.s,o.c).ajaxForm(options);
+ });
+ return this;
+ }
+ // is your DOM ready? http://docs.jquery.com/Tutorials:Introducing_$(document).ready()
+ log('terminating; zero elements found by selector' + ($.isReady ? '' : ' (DOM not ready)'));
+ return this;
+ }
+
+ if ( options.delegation ) {
+ $(document)
+ .off('submit.form-plugin', this.selector, doAjaxSubmit)
+ .off('click.form-plugin', this.selector, captureSubmittingElement)
+ .on('submit.form-plugin', this.selector, options, doAjaxSubmit)
+ .on('click.form-plugin', this.selector, options, captureSubmittingElement);
+ return this;
+ }
+
+ return this.ajaxFormUnbind()
+ .bind('submit.form-plugin', options, doAjaxSubmit)
+ .bind('click.form-plugin', options, captureSubmittingElement);
};
+// private event handlers
+function doAjaxSubmit(e) {
+ /*jshint validthis:true */
+ var options = e.data;
+ if (!e.isDefaultPrevented()) { // if event has been canceled, don't proceed
+ e.preventDefault();
+ $(this).ajaxSubmit(options);
+ }
+}
+
+function captureSubmittingElement(e) {
+ /*jshint validthis:true */
+ var target = e.target;
+ var $el = $(target);
+ if (!($el.is("[type=submit],[type=image]"))) {
+ // is this a child element of the submit el? (ex: a span within a button)
+ var t = $el.closest('[type=submit]');
+ if (t.length === 0) {
+ return;
+ }
+ target = t[0];
+ }
+ var form = this;
+ form.clk = target;
+ if (target.type == 'image') {
+ if (e.offsetX !== undefined) {
+ form.clk_x = e.offsetX;
+ form.clk_y = e.offsetY;
+ } else if (typeof $.fn.offset == 'function') {
+ var offset = $el.offset();
+ form.clk_x = e.pageX - offset.left;
+ form.clk_y = e.pageY - offset.top;
+ } else {
+ form.clk_x = e.pageX - target.offsetLeft;
+ form.clk_y = e.pageY - target.offsetTop;
+ }
+ }
+ // clear form vars
+ setTimeout(function() { form.clk = form.clk_x = form.clk_y = null; }, 100);
+}
+
+
// ajaxFormUnbind unbinds the event handlers that were bound by ajaxForm
$.fn.ajaxFormUnbind = function() {
- this.unbind('submit.form-plugin');
- return this.each(function() {
- $(":submit,input:image", this).unbind('click.form-plugin');
- });
-
+ return this.unbind('submit.form-plugin click.form-plugin');
};
/**
@@ -409,41 +811,70 @@ $.fn.ajaxFormUnbind = function() {
* It is this array that is passed to pre-submit callback functions provided to the
* ajaxSubmit() and ajaxForm() methods.
*/
-$.fn.formToArray = function(semantic) {
+$.fn.formToArray = function(semantic, elements) {
var a = [];
- if (this.length == 0) return a;
+ if (this.length === 0) {
+ return a;
+ }
var form = this[0];
var els = semantic ? form.getElementsByTagName('*') : form.elements;
- if (!els) return a;
- for(var i=0, max=els.length; i < max; i++) {
- var el = els[i];
- var n = el.name;
- if (!n) continue;
+ if (!els) {
+ return a;
+ }
+
+ var i,j,n,v,el,max,jmax;
+ for(i=0, max=els.length; i < max; i++) {
+ el = els[i];
+ n = el.name;
+ if (!n) {
+ continue;
+ }
if (semantic && form.clk && el.type == "image") {
// handle image inputs on the fly when semantic == true
if(!el.disabled && form.clk == el) {
- a.push({name: n, value: $(el).val()});
+ a.push({name: n, value: $(el).val(), type: el.type });
a.push({name: n+'.x', value: form.clk_x}, {name: n+'.y', value: form.clk_y});
}
continue;
}
- var v = $.fieldValue(el, true);
+ v = $.fieldValue(el, true);
if (v && v.constructor == Array) {
- for(var j=0, jmax=v.length; j < jmax; j++)
+ if (elements)
+ elements.push(el);
+ for(j=0, jmax=v.length; j < jmax; j++) {
a.push({name: n, value: v[j]});
+ }
+ }
+ else if (feature.fileapi && el.type == 'file' && !el.disabled) {
+ if (elements)
+ elements.push(el);
+ var files = el.files;
+ if (files.length) {
+ for (j=0; j < files.length; j++) {
+ a.push({name: n, value: files[j], type: el.type});
+ }
+ }
+ else {
+ // #180
+ a.push({ name: n, value: '', type: el.type });
+ }
+ }
+ else if (v !== null && typeof v != 'undefined') {
+ if (elements)
+ elements.push(el);
+ a.push({name: n, value: v, type: el.type, required: el.required});
}
- else if (v !== null && typeof v != 'undefined')
- a.push({name: n, value: v});
}
if (!semantic && form.clk) {
// input type=='image' are not found in elements array! handle it here
- var $input = $(form.clk), input = $input[0], n = input.name;
+ var $input = $(form.clk), input = $input[0];
+ n = input.name;
if (n && !input.disabled && input.type == 'image') {
- a.push({name: n, value: $input.val()});
+ a.push({name: n, value: $input.val()});
a.push({name: n+'.x', value: form.clk_x}, {name: n+'.y', value: form.clk_y});
}
}
@@ -467,14 +898,18 @@ $.fn.fieldSerialize = function(successful) {
var a = [];
this.each(function() {
var n = this.name;
- if (!n) return;
+ if (!n) {
+ return;
+ }
var v = $.fieldValue(this, successful);
if (v && v.constructor == Array) {
- for (var i=0,max=v.length; i < max; i++)
+ for (var i=0,max=v.length; i < max; i++) {
a.push({name: n, value: v[i]});
+ }
}
- else if (v !== null && typeof v != 'undefined')
+ else if (v !== null && typeof v != 'undefined') {
a.push({name: this.name, value: v});
+ }
});
//hand off to jQuery.param for proper encoding
return $.param(a);
@@ -492,19 +927,19 @@ $.fn.fieldSerialize = function(successful) {
* <input name="C" type="radio" value="C2" />
* </fieldset></form>
*
- * var v = $(':text').fieldValue();
+ * var v = $('input[type=text]').fieldValue();
* // if no values are entered into the text inputs
* v == ['','']
* // if values entered into the text inputs are 'foo' and 'bar'
* v == ['foo','bar']
*
- * var v = $(':checkbox').fieldValue();
+ * var v = $('input[type=checkbox]').fieldValue();
* // if neither checkbox is checked
* v === undefined
* // if both checkboxes are checked
* v == ['B1', 'B2']
*
- * var v = $(':radio').fieldValue();
+ * var v = $('input[type=radio]').fieldValue();
* // if neither radio is checked
* v === undefined
* // if first radio is checked
@@ -516,15 +951,19 @@ $.fn.fieldSerialize = function(successful) {
* for each element is returned.
*
* Note: This method *always* returns an array. If no valid value can be determined the
- * array will be empty, otherwise it will contain one or more values.
+ * array will be empty, otherwise it will contain one or more values.
*/
$.fn.fieldValue = function(successful) {
for (var val=[], i=0, max=this.length; i < max; i++) {
var el = this[i];
var v = $.fieldValue(el, successful);
- if (v === null || typeof v == 'undefined' || (v.constructor == Array && !v.length))
+ if (v === null || typeof v == 'undefined' || (v.constructor == Array && !v.length)) {
continue;
- v.constructor == Array ? $.merge(val, v) : val.push(v);
+ }
+ if (v.constructor == Array)
+ $.merge(val, v);
+ else
+ val.push(v);
}
return val;
};
@@ -534,33 +973,41 @@ $.fn.fieldValue = function(successful) {
*/
$.fieldValue = function(el, successful) {
var n = el.name, t = el.type, tag = el.tagName.toLowerCase();
- if (typeof successful == 'undefined') successful = true;
+ if (successful === undefined) {
+ successful = true;
+ }
if (successful && (!n || el.disabled || t == 'reset' || t == 'button' ||
(t == 'checkbox' || t == 'radio') && !el.checked ||
(t == 'submit' || t == 'image') && el.form && el.form.clk != el ||
- tag == 'select' && el.selectedIndex == -1))
+ tag == 'select' && el.selectedIndex == -1)) {
return null;
+ }
if (tag == 'select') {
var index = el.selectedIndex;
- if (index < 0) return null;
+ if (index < 0) {
+ return null;
+ }
var a = [], ops = el.options;
var one = (t == 'select-one');
var max = (one ? index+1 : ops.length);
for(var i=(one ? index : 0); i < max; i++) {
var op = ops[i];
if (op.selected) {
- var v = op.value;
- if (!v) // extra pain for IE...
- v = (op.attributes && op.attributes['value'] && !(op.attributes['value'].specified)) ? op.text : op.value;
- if (one) return v;
+ var v = op.value;
+ if (!v) { // extra pain for IE...
+ v = (op.attributes && op.attributes['value'] && !(op.attributes['value'].specified)) ? op.text : op.value;
+ }
+ if (one) {
+ return v;
+ }
a.push(v);
}
}
return a;
}
- return el.value;
+ return $(el).val();
};
/**
@@ -571,24 +1018,44 @@ $.fieldValue = function(el, successful) {
* - inputs of type submit, button, reset, and hidden will *not* be effected
* - button elements will *not* be effected
*/
-$.fn.clearForm = function() {
+$.fn.clearForm = function(includeHidden) {
return this.each(function() {
- $('input,select,textarea', this).clearFields();
+ $('input,select,textarea', this).clearFields(includeHidden);
});
};
/**
* Clears the selected form elements.
*/
-$.fn.clearFields = $.fn.clearInputs = function() {
+$.fn.clearFields = $.fn.clearInputs = function(includeHidden) {
+ var re = /^(?:color|date|datetime|email|month|number|password|range|search|tel|text|time|url|week)$/i; // 'hidden' is not in this list
return this.each(function() {
var t = this.type, tag = this.tagName.toLowerCase();
- if (t == 'text' || t == 'password' || tag == 'textarea')
+ if (re.test(t) || tag == 'textarea') {
this.value = '';
- else if (t == 'checkbox' || t == 'radio')
+ }
+ else if (t == 'checkbox' || t == 'radio') {
this.checked = false;
- else if (tag == 'select')
+ }
+ else if (tag == 'select') {
this.selectedIndex = -1;
+ }
+ else if (t == "file") {
+ if (/MSIE/.test(navigator.userAgent)) {
+ $(this).replaceWith($(this).clone());
+ } else {
+ $(this).val('');
+ }
+ }
+ else if (includeHidden) {
+ // includeHidden can be the value true, or it can be a selector string
+ // indicating a special test; for example:
+ // $('#myForm').clearForm('.special:hidden')
+ // the above would clean hidden inputs that have the class of 'special'
+ if ( (includeHidden === true && /hidden/.test(t)) ||
+ (typeof includeHidden == 'string' && $(this).is(includeHidden)) )
+ this.value = '';
+ }
});
};
@@ -599,8 +1066,9 @@ $.fn.resetForm = function() {
return this.each(function() {
// guard against an input with the name of 'reset'
// note that IE reports the reset function as an 'object'
- if (typeof this.reset == 'function' || (typeof this.reset == 'object' && !this.reset.nodeType))
+ if (typeof this.reset == 'function' || (typeof this.reset == 'object' && !this.reset.nodeType)) {
this.reset();
+ }
});
};
@@ -608,7 +1076,9 @@ $.fn.resetForm = function() {
* Enables or disables any matching elements.
*/
$.fn.enable = function(b) {
- if (b == undefined) b = true;
+ if (b === undefined) {
+ b = true;
+ }
return this.each(function() {
this.disabled = !b;
});
@@ -619,11 +1089,14 @@ $.fn.enable = function(b) {
* selects/deselects and matching option elements.
*/
$.fn.selected = function(select) {
- if (select == undefined) select = true;
+ if (select === undefined) {
+ select = true;
+ }
return this.each(function() {
var t = this.type;
- if (t == 'checkbox' || t == 'radio')
+ if (t == 'checkbox' || t == 'radio') {
this.checked = select;
+ }
else if (this.tagName.toLowerCase() == 'option') {
var $sel = $(this).parent('select');
if (select && $sel[0] && $sel[0].type == 'select-one') {
@@ -635,11 +1108,20 @@ $.fn.selected = function(select) {
});
};
+// expose debug var
+$.fn.ajaxSubmit.debug = false;
+
// helper fn for console logging
-// set $.fn.ajaxSubmit.debug to true to enable debug logging
function log() {
- if ($.fn.ajaxSubmit.debug && window.console && window.console.log)
- window.console.log('[jquery.form] ' + Array.prototype.join.call(arguments,''));
-};
+ if (!$.fn.ajaxSubmit.debug)
+ return;
+ var msg = '[jquery.form] ' + Array.prototype.join.call(arguments,'');
+ if (window.console && window.console.log) {
+ window.console.log(msg);
+ }
+ else if (window.opera && window.opera.postError) {
+ window.opera.postError(msg);
+ }
+}
})(jQuery);
diff --git a/lib/jquery.jeditable.js b/lib/jquery.jeditable.js
deleted file mode 100644
index 9f0ab37d..00000000
--- a/lib/jquery.jeditable.js
+++ /dev/null
@@ -1,32 +0,0 @@
-
-(function($){$.fn.editable=function(target,options){var settings={target:target,name:'value',id:'id',type:'text',width:'auto',height:'auto',event:'click',onblur:'cancel',loadtype:'GET',loadtext:'Loading...',placeholder:'Click to edit',loaddata:{},submitdata:{},ajaxoptions:{}};if(options){$.extend(settings,options);}
-var plugin=$.editable.types[settings.type].plugin||function(){};var submit=$.editable.types[settings.type].submit||function(){};var buttons=$.editable.types[settings.type].buttons||$.editable.types['defaults'].buttons;var content=$.editable.types[settings.type].content||$.editable.types['defaults'].content;var element=$.editable.types[settings.type].element||$.editable.types['defaults'].element;var reset=$.editable.types[settings.type].reset||$.editable.types['defaults'].reset;var callback=settings.callback||function(){};var onsubmit=settings.onsubmit||function(){};var onreset=settings.onreset||function(){};var onerror=settings.onerror||reset;if(!$.isFunction($(this)[settings.event])){$.fn[settings.event]=function(fn){return fn?this.bind(settings.event,fn):this.trigger(settings.event);}}
-$(this).attr('title',settings.tooltip);settings.autowidth='auto'==settings.width;settings.autoheight='auto'==settings.height;return this.each(function(){var self=this;var savedwidth=$(self).width();var savedheight=$(self).height();if(!$.trim($(this).html())){$(this).html(settings.placeholder);}
-$(this)[settings.event](function(e){if(self.editing){return;}
-$(self).removeAttr('title');if(0==$(self).width()){settings.width=savedwidth;settings.height=savedheight;}else{if(settings.width!='none'){settings.width=settings.autowidth?$(self).width():settings.width;}
-if(settings.height!='none'){settings.height=settings.autoheight?$(self).height():settings.height;}}
-if($(this).html().toLowerCase().replace(/;/,'')==settings.placeholder.toLowerCase().replace(/;/,'')){$(this).html('');}
-self.editing=true;self.revert=$(self).html();$(self).html('');var form=$('<form />');if(settings.cssclass){if('inherit'==settings.cssclass){form.attr('class',$(self).attr('class'));}else{form.attr('class',settings.cssclass);}}
-if(settings.style){if('inherit'==settings.style){form.attr('style',$(self).attr('style'));form.css('display',$(self).css('display'));}else{form.attr('style',settings.style);}}
-var input=element.apply(form,[settings,self]);var input_content;if(settings.loadurl){var t=setTimeout(function(){input.disabled=true;content.apply(form,[settings.loadtext,settings,self]);},100);var loaddata={};loaddata[settings.id]=self.id;if($.isFunction(settings.loaddata)){$.extend(loaddata,settings.loaddata.apply(self,[self.revert,settings]));}else{$.extend(loaddata,settings.loaddata);}
-$.ajax({type:settings.loadtype,url:settings.loadurl,data:loaddata,async:false,success:function(result){window.clearTimeout(t);input_content=result;input.disabled=false;}});}else if(settings.data){input_content=settings.data;if($.isFunction(settings.data)){input_content=settings.data.apply(self,[self.revert,settings]);}}else{input_content=self.revert;}
-content.apply(form,[input_content,settings,self]);input.attr('name',settings.name);buttons.apply(form,[settings,self]);$(self).append(form);plugin.apply(form,[settings,self]);$(':input:visible:enabled:first',form).focus();if(settings.select){input.select();}
-input.keydown(function(e){if(e.keyCode==27){e.preventDefault();reset.apply(form,[settings,self]);}});var t;if('cancel'==settings.onblur){input.blur(function(e){t=setTimeout(function(){reset.apply(form,[settings,self]);},500);});}else if('submit'==settings.onblur){input.blur(function(e){t=setTimeout(function(){form.submit();},200);});}else if($.isFunction(settings.onblur)){input.blur(function(e){settings.onblur.apply(self,[input.val(),settings]);});}else{input.blur(function(e){});}
-form.submit(function(e){if(t){clearTimeout(t);}
-e.preventDefault();if(false!==onsubmit.apply(form,[settings,self])){if(false!==submit.apply(form,[settings,self])){if($.isFunction(settings.target)){var str=settings.target.apply(self,[input.val(),settings]);$(self).html(str);self.editing=false;callback.apply(self,[self.innerHTML,settings]);if(!$.trim($(self).html())){$(self).html(settings.placeholder);}}else{var submitdata={};submitdata[settings.name]=input.val();submitdata[settings.id]=self.id;if($.isFunction(settings.submitdata)){$.extend(submitdata,settings.submitdata.apply(self,[self.revert,settings]));}else{$.extend(submitdata,settings.submitdata);}
-if('PUT'==settings.method){submitdata['_method']='put';}
-$(self).html(settings.indicator);var ajaxoptions={type:'POST',data:submitdata,url:settings.target,success:function(result,status){$(self).html(result);self.editing=false;callback.apply(self,[self.innerHTML,settings]);if(!$.trim($(self).html())){$(self).html(settings.placeholder);}},error:function(xhr,status,error){onerror.apply(form,[settings,self,xhr]);}}
-$.extend(ajaxoptions,settings.ajaxoptions);$.ajax(ajaxoptions);}}}
-$(self).attr('title',settings.tooltip);return false;});});this.reset=function(form){if(this.editing){if(false!==onreset.apply(form,[settings,self])){$(self).html(self.revert);self.editing=false;if(!$.trim($(self).html())){$(self).html(settings.placeholder);}
-$(self).attr('title',settings.tooltip);}}}});};$.editable={types:{defaults:{element:function(settings,original){var input=$('<input type="hidden"></input>');$(this).append(input);return(input);},content:function(string,settings,original){$(':input:first',this).val(string);},reset:function(settings,original){original.reset(this);},buttons:function(settings,original){var form=this;if(settings.submit){if(settings.submit.match(/>$/)){var submit=$(settings.submit).click(function(){if(submit.attr("type")!="submit"){form.submit();}});}else{var submit=$('<button type="submit" />');submit.html(settings.submit);}
-$(this).append(submit);}
-if(settings.cancel){if(settings.cancel.match(/>$/)){var cancel=$(settings.cancel);}else{var cancel=$('<button type="cancel" />');cancel.html(settings.cancel);}
-$(this).append(cancel);$(cancel).click(function(event){if($.isFunction($.editable.types[settings.type].reset)){var reset=$.editable.types[settings.type].reset;}else{var reset=$.editable.types['defaults'].reset;}
-reset.apply(form,[settings,original]);return false;});}}},text:{element:function(settings,original){var input=$('<input />');if(settings.width!='none'){input.width(settings.width);}
-if(settings.height!='none'){input.height(settings.height);}
-input.attr('autocomplete','off');$(this).append(input);return(input);}},textarea:{element:function(settings,original){var textarea=$('<textarea />');if(settings.rows){textarea.attr('rows',settings.rows);}else{textarea.height(settings.height);}
-if(settings.cols){textarea.attr('cols',settings.cols);}else{textarea.width(settings.width);}
-$(this).append(textarea);return(textarea);}},select:{element:function(settings,original){var select=$('<select />');$(this).append(select);return(select);},content:function(string,settings,original){if(String==string.constructor){eval('var json = '+string);for(var key in json){if(!json.hasOwnProperty(key)){continue;}
-if('selected'==key){continue;}
-var option=$('<option />').val(key).append(json[key]);$('select',this).append(option);}}
-$('select',this).children().each(function(){if($(this).val()==json['selected']||$(this).text()==original.revert){$(this).attr('selected','selected');};});}}},addInputType:function(name,input){$.editable.types[name]=input;}};})(jQuery); \ No newline at end of file
diff --git a/lib/jquery.js b/lib/jquery.js
index b1ae21d8..67e31603 100644
--- a/lib/jquery.js
+++ b/lib/jquery.js
@@ -1,19 +1,9555 @@
-/*
- * jQuery JavaScript Library v1.3.2
+/*!
+ * jQuery JavaScript Library v1.9.0
* http://jquery.com/
*
- * Copyright (c) 2009 John Resig
- * Dual licensed under the MIT and GPL licenses.
- * http://docs.jquery.com/License
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ *
+ * Copyright 2005, 2012 jQuery Foundation, Inc. and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
*
- * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009)
- * Revision: 6246
+ * Date: 2013-1-14
*/
-(function(){var l=this,g,y=l.jQuery,p=l.$,o=l.jQuery=l.$=function(E,F){return new o.fn.init(E,F)},D=/^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/,f=/^.[^:#\[\.,]*$/;o.fn=o.prototype={init:function(E,H){E=E||document;if(E.nodeType){this[0]=E;this.length=1;this.context=E;return this}if(typeof E==="string"){var G=D.exec(E);if(G&&(G[1]||!H)){if(G[1]){E=o.clean([G[1]],H)}else{var I=document.getElementById(G[3]);if(I&&I.id!=G[3]){return o().find(E)}var F=o(I||[]);F.context=document;F.selector=E;return F}}else{return o(H).find(E)}}else{if(o.isFunction(E)){return o(document).ready(E)}}if(E.selector&&E.context){this.selector=E.selector;this.context=E.context}return this.setArray(o.isArray(E)?E:o.makeArray(E))},selector:"",jquery:"1.3.2",size:function(){return this.length},get:function(E){return E===g?Array.prototype.slice.call(this):this[E]},pushStack:function(F,H,E){var G=o(F);G.prevObject=this;G.context=this.context;if(H==="find"){G.selector=this.selector+(this.selector?" ":"")+E}else{if(H){G.selector=this.selector+"."+H+"("+E+")"}}return G},setArray:function(E){this.length=0;Array.prototype.push.apply(this,E);return this},each:function(F,E){return o.each(this,F,E)},index:function(E){return o.inArray(E&&E.jquery?E[0]:E,this)},attr:function(F,H,G){var E=F;if(typeof F==="string"){if(H===g){return this[0]&&o[G||"attr"](this[0],F)}else{E={};E[F]=H}}return this.each(function(I){for(F in E){o.attr(G?this.style:this,F,o.prop(this,E[F],G,I,F))}})},css:function(E,F){if((E=="width"||E=="height")&&parseFloat(F)<0){F=g}return this.attr(E,F,"curCSS")},text:function(F){if(typeof F!=="object"&&F!=null){return this.empty().append((this[0]&&this[0].ownerDocument||document).createTextNode(F))}var E="";o.each(F||this,function(){o.each(this.childNodes,function(){if(this.nodeType!=8){E+=this.nodeType!=1?this.nodeValue:o.fn.text([this])}})});return E},wrapAll:function(E){if(this[0]){var F=o(E,this[0].ownerDocument).clone();if(this[0].parentNode){F.insertBefore(this[0])}F.map(function(){var G=this;while(G.firstChild){G=G.firstChild}return G}).append(this)}return this},wrapInner:function(E){return this.each(function(){o(this).contents().wrapAll(E)})},wrap:function(E){return this.each(function(){o(this).wrapAll(E)})},append:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.appendChild(E)}})},prepend:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.insertBefore(E,this.firstChild)}})},before:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this)})},after:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this.nextSibling)})},end:function(){return this.prevObject||o([])},push:[].push,sort:[].sort,splice:[].splice,find:function(E){if(this.length===1){var F=this.pushStack([],"find",E);F.length=0;o.find(E,this[0],F);return F}else{return this.pushStack(o.unique(o.map(this,function(G){return o.find(E,G)})),"find",E)}},clone:function(G){var E=this.map(function(){if(!o.support.noCloneEvent&&!o.isXMLDoc(this)){var I=this.outerHTML;if(!I){var J=this.ownerDocument.createElement("div");J.appendChild(this.cloneNode(true));I=J.innerHTML}return o.clean([I.replace(/ jQuery\d+="(?:\d+|null)"/g,"").replace(/^\s*/,"")])[0]}else{return this.cloneNode(true)}});if(G===true){var H=this.find("*").andSelf(),F=0;E.find("*").andSelf().each(function(){if(this.nodeName!==H[F].nodeName){return}var I=o.data(H[F],"events");for(var K in I){for(var J in I[K]){o.event.add(this,K,I[K][J],I[K][J].data)}}F++})}return E},filter:function(E){return this.pushStack(o.isFunction(E)&&o.grep(this,function(G,F){return E.call(G,F)})||o.multiFilter(E,o.grep(this,function(F){return F.nodeType===1})),"filter",E)},closest:function(E){var G=o.expr.match.POS.test(E)?o(E):null,F=0;return this.map(function(){var H=this;while(H&&H.ownerDocument){if(G?G.index(H)>-1:o(H).is(E)){o.data(H,"closest",F);return H}H=H.parentNode;F++}})},not:function(E){if(typeof E==="string"){if(f.test(E)){return this.pushStack(o.multiFilter(E,this,true),"not",E)}else{E=o.multiFilter(E,this)}}var F=E.length&&E[E.length-1]!==g&&!E.nodeType;return this.filter(function(){return F?o.inArray(this,E)<0:this!=E})},add:function(E){return this.pushStack(o.unique(o.merge(this.get(),typeof E==="string"?o(E):o.makeArray(E))))},is:function(E){return !!E&&o.multiFilter(E,this).length>0},hasClass:function(E){return !!E&&this.is("."+E)},val:function(K){if(K===g){var E=this[0];if(E){if(o.nodeName(E,"option")){return(E.attributes.value||{}).specified?E.value:E.text}if(o.nodeName(E,"select")){var I=E.selectedIndex,L=[],M=E.options,H=E.type=="select-one";if(I<0){return null}for(var F=H?I:0,J=H?I+1:M.length;F<J;F++){var G=M[F];if(G.selected){K=o(G).val();if(H){return K}L.push(K)}}return L}return(E.value||"").replace(/\r/g,"")}return g}if(typeof K==="number"){K+=""}return this.each(function(){if(this.nodeType!=1){return}if(o.isArray(K)&&/radio|checkbox/.test(this.type)){this.checked=(o.inArray(this.value,K)>=0||o.inArray(this.name,K)>=0)}else{if(o.nodeName(this,"select")){var N=o.makeArray(K);o("option",this).each(function(){this.selected=(o.inArray(this.value,N)>=0||o.inArray(this.text,N)>=0)});if(!N.length){this.selectedIndex=-1}}else{this.value=K}}})},html:function(E){return E===g?(this[0]?this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g,""):null):this.empty().append(E)},replaceWith:function(E){return this.after(E).remove()},eq:function(E){return this.slice(E,+E+1)},slice:function(){return this.pushStack(Array.prototype.slice.apply(this,arguments),"slice",Array.prototype.slice.call(arguments).join(","))},map:function(E){return this.pushStack(o.map(this,function(G,F){return E.call(G,F,G)}))},andSelf:function(){return this.add(this.prevObject)},domManip:function(J,M,L){if(this[0]){var I=(this[0].ownerDocument||this[0]).createDocumentFragment(),F=o.clean(J,(this[0].ownerDocument||this[0]),I),H=I.firstChild;if(H){for(var G=0,E=this.length;G<E;G++){L.call(K(this[G],H),this.length>1||G>0?I.cloneNode(true):I)}}if(F){o.each(F,z)}}return this;function K(N,O){return M&&o.nodeName(N,"table")&&o.nodeName(O,"tr")?(N.getElementsByTagName("tbody")[0]||N.appendChild(N.ownerDocument.createElement("tbody"))):N}}};o.fn.init.prototype=o.fn;function z(E,F){if(F.src){o.ajax({url:F.src,async:false,dataType:"script"})}else{o.globalEval(F.text||F.textContent||F.innerHTML||"")}if(F.parentNode){F.parentNode.removeChild(F)}}function e(){return +new Date}o.extend=o.fn.extend=function(){var J=arguments[0]||{},H=1,I=arguments.length,E=false,G;if(typeof J==="boolean"){E=J;J=arguments[1]||{};H=2}if(typeof J!=="object"&&!o.isFunction(J)){J={}}if(I==H){J=this;--H}for(;H<I;H++){if((G=arguments[H])!=null){for(var F in G){var K=J[F],L=G[F];if(J===L){continue}if(E&&L&&typeof L==="object"&&!L.nodeType){J[F]=o.extend(E,K||(L.length!=null?[]:{}),L)}else{if(L!==g){J[F]=L}}}}}return J};var b=/z-?index|font-?weight|opacity|zoom|line-?height/i,q=document.defaultView||{},s=Object.prototype.toString;o.extend({noConflict:function(E){l.$=p;if(E){l.jQuery=y}return o},isFunction:function(E){return s.call(E)==="[object Function]"},isArray:function(E){return s.call(E)==="[object Array]"},isXMLDoc:function(E){return E.nodeType===9&&E.documentElement.nodeName!=="HTML"||!!E.ownerDocument&&o.isXMLDoc(E.ownerDocument)},globalEval:function(G){if(G&&/\S/.test(G)){var F=document.getElementsByTagName("head")[0]||document.documentElement,E=document.createElement("script");E.type="text/javascript";if(o.support.scriptEval){E.appendChild(document.createTextNode(G))}else{E.text=G}F.insertBefore(E,F.firstChild);F.removeChild(E)}},nodeName:function(F,E){return F.nodeName&&F.nodeName.toUpperCase()==E.toUpperCase()},each:function(G,K,F){var E,H=0,I=G.length;if(F){if(I===g){for(E in G){if(K.apply(G[E],F)===false){break}}}else{for(;H<I;){if(K.apply(G[H++],F)===false){break}}}}else{if(I===g){for(E in G){if(K.call(G[E],E,G[E])===false){break}}}else{for(var J=G[0];H<I&&K.call(J,H,J)!==false;J=G[++H]){}}}return G},prop:function(H,I,G,F,E){if(o.isFunction(I)){I=I.call(H,F)}return typeof I==="number"&&G=="curCSS"&&!b.test(E)?I+"px":I},className:{add:function(E,F){o.each((F||"").split(/\s+/),function(G,H){if(E.nodeType==1&&!o.className.has(E.className,H)){E.className+=(E.className?" ":"")+H}})},remove:function(E,F){if(E.nodeType==1){E.className=F!==g?o.grep(E.className.split(/\s+/),function(G){return !o.className.has(F,G)}).join(" "):""}},has:function(F,E){return F&&o.inArray(E,(F.className||F).toString().split(/\s+/))>-1}},swap:function(H,G,I){var E={};for(var F in G){E[F]=H.style[F];H.style[F]=G[F]}I.call(H);for(var F in G){H.style[F]=E[F]}},css:function(H,F,J,E){if(F=="width"||F=="height"){var L,G={position:"absolute",visibility:"hidden",display:"block"},K=F=="width"?["Left","Right"]:["Top","Bottom"];function I(){L=F=="width"?H.offsetWidth:H.offsetHeight;if(E==="border"){return}o.each(K,function(){if(!E){L-=parseFloat(o.curCSS(H,"padding"+this,true))||0}if(E==="margin"){L+=parseFloat(o.curCSS(H,"margin"+this,true))||0}else{L-=parseFloat(o.curCSS(H,"border"+this+"Width",true))||0}})}if(H.offsetWidth!==0){I()}else{o.swap(H,G,I)}return Math.max(0,Math.round(L))}return o.curCSS(H,F,J)},curCSS:function(I,F,G){var L,E=I.style;if(F=="opacity"&&!o.support.opacity){L=o.attr(E,"opacity");return L==""?"1":L}if(F.match(/float/i)){F=w}if(!G&&E&&E[F]){L=E[F]}else{if(q.getComputedStyle){if(F.match(/float/i)){F="float"}F=F.replace(/([A-Z])/g,"-$1").toLowerCase();var M=q.getComputedStyle(I,null);if(M){L=M.getPropertyValue(F)}if(F=="opacity"&&L==""){L="1"}}else{if(I.currentStyle){var J=F.replace(/\-(\w)/g,function(N,O){return O.toUpperCase()});L=I.currentStyle[F]||I.currentStyle[J];if(!/^\d+(px)?$/i.test(L)&&/^\d/.test(L)){var H=E.left,K=I.runtimeStyle.left;I.runtimeStyle.left=I.currentStyle.left;E.left=L||0;L=E.pixelLeft+"px";E.left=H;I.runtimeStyle.left=K}}}}return L},clean:function(F,K,I){K=K||document;if(typeof K.createElement==="undefined"){K=K.ownerDocument||K[0]&&K[0].ownerDocument||document}if(!I&&F.length===1&&typeof F[0]==="string"){var H=/^<(\w+)\s*\/?>$/.exec(F[0]);if(H){return[K.createElement(H[1])]}}var G=[],E=[],L=K.createElement("div");o.each(F,function(P,S){if(typeof S==="number"){S+=""}if(!S){return}if(typeof S==="string"){S=S.replace(/(<(\w+)[^>]*?)\/>/g,function(U,V,T){return T.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i)?U:V+"></"+T+">"});var O=S.replace(/^\s+/,"").substring(0,10).toLowerCase();var Q=!O.indexOf("<opt")&&[1,"<select multiple='multiple'>","</select>"]||!O.indexOf("<leg")&&[1,"<fieldset>","</fieldset>"]||O.match(/^<(thead|tbody|tfoot|colg|cap)/)&&[1,"<table>","</table>"]||!O.indexOf("<tr")&&[2,"<table><tbody>","</tbody></table>"]||(!O.indexOf("<td")||!O.indexOf("<th"))&&[3,"<table><tbody><tr>","</tr></tbody></table>"]||!O.indexOf("<col")&&[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"]||!o.support.htmlSerialize&&[1,"div<div>","</div>"]||[0,"",""];L.innerHTML=Q[1]+S+Q[2];while(Q[0]--){L=L.lastChild}if(!o.support.tbody){var R=/<tbody/i.test(S),N=!O.indexOf("<table")&&!R?L.firstChild&&L.firstChild.childNodes:Q[1]=="<table>"&&!R?L.childNodes:[];for(var M=N.length-1;M>=0;--M){if(o.nodeName(N[M],"tbody")&&!N[M].childNodes.length){N[M].parentNode.removeChild(N[M])}}}if(!o.support.leadingWhitespace&&/^\s/.test(S)){L.insertBefore(K.createTextNode(S.match(/^\s*/)[0]),L.firstChild)}S=o.makeArray(L.childNodes)}if(S.nodeType){G.push(S)}else{G=o.merge(G,S)}});if(I){for(var J=0;G[J];J++){if(o.nodeName(G[J],"script")&&(!G[J].type||G[J].type.toLowerCase()==="text/javascript")){E.push(G[J].parentNode?G[J].parentNode.removeChild(G[J]):G[J])}else{if(G[J].nodeType===1){G.splice.apply(G,[J+1,0].concat(o.makeArray(G[J].getElementsByTagName("script"))))}I.appendChild(G[J])}}return E}return G},attr:function(J,G,K){if(!J||J.nodeType==3||J.nodeType==8){return g}var H=!o.isXMLDoc(J),L=K!==g;G=H&&o.props[G]||G;if(J.tagName){var F=/href|src|style/.test(G);if(G=="selected"&&J.parentNode){J.parentNode.selectedIndex}if(G in J&&H&&!F){if(L){if(G=="type"&&o.nodeName(J,"input")&&J.parentNode){throw"type property can't be changed"}J[G]=K}if(o.nodeName(J,"form")&&J.getAttributeNode(G)){return J.getAttributeNode(G).nodeValue}if(G=="tabIndex"){var I=J.getAttributeNode("tabIndex");return I&&I.specified?I.value:J.nodeName.match(/(button|input|object|select|textarea)/i)?0:J.nodeName.match(/^(a|area)$/i)&&J.href?0:g}return J[G]}if(!o.support.style&&H&&G=="style"){return o.attr(J.style,"cssText",K)}if(L){J.setAttribute(G,""+K)}var E=!o.support.hrefNormalized&&H&&F?J.getAttribute(G,2):J.getAttribute(G);return E===null?g:E}if(!o.support.opacity&&G=="opacity"){if(L){J.zoom=1;J.filter=(J.filter||"").replace(/alpha\([^)]*\)/,"")+(parseInt(K)+""=="NaN"?"":"alpha(opacity="+K*100+")")}return J.filter&&J.filter.indexOf("opacity=")>=0?(parseFloat(J.filter.match(/opacity=([^)]*)/)[1])/100)+"":""}G=G.replace(/-([a-z])/ig,function(M,N){return N.toUpperCase()});if(L){J[G]=K}return J[G]},trim:function(E){return(E||"").replace(/^\s+|\s+$/g,"")},makeArray:function(G){var E=[];if(G!=null){var F=G.length;if(F==null||typeof G==="string"||o.isFunction(G)||G.setInterval){E[0]=G}else{while(F){E[--F]=G[F]}}}return E},inArray:function(G,H){for(var E=0,F=H.length;E<F;E++){if(H[E]===G){return E}}return -1},merge:function(H,E){var F=0,G,I=H.length;if(!o.support.getAll){while((G=E[F++])!=null){if(G.nodeType!=8){H[I++]=G}}}else{while((G=E[F++])!=null){H[I++]=G}}return H},unique:function(K){var F=[],E={};try{for(var G=0,H=K.length;G<H;G++){var J=o.data(K[G]);if(!E[J]){E[J]=true;F.push(K[G])}}}catch(I){F=K}return F},grep:function(F,J,E){var G=[];for(var H=0,I=F.length;H<I;H++){if(!E!=!J(F[H],H)){G.push(F[H])}}return G},map:function(E,J){var F=[];for(var G=0,H=E.length;G<H;G++){var I=J(E[G],G);if(I!=null){F[F.length]=I}}return F.concat.apply([],F)}});var C=navigator.userAgent.toLowerCase();o.browser={version:(C.match(/.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/)||[0,"0"])[1],safari:/webkit/.test(C),opera:/opera/.test(C),msie:/msie/.test(C)&&!/opera/.test(C),mozilla:/mozilla/.test(C)&&!/(compatible|webkit)/.test(C)};o.each({parent:function(E){return E.parentNode},parents:function(E){return o.dir(E,"parentNode")},next:function(E){return o.nth(E,2,"nextSibling")},prev:function(E){return o.nth(E,2,"previousSibling")},nextAll:function(E){return o.dir(E,"nextSibling")},prevAll:function(E){return o.dir(E,"previousSibling")},siblings:function(E){return o.sibling(E.parentNode.firstChild,E)},children:function(E){return o.sibling(E.firstChild)},contents:function(E){return o.nodeName(E,"iframe")?E.contentDocument||E.contentWindow.document:o.makeArray(E.childNodes)}},function(E,F){o.fn[E]=function(G){var H=o.map(this,F);if(G&&typeof G=="string"){H=o.multiFilter(G,H)}return this.pushStack(o.unique(H),E,G)}});o.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(E,F){o.fn[E]=function(G){var J=[],L=o(G);for(var K=0,H=L.length;K<H;K++){var I=(K>0?this.clone(true):this).get();o.fn[F].apply(o(L[K]),I);J=J.concat(I)}return this.pushStack(J,E,G)}});o.each({removeAttr:function(E){o.attr(this,E,"");if(this.nodeType==1){this.removeAttribute(E)}},addClass:function(E){o.className.add(this,E)},removeClass:function(E){o.className.remove(this,E)},toggleClass:function(F,E){if(typeof E!=="boolean"){E=!o.className.has(this,F)}o.className[E?"add":"remove"](this,F)},remove:function(E){if(!E||o.filter(E,[this]).length){o("*",this).add([this]).each(function(){o.event.remove(this);o.removeData(this)});if(this.parentNode){this.parentNode.removeChild(this)}}},empty:function(){o(this).children().remove();while(this.firstChild){this.removeChild(this.firstChild)}}},function(E,F){o.fn[E]=function(){return this.each(F,arguments)}});function j(E,F){return E[0]&&parseInt(o.curCSS(E[0],F,true),10)||0}var h="jQuery"+e(),v=0,A={};o.extend({cache:{},data:function(F,E,G){F=F==l?A:F;var H=F[h];if(!H){H=F[h]=++v}if(E&&!o.cache[H]){o.cache[H]={}}if(G!==g){o.cache[H][E]=G}return E?o.cache[H][E]:H},removeData:function(F,E){F=F==l?A:F;var H=F[h];if(E){if(o.cache[H]){delete o.cache[H][E];E="";for(E in o.cache[H]){break}if(!E){o.removeData(F)}}}else{try{delete F[h]}catch(G){if(F.removeAttribute){F.removeAttribute(h)}}delete o.cache[H]}},queue:function(F,E,H){if(F){E=(E||"fx")+"queue";var G=o.data(F,E);if(!G||o.isArray(H)){G=o.data(F,E,o.makeArray(H))}else{if(H){G.push(H)}}}return G},dequeue:function(H,G){var E=o.queue(H,G),F=E.shift();if(!G||G==="fx"){F=E[0]}if(F!==g){F.call(H)}}});o.fn.extend({data:function(E,G){var H=E.split(".");H[1]=H[1]?"."+H[1]:"";if(G===g){var F=this.triggerHandler("getData"+H[1]+"!",[H[0]]);if(F===g&&this.length){F=o.data(this[0],E)}return F===g&&H[1]?this.data(H[0]):F}else{return this.trigger("setData"+H[1]+"!",[H[0],G]).each(function(){o.data(this,E,G)})}},removeData:function(E){return this.each(function(){o.removeData(this,E)})},queue:function(E,F){if(typeof E!=="string"){F=E;E="fx"}if(F===g){return o.queue(this[0],E)}return this.each(function(){var G=o.queue(this,E,F);if(E=="fx"&&G.length==1){G[0].call(this)}})},dequeue:function(E){return this.each(function(){o.dequeue(this,E)})}});
+(function( window, undefined ) {
+"use strict";
+var
+ // A central reference to the root jQuery(document)
+ rootjQuery,
+
+ // The deferred used on DOM ready
+ readyList,
+
+ // Use the correct document accordingly with window argument (sandbox)
+ document = window.document,
+ location = window.location,
+
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+
+ // Map over the $ in case of overwrite
+ _$ = window.$,
+
+ // [[Class]] -> type pairs
+ class2type = {},
+
+ // List of deleted data cache ids, so we can reuse them
+ core_deletedIds = [],
+
+ core_version = "1.9.0",
+
+ // Save a reference to some core methods
+ core_concat = core_deletedIds.concat,
+ core_push = core_deletedIds.push,
+ core_slice = core_deletedIds.slice,
+ core_indexOf = core_deletedIds.indexOf,
+ core_toString = class2type.toString,
+ core_hasOwn = class2type.hasOwnProperty,
+ core_trim = core_version.trim,
+
+ // Define a local copy of jQuery
+ jQuery = function( selector, context ) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ return new jQuery.fn.init( selector, context, rootjQuery );
+ },
+
+ // Used for matching numbers
+ core_pnum = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,
+
+ // Used for splitting on whitespace
+ core_rnotwhite = /\S+/g,
+
+ // Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE)
+ rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,
+
+ // A simple way to check for HTML strings
+ // Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
+ // Strict HTML recognition (#11290: must start with <)
+ rquickExpr = /^(?:(<[\w\W]+>)[^>]*|#([\w-]*))$/,
+
+ // Match a standalone tag
+ rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/,
+
+ // JSON RegExp
+ rvalidchars = /^[\],:{}\s]*$/,
+ rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
+ rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,
+ rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d+\.|)\d+(?:[eE][+-]?\d+|)/g,
+
+ // Matches dashed string for camelizing
+ rmsPrefix = /^-ms-/,
+ rdashAlpha = /-([\da-z])/gi,
+
+ // Used by jQuery.camelCase as callback to replace()
+ fcamelCase = function( all, letter ) {
+ return letter.toUpperCase();
+ },
+
+ // The ready event handler and self cleanup method
+ DOMContentLoaded = function() {
+ if ( document.addEventListener ) {
+ document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+ jQuery.ready();
+ } else if ( document.readyState === "complete" ) {
+ // we're here because readyState === "complete" in oldIE
+ // which is good enough for us to call the dom ready!
+ document.detachEvent( "onreadystatechange", DOMContentLoaded );
+ jQuery.ready();
+ }
+ };
+
+jQuery.fn = jQuery.prototype = {
+ // The current version of jQuery being used
+ jquery: core_version,
+
+ constructor: jQuery,
+ init: function( selector, context, rootjQuery ) {
+ var match, elem;
+
+ // HANDLE: $(""), $(null), $(undefined), $(false)
+ if ( !selector ) {
+ return this;
+ }
+
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) {
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [ null, selector, null ];
+
+ } else {
+ match = rquickExpr.exec( selector );
+ }
+
+ // Match html or make sure no context is specified for #id
+ if ( match && (match[1] || !context) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[1] ) {
+ context = context instanceof jQuery ? context[0] : context;
+
+ // scripts is true for back-compat
+ jQuery.merge( this, jQuery.parseHTML(
+ match[1],
+ context && context.nodeType ? context.ownerDocument || context : document,
+ true
+ ) );
+
+ // HANDLE: $(html, props)
+ if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) {
+ for ( match in context ) {
+ // Properties of context are called as methods if possible
+ if ( jQuery.isFunction( this[ match ] ) ) {
+ this[ match ]( context[ match ] );
+
+ // ...and otherwise set as attributes
+ } else {
+ this.attr( match, context[ match ] );
+ }
+ }
+ }
+
+ return this;
+
+ // HANDLE: $(#id)
+ } else {
+ elem = document.getElementById( match[2] );
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id !== match[2] ) {
+ return rootjQuery.find( selector );
+ }
+
+ // Otherwise, we inject the element directly into the jQuery object
+ this.length = 1;
+ this[0] = elem;
+ }
+
+ this.context = document;
+ this.selector = selector;
+ return this;
+ }
+
+ // HANDLE: $(expr, $(...))
+ } else if ( !context || context.jquery ) {
+ return ( context || rootjQuery ).find( selector );
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
+ return this.constructor( context ).find( selector );
+ }
+
+ // HANDLE: $(DOMElement)
+ } else if ( selector.nodeType ) {
+ this.context = this[0] = selector;
+ this.length = 1;
+ return this;
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( jQuery.isFunction( selector ) ) {
+ return rootjQuery.ready( selector );
+ }
+
+ if ( selector.selector !== undefined ) {
+ this.selector = selector.selector;
+ this.context = selector.context;
+ }
+
+ return jQuery.makeArray( selector, this );
+ },
+
+ // Start with an empty selector
+ selector: "",
+
+ // The default length of a jQuery object is 0
+ length: 0,
+
+ // The number of elements contained in the matched element set
+ size: function() {
+ return this.length;
+ },
+
+ toArray: function() {
+ return core_slice.call( this );
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+ return num == null ?
+
+ // Return a 'clean' array
+ this.toArray() :
+
+ // Return just the object
+ ( num < 0 ? this[ this.length + num ] : this[ num ] );
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems ) {
+
+ // Build a new jQuery matched element set
+ var ret = jQuery.merge( this.constructor(), elems );
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+ ret.context = this.context;
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Execute a callback for every element in the matched set.
+ // (You can seed the arguments with an array of args, but this is
+ // only used internally.)
+ each: function( callback, args ) {
+ return jQuery.each( this, callback, args );
+ },
+
+ ready: function( fn ) {
+ // Add the callback
+ jQuery.ready.promise().done( fn );
+
+ return this;
+ },
+
+ slice: function() {
+ return this.pushStack( core_slice.apply( this, arguments ) );
+ },
+
+ first: function() {
+ return this.eq( 0 );
+ },
+
+ last: function() {
+ return this.eq( -1 );
+ },
+
+ eq: function( i ) {
+ var len = this.length,
+ j = +i + ( i < 0 ? len : 0 );
+ return this.pushStack( j >= 0 && j < len ? [ this[j] ] : [] );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map(this, function( elem, i ) {
+ return callback.call( elem, i, elem );
+ }));
+ },
+
+ end: function() {
+ return this.prevObject || this.constructor(null);
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: core_push,
+ sort: [].sort,
+ splice: [].splice
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+jQuery.extend = jQuery.fn.extend = function() {
+ var options, name, src, copy, copyIsArray, clone,
+ target = arguments[0] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+ target = arguments[1] || {};
+ // skip the boolean and the target
+ i = 2;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+ target = {};
+ }
+
+ // extend jQuery itself if only one argument is passed
+ if ( length === i ) {
+ target = this;
+ --i;
+ }
+
+ for ( ; i < length; i++ ) {
+ // Only deal with non-null/undefined values
+ if ( (options = arguments[ i ]) != null ) {
+ // Extend the base object
+ for ( name in options ) {
+ src = target[ name ];
+ copy = options[ name ];
+
+ // Prevent never-ending loop
+ if ( target === copy ) {
+ continue;
+ }
+
+ // Recurse if we're merging plain objects or arrays
+ if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
+ if ( copyIsArray ) {
+ copyIsArray = false;
+ clone = src && jQuery.isArray(src) ? src : [];
+
+ } else {
+ clone = src && jQuery.isPlainObject(src) ? src : {};
+ }
+
+ // Never move original objects, clone them
+ target[ name ] = jQuery.extend( deep, clone, copy );
+
+ // Don't bring in undefined values
+ } else if ( copy !== undefined ) {
+ target[ name ] = copy;
+ }
+ }
+ }
+ }
+
+ // Return the modified object
+ return target;
+};
+
+jQuery.extend({
+ noConflict: function( deep ) {
+ if ( window.$ === jQuery ) {
+ window.$ = _$;
+ }
+
+ if ( deep && window.jQuery === jQuery ) {
+ window.jQuery = _jQuery;
+ }
+
+ return jQuery;
+ },
+
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Hold (or release) the ready event
+ holdReady: function( hold ) {
+ if ( hold ) {
+ jQuery.readyWait++;
+ } else {
+ jQuery.ready( true );
+ }
+ },
+
+ // Handle when the DOM is ready
+ ready: function( wait ) {
+
+ // Abort if there are pending holds or we're already ready
+ if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+ return;
+ }
+
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( !document.body ) {
+ return setTimeout( jQuery.ready );
+ }
+
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --jQuery.readyWait > 0 ) {
+ return;
+ }
+
+ // If there are functions bound, to execute
+ readyList.resolveWith( document, [ jQuery ] );
+
+ // Trigger any bound ready events
+ if ( jQuery.fn.trigger ) {
+ jQuery( document ).trigger("ready").off("ready");
+ }
+ },
+
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function( obj ) {
+ return jQuery.type(obj) === "function";
+ },
+
+ isArray: Array.isArray || function( obj ) {
+ return jQuery.type(obj) === "array";
+ },
+
+ isWindow: function( obj ) {
+ return obj != null && obj == obj.window;
+ },
+
+ isNumeric: function( obj ) {
+ return !isNaN( parseFloat(obj) ) && isFinite( obj );
+ },
+
+ type: function( obj ) {
+ if ( obj == null ) {
+ return String( obj );
+ }
+ return typeof obj === "object" || typeof obj === "function" ?
+ class2type[ core_toString.call(obj) ] || "object" :
+ typeof obj;
+ },
+
+ isPlainObject: function( obj ) {
+ // Must be an Object.
+ // Because of IE, we also have to check the presence of the constructor property.
+ // Make sure that DOM nodes and window objects don't pass through, as well
+ if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
+ return false;
+ }
+
+ try {
+ // Not own constructor property must be Object
+ if ( obj.constructor &&
+ !core_hasOwn.call(obj, "constructor") &&
+ !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
+ return false;
+ }
+ } catch ( e ) {
+ // IE8,9 Will throw exceptions on certain host objects #9897
+ return false;
+ }
+
+ // Own properties are enumerated firstly, so to speed up,
+ // if last one is own, then all properties are own.
+
+ var key;
+ for ( key in obj ) {}
+
+ return key === undefined || core_hasOwn.call( obj, key );
+ },
+
+ isEmptyObject: function( obj ) {
+ var name;
+ for ( name in obj ) {
+ return false;
+ }
+ return true;
+ },
+
+ error: function( msg ) {
+ throw new Error( msg );
+ },
+
+ // data: string of html
+ // context (optional): If specified, the fragment will be created in this context, defaults to document
+ // keepScripts (optional): If true, will include scripts passed in the html string
+ parseHTML: function( data, context, keepScripts ) {
+ if ( !data || typeof data !== "string" ) {
+ return null;
+ }
+ if ( typeof context === "boolean" ) {
+ keepScripts = context;
+ context = false;
+ }
+ context = context || document;
+
+ var parsed = rsingleTag.exec( data ),
+ scripts = !keepScripts && [];
+
+ // Single tag
+ if ( parsed ) {
+ return [ context.createElement( parsed[1] ) ];
+ }
+
+ parsed = jQuery.buildFragment( [ data ], context, scripts );
+ if ( scripts ) {
+ jQuery( scripts ).remove();
+ }
+ return jQuery.merge( [], parsed.childNodes );
+ },
+
+ parseJSON: function( data ) {
+ // Attempt to parse using the native JSON parser first
+ if ( window.JSON && window.JSON.parse ) {
+ return window.JSON.parse( data );
+ }
+
+ if ( data === null ) {
+ return data;
+ }
+
+ if ( typeof data === "string" ) {
+
+ // Make sure leading/trailing whitespace is removed (IE can't handle it)
+ data = jQuery.trim( data );
+
+ if ( data ) {
+ // Make sure the incoming data is actual JSON
+ // Logic borrowed from http://json.org/json2.js
+ if ( rvalidchars.test( data.replace( rvalidescape, "@" )
+ .replace( rvalidtokens, "]" )
+ .replace( rvalidbraces, "")) ) {
+
+ return ( new Function( "return " + data ) )();
+ }
+ }
+ }
+
+ jQuery.error( "Invalid JSON: " + data );
+ },
+
+ // Cross-browser xml parsing
+ parseXML: function( data ) {
+ var xml, tmp;
+ if ( !data || typeof data !== "string" ) {
+ return null;
+ }
+ try {
+ if ( window.DOMParser ) { // Standard
+ tmp = new DOMParser();
+ xml = tmp.parseFromString( data , "text/xml" );
+ } else { // IE
+ xml = new ActiveXObject( "Microsoft.XMLDOM" );
+ xml.async = "false";
+ xml.loadXML( data );
+ }
+ } catch( e ) {
+ xml = undefined;
+ }
+ if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) {
+ jQuery.error( "Invalid XML: " + data );
+ }
+ return xml;
+ },
+
+ noop: function() {},
+
+ // Evaluates a script in a global context
+ // Workarounds based on findings by Jim Driscoll
+ // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
+ globalEval: function( data ) {
+ if ( data && jQuery.trim( data ) ) {
+ // We use execScript on Internet Explorer
+ // We use an anonymous function so that context is window
+ // rather than jQuery in Firefox
+ ( window.execScript || function( data ) {
+ window[ "eval" ].call( window, data );
+ } )( data );
+ }
+ },
+
+ // Convert dashed to camelCase; used by the css and data modules
+ // Microsoft forgot to hump their vendor prefix (#9572)
+ camelCase: function( string ) {
+ return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+ },
+
+ nodeName: function( elem, name ) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+ },
+
+ // args is for internal usage only
+ each: function( obj, callback, args ) {
+ var value,
+ i = 0,
+ length = obj.length,
+ isArray = isArraylike( obj );
+
+ if ( args ) {
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback.apply( obj[ i ], args );
+
+ if ( value === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( i in obj ) {
+ value = callback.apply( obj[ i ], args );
+
+ if ( value === false ) {
+ break;
+ }
+ }
+ }
+
+ // A special, fast, case for the most common use of each
+ } else {
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback.call( obj[ i ], i, obj[ i ] );
+
+ if ( value === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( i in obj ) {
+ value = callback.call( obj[ i ], i, obj[ i ] );
+
+ if ( value === false ) {
+ break;
+ }
+ }
+ }
+ }
+
+ return obj;
+ },
+
+ // Use native String.trim function wherever possible
+ trim: core_trim && !core_trim.call("\uFEFF\xA0") ?
+ function( text ) {
+ return text == null ?
+ "" :
+ core_trim.call( text );
+ } :
+
+ // Otherwise use our own trimming functionality
+ function( text ) {
+ return text == null ?
+ "" :
+ ( text + "" ).replace( rtrim, "" );
+ },
+
+ // results is for internal usage only
+ makeArray: function( arr, results ) {
+ var ret = results || [];
+
+ if ( arr != null ) {
+ if ( isArraylike( Object(arr) ) ) {
+ jQuery.merge( ret,
+ typeof arr === "string" ?
+ [ arr ] : arr
+ );
+ } else {
+ core_push.call( ret, arr );
+ }
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, arr, i ) {
+ var len;
+
+ if ( arr ) {
+ if ( core_indexOf ) {
+ return core_indexOf.call( arr, elem, i );
+ }
+
+ len = arr.length;
+ i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0;
+
+ for ( ; i < len; i++ ) {
+ // Skip accessing in sparse arrays
+ if ( i in arr && arr[ i ] === elem ) {
+ return i;
+ }
+ }
+ }
+
+ return -1;
+ },
+
+ merge: function( first, second ) {
+ var l = second.length,
+ i = first.length,
+ j = 0;
+
+ if ( typeof l === "number" ) {
+ for ( ; j < l; j++ ) {
+ first[ i++ ] = second[ j ];
+ }
+ } else {
+ while ( second[j] !== undefined ) {
+ first[ i++ ] = second[ j++ ];
+ }
+ }
+
+ first.length = i;
+
+ return first;
+ },
+
+ grep: function( elems, callback, inv ) {
+ var retVal,
+ ret = [],
+ i = 0,
+ length = elems.length;
+ inv = !!inv;
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( ; i < length; i++ ) {
+ retVal = !!callback( elems[ i ], i );
+ if ( inv !== retVal ) {
+ ret.push( elems[ i ] );
+ }
+ }
+
+ return ret;
+ },
+
+ // arg is for internal usage only
+ map: function( elems, callback, arg ) {
+ var value,
+ i = 0,
+ length = elems.length,
+ isArray = isArraylike( elems ),
+ ret = [];
+
+ // Go through the array, translating each of the items to their
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for ( i in elems ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+ }
+
+ // Flatten any nested arrays
+ return core_concat.apply( [], ret );
+ },
+
+ // A global GUID counter for objects
+ guid: 1,
+
+ // Bind a function to a context, optionally partially applying any
+ // arguments.
+ proxy: function( fn, context ) {
+ var tmp, args, proxy;
+
+ if ( typeof context === "string" ) {
+ tmp = fn[ context ];
+ context = fn;
+ fn = tmp;
+ }
+
+ // Quick check to determine if target is callable, in the spec
+ // this throws a TypeError, but we will just return undefined.
+ if ( !jQuery.isFunction( fn ) ) {
+ return undefined;
+ }
+
+ // Simulated bind
+ args = core_slice.call( arguments, 2 );
+ proxy = function() {
+ return fn.apply( context || this, args.concat( core_slice.call( arguments ) ) );
+ };
+
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || jQuery.guid++;
+
+ return proxy;
+ },
+
+ // Multifunctional method to get and set values of a collection
+ // The value/s can optionally be executed if it's a function
+ access: function( elems, fn, key, value, chainable, emptyGet, raw ) {
+ var i = 0,
+ length = elems.length,
+ bulk = key == null;
+
+ // Sets many values
+ if ( jQuery.type( key ) === "object" ) {
+ chainable = true;
+ for ( i in key ) {
+ jQuery.access( elems, fn, i, key[i], true, emptyGet, raw );
+ }
+
+ // Sets one value
+ } else if ( value !== undefined ) {
+ chainable = true;
+
+ if ( !jQuery.isFunction( value ) ) {
+ raw = true;
+ }
+
+ if ( bulk ) {
+ // Bulk operations run against the entire set
+ if ( raw ) {
+ fn.call( elems, value );
+ fn = null;
+
+ // ...except when executing function values
+ } else {
+ bulk = fn;
+ fn = function( elem, key, value ) {
+ return bulk.call( jQuery( elem ), value );
+ };
+ }
+ }
+
+ if ( fn ) {
+ for ( ; i < length; i++ ) {
+ fn( elems[i], key, raw ? value : value.call( elems[i], i, fn( elems[i], key ) ) );
+ }
+ }
+ }
+
+ return chainable ?
+ elems :
+
+ // Gets
+ bulk ?
+ fn.call( elems ) :
+ length ? fn( elems[0], key ) : emptyGet;
+ },
+
+ now: function() {
+ return ( new Date() ).getTime();
+ }
+});
+
+jQuery.ready.promise = function( obj ) {
+ if ( !readyList ) {
+
+ readyList = jQuery.Deferred();
+
+ // Catch cases where $(document).ready() is called after the browser event has already occurred.
+ // we once tried to use readyState "interactive" here, but it caused issues like the one
+ // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15
+ if ( document.readyState === "complete" ) {
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ setTimeout( jQuery.ready );
+
+ // Standards-based browsers support DOMContentLoaded
+ } else if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", jQuery.ready, false );
+
+ // If IE event model is used
+ } else {
+ // Ensure firing before onload, maybe late but safe also for iframes
+ document.attachEvent( "onreadystatechange", DOMContentLoaded );
+
+ // A fallback to window.onload, that will always work
+ window.attachEvent( "onload", jQuery.ready );
+
+ // If IE and not a frame
+ // continually check to see if the document is ready
+ var top = false;
+
+ try {
+ top = window.frameElement == null && document.documentElement;
+ } catch(e) {}
+
+ if ( top && top.doScroll ) {
+ (function doScrollCheck() {
+ if ( !jQuery.isReady ) {
+
+ try {
+ // Use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ top.doScroll("left");
+ } catch(e) {
+ return setTimeout( doScrollCheck, 50 );
+ }
+
+ // and execute any waiting functions
+ jQuery.ready();
+ }
+ })();
+ }
+ }
+ }
+ return readyList.promise( obj );
+};
+
+// Populate the class2type map
+jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function(i, name) {
+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
+});
+
+function isArraylike( obj ) {
+ var length = obj.length,
+ type = jQuery.type( obj );
+
+ if ( jQuery.isWindow( obj ) ) {
+ return false;
+ }
+
+ if ( obj.nodeType === 1 && length ) {
+ return true;
+ }
+
+ return type === "array" || type !== "function" &&
+ ( length === 0 ||
+ typeof length === "number" && length > 0 && ( length - 1 ) in obj );
+}
+
+// All jQuery objects should point back to these
+rootjQuery = jQuery(document);
+// String to Object options format cache
+var optionsCache = {};
+
+// Convert String-formatted options into Object-formatted ones and store in cache
+function createOptions( options ) {
+ var object = optionsCache[ options ] = {};
+ jQuery.each( options.match( core_rnotwhite ) || [], function( _, flag ) {
+ object[ flag ] = true;
+ });
+ return object;
+}
+
/*
- * Sizzle CSS Selector Engine - v0.9.3
- * Copyright 2009, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
- * More information: http://sizzlejs.com/
+ * Create a callback list using the following parameters:
+ *
+ * options: an optional list of space-separated options that will change how
+ * the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ * once: will ensure the callback list can only be fired once (like a Deferred)
+ *
+ * memory: will keep track of previous values and will call any callback added
+ * after the list has been fired right away with the latest "memorized"
+ * values (like a Deferred)
+ *
+ * unique: will ensure a callback can only be added once (no duplicate in the list)
+ *
+ * stopOnFalse: interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+ // Convert options from String-formatted to Object-formatted if needed
+ // (we check in cache first)
+ options = typeof options === "string" ?
+ ( optionsCache[ options ] || createOptions( options ) ) :
+ jQuery.extend( {}, options );
+
+ var // Last fire value (for non-forgettable lists)
+ memory,
+ // Flag to know if list was already fired
+ fired,
+ // Flag to know if list is currently firing
+ firing,
+ // First callback to fire (used internally by add and fireWith)
+ firingStart,
+ // End of the loop when firing
+ firingLength,
+ // Index of currently firing callback (modified by remove if needed)
+ firingIndex,
+ // Actual callback list
+ list = [],
+ // Stack of fire calls for repeatable lists
+ stack = !options.once && [],
+ // Fire callbacks
+ fire = function( data ) {
+ memory = options.memory && data;
+ fired = true;
+ firingIndex = firingStart || 0;
+ firingStart = 0;
+ firingLength = list.length;
+ firing = true;
+ for ( ; list && firingIndex < firingLength; firingIndex++ ) {
+ if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) {
+ memory = false; // To prevent further calls using add
+ break;
+ }
+ }
+ firing = false;
+ if ( list ) {
+ if ( stack ) {
+ if ( stack.length ) {
+ fire( stack.shift() );
+ }
+ } else if ( memory ) {
+ list = [];
+ } else {
+ self.disable();
+ }
+ }
+ },
+ // Actual Callbacks object
+ self = {
+ // Add a callback or a collection of callbacks to the list
+ add: function() {
+ if ( list ) {
+ // First, we save the current length
+ var start = list.length;
+ (function add( args ) {
+ jQuery.each( args, function( _, arg ) {
+ var type = jQuery.type( arg );
+ if ( type === "function" ) {
+ if ( !options.unique || !self.has( arg ) ) {
+ list.push( arg );
+ }
+ } else if ( arg && arg.length && type !== "string" ) {
+ // Inspect recursively
+ add( arg );
+ }
+ });
+ })( arguments );
+ // Do we need to add the callbacks to the
+ // current firing batch?
+ if ( firing ) {
+ firingLength = list.length;
+ // With memory, if we're not firing then
+ // we should call right away
+ } else if ( memory ) {
+ firingStart = start;
+ fire( memory );
+ }
+ }
+ return this;
+ },
+ // Remove a callback from the list
+ remove: function() {
+ if ( list ) {
+ jQuery.each( arguments, function( _, arg ) {
+ var index;
+ while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+ list.splice( index, 1 );
+ // Handle firing indexes
+ if ( firing ) {
+ if ( index <= firingLength ) {
+ firingLength--;
+ }
+ if ( index <= firingIndex ) {
+ firingIndex--;
+ }
+ }
+ }
+ });
+ }
+ return this;
+ },
+ // Control if a given callback is in the list
+ has: function( fn ) {
+ return jQuery.inArray( fn, list ) > -1;
+ },
+ // Remove all callbacks from the list
+ empty: function() {
+ list = [];
+ return this;
+ },
+ // Have the list do nothing anymore
+ disable: function() {
+ list = stack = memory = undefined;
+ return this;
+ },
+ // Is it disabled?
+ disabled: function() {
+ return !list;
+ },
+ // Lock the list in its current state
+ lock: function() {
+ stack = undefined;
+ if ( !memory ) {
+ self.disable();
+ }
+ return this;
+ },
+ // Is it locked?
+ locked: function() {
+ return !stack;
+ },
+ // Call all callbacks with the given context and arguments
+ fireWith: function( context, args ) {
+ args = args || [];
+ args = [ context, args.slice ? args.slice() : args ];
+ if ( list && ( !fired || stack ) ) {
+ if ( firing ) {
+ stack.push( args );
+ } else {
+ fire( args );
+ }
+ }
+ return this;
+ },
+ // Call all the callbacks with the given arguments
+ fire: function() {
+ self.fireWith( this, arguments );
+ return this;
+ },
+ // To know if the callbacks have already been called at least once
+ fired: function() {
+ return !!fired;
+ }
+ };
+
+ return self;
+};
+jQuery.extend({
+
+ Deferred: function( func ) {
+ var tuples = [
+ // action, add listener, listener list, final state
+ [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ],
+ [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ],
+ [ "notify", "progress", jQuery.Callbacks("memory") ]
+ ],
+ state = "pending",
+ promise = {
+ state: function() {
+ return state;
+ },
+ always: function() {
+ deferred.done( arguments ).fail( arguments );
+ return this;
+ },
+ then: function( /* fnDone, fnFail, fnProgress */ ) {
+ var fns = arguments;
+ return jQuery.Deferred(function( newDefer ) {
+ jQuery.each( tuples, function( i, tuple ) {
+ var action = tuple[ 0 ],
+ fn = jQuery.isFunction( fns[ i ] ) && fns[ i ];
+ // deferred[ done | fail | progress ] for forwarding actions to newDefer
+ deferred[ tuple[1] ](function() {
+ var returned = fn && fn.apply( this, arguments );
+ if ( returned && jQuery.isFunction( returned.promise ) ) {
+ returned.promise()
+ .done( newDefer.resolve )
+ .fail( newDefer.reject )
+ .progress( newDefer.notify );
+ } else {
+ newDefer[ action + "With" ]( this === promise ? newDefer.promise() : this, fn ? [ returned ] : arguments );
+ }
+ });
+ });
+ fns = null;
+ }).promise();
+ },
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function( obj ) {
+ return obj != null ? jQuery.extend( obj, promise ) : promise;
+ }
+ },
+ deferred = {};
+
+ // Keep pipe for back-compat
+ promise.pipe = promise.then;
+
+ // Add list-specific methods
+ jQuery.each( tuples, function( i, tuple ) {
+ var list = tuple[ 2 ],
+ stateString = tuple[ 3 ];
+
+ // promise[ done | fail | progress ] = list.add
+ promise[ tuple[1] ] = list.add;
+
+ // Handle state
+ if ( stateString ) {
+ list.add(function() {
+ // state = [ resolved | rejected ]
+ state = stateString;
+
+ // [ reject_list | resolve_list ].disable; progress_list.lock
+ }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock );
+ }
+
+ // deferred[ resolve | reject | notify ]
+ deferred[ tuple[0] ] = function() {
+ deferred[ tuple[0] + "With" ]( this === deferred ? promise : this, arguments );
+ return this;
+ };
+ deferred[ tuple[0] + "With" ] = list.fireWith;
+ });
+
+ // Make the deferred a promise
+ promise.promise( deferred );
+
+ // Call given func if any
+ if ( func ) {
+ func.call( deferred, deferred );
+ }
+
+ // All done!
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function( subordinate /* , ..., subordinateN */ ) {
+ var i = 0,
+ resolveValues = core_slice.call( arguments ),
+ length = resolveValues.length,
+
+ // the count of uncompleted subordinates
+ remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0,
+
+ // the master Deferred. If resolveValues consist of only a single Deferred, just use that.
+ deferred = remaining === 1 ? subordinate : jQuery.Deferred(),
+
+ // Update function for both resolve and progress values
+ updateFunc = function( i, contexts, values ) {
+ return function( value ) {
+ contexts[ i ] = this;
+ values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value;
+ if( values === progressValues ) {
+ deferred.notifyWith( contexts, values );
+ } else if ( !( --remaining ) ) {
+ deferred.resolveWith( contexts, values );
+ }
+ };
+ },
+
+ progressValues, progressContexts, resolveContexts;
+
+ // add listeners to Deferred subordinates; treat others as resolved
+ if ( length > 1 ) {
+ progressValues = new Array( length );
+ progressContexts = new Array( length );
+ resolveContexts = new Array( length );
+ for ( ; i < length; i++ ) {
+ if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) {
+ resolveValues[ i ].promise()
+ .done( updateFunc( i, resolveContexts, resolveValues ) )
+ .fail( deferred.reject )
+ .progress( updateFunc( i, progressContexts, progressValues ) );
+ } else {
+ --remaining;
+ }
+ }
+ }
+
+ // if we're not waiting on anything, resolve the master
+ if ( !remaining ) {
+ deferred.resolveWith( resolveContexts, resolveValues );
+ }
+
+ return deferred.promise();
+ }
+});
+jQuery.support = (function() {
+
+ var support, all, a, select, opt, input, fragment, eventName, isSupported, i,
+ div = document.createElement("div");
+
+ // Setup
+ div.setAttribute( "className", "t" );
+ div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+
+ // Support tests won't run in some limited or non-browser environments
+ all = div.getElementsByTagName("*");
+ a = div.getElementsByTagName("a")[ 0 ];
+ if ( !all || !a || !all.length ) {
+ return {};
+ }
+
+ // First batch of tests
+ select = document.createElement("select");
+ opt = select.appendChild( document.createElement("option") );
+ input = div.getElementsByTagName("input")[ 0 ];
+
+ a.style.cssText = "top:1px;float:left;opacity:.5";
+ support = {
+ // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
+ getSetAttribute: div.className !== "t",
+
+ // IE strips leading whitespace when .innerHTML is used
+ leadingWhitespace: div.firstChild.nodeType === 3,
+
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ tbody: !div.getElementsByTagName("tbody").length,
+
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ htmlSerialize: !!div.getElementsByTagName("link").length,
+
+ // Get the style information from getAttribute
+ // (IE uses .cssText instead)
+ style: /top/.test( a.getAttribute("style") ),
+
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ hrefNormalized: a.getAttribute("href") === "/a",
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ // Use a regex to work around a WebKit issue. See #5145
+ opacity: /^0.5/.test( a.style.opacity ),
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ cssFloat: !!a.style.cssFloat,
+
+ // Check the default checkbox/radio value ("" on WebKit; "on" elsewhere)
+ checkOn: !!input.value,
+
+ // Make sure that a selected-by-default option has a working selected property.
+ // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+ optSelected: opt.selected,
+
+ // Tests for enctype support on a form (#6743)
+ enctype: !!document.createElement("form").enctype,
+
+ // Makes sure cloning an html5 element does not cause problems
+ // Where outerHTML is undefined, this still works
+ html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>",
+
+ // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode
+ boxModel: document.compatMode === "CSS1Compat",
+
+ // Will be defined later
+ deleteExpando: true,
+ noCloneEvent: true,
+ inlineBlockNeedsLayout: false,
+ shrinkWrapBlocks: false,
+ reliableMarginRight: true,
+ boxSizingReliable: true,
+ pixelPosition: false
+ };
+
+ // Make sure checked status is properly cloned
+ input.checked = true;
+ support.noCloneChecked = input.cloneNode( true ).checked;
+
+ // Make sure that the options inside disabled selects aren't marked as disabled
+ // (WebKit marks them as disabled)
+ select.disabled = true;
+ support.optDisabled = !opt.disabled;
+
+ // Support: IE<9
+ try {
+ delete div.test;
+ } catch( e ) {
+ support.deleteExpando = false;
+ }
+
+ // Check if we can trust getAttribute("value")
+ input = document.createElement("input");
+ input.setAttribute( "value", "" );
+ support.input = input.getAttribute( "value" ) === "";
+
+ // Check if an input maintains its value after becoming a radio
+ input.value = "t";
+ input.setAttribute( "type", "radio" );
+ support.radioValue = input.value === "t";
+
+ // #11217 - WebKit loses check when the name is after the checked attribute
+ input.setAttribute( "checked", "t" );
+ input.setAttribute( "name", "t" );
+
+ fragment = document.createDocumentFragment();
+ fragment.appendChild( input );
+
+ // Check if a disconnected checkbox will retain its checked
+ // value of true after appended to the DOM (IE6/7)
+ support.appendChecked = input.checked;
+
+ // WebKit doesn't clone checked state correctly in fragments
+ support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+ // Support: IE<9
+ // Opera does not clone events (and typeof div.attachEvent === undefined).
+ // IE9-10 clones events bound via attachEvent, but they don't trigger with .click()
+ if ( div.attachEvent ) {
+ div.attachEvent( "onclick", function() {
+ support.noCloneEvent = false;
+ });
+
+ div.cloneNode( true ).click();
+ }
+
+ // Support: IE<9 (lack submit/change bubble), Firefox 17+ (lack focusin event)
+ // Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP), test/csp.php
+ for ( i in { submit: true, change: true, focusin: true }) {
+ div.setAttribute( eventName = "on" + i, "t" );
+
+ support[ i + "Bubbles" ] = eventName in window || div.attributes[ eventName ].expando === false;
+ }
+
+ div.style.backgroundClip = "content-box";
+ div.cloneNode( true ).style.backgroundClip = "";
+ support.clearCloneStyle = div.style.backgroundClip === "content-box";
+
+ // Run tests that need a body at doc ready
+ jQuery(function() {
+ var container, marginDiv, tds,
+ divReset = "padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;",
+ body = document.getElementsByTagName("body")[0];
+
+ if ( !body ) {
+ // Return for frameset docs that don't have a body
+ return;
+ }
+
+ container = document.createElement("div");
+ container.style.cssText = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px";
+
+ body.appendChild( container ).appendChild( div );
+
+ // Support: IE8
+ // Check if table cells still have offsetWidth/Height when they are set
+ // to display:none and there are still other visible table cells in a
+ // table row; if so, offsetWidth/Height are not reliable for use when
+ // determining if an element has been hidden directly using
+ // display:none (it is still safe to use offsets if a parent element is
+ // hidden; don safety goggles and see bug #4512 for more information).
+ div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>";
+ tds = div.getElementsByTagName("td");
+ tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none";
+ isSupported = ( tds[ 0 ].offsetHeight === 0 );
+
+ tds[ 0 ].style.display = "";
+ tds[ 1 ].style.display = "none";
+
+ // Support: IE8
+ // Check if empty table cells still have offsetWidth/Height
+ support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 );
+
+ // Check box-sizing and margin behavior
+ div.innerHTML = "";
+ div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;";
+ support.boxSizing = ( div.offsetWidth === 4 );
+ support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 );
+
+ // Use window.getComputedStyle because jsdom on node.js will break without it.
+ if ( window.getComputedStyle ) {
+ support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%";
+ support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px";
+
+ // Check if div with explicit width and no margin-right incorrectly
+ // gets computed margin-right based on width of container. (#3333)
+ // Fails in WebKit before Feb 2011 nightlies
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ marginDiv = div.appendChild( document.createElement("div") );
+ marginDiv.style.cssText = div.style.cssText = divReset;
+ marginDiv.style.marginRight = marginDiv.style.width = "0";
+ div.style.width = "1px";
+
+ support.reliableMarginRight =
+ !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight );
+ }
+
+ if ( typeof div.style.zoom !== "undefined" ) {
+ // Support: IE<8
+ // Check if natively block-level elements act like inline-block
+ // elements when setting their display to 'inline' and giving
+ // them layout
+ div.innerHTML = "";
+ div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1";
+ support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 );
+
+ // Support: IE6
+ // Check if elements with layout shrink-wrap their children
+ div.style.display = "block";
+ div.innerHTML = "<div></div>";
+ div.firstChild.style.width = "5px";
+ support.shrinkWrapBlocks = ( div.offsetWidth !== 3 );
+
+ // Prevent IE 6 from affecting layout for positioned elements #11048
+ // Prevent IE from shrinking the body in IE 7 mode #12869
+ body.style.zoom = 1;
+ }
+
+ body.removeChild( container );
+
+ // Null elements to avoid leaks in IE
+ container = div = tds = marginDiv = null;
+ });
+
+ // Null elements to avoid leaks in IE
+ all = select = fragment = opt = a = input = null;
+
+ return support;
+})();
+
+var rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/,
+ rmultiDash = /([A-Z])/g;
+
+function internalData( elem, name, data, pvt /* Internal Use Only */ ){
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var thisCache, ret,
+ internalKey = jQuery.expando,
+ getByName = typeof name === "string",
+
+ // We have to handle DOM nodes and JS objects differently because IE6-7
+ // can't GC object references properly across the DOM-JS boundary
+ isNode = elem.nodeType,
+
+ // Only DOM nodes need the global jQuery cache; JS object data is
+ // attached directly to the object so GC can occur automatically
+ cache = isNode ? jQuery.cache : elem,
+
+ // Only defining an ID for JS objects if its cache already exists allows
+ // the code to shortcut on the same path as a DOM node with no cache
+ id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey;
+
+ // Avoid doing any more work than we need to when trying to get data on an
+ // object that has no data at all
+ if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) {
+ return;
+ }
+
+ if ( !id ) {
+ // Only DOM nodes need a new unique ID for each element since their data
+ // ends up in the global cache
+ if ( isNode ) {
+ elem[ internalKey ] = id = core_deletedIds.pop() || jQuery.guid++;
+ } else {
+ id = internalKey;
+ }
+ }
+
+ if ( !cache[ id ] ) {
+ cache[ id ] = {};
+
+ // Avoids exposing jQuery metadata on plain JS objects when the object
+ // is serialized using JSON.stringify
+ if ( !isNode ) {
+ cache[ id ].toJSON = jQuery.noop;
+ }
+ }
+
+ // An object can be passed to jQuery.data instead of a key/value pair; this gets
+ // shallow copied over onto the existing cache
+ if ( typeof name === "object" || typeof name === "function" ) {
+ if ( pvt ) {
+ cache[ id ] = jQuery.extend( cache[ id ], name );
+ } else {
+ cache[ id ].data = jQuery.extend( cache[ id ].data, name );
+ }
+ }
+
+ thisCache = cache[ id ];
+
+ // jQuery data() is stored in a separate object inside the object's internal data
+ // cache in order to avoid key collisions between internal data and user-defined
+ // data.
+ if ( !pvt ) {
+ if ( !thisCache.data ) {
+ thisCache.data = {};
+ }
+
+ thisCache = thisCache.data;
+ }
+
+ if ( data !== undefined ) {
+ thisCache[ jQuery.camelCase( name ) ] = data;
+ }
+
+ // Check for both converted-to-camel and non-converted data property names
+ // If a data property was specified
+ if ( getByName ) {
+
+ // First Try to find as-is property data
+ ret = thisCache[ name ];
+
+ // Test for null|undefined property data
+ if ( ret == null ) {
+
+ // Try to find the camelCased property
+ ret = thisCache[ jQuery.camelCase( name ) ];
+ }
+ } else {
+ ret = thisCache;
+ }
+
+ return ret;
+}
+
+function internalRemoveData( elem, name, pvt /* For internal use only */ ){
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var thisCache, i, l,
+
+ isNode = elem.nodeType,
+
+ // See jQuery.data for more information
+ cache = isNode ? jQuery.cache : elem,
+ id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
+
+ // If there is already no cache entry for this object, there is no
+ // purpose in continuing
+ if ( !cache[ id ] ) {
+ return;
+ }
+
+ if ( name ) {
+
+ thisCache = pvt ? cache[ id ] : cache[ id ].data;
+
+ if ( thisCache ) {
+
+ // Support array or space separated string names for data keys
+ if ( !jQuery.isArray( name ) ) {
+
+ // try the string as a key before any manipulation
+ if ( name in thisCache ) {
+ name = [ name ];
+ } else {
+
+ // split the camel cased version by spaces unless a key with the spaces exists
+ name = jQuery.camelCase( name );
+ if ( name in thisCache ) {
+ name = [ name ];
+ } else {
+ name = name.split(" ");
+ }
+ }
+ } else {
+ // If "name" is an array of keys...
+ // When data is initially created, via ("key", "val") signature,
+ // keys will be converted to camelCase.
+ // Since there is no way to tell _how_ a key was added, remove
+ // both plain key and camelCase key. #12786
+ // This will only penalize the array argument path.
+ name = name.concat( jQuery.map( name, jQuery.camelCase ) );
+ }
+
+ for ( i = 0, l = name.length; i < l; i++ ) {
+ delete thisCache[ name[i] ];
+ }
+
+ // If there is no data left in the cache, we want to continue
+ // and let the cache object itself get destroyed
+ if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) {
+ return;
+ }
+ }
+ }
+
+ // See jQuery.data for more information
+ if ( !pvt ) {
+ delete cache[ id ].data;
+
+ // Don't destroy the parent cache unless the internal data object
+ // had been the only thing left in it
+ if ( !isEmptyDataObject( cache[ id ] ) ) {
+ return;
+ }
+ }
+
+ // Destroy the cache
+ if ( isNode ) {
+ jQuery.cleanData( [ elem ], true );
+
+ // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080)
+ } else if ( jQuery.support.deleteExpando || cache != cache.window ) {
+ delete cache[ id ];
+
+ // When all else fails, null
+ } else {
+ cache[ id ] = null;
+ }
+}
+
+jQuery.extend({
+ cache: {},
+
+ // Unique for each copy of jQuery on the page
+ // Non-digits removed to match rinlinejQuery
+ expando: "jQuery" + ( core_version + Math.random() ).replace( /\D/g, "" ),
+
+ // The following elements throw uncatchable exceptions if you
+ // attempt to add expando properties to them.
+ noData: {
+ "embed": true,
+ // Ban all objects except for Flash (which handle expandos)
+ "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
+ "applet": true
+ },
+
+ hasData: function( elem ) {
+ elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
+ return !!elem && !isEmptyDataObject( elem );
+ },
+
+ data: function( elem, name, data ) {
+ return internalData( elem, name, data, false );
+ },
+
+ removeData: function( elem, name ) {
+ return internalRemoveData( elem, name, false );
+ },
+
+ // For internal use only.
+ _data: function( elem, name, data ) {
+ return internalData( elem, name, data, true );
+ },
+
+ _removeData: function( elem, name ) {
+ return internalRemoveData( elem, name, true );
+ },
+
+ // A method for determining if a DOM node can handle the data expando
+ acceptData: function( elem ) {
+ var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ];
+
+ // nodes accept data unless otherwise specified; rejection can be conditional
+ return !noData || noData !== true && elem.getAttribute("classid") === noData;
+ }
+});
+
+jQuery.fn.extend({
+ data: function( key, value ) {
+ var attrs, name,
+ elem = this[0],
+ i = 0,
+ data = null;
+
+ // Gets all values
+ if ( key === undefined ) {
+ if ( this.length ) {
+ data = jQuery.data( elem );
+
+ if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) {
+ attrs = elem.attributes;
+ for ( ; i < attrs.length; i++ ) {
+ name = attrs[i].name;
+
+ if ( !name.indexOf( "data-" ) ) {
+ name = jQuery.camelCase( name.substring(5) );
+
+ dataAttr( elem, name, data[ name ] );
+ }
+ }
+ jQuery._data( elem, "parsedAttrs", true );
+ }
+ }
+
+ return data;
+ }
+
+ // Sets multiple values
+ if ( typeof key === "object" ) {
+ return this.each(function() {
+ jQuery.data( this, key );
+ });
+ }
+
+ return jQuery.access( this, function( value ) {
+
+ if ( value === undefined ) {
+ // Try to fetch any internally stored data first
+ return elem ? dataAttr( elem, key, jQuery.data( elem, key ) ) : null;
+ }
+
+ this.each(function() {
+ jQuery.data( this, key, value );
+ });
+ }, null, value, arguments.length > 1, null, true );
+ },
+
+ removeData: function( key ) {
+ return this.each(function() {
+ jQuery.removeData( this, key );
+ });
+ }
+});
+
+function dataAttr( elem, key, data ) {
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if ( data === undefined && elem.nodeType === 1 ) {
+
+ var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase();
+
+ data = elem.getAttribute( name );
+
+ if ( typeof data === "string" ) {
+ try {
+ data = data === "true" ? true :
+ data === "false" ? false :
+ data === "null" ? null :
+ // Only convert to a number if it doesn't change the string
+ +data + "" === data ? +data :
+ rbrace.test( data ) ? jQuery.parseJSON( data ) :
+ data;
+ } catch( e ) {}
+
+ // Make sure we set the data so it isn't changed later
+ jQuery.data( elem, key, data );
+
+ } else {
+ data = undefined;
+ }
+ }
+
+ return data;
+}
+
+// checks a cache object for emptiness
+function isEmptyDataObject( obj ) {
+ var name;
+ for ( name in obj ) {
+
+ // if the public data object is empty, the private is still empty
+ if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) {
+ continue;
+ }
+ if ( name !== "toJSON" ) {
+ return false;
+ }
+ }
+
+ return true;
+}
+jQuery.extend({
+ queue: function( elem, type, data ) {
+ var queue;
+
+ if ( elem ) {
+ type = ( type || "fx" ) + "queue";
+ queue = jQuery._data( elem, type );
+
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( data ) {
+ if ( !queue || jQuery.isArray(data) ) {
+ queue = jQuery._data( elem, type, jQuery.makeArray(data) );
+ } else {
+ queue.push( data );
+ }
+ }
+ return queue || [];
+ }
+ },
+
+ dequeue: function( elem, type ) {
+ type = type || "fx";
+
+ var queue = jQuery.queue( elem, type ),
+ startLength = queue.length,
+ fn = queue.shift(),
+ hooks = jQuery._queueHooks( elem, type ),
+ next = function() {
+ jQuery.dequeue( elem, type );
+ };
+
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if ( fn === "inprogress" ) {
+ fn = queue.shift();
+ startLength--;
+ }
+
+ hooks.cur = fn;
+ if ( fn ) {
+
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if ( type === "fx" ) {
+ queue.unshift( "inprogress" );
+ }
+
+ // clear up the last queue stop function
+ delete hooks.stop;
+ fn.call( elem, next, hooks );
+ }
+
+ if ( !startLength && hooks ) {
+ hooks.empty.fire();
+ }
+ },
+
+ // not intended for public consumption - generates a queueHooks object, or returns the current one
+ _queueHooks: function( elem, type ) {
+ var key = type + "queueHooks";
+ return jQuery._data( elem, key ) || jQuery._data( elem, key, {
+ empty: jQuery.Callbacks("once memory").add(function() {
+ jQuery._removeData( elem, type + "queue" );
+ jQuery._removeData( elem, key );
+ })
+ });
+ }
+});
+
+jQuery.fn.extend({
+ queue: function( type, data ) {
+ var setter = 2;
+
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ setter--;
+ }
+
+ if ( arguments.length < setter ) {
+ return jQuery.queue( this[0], type );
+ }
+
+ return data === undefined ?
+ this :
+ this.each(function() {
+ var queue = jQuery.queue( this, type, data );
+
+ // ensure a hooks for this queue
+ jQuery._queueHooks( this, type );
+
+ if ( type === "fx" && queue[0] !== "inprogress" ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ },
+ dequeue: function( type ) {
+ return this.each(function() {
+ jQuery.dequeue( this, type );
+ });
+ },
+ // Based off of the plugin by Clint Helfers, with permission.
+ // http://blindsignals.com/index.php/2009/07/jquery-delay/
+ delay: function( time, type ) {
+ time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+ type = type || "fx";
+
+ return this.queue( type, function( next, hooks ) {
+ var timeout = setTimeout( next, time );
+ hooks.stop = function() {
+ clearTimeout( timeout );
+ };
+ });
+ },
+ clearQueue: function( type ) {
+ return this.queue( type || "fx", [] );
+ },
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function( type, obj ) {
+ var tmp,
+ count = 1,
+ defer = jQuery.Deferred(),
+ elements = this,
+ i = this.length,
+ resolve = function() {
+ if ( !( --count ) ) {
+ defer.resolveWith( elements, [ elements ] );
+ }
+ };
+
+ if ( typeof type !== "string" ) {
+ obj = type;
+ type = undefined;
+ }
+ type = type || "fx";
+
+ while( i-- ) {
+ tmp = jQuery._data( elements[ i ], type + "queueHooks" );
+ if ( tmp && tmp.empty ) {
+ count++;
+ tmp.empty.add( resolve );
+ }
+ }
+ resolve();
+ return defer.promise( obj );
+ }
+});
+var nodeHook, boolHook,
+ rclass = /[\t\r\n]/g,
+ rreturn = /\r/g,
+ rfocusable = /^(?:input|select|textarea|button|object)$/i,
+ rclickable = /^(?:a|area)$/i,
+ rboolean = /^(?:checked|selected|autofocus|autoplay|async|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped)$/i,
+ ruseDefault = /^(?:checked|selected)$/i,
+ getSetAttribute = jQuery.support.getSetAttribute,
+ getSetInput = jQuery.support.input;
+
+jQuery.fn.extend({
+ attr: function( name, value ) {
+ return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 );
+ },
+
+ removeAttr: function( name ) {
+ return this.each(function() {
+ jQuery.removeAttr( this, name );
+ });
+ },
+
+ prop: function( name, value ) {
+ return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 );
+ },
+
+ removeProp: function( name ) {
+ name = jQuery.propFix[ name ] || name;
+ return this.each(function() {
+ // try/catch handles cases where IE balks (such as removing a property on window)
+ try {
+ this[ name ] = undefined;
+ delete this[ name ];
+ } catch( e ) {}
+ });
+ },
+
+ addClass: function( value ) {
+ var classes, elem, cur, clazz, j,
+ i = 0,
+ len = this.length,
+ proceed = typeof value === "string" && value;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).addClass( value.call( this, j, this.className ) );
+ });
+ }
+
+ if ( proceed ) {
+ // The disjunction here is for better compressibility (see removeClass)
+ classes = ( value || "" ).match( core_rnotwhite ) || [];
+
+ for ( ; i < len; i++ ) {
+ elem = this[ i ];
+ cur = elem.nodeType === 1 && ( elem.className ?
+ ( " " + elem.className + " " ).replace( rclass, " " ) :
+ " "
+ );
+
+ if ( cur ) {
+ j = 0;
+ while ( (clazz = classes[j++]) ) {
+ if ( cur.indexOf( " " + clazz + " " ) < 0 ) {
+ cur += clazz + " ";
+ }
+ }
+ elem.className = jQuery.trim( cur );
+
+ }
+ }
+ }
+
+ return this;
+ },
+
+ removeClass: function( value ) {
+ var classes, elem, cur, clazz, j,
+ i = 0,
+ len = this.length,
+ proceed = arguments.length === 0 || typeof value === "string" && value;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).removeClass( value.call( this, j, this.className ) );
+ });
+ }
+ if ( proceed ) {
+ classes = ( value || "" ).match( core_rnotwhite ) || [];
+
+ for ( ; i < len; i++ ) {
+ elem = this[ i ];
+ // This expression is here for better compressibility (see addClass)
+ cur = elem.nodeType === 1 && ( elem.className ?
+ ( " " + elem.className + " " ).replace( rclass, " " ) :
+ ""
+ );
+
+ if ( cur ) {
+ j = 0;
+ while ( (clazz = classes[j++]) ) {
+ // Remove *all* instances
+ while ( cur.indexOf( " " + clazz + " " ) >= 0 ) {
+ cur = cur.replace( " " + clazz + " ", " " );
+ }
+ }
+ elem.className = value ? jQuery.trim( cur ) : "";
+ }
+ }
+ }
+
+ return this;
+ },
+
+ toggleClass: function( value, stateVal ) {
+ var type = typeof value,
+ isBool = typeof stateVal === "boolean";
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( i ) {
+ jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal );
+ });
+ }
+
+ return this.each(function() {
+ if ( type === "string" ) {
+ // toggle individual class names
+ var className,
+ i = 0,
+ self = jQuery( this ),
+ state = stateVal,
+ classNames = value.match( core_rnotwhite ) || [];
+
+ while ( (className = classNames[ i++ ]) ) {
+ // check each className given, space separated list
+ state = isBool ? state : !self.hasClass( className );
+ self[ state ? "addClass" : "removeClass" ]( className );
+ }
+
+ // Toggle whole class name
+ } else if ( type === "undefined" || type === "boolean" ) {
+ if ( this.className ) {
+ // store className if set
+ jQuery._data( this, "__className__", this.className );
+ }
+
+ // If the element has a class name or if we're passed "false",
+ // then remove the whole classname (if there was one, the above saved it).
+ // Otherwise bring back whatever was previously saved (if anything),
+ // falling back to the empty string if nothing was stored.
+ this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
+ }
+ });
+ },
+
+ hasClass: function( selector ) {
+ var className = " " + selector + " ",
+ i = 0,
+ l = this.length;
+ for ( ; i < l; i++ ) {
+ if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) {
+ return true;
+ }
+ }
+
+ return false;
+ },
+
+ val: function( value ) {
+ var hooks, ret, isFunction,
+ elem = this[0];
+
+ if ( !arguments.length ) {
+ if ( elem ) {
+ hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
+ return ret;
+ }
+
+ ret = elem.value;
+
+ return typeof ret === "string" ?
+ // handle most common string cases
+ ret.replace(rreturn, "") :
+ // handle cases where value is null/undef or number
+ ret == null ? "" : ret;
+ }
+
+ return;
+ }
+
+ isFunction = jQuery.isFunction( value );
+
+ return this.each(function( i ) {
+ var val,
+ self = jQuery(this);
+
+ if ( this.nodeType !== 1 ) {
+ return;
+ }
+
+ if ( isFunction ) {
+ val = value.call( this, i, self.val() );
+ } else {
+ val = value;
+ }
+
+ // Treat null/undefined as ""; convert numbers to string
+ if ( val == null ) {
+ val = "";
+ } else if ( typeof val === "number" ) {
+ val += "";
+ } else if ( jQuery.isArray( val ) ) {
+ val = jQuery.map(val, function ( value ) {
+ return value == null ? "" : value + "";
+ });
+ }
+
+ hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
+
+ // If set returns undefined, fall back to normal setting
+ if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
+ this.value = val;
+ }
+ });
+ }
+});
+
+jQuery.extend({
+ valHooks: {
+ option: {
+ get: function( elem ) {
+ // attributes.value is undefined in Blackberry 4.7 but
+ // uses .value. See #6932
+ var val = elem.attributes.value;
+ return !val || val.specified ? elem.value : elem.text;
+ }
+ },
+ select: {
+ get: function( elem ) {
+ var value, option,
+ options = elem.options,
+ index = elem.selectedIndex,
+ one = elem.type === "select-one" || index < 0,
+ values = one ? null : [],
+ max = one ? index + 1 : options.length,
+ i = index < 0 ?
+ max :
+ one ? index : 0;
+
+ // Loop through all the selected options
+ for ( ; i < max; i++ ) {
+ option = options[ i ];
+
+ // oldIE doesn't update selected after form reset (#2551)
+ if ( ( option.selected || i === index ) &&
+ // Don't return options that are disabled or in a disabled optgroup
+ ( jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) &&
+ ( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) {
+
+ // Get the specific value for the option
+ value = jQuery( option ).val();
+
+ // We don't need an array for one selects
+ if ( one ) {
+ return value;
+ }
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ return values;
+ },
+
+ set: function( elem, value ) {
+ var values = jQuery.makeArray( value );
+
+ jQuery(elem).find("option").each(function() {
+ this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
+ });
+
+ if ( !values.length ) {
+ elem.selectedIndex = -1;
+ }
+ return values;
+ }
+ }
+ },
+
+ attr: function( elem, name, value ) {
+ var ret, hooks, notxml,
+ nType = elem.nodeType;
+
+ // don't get/set attributes on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ // Fallback to prop when attributes are not supported
+ if ( typeof elem.getAttribute === "undefined" ) {
+ return jQuery.prop( elem, name, value );
+ }
+
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ // All attributes are lowercase
+ // Grab necessary hook if one is defined
+ if ( notxml ) {
+ name = name.toLowerCase();
+ hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook );
+ }
+
+ if ( value !== undefined ) {
+
+ if ( value === null ) {
+ jQuery.removeAttr( elem, name );
+
+ } else if ( hooks && notxml && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ elem.setAttribute( name, value + "" );
+ return value;
+ }
+
+ } else if ( hooks && notxml && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) {
+ return ret;
+
+ } else {
+
+ // In IE9+, Flash objects don't have .getAttribute (#12945)
+ // Support: IE9+
+ if ( typeof elem.getAttribute !== "undefined" ) {
+ ret = elem.getAttribute( name );
+ }
+
+ // Non-existent attributes return null, we normalize to undefined
+ return ret == null ?
+ undefined :
+ ret;
+ }
+ },
+
+ removeAttr: function( elem, value ) {
+ var name, propName,
+ i = 0,
+ attrNames = value && value.match( core_rnotwhite );
+
+ if ( attrNames && elem.nodeType === 1 ) {
+ while ( (name = attrNames[i++]) ) {
+ propName = jQuery.propFix[ name ] || name;
+
+ // Boolean attributes get special treatment (#10870)
+ if ( rboolean.test( name ) ) {
+ // Set corresponding property to false for boolean attributes
+ // Also clear defaultChecked/defaultSelected (if appropriate) for IE<8
+ if ( !getSetAttribute && ruseDefault.test( name ) ) {
+ elem[ jQuery.camelCase( "default-" + name ) ] =
+ elem[ propName ] = false;
+ } else {
+ elem[ propName ] = false;
+ }
+
+ // See #9699 for explanation of this approach (setting first, then removal)
+ } else {
+ jQuery.attr( elem, name, "" );
+ }
+
+ elem.removeAttribute( getSetAttribute ? name : propName );
+ }
+ }
+ },
+
+ attrHooks: {
+ type: {
+ set: function( elem, value ) {
+ if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) {
+ // Setting the type on a radio button after the value resets the value in IE6-9
+ // Reset value to default in case type is set after value during creation
+ var val = elem.value;
+ elem.setAttribute( "type", value );
+ if ( val ) {
+ elem.value = val;
+ }
+ return value;
+ }
+ }
+ }
+ },
+
+ propFix: {
+ tabindex: "tabIndex",
+ readonly: "readOnly",
+ "for": "htmlFor",
+ "class": "className",
+ maxlength: "maxLength",
+ cellspacing: "cellSpacing",
+ cellpadding: "cellPadding",
+ rowspan: "rowSpan",
+ colspan: "colSpan",
+ usemap: "useMap",
+ frameborder: "frameBorder",
+ contenteditable: "contentEditable"
+ },
+
+ prop: function( elem, name, value ) {
+ var ret, hooks, notxml,
+ nType = elem.nodeType;
+
+ // don't get/set properties on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ if ( notxml ) {
+ // Fix name and attach hooks
+ name = jQuery.propFix[ name ] || name;
+ hooks = jQuery.propHooks[ name ];
+ }
+
+ if ( value !== undefined ) {
+ if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ return ( elem[ name ] = value );
+ }
+
+ } else {
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) {
+ return ret;
+
+ } else {
+ return elem[ name ];
+ }
+ }
+ },
+
+ propHooks: {
+ tabIndex: {
+ get: function( elem ) {
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ var attributeNode = elem.getAttributeNode("tabindex");
+
+ return attributeNode && attributeNode.specified ?
+ parseInt( attributeNode.value, 10 ) :
+ rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+ 0 :
+ undefined;
+ }
+ }
+ }
+});
+
+// Hook for boolean attributes
+boolHook = {
+ get: function( elem, name ) {
+ var
+ // Use .prop to determine if this attribute is understood as boolean
+ prop = jQuery.prop( elem, name ),
+
+ // Fetch it accordingly
+ attr = typeof prop === "boolean" && elem.getAttribute( name ),
+ detail = typeof prop === "boolean" ?
+
+ getSetInput && getSetAttribute ?
+ attr != null :
+ // oldIE fabricates an empty string for missing boolean attributes
+ // and conflates checked/selected into attroperties
+ ruseDefault.test( name ) ?
+ elem[ jQuery.camelCase( "default-" + name ) ] :
+ !!attr :
+
+ // fetch an attribute node for properties not recognized as boolean
+ elem.getAttributeNode( name );
+
+ return detail && detail.value !== false ?
+ name.toLowerCase() :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ if ( value === false ) {
+ // Remove boolean attributes when set to false
+ jQuery.removeAttr( elem, name );
+ } else if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) {
+ // IE<8 needs the *property* name
+ elem.setAttribute( !getSetAttribute && jQuery.propFix[ name ] || name, name );
+
+ // Use defaultChecked and defaultSelected for oldIE
+ } else {
+ elem[ jQuery.camelCase( "default-" + name ) ] = elem[ name ] = true;
+ }
+
+ return name;
+ }
+};
+
+// fix oldIE value attroperty
+if ( !getSetInput || !getSetAttribute ) {
+ jQuery.attrHooks.value = {
+ get: function( elem, name ) {
+ var ret = elem.getAttributeNode( name );
+ return jQuery.nodeName( elem, "input" ) ?
+
+ // Ignore the value *property* by using defaultValue
+ elem.defaultValue :
+
+ ret && ret.specified ? ret.value : undefined;
+ },
+ set: function( elem, value, name ) {
+ if ( jQuery.nodeName( elem, "input" ) ) {
+ // Does not return so that setAttribute is also used
+ elem.defaultValue = value;
+ } else {
+ // Use nodeHook if defined (#1954); otherwise setAttribute is fine
+ return nodeHook && nodeHook.set( elem, value, name );
+ }
+ }
+ };
+}
+
+// IE6/7 do not support getting/setting some attributes with get/setAttribute
+if ( !getSetAttribute ) {
+
+ // Use this for any attribute in IE6/7
+ // This fixes almost every IE6/7 issue
+ nodeHook = jQuery.valHooks.button = {
+ get: function( elem, name ) {
+ var ret = elem.getAttributeNode( name );
+ return ret && ( name === "id" || name === "name" || name === "coords" ? ret.value !== "" : ret.specified ) ?
+ ret.value :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ // Set the existing or create a new attribute node
+ var ret = elem.getAttributeNode( name );
+ if ( !ret ) {
+ elem.setAttributeNode(
+ (ret = elem.ownerDocument.createAttribute( name ))
+ );
+ }
+
+ ret.value = value += "";
+
+ // Break association with cloned elements by also using setAttribute (#9646)
+ return name === "value" || value === elem.getAttribute( name ) ?
+ value :
+ undefined;
+ }
+ };
+
+ // Set contenteditable to false on removals(#10429)
+ // Setting to empty string throws an error as an invalid value
+ jQuery.attrHooks.contenteditable = {
+ get: nodeHook.get,
+ set: function( elem, value, name ) {
+ nodeHook.set( elem, value === "" ? false : value, name );
+ }
+ };
+
+ // Set width and height to auto instead of 0 on empty string( Bug #8150 )
+ // This is for removals
+ jQuery.each([ "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ set: function( elem, value ) {
+ if ( value === "" ) {
+ elem.setAttribute( name, "auto" );
+ return value;
+ }
+ }
+ });
+ });
+}
+
+
+// Some attributes require a special call on IE
+// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+if ( !jQuery.support.hrefNormalized ) {
+ jQuery.each([ "href", "src", "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ get: function( elem ) {
+ var ret = elem.getAttribute( name, 2 );
+ return ret == null ? undefined : ret;
+ }
+ });
+ });
+
+ // href/src property should get the full normalized URL (#10299/#12915)
+ jQuery.each([ "href", "src" ], function( i, name ) {
+ jQuery.propHooks[ name ] = {
+ get: function( elem ) {
+ return elem.getAttribute( name, 4 );
+ }
+ };
+ });
+}
+
+if ( !jQuery.support.style ) {
+ jQuery.attrHooks.style = {
+ get: function( elem ) {
+ // Return undefined in the case of empty string
+ // Note: IE uppercases css property names, but if we were to .toLowerCase()
+ // .cssText, that would destroy case senstitivity in URL's, like in "background"
+ return elem.style.cssText || undefined;
+ },
+ set: function( elem, value ) {
+ return ( elem.style.cssText = value + "" );
+ }
+ };
+}
+
+// Safari mis-reports the default selected property of an option
+// Accessing the parent's selectedIndex property fixes it
+if ( !jQuery.support.optSelected ) {
+ jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, {
+ get: function( elem ) {
+ var parent = elem.parentNode;
+
+ if ( parent ) {
+ parent.selectedIndex;
+
+ // Make sure that it also works with optgroups, see #5701
+ if ( parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ return null;
+ }
+ });
+}
+
+// IE6/7 call enctype encoding
+if ( !jQuery.support.enctype ) {
+ jQuery.propFix.enctype = "encoding";
+}
+
+// Radios and checkboxes getter/setter
+if ( !jQuery.support.checkOn ) {
+ jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = {
+ get: function( elem ) {
+ // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+ return elem.getAttribute("value") === null ? "on" : elem.value;
+ }
+ };
+ });
+}
+jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], {
+ set: function( elem, value ) {
+ if ( jQuery.isArray( value ) ) {
+ return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 );
+ }
+ }
+ });
+});
+var rformElems = /^(?:input|select|textarea)$/i,
+ rkeyEvent = /^key/,
+ rmouseEvent = /^(?:mouse|contextmenu)|click/,
+ rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+ rtypenamespace = /^([^.]*)(?:\.(.+)|)$/;
+
+function returnTrue() {
+ return true;
+}
+
+function returnFalse() {
+ return false;
+}
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+ global: {},
+
+ add: function( elem, types, handler, data, selector ) {
+
+ var handleObjIn, eventHandle, tmp,
+ events, t, handleObj,
+ special, handlers, type, namespaces, origType,
+ // Don't attach events to noData or text/comment nodes (but allow plain objects)
+ elemData = elem.nodeType !== 3 && elem.nodeType !== 8 && jQuery._data( elem );
+
+ if ( !elemData ) {
+ return;
+ }
+
+ // Caller can pass in an object of custom data in lieu of the handler
+ if ( handler.handler ) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ selector = handleObjIn.selector;
+ }
+
+ // Make sure that the handler has a unique ID, used to find/remove it later
+ if ( !handler.guid ) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure and main handler, if this is the first
+ if ( !(events = elemData.events) ) {
+ events = elemData.events = {};
+ }
+ if ( !(eventHandle = elemData.handle) ) {
+ eventHandle = elemData.handle = function( e ) {
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ?
+ jQuery.event.dispatch.apply( eventHandle.elem, arguments ) :
+ undefined;
+ };
+ // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events
+ eventHandle.elem = elem;
+ }
+
+ // Handle multiple events separated by a space
+ // jQuery(...).bind("mouseover mouseout", fn);
+ types = ( types || "" ).match( core_rnotwhite ) || [""];
+ t = types.length;
+ while ( t-- ) {
+ tmp = rtypenamespace.exec( types[t] ) || [];
+ type = origType = tmp[1];
+ namespaces = ( tmp[2] || "" ).split( "." ).sort();
+
+ // If event changes its type, use the special event handlers for the changed type
+ special = jQuery.event.special[ type ] || {};
+
+ // If selector defined, determine special event api type, otherwise given type
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+
+ // Update special based on newly reset type
+ special = jQuery.event.special[ type ] || {};
+
+ // handleObj is passed to all event handlers
+ handleObj = jQuery.extend({
+ type: type,
+ origType: origType,
+ data: data,
+ handler: handler,
+ guid: handler.guid,
+ selector: selector,
+ needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
+ namespace: namespaces.join(".")
+ }, handleObjIn );
+
+ // Init the event handler queue if we're the first
+ if ( !(handlers = events[ type ]) ) {
+ handlers = events[ type ] = [];
+ handlers.delegateCount = 0;
+
+ // Only use addEventListener/attachEvent if the special events handler returns false
+ if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+ // Bind the global event handler to the element
+ if ( elem.addEventListener ) {
+ elem.addEventListener( type, eventHandle, false );
+
+ } else if ( elem.attachEvent ) {
+ elem.attachEvent( "on" + type, eventHandle );
+ }
+ }
+ }
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
+
+ if ( !handleObj.handler.guid ) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add to the element's handler list, delegates in front
+ if ( selector ) {
+ handlers.splice( handlers.delegateCount++, 0, handleObj );
+ } else {
+ handlers.push( handleObj );
+ }
+
+ // Keep track of which events have ever been used, for event optimization
+ jQuery.event.global[ type ] = true;
+ }
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ // Detach an event or set of events from an element
+ remove: function( elem, types, handler, selector, mappedTypes ) {
+
+ var j, origCount, tmp,
+ events, t, handleObj,
+ special, handlers, type, namespaces, origType,
+ elemData = jQuery.hasData( elem ) && jQuery._data( elem );
+
+ if ( !elemData || !(events = elemData.events) ) {
+ return;
+ }
+
+ // Once for each type.namespace in types; type may be omitted
+ types = ( types || "" ).match( core_rnotwhite ) || [""];
+ t = types.length;
+ while ( t-- ) {
+ tmp = rtypenamespace.exec( types[t] ) || [];
+ type = origType = tmp[1];
+ namespaces = ( tmp[2] || "" ).split( "." ).sort();
+
+ // Unbind all events (on this namespace, if provided) for the element
+ if ( !type ) {
+ for ( type in events ) {
+ jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+ }
+ continue;
+ }
+
+ special = jQuery.event.special[ type ] || {};
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+ handlers = events[ type ] || [];
+ tmp = tmp[2] && new RegExp( "(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)" );
+
+ // Remove matching events
+ origCount = j = handlers.length;
+ while ( j-- ) {
+ handleObj = handlers[ j ];
+
+ if ( ( mappedTypes || origType === handleObj.origType ) &&
+ ( !handler || handler.guid === handleObj.guid ) &&
+ ( !tmp || tmp.test( handleObj.namespace ) ) &&
+ ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) {
+ handlers.splice( j, 1 );
+
+ if ( handleObj.selector ) {
+ handlers.delegateCount--;
+ }
+ if ( special.remove ) {
+ special.remove.call( elem, handleObj );
+ }
+ }
+ }
+
+ // Remove generic event handler if we removed something and no more handlers exist
+ // (avoids potential for endless recursion during removal of special event handlers)
+ if ( origCount && !handlers.length ) {
+ if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+ jQuery.removeEvent( elem, type, elemData.handle );
+ }
+
+ delete events[ type ];
+ }
+ }
+
+ // Remove the expando if it's no longer used
+ if ( jQuery.isEmptyObject( events ) ) {
+ delete elemData.handle;
+
+ // removeData also checks for emptiness and clears the expando if empty
+ // so use it instead of delete
+ jQuery._removeData( elem, "events" );
+ }
+ },
+
+ trigger: function( event, data, elem, onlyHandlers ) {
+
+ var i, cur, tmp, bubbleType, ontype, handle, special,
+ eventPath = [ elem || document ],
+ type = event.type || event,
+ namespaces = event.namespace ? event.namespace.split(".") : [];
+
+ cur = tmp = elem = elem || document;
+
+ // Don't do events on text and comment nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
+ }
+
+ // focus/blur morphs to focusin/out; ensure we're not firing them right now
+ if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
+ return;
+ }
+
+ if ( type.indexOf(".") >= 0 ) {
+ // Namespaced trigger; create a regexp to match event type in handle()
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ namespaces.sort();
+ }
+ ontype = type.indexOf(":") < 0 && "on" + type;
+
+ // Caller can pass in a jQuery.Event object, Object, or just an event type string
+ event = event[ jQuery.expando ] ?
+ event :
+ new jQuery.Event( type, typeof event === "object" && event );
+
+ event.isTrigger = true;
+ event.namespace = namespaces.join(".");
+ event.namespace_re = event.namespace ?
+ new RegExp( "(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)" ) :
+ null;
+
+ // Clean up the event in case it is being reused
+ event.result = undefined;
+ if ( !event.target ) {
+ event.target = elem;
+ }
+
+ // Clone any incoming data and prepend the event, creating the handler arg list
+ data = data == null ?
+ [ event ] :
+ jQuery.makeArray( data, [ event ] );
+
+ // Allow special events to draw outside the lines
+ special = jQuery.event.special[ type ] || {};
+ if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
+ return;
+ }
+
+ // Determine event propagation path in advance, per W3C events spec (#9951)
+ // Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
+ if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
+
+ bubbleType = special.delegateType || type;
+ if ( !rfocusMorph.test( bubbleType + type ) ) {
+ cur = cur.parentNode;
+ }
+ for ( ; cur; cur = cur.parentNode ) {
+ eventPath.push( cur );
+ tmp = cur;
+ }
+
+ // Only add window if we got to document (e.g., not plain obj or detached DOM)
+ if ( tmp === (elem.ownerDocument || document) ) {
+ eventPath.push( tmp.defaultView || tmp.parentWindow || window );
+ }
+ }
+
+ // Fire handlers on the event path
+ i = 0;
+ while ( (cur = eventPath[i++]) && !event.isPropagationStopped() ) {
+
+ event.type = i > 1 ?
+ bubbleType :
+ special.bindType || type;
+
+ // jQuery handler
+ handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" );
+ if ( handle ) {
+ handle.apply( cur, data );
+ }
+
+ // Native handler
+ handle = ontype && cur[ ontype ];
+ if ( handle && jQuery.acceptData( cur ) && handle.apply && handle.apply( cur, data ) === false ) {
+ event.preventDefault();
+ }
+ }
+ event.type = type;
+
+ // If nobody prevented the default action, do it now
+ if ( !onlyHandlers && !event.isDefaultPrevented() ) {
+
+ if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) &&
+ !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) {
+
+ // Call a native DOM method on the target with the same name name as the event.
+ // Can't use an .isFunction() check here because IE6/7 fails that test.
+ // Don't do default actions on window, that's where global variables be (#6170)
+ if ( ontype && elem[ type ] && !jQuery.isWindow( elem ) ) {
+
+ // Don't re-trigger an onFOO event when we call its FOO() method
+ tmp = elem[ ontype ];
+
+ if ( tmp ) {
+ elem[ ontype ] = null;
+ }
+
+ // Prevent re-triggering of the same event, since we already bubbled it above
+ jQuery.event.triggered = type;
+ try {
+ elem[ type ]();
+ } catch ( e ) {
+ // IE<9 dies on focus/blur to hidden element (#1486,#12518)
+ // only reproducible on winXP IE8 native, not IE9 in IE8 mode
+ }
+ jQuery.event.triggered = undefined;
+
+ if ( tmp ) {
+ elem[ ontype ] = tmp;
+ }
+ }
+ }
+ }
+
+ return event.result;
+ },
+
+ dispatch: function( event ) {
+
+ // Make a writable jQuery.Event from the native event object
+ event = jQuery.event.fix( event );
+
+ var i, j, ret, matched, handleObj,
+ handlerQueue = [],
+ args = core_slice.call( arguments ),
+ handlers = ( jQuery._data( this, "events" ) || {} )[ event.type ] || [],
+ special = jQuery.event.special[ event.type ] || {};
+
+ // Use the fix-ed jQuery.Event rather than the (read-only) native event
+ args[0] = event;
+ event.delegateTarget = this;
+
+ // Call the preDispatch hook for the mapped type, and let it bail if desired
+ if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
+ return;
+ }
+
+ // Determine handlers
+ handlerQueue = jQuery.event.handlers.call( this, event, handlers );
+
+ // Run delegates first; they may want to stop propagation beneath us
+ i = 0;
+ while ( (matched = handlerQueue[ i++ ]) && !event.isPropagationStopped() ) {
+ event.currentTarget = matched.elem;
+
+ j = 0;
+ while ( (handleObj = matched.handlers[ j++ ]) && !event.isImmediatePropagationStopped() ) {
+
+ // Triggered event must either 1) have no namespace, or
+ // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).
+ if ( !event.namespace_re || event.namespace_re.test( handleObj.namespace ) ) {
+
+ event.handleObj = handleObj;
+ event.data = handleObj.data;
+
+ ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )
+ .apply( matched.elem, args );
+
+ if ( ret !== undefined ) {
+ if ( (event.result = ret) === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+ }
+ }
+ }
+
+ // Call the postDispatch hook for the mapped type
+ if ( special.postDispatch ) {
+ special.postDispatch.call( this, event );
+ }
+
+ return event.result;
+ },
+
+ handlers: function( event, handlers ) {
+ var i, matches, sel, handleObj,
+ handlerQueue = [],
+ delegateCount = handlers.delegateCount,
+ cur = event.target;
+
+ // Find delegate handlers
+ // Black-hole SVG <use> instance trees (#13180)
+ // Avoid non-left-click bubbling in Firefox (#3861)
+ if ( delegateCount && cur.nodeType && (!event.button || event.type !== "click") ) {
+
+ for ( ; cur != this; cur = cur.parentNode || this ) {
+
+ // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
+ if ( cur.disabled !== true || event.type !== "click" ) {
+ matches = [];
+ for ( i = 0; i < delegateCount; i++ ) {
+ handleObj = handlers[ i ];
+
+ // Don't conflict with Object.prototype properties (#13203)
+ sel = handleObj.selector + " ";
+
+ if ( matches[ sel ] === undefined ) {
+ matches[ sel ] = handleObj.needsContext ?
+ jQuery( sel, this ).index( cur ) >= 0 :
+ jQuery.find( sel, this, null, [ cur ] ).length;
+ }
+ if ( matches[ sel ] ) {
+ matches.push( handleObj );
+ }
+ }
+ if ( matches.length ) {
+ handlerQueue.push({ elem: cur, handlers: matches });
+ }
+ }
+ }
+ }
+
+ // Add the remaining (directly-bound) handlers
+ if ( delegateCount < handlers.length ) {
+ handlerQueue.push({ elem: this, handlers: handlers.slice( delegateCount ) });
+ }
+
+ return handlerQueue;
+ },
+
+ fix: function( event ) {
+ if ( event[ jQuery.expando ] ) {
+ return event;
+ }
+
+ // Create a writable copy of the event object and normalize some properties
+ var i, prop,
+ originalEvent = event,
+ fixHook = jQuery.event.fixHooks[ event.type ] || {},
+ copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;
+
+ event = new jQuery.Event( originalEvent );
+
+ i = copy.length;
+ while ( i-- ) {
+ prop = copy[ i ];
+ event[ prop ] = originalEvent[ prop ];
+ }
+
+ // Support: IE<9
+ // Fix target property (#1925)
+ if ( !event.target ) {
+ event.target = originalEvent.srcElement || document;
+ }
+
+ // Support: Chrome 23+, Safari?
+ // Target should not be a text node (#504, #13143)
+ if ( event.target.nodeType === 3 ) {
+ event.target = event.target.parentNode;
+ }
+
+ // Support: IE<9
+ // For mouse/key events, metaKey==false if it's undefined (#3368, #11328)
+ event.metaKey = !!event.metaKey;
+
+ return fixHook.filter ? fixHook.filter( event, originalEvent ) : event;
+ },
+
+ // Includes some event props shared by KeyEvent and MouseEvent
+ props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
+
+ fixHooks: {},
+
+ keyHooks: {
+ props: "char charCode key keyCode".split(" "),
+ filter: function( event, original ) {
+
+ // Add which for key events
+ if ( event.which == null ) {
+ event.which = original.charCode != null ? original.charCode : original.keyCode;
+ }
+
+ return event;
+ }
+ },
+
+ mouseHooks: {
+ props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
+ filter: function( event, original ) {
+ var eventDoc, doc, body,
+ button = original.button,
+ fromElement = original.fromElement;
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if ( event.pageX == null && original.clientX != null ) {
+ eventDoc = event.target.ownerDocument || document;
+ doc = eventDoc.documentElement;
+ body = eventDoc.body;
+
+ event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );
+ event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 );
+ }
+
+ // Add relatedTarget, if necessary
+ if ( !event.relatedTarget && fromElement ) {
+ event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
+ }
+
+ // Add which for click: 1 === left; 2 === middle; 3 === right
+ // Note: button is not normalized, so don't use it
+ if ( !event.which && button !== undefined ) {
+ event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) );
+ }
+
+ return event;
+ }
+ },
+
+ special: {
+ load: {
+ // Prevent triggered image.load events from bubbling to window.load
+ noBubble: true
+ },
+ click: {
+ // For checkbox, fire native event so checked state will be right
+ trigger: function() {
+ if ( jQuery.nodeName( this, "input" ) && this.type === "checkbox" && this.click ) {
+ this.click();
+ return false;
+ }
+ }
+ },
+ focus: {
+ // Fire native event if possible so blur/focus sequence is correct
+ trigger: function() {
+ if ( this !== document.activeElement && this.focus ) {
+ try {
+ this.focus();
+ return false;
+ } catch ( e ) {
+ // Support: IE<9
+ // If we error on focus to hidden element (#1486, #12518),
+ // let .trigger() run the handlers
+ }
+ }
+ },
+ delegateType: "focusin"
+ },
+ blur: {
+ trigger: function() {
+ if ( this === document.activeElement && this.blur ) {
+ this.blur();
+ return false;
+ }
+ },
+ delegateType: "focusout"
+ },
+
+ beforeunload: {
+ postDispatch: function( event ) {
+
+ // Even when returnValue equals to undefined Firefox will still show alert
+ if ( event.result !== undefined ) {
+ event.originalEvent.returnValue = event.result;
+ }
+ }
+ }
+ },
+
+ simulate: function( type, elem, event, bubble ) {
+ // Piggyback on a donor event to simulate a different one.
+ // Fake originalEvent to avoid donor's stopPropagation, but if the
+ // simulated event prevents default then we do the same on the donor.
+ var e = jQuery.extend(
+ new jQuery.Event(),
+ event,
+ { type: type,
+ isSimulated: true,
+ originalEvent: {}
+ }
+ );
+ if ( bubble ) {
+ jQuery.event.trigger( e, null, elem );
+ } else {
+ jQuery.event.dispatch.call( elem, e );
+ }
+ if ( e.isDefaultPrevented() ) {
+ event.preventDefault();
+ }
+ }
+};
+
+jQuery.removeEvent = document.removeEventListener ?
+ function( elem, type, handle ) {
+ if ( elem.removeEventListener ) {
+ elem.removeEventListener( type, handle, false );
+ }
+ } :
+ function( elem, type, handle ) {
+ var name = "on" + type;
+
+ if ( elem.detachEvent ) {
+
+ // #8545, #7054, preventing memory leaks for custom events in IE6-8
+ // detachEvent needed property on element, by name of that event, to properly expose it to GC
+ if ( typeof elem[ name ] === "undefined" ) {
+ elem[ name ] = null;
+ }
+
+ elem.detachEvent( name, handle );
+ }
+ };
+
+jQuery.Event = function( src, props ) {
+ // Allow instantiation without the 'new' keyword
+ if ( !(this instanceof jQuery.Event) ) {
+ return new jQuery.Event( src, props );
+ }
+
+ // Event object
+ if ( src && src.type ) {
+ this.originalEvent = src;
+ this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false ||
+ src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse;
+
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // Put explicitly provided properties onto the event object
+ if ( props ) {
+ jQuery.extend( this, props );
+ }
+
+ // Create a timestamp if incoming event doesn't have one
+ this.timeStamp = src && src.timeStamp || jQuery.now();
+
+ // Mark it as fixed
+ this[ jQuery.expando ] = true;
+};
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse,
+
+ preventDefault: function() {
+ var e = this.originalEvent;
+
+ this.isDefaultPrevented = returnTrue;
+ if ( !e ) {
+ return;
+ }
+
+ // If preventDefault exists, run it on the original event
+ if ( e.preventDefault ) {
+ e.preventDefault();
+
+ // Support: IE
+ // Otherwise set the returnValue property of the original event to false
+ } else {
+ e.returnValue = false;
+ }
+ },
+ stopPropagation: function() {
+ var e = this.originalEvent;
+
+ this.isPropagationStopped = returnTrue;
+ if ( !e ) {
+ return;
+ }
+ // If stopPropagation exists, run it on the original event
+ if ( e.stopPropagation ) {
+ e.stopPropagation();
+ }
+
+ // Support: IE
+ // Set the cancelBubble property of the original event to true
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation: function() {
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ }
+};
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+jQuery.each({
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+}, function( orig, fix ) {
+ jQuery.event.special[ orig ] = {
+ delegateType: fix,
+ bindType: fix,
+
+ handle: function( event ) {
+ var ret,
+ target = this,
+ related = event.relatedTarget,
+ handleObj = event.handleObj;
+
+ // For mousenter/leave call the handler if related is outside the target.
+ // NB: No relatedTarget if the mouse left/entered the browser window
+ if ( !related || (related !== target && !jQuery.contains( target, related )) ) {
+ event.type = handleObj.origType;
+ ret = handleObj.handler.apply( this, arguments );
+ event.type = fix;
+ }
+ return ret;
+ }
+ };
+});
+
+// IE submit delegation
+if ( !jQuery.support.submitBubbles ) {
+
+ jQuery.event.special.submit = {
+ setup: function() {
+ // Only need this for delegated form submit events
+ if ( jQuery.nodeName( this, "form" ) ) {
+ return false;
+ }
+
+ // Lazy-add a submit handler when a descendant form may potentially be submitted
+ jQuery.event.add( this, "click._submit keypress._submit", function( e ) {
+ // Node name check avoids a VML-related crash in IE (#9807)
+ var elem = e.target,
+ form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined;
+ if ( form && !jQuery._data( form, "submitBubbles" ) ) {
+ jQuery.event.add( form, "submit._submit", function( event ) {
+ event._submit_bubble = true;
+ });
+ jQuery._data( form, "submitBubbles", true );
+ }
+ });
+ // return undefined since we don't need an event listener
+ },
+
+ postDispatch: function( event ) {
+ // If form was submitted by the user, bubble the event up the tree
+ if ( event._submit_bubble ) {
+ delete event._submit_bubble;
+ if ( this.parentNode && !event.isTrigger ) {
+ jQuery.event.simulate( "submit", this.parentNode, event, true );
+ }
+ }
+ },
+
+ teardown: function() {
+ // Only need this for delegated form submit events
+ if ( jQuery.nodeName( this, "form" ) ) {
+ return false;
+ }
+
+ // Remove delegated handlers; cleanData eventually reaps submit handlers attached above
+ jQuery.event.remove( this, "._submit" );
+ }
+ };
+}
+
+// IE change delegation and checkbox/radio fix
+if ( !jQuery.support.changeBubbles ) {
+
+ jQuery.event.special.change = {
+
+ setup: function() {
+
+ if ( rformElems.test( this.nodeName ) ) {
+ // IE doesn't fire change on a check/radio until blur; trigger it on click
+ // after a propertychange. Eat the blur-change in special.change.handle.
+ // This still fires onchange a second time for check/radio after blur.
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ jQuery.event.add( this, "propertychange._change", function( event ) {
+ if ( event.originalEvent.propertyName === "checked" ) {
+ this._just_changed = true;
+ }
+ });
+ jQuery.event.add( this, "click._change", function( event ) {
+ if ( this._just_changed && !event.isTrigger ) {
+ this._just_changed = false;
+ }
+ // Allow triggered, simulated change events (#11500)
+ jQuery.event.simulate( "change", this, event, true );
+ });
+ }
+ return false;
+ }
+ // Delegated event; lazy-add a change handler on descendant inputs
+ jQuery.event.add( this, "beforeactivate._change", function( e ) {
+ var elem = e.target;
+
+ if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "changeBubbles" ) ) {
+ jQuery.event.add( elem, "change._change", function( event ) {
+ if ( this.parentNode && !event.isSimulated && !event.isTrigger ) {
+ jQuery.event.simulate( "change", this.parentNode, event, true );
+ }
+ });
+ jQuery._data( elem, "changeBubbles", true );
+ }
+ });
+ },
+
+ handle: function( event ) {
+ var elem = event.target;
+
+ // Swallow native change events from checkbox/radio, we already triggered them above
+ if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) {
+ return event.handleObj.handler.apply( this, arguments );
+ }
+ },
+
+ teardown: function() {
+ jQuery.event.remove( this, "._change" );
+
+ return !rformElems.test( this.nodeName );
+ }
+ };
+}
+
+// Create "bubbling" focus and blur events
+if ( !jQuery.support.focusinBubbles ) {
+ jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+ // Attach a single capturing handler while someone wants focusin/focusout
+ var attaches = 0,
+ handler = function( event ) {
+ jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true );
+ };
+
+ jQuery.event.special[ fix ] = {
+ setup: function() {
+ if ( attaches++ === 0 ) {
+ document.addEventListener( orig, handler, true );
+ }
+ },
+ teardown: function() {
+ if ( --attaches === 0 ) {
+ document.removeEventListener( orig, handler, true );
+ }
+ }
+ };
+ });
+}
+
+jQuery.fn.extend({
+
+ on: function( types, selector, data, fn, /*INTERNAL*/ one ) {
+ var origFn, type;
+
+ // Types can be a map of types/handlers
+ if ( typeof types === "object" ) {
+ // ( types-Object, selector, data )
+ if ( typeof selector !== "string" ) {
+ // ( types-Object, data )
+ data = data || selector;
+ selector = undefined;
+ }
+ for ( type in types ) {
+ this.on( type, selector, data, types[ type ], one );
+ }
+ return this;
+ }
+
+ if ( data == null && fn == null ) {
+ // ( types, fn )
+ fn = selector;
+ data = selector = undefined;
+ } else if ( fn == null ) {
+ if ( typeof selector === "string" ) {
+ // ( types, selector, fn )
+ fn = data;
+ data = undefined;
+ } else {
+ // ( types, data, fn )
+ fn = data;
+ data = selector;
+ selector = undefined;
+ }
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ } else if ( !fn ) {
+ return this;
+ }
+
+ if ( one === 1 ) {
+ origFn = fn;
+ fn = function( event ) {
+ // Can use an empty set, since event contains the info
+ jQuery().off( event );
+ return origFn.apply( this, arguments );
+ };
+ // Use same guid so caller can remove using origFn
+ fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+ }
+ return this.each( function() {
+ jQuery.event.add( this, types, fn, data, selector );
+ });
+ },
+ one: function( types, selector, data, fn ) {
+ return this.on( types, selector, data, fn, 1 );
+ },
+ off: function( types, selector, fn ) {
+ var handleObj, type;
+ if ( types && types.preventDefault && types.handleObj ) {
+ // ( event ) dispatched jQuery.Event
+ handleObj = types.handleObj;
+ jQuery( types.delegateTarget ).off(
+ handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
+ handleObj.selector,
+ handleObj.handler
+ );
+ return this;
+ }
+ if ( typeof types === "object" ) {
+ // ( types-object [, selector] )
+ for ( type in types ) {
+ this.off( type, selector, types[ type ] );
+ }
+ return this;
+ }
+ if ( selector === false || typeof selector === "function" ) {
+ // ( types [, fn] )
+ fn = selector;
+ selector = undefined;
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ }
+ return this.each(function() {
+ jQuery.event.remove( this, types, fn, selector );
+ });
+ },
+
+ bind: function( types, data, fn ) {
+ return this.on( types, null, data, fn );
+ },
+ unbind: function( types, fn ) {
+ return this.off( types, null, fn );
+ },
+
+ delegate: function( selector, types, data, fn ) {
+ return this.on( types, selector, data, fn );
+ },
+ undelegate: function( selector, types, fn ) {
+ // ( namespace ) or ( selector, types [, fn] )
+ return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn );
+ },
+
+ trigger: function( type, data ) {
+ return this.each(function() {
+ jQuery.event.trigger( type, data, this );
+ });
+ },
+ triggerHandler: function( type, data ) {
+ var elem = this[0];
+ if ( elem ) {
+ return jQuery.event.trigger( type, data, elem, true );
+ }
+ },
+
+ hover: function( fnOver, fnOut ) {
+ return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+ }
+});
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+ "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) {
+
+ // Handle event binding
+ jQuery.fn[ name ] = function( data, fn ) {
+ return arguments.length > 0 ?
+ this.on( name, null, data, fn ) :
+ this.trigger( name );
+ };
+
+ if ( rkeyEvent.test( name ) ) {
+ jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks;
+ }
+
+ if ( rmouseEvent.test( name ) ) {
+ jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks;
+ }
+});
+/*!
+ * Sizzle CSS Selector Engine
+ * Copyright 2012 jQuery Foundation and other contributors
+ * Released under the MIT license
+ * http://sizzlejs.com/
+ */
+(function( window, undefined ) {
+
+var i,
+ cachedruns,
+ Expr,
+ getText,
+ isXML,
+ compile,
+ hasDuplicate,
+ outermostContext,
+
+ // Local document vars
+ setDocument,
+ document,
+ docElem,
+ documentIsXML,
+ rbuggyQSA,
+ rbuggyMatches,
+ matches,
+ contains,
+ sortOrder,
+
+ // Instance-specific data
+ expando = "sizzle" + -(new Date()),
+ preferredDoc = window.document,
+ support = {},
+ dirruns = 0,
+ done = 0,
+ classCache = createCache(),
+ tokenCache = createCache(),
+ compilerCache = createCache(),
+
+ // General-purpose constants
+ strundefined = typeof undefined,
+ MAX_NEGATIVE = 1 << 31,
+
+ // Array methods
+ arr = [],
+ pop = arr.pop,
+ push = arr.push,
+ slice = arr.slice,
+ // Use a stripped-down indexOf if we can't use a native one
+ indexOf = arr.indexOf || function( elem ) {
+ var i = 0,
+ len = this.length;
+ for ( ; i < len; i++ ) {
+ if ( this[i] === elem ) {
+ return i;
+ }
+ }
+ return -1;
+ },
+
+
+ // Regular expressions
+
+ // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace
+ whitespace = "[\\x20\\t\\r\\n\\f]",
+ // http://www.w3.org/TR/css3-syntax/#characters
+ characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",
+
+ // Loosely modeled on CSS identifier characters
+ // An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors
+ // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
+ identifier = characterEncoding.replace( "w", "w#" ),
+
+ // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors
+ operators = "([*^$|!~]?=)",
+ attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace +
+ "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]",
+
+ // Prefer arguments quoted,
+ // then not containing pseudos/brackets,
+ // then attribute selectors/non-parenthetical expressions,
+ // then anything else
+ // These preferences are here to reduce the number of selectors
+ // needing tokenize in the PSEUDO preFilter
+ pseudos = ":(" + characterEncoding + ")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|" + attributes.replace( 3, 8 ) + ")*)|.*)\\)|)",
+
+ // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+ rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
+
+ rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+ rcombinators = new RegExp( "^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*" ),
+ rpseudo = new RegExp( pseudos ),
+ ridentifier = new RegExp( "^" + identifier + "$" ),
+
+ matchExpr = {
+ "ID": new RegExp( "^#(" + characterEncoding + ")" ),
+ "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ),
+ "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ),
+ "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ),
+ "ATTR": new RegExp( "^" + attributes ),
+ "PSEUDO": new RegExp( "^" + pseudos ),
+ "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
+ "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
+ "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+ // For use in libraries implementing .is()
+ // We use this for POS matching in `select`
+ "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
+ whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
+ },
+
+ rsibling = /[\x20\t\r\n\f]*[+~]/,
+
+ rnative = /\{\s*\[native code\]\s*\}/,
+
+ // Easily-parseable/retrievable ID or TAG or CLASS selectors
+ rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+ rinputs = /^(?:input|select|textarea|button)$/i,
+ rheader = /^h\d$/i,
+
+ rescape = /'|\\/g,
+ rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g,
+
+ // CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+ runescape = /\\([\da-fA-F]{1,6}[\x20\t\r\n\f]?|.)/g,
+ funescape = function( _, escaped ) {
+ var high = "0x" + escaped - 0x10000;
+ // NaN means non-codepoint
+ return high !== high ?
+ escaped :
+ // BMP codepoint
+ high < 0 ?
+ String.fromCharCode( high + 0x10000 ) :
+ // Supplemental Plane codepoint (surrogate pair)
+ String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
+ };
+
+// Use a stripped-down slice if we can't use a native one
+try {
+ slice.call( docElem.childNodes, 0 )[0].nodeType;
+} catch ( e ) {
+ slice = function( i ) {
+ var elem,
+ results = [];
+ for ( ; (elem = this[i]); i++ ) {
+ results.push( elem );
+ }
+ return results;
+ };
+}
+
+/**
+ * For feature detection
+ * @param {Function} fn The function to test for native support
+ */
+function isNative( fn ) {
+ return rnative.test( fn + "" );
+}
+
+/**
+ * Create key-value caches of limited size
+ * @returns {Function(string, Object)} Returns the Object data after storing it on itself with
+ * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ * deleting the oldest entry
+ */
+function createCache() {
+ var cache,
+ keys = [];
+
+ return (cache = function( key, value ) {
+ // Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
+ if ( keys.push( key += " " ) > Expr.cacheLength ) {
+ // Only keep the most recent entries
+ delete cache[ keys.shift() ];
+ }
+ return (cache[ key ] = value);
+ });
+}
+
+/**
+ * Mark a function for special use by Sizzle
+ * @param {Function} fn The function to mark
+ */
+function markFunction( fn ) {
+ fn[ expando ] = true;
+ return fn;
+}
+
+/**
+ * Support testing using an element
+ * @param {Function} fn Passed the created div and expects a boolean result
+ */
+function assert( fn ) {
+ var div = document.createElement("div");
+
+ try {
+ return fn( div );
+ } catch (e) {
+ return false;
+ } finally {
+ // release memory in IE
+ div = null;
+ }
+}
+
+function Sizzle( selector, context, results, seed ) {
+ var match, elem, m, nodeType,
+ // QSA vars
+ i, groups, old, nid, newContext, newSelector;
+
+ if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {
+ setDocument( context );
+ }
+
+ context = context || document;
+ results = results || [];
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ if ( (nodeType = context.nodeType) !== 1 && nodeType !== 9 ) {
+ return [];
+ }
+
+ if ( !documentIsXML && !seed ) {
+
+ // Shortcuts
+ if ( (match = rquickExpr.exec( selector )) ) {
+ // Speed-up: Sizzle("#ID")
+ if ( (m = match[1]) ) {
+ if ( nodeType === 9 ) {
+ elem = context.getElementById( m );
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE, Opera, and Webkit return items
+ // by name instead of ID
+ if ( elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ } else {
+ return results;
+ }
+ } else {
+ // Context is not a document
+ if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) &&
+ contains( context, elem ) && elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ }
+
+ // Speed-up: Sizzle("TAG")
+ } else if ( match[2] ) {
+ push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) );
+ return results;
+
+ // Speed-up: Sizzle(".CLASS")
+ } else if ( (m = match[3]) && support.getByClassName && context.getElementsByClassName ) {
+ push.apply( results, slice.call(context.getElementsByClassName( m ), 0) );
+ return results;
+ }
+ }
+
+ // QSA path
+ if ( support.qsa && !rbuggyQSA.test(selector) ) {
+ old = true;
+ nid = expando;
+ newContext = context;
+ newSelector = nodeType === 9 && selector;
+
+ // qSA works strangely on Element-rooted queries
+ // We can work around this by specifying an extra ID on the root
+ // and working up from there (Thanks to Andrew Dupont for the technique)
+ // IE 8 doesn't work on object elements
+ if ( nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
+ groups = tokenize( selector );
+
+ if ( (old = context.getAttribute("id")) ) {
+ nid = old.replace( rescape, "\\$&" );
+ } else {
+ context.setAttribute( "id", nid );
+ }
+ nid = "[id='" + nid + "'] ";
+
+ i = groups.length;
+ while ( i-- ) {
+ groups[i] = nid + toSelector( groups[i] );
+ }
+ newContext = rsibling.test( selector ) && context.parentNode || context;
+ newSelector = groups.join(",");
+ }
+
+ if ( newSelector ) {
+ try {
+ push.apply( results, slice.call( newContext.querySelectorAll(
+ newSelector
+ ), 0 ) );
+ return results;
+ } catch(qsaError) {
+ } finally {
+ if ( !old ) {
+ context.removeAttribute("id");
+ }
+ }
+ }
+ }
+ }
+
+ // All others
+ return select( selector.replace( rtrim, "$1" ), context, results, seed );
+}
+
+/**
+ * Detect xml
+ * @param {Element|Object} elem An element or a document
+ */
+isXML = Sizzle.isXML = function( elem ) {
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = elem && (elem.ownerDocument || elem).documentElement;
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+/**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [doc] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+setDocument = Sizzle.setDocument = function( node ) {
+ var doc = node ? node.ownerDocument || node : preferredDoc;
+
+ // If no document and documentElement is available, return
+ if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {
+ return document;
+ }
+
+ // Set our document
+ document = doc;
+ docElem = doc.documentElement;
+
+ // Support tests
+ documentIsXML = isXML( doc );
+
+ // Check if getElementsByTagName("*") returns only elements
+ support.tagNameNoComments = assert(function( div ) {
+ div.appendChild( doc.createComment("") );
+ return !div.getElementsByTagName("*").length;
+ });
+
+ // Check if attributes should be retrieved by attribute nodes
+ support.attributes = assert(function( div ) {
+ div.innerHTML = "<select></select>";
+ var type = typeof div.lastChild.getAttribute("multiple");
+ // IE8 returns a string for some attributes even when not present
+ return type !== "boolean" && type !== "string";
+ });
+
+ // Check if getElementsByClassName can be trusted
+ support.getByClassName = assert(function( div ) {
+ // Opera can't find a second classname (in 9.6)
+ div.innerHTML = "<div class='hidden e'></div><div class='hidden'></div>";
+ if ( !div.getElementsByClassName || !div.getElementsByClassName("e").length ) {
+ return false;
+ }
+
+ // Safari 3.2 caches class attributes and doesn't catch changes
+ div.lastChild.className = "e";
+ return div.getElementsByClassName("e").length === 2;
+ });
+
+ // Check if getElementById returns elements by name
+ // Check if getElementsByName privileges form controls or returns elements by ID
+ support.getByName = assert(function( div ) {
+ // Inject content
+ div.id = expando + 0;
+ div.innerHTML = "<a name='" + expando + "'></a><div name='" + expando + "'></div>";
+ docElem.insertBefore( div, docElem.firstChild );
+
+ // Test
+ var pass = doc.getElementsByName &&
+ // buggy browsers will return fewer than the correct 2
+ doc.getElementsByName( expando ).length === 2 +
+ // buggy browsers will return more than the correct 0
+ doc.getElementsByName( expando + 0 ).length;
+ support.getIdNotName = !doc.getElementById( expando );
+
+ // Cleanup
+ docElem.removeChild( div );
+
+ return pass;
+ });
+
+ // IE6/7 return modified attributes
+ Expr.attrHandle = assert(function( div ) {
+ div.innerHTML = "<a href='#'></a>";
+ return div.firstChild && typeof div.firstChild.getAttribute !== strundefined &&
+ div.firstChild.getAttribute("href") === "#";
+ }) ?
+ {} :
+ {
+ "href": function( elem ) {
+ return elem.getAttribute( "href", 2 );
+ },
+ "type": function( elem ) {
+ return elem.getAttribute("type");
+ }
+ };
+
+ // ID find and filter
+ if ( support.getIdNotName ) {
+ Expr.find["ID"] = function( id, context ) {
+ if ( typeof context.getElementById !== strundefined && !documentIsXML ) {
+ var m = context.getElementById( id );
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ return m && m.parentNode ? [m] : [];
+ }
+ };
+ Expr.filter["ID"] = function( id ) {
+ var attrId = id.replace( runescape, funescape );
+ return function( elem ) {
+ return elem.getAttribute("id") === attrId;
+ };
+ };
+ } else {
+ Expr.find["ID"] = function( id, context ) {
+ if ( typeof context.getElementById !== strundefined && !documentIsXML ) {
+ var m = context.getElementById( id );
+
+ return m ?
+ m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ?
+ [m] :
+ undefined :
+ [];
+ }
+ };
+ Expr.filter["ID"] = function( id ) {
+ var attrId = id.replace( runescape, funescape );
+ return function( elem ) {
+ var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id");
+ return node && node.value === attrId;
+ };
+ };
+ }
+
+ // Tag
+ Expr.find["TAG"] = support.tagNameNoComments ?
+ function( tag, context ) {
+ if ( typeof context.getElementsByTagName !== strundefined ) {
+ return context.getElementsByTagName( tag );
+ }
+ } :
+ function( tag, context ) {
+ var elem,
+ tmp = [],
+ i = 0,
+ results = context.getElementsByTagName( tag );
+
+ // Filter out possible comments
+ if ( tag === "*" ) {
+ for ( ; (elem = results[i]); i++ ) {
+ if ( elem.nodeType === 1 ) {
+ tmp.push( elem );
+ }
+ }
+
+ return tmp;
+ }
+ return results;
+ };
+
+ // Name
+ Expr.find["NAME"] = support.getByName && function( tag, context ) {
+ if ( typeof context.getElementsByName !== strundefined ) {
+ return context.getElementsByName( name );
+ }
+ };
+
+ // Class
+ Expr.find["CLASS"] = support.getByClassName && function( className, context ) {
+ if ( typeof context.getElementsByClassName !== strundefined && !documentIsXML ) {
+ return context.getElementsByClassName( className );
+ }
+ };
+
+ // QSA and matchesSelector support
+
+ // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+ rbuggyMatches = [];
+
+ // qSa(:focus) reports false when true (Chrome 21),
+ // no need to also add to buggyMatches since matches checks buggyQSA
+ // A support test would require too much code (would include document ready)
+ rbuggyQSA = [ ":focus" ];
+
+ if ( (support.qsa = isNative(doc.querySelectorAll)) ) {
+ // Build QSA regex
+ // Regex strategy adopted from Diego Perini
+ assert(function( div ) {
+ // Select is set to empty string on purpose
+ // This is to test IE's treatment of not explictly
+ // setting a boolean content attribute,
+ // since its presence should be enough
+ // http://bugs.jquery.com/ticket/12359
+ div.innerHTML = "<select><option selected=''></option></select>";
+
+ // IE8 - Some boolean attributes are not treated correctly
+ if ( !div.querySelectorAll("[selected]").length ) {
+ rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" );
+ }
+
+ // Webkit/Opera - :checked should return selected option elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ // IE8 throws error here and will not see later tests
+ if ( !div.querySelectorAll(":checked").length ) {
+ rbuggyQSA.push(":checked");
+ }
+ });
+
+ assert(function( div ) {
+
+ // Opera 10-12/IE8 - ^= $= *= and empty values
+ // Should not select anything
+ div.innerHTML = "<input type='hidden' i=''/>";
+ if ( div.querySelectorAll("[i^='']").length ) {
+ rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" );
+ }
+
+ // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+ // IE8 throws error here and will not see later tests
+ if ( !div.querySelectorAll(":enabled").length ) {
+ rbuggyQSA.push( ":enabled", ":disabled" );
+ }
+
+ // Opera 10-11 does not throw on post-comma invalid pseudos
+ div.querySelectorAll("*,:x");
+ rbuggyQSA.push(",.*:");
+ });
+ }
+
+ if ( (support.matchesSelector = isNative( (matches = docElem.matchesSelector ||
+ docElem.mozMatchesSelector ||
+ docElem.webkitMatchesSelector ||
+ docElem.oMatchesSelector ||
+ docElem.msMatchesSelector) )) ) {
+
+ assert(function( div ) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9)
+ support.disconnectedMatch = matches.call( div, "div" );
+
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ matches.call( div, "[s!='']:x" );
+ rbuggyMatches.push( "!=", pseudos );
+ });
+ }
+
+ rbuggyQSA = new RegExp( rbuggyQSA.join("|") );
+ rbuggyMatches = new RegExp( rbuggyMatches.join("|") );
+
+ // Element contains another
+ // Purposefully does not implement inclusive descendent
+ // As in, an element does not contain itself
+ contains = isNative(docElem.contains) || docElem.compareDocumentPosition ?
+ function( a, b ) {
+ var adown = a.nodeType === 9 ? a.documentElement : a,
+ bup = b && b.parentNode;
+ return a === bup || !!( bup && bup.nodeType === 1 && (
+ adown.contains ?
+ adown.contains( bup ) :
+ a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
+ ));
+ } :
+ function( a, b ) {
+ if ( b ) {
+ while ( (b = b.parentNode) ) {
+ if ( b === a ) {
+ return true;
+ }
+ }
+ }
+ return false;
+ };
+
+ // Document order sorting
+ sortOrder = docElem.compareDocumentPosition ?
+ function( a, b ) {
+ var compare;
+
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ if ( (compare = b.compareDocumentPosition && a.compareDocumentPosition && a.compareDocumentPosition( b )) ) {
+ if ( compare & 1 || a.parentNode && a.parentNode.nodeType === 11 ) {
+ if ( a === doc || contains( preferredDoc, a ) ) {
+ return -1;
+ }
+ if ( b === doc || contains( preferredDoc, b ) ) {
+ return 1;
+ }
+ return 0;
+ }
+ return compare & 4 ? -1 : 1;
+ }
+
+ return a.compareDocumentPosition ? -1 : 1;
+ } :
+ function( a, b ) {
+ var cur,
+ i = 0,
+ aup = a.parentNode,
+ bup = b.parentNode,
+ ap = [ a ],
+ bp = [ b ];
+
+ // The nodes are identical, we can exit early
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+
+ // Fallback to using sourceIndex (in IE) if it's available on both nodes
+ } else if ( a.sourceIndex && b.sourceIndex ) {
+ return ( ~b.sourceIndex || MAX_NEGATIVE ) - ( contains( preferredDoc, a ) && ~a.sourceIndex || MAX_NEGATIVE );
+
+ // Parentless nodes are either documents or disconnected
+ } else if ( !aup || !bup ) {
+ return a === doc ? -1 :
+ b === doc ? 1 :
+ aup ? -1 :
+ bup ? 1 :
+ 0;
+
+ // If the nodes are siblings, we can do a quick check
+ } else if ( aup === bup ) {
+ return siblingCheck( a, b );
+ }
+
+ // Otherwise we need full lists of their ancestors for comparison
+ cur = a;
+ while ( (cur = cur.parentNode) ) {
+ ap.unshift( cur );
+ }
+ cur = b;
+ while ( (cur = cur.parentNode) ) {
+ bp.unshift( cur );
+ }
+
+ // Walk down the tree looking for a discrepancy
+ while ( ap[i] === bp[i] ) {
+ i++;
+ }
+
+ return i ?
+ // Do a sibling check if the nodes have a common ancestor
+ siblingCheck( ap[i], bp[i] ) :
+
+ // Otherwise nodes in our document sort first
+ ap[i] === preferredDoc ? -1 :
+ bp[i] === preferredDoc ? 1 :
+ 0;
+ };
+
+ // Always assume the presence of duplicates if sort doesn't
+ // pass them to our comparison function (as in Google Chrome).
+ hasDuplicate = false;
+ [0, 0].sort( sortOrder );
+ support.detectDuplicates = hasDuplicate;
+
+ return document;
+};
+
+Sizzle.matches = function( expr, elements ) {
+ return Sizzle( expr, null, null, elements );
+};
+
+Sizzle.matchesSelector = function( elem, expr ) {
+ // Set document vars if needed
+ if ( ( elem.ownerDocument || elem ) !== document ) {
+ setDocument( elem );
+ }
+
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace( rattributeQuotes, "='$1']" );
+
+ // rbuggyQSA always contains :focus, so no need for an existence check
+ if ( support.matchesSelector && !documentIsXML && (!rbuggyMatches || !rbuggyMatches.test(expr)) && !rbuggyQSA.test(expr) ) {
+ try {
+ var ret = matches.call( elem, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || support.disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9
+ elem.document && elem.document.nodeType !== 11 ) {
+ return ret;
+ }
+ } catch(e) {}
+ }
+
+ return Sizzle( expr, document, null, [elem] ).length > 0;
+};
+
+Sizzle.contains = function( context, elem ) {
+ // Set document vars if needed
+ if ( ( context.ownerDocument || context ) !== document ) {
+ setDocument( context );
+ }
+ return contains( context, elem );
+};
+
+Sizzle.attr = function( elem, name ) {
+ var val;
+
+ // Set document vars if needed
+ if ( ( elem.ownerDocument || elem ) !== document ) {
+ setDocument( elem );
+ }
+
+ if ( !documentIsXML ) {
+ name = name.toLowerCase();
+ }
+ if ( (val = Expr.attrHandle[ name ]) ) {
+ return val( elem );
+ }
+ if ( documentIsXML || support.attributes ) {
+ return elem.getAttribute( name );
+ }
+ return ( (val = elem.getAttributeNode( name )) || elem.getAttribute( name ) ) && elem[ name ] === true ?
+ name :
+ val && val.specified ? val.value : null;
+};
+
+Sizzle.error = function( msg ) {
+ throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+// Document sorting and removing duplicates
+Sizzle.uniqueSort = function( results ) {
+ var elem,
+ duplicates = [],
+ i = 1,
+ j = 0;
+
+ // Unless we *know* we can detect duplicates, assume their presence
+ hasDuplicate = !support.detectDuplicates;
+ results.sort( sortOrder );
+
+ if ( hasDuplicate ) {
+ for ( ; (elem = results[i]); i++ ) {
+ if ( elem === results[ i - 1 ] ) {
+ j = duplicates.push( i );
+ }
+ }
+ while ( j-- ) {
+ results.splice( duplicates[ j ], 1 );
+ }
+ }
+
+ return results;
+};
+
+function siblingCheck( a, b ) {
+ var cur = a && b && a.nextSibling;
+
+ for ( ; cur; cur = cur.nextSibling ) {
+ if ( cur === b ) {
+ return -1;
+ }
+ }
+
+ return a ? 1 : -1;
+}
+
+// Returns a function to use in pseudos for input types
+function createInputPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === type;
+ };
+}
+
+// Returns a function to use in pseudos for buttons
+function createButtonPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && elem.type === type;
+ };
+}
+
+// Returns a function to use in pseudos for positionals
+function createPositionalPseudo( fn ) {
+ return markFunction(function( argument ) {
+ argument = +argument;
+ return markFunction(function( seed, matches ) {
+ var j,
+ matchIndexes = fn( [], seed.length, argument ),
+ i = matchIndexes.length;
+
+ // Match elements found at the specified indexes
+ while ( i-- ) {
+ if ( seed[ (j = matchIndexes[i]) ] ) {
+ seed[j] = !(matches[j] = seed[j]);
+ }
+ }
+ });
+ });
+}
+
+/**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+getText = Sizzle.getText = function( elem ) {
+ var node,
+ ret = "",
+ i = 0,
+ nodeType = elem.nodeType;
+
+ if ( !nodeType ) {
+ // If no nodeType, this is expected to be an array
+ for ( ; (node = elem[i]); i++ ) {
+ // Do not traverse comment nodes
+ ret += getText( node );
+ }
+ } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
+ // Use textContent for elements
+ // innerText usage removed for consistency of new lines (see #11153)
+ if ( typeof elem.textContent === "string" ) {
+ return elem.textContent;
+ } else {
+ // Traverse its children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ ret += getText( elem );
+ }
+ }
+ } else if ( nodeType === 3 || nodeType === 4 ) {
+ return elem.nodeValue;
+ }
+ // Do not include comment or processing instruction nodes
+
+ return ret;
+};
+
+Expr = Sizzle.selectors = {
+
+ // Can be adjusted by the user
+ cacheLength: 50,
+
+ createPseudo: markFunction,
+
+ match: matchExpr,
+
+ find: {},
+
+ relative: {
+ ">": { dir: "parentNode", first: true },
+ " ": { dir: "parentNode" },
+ "+": { dir: "previousSibling", first: true },
+ "~": { dir: "previousSibling" }
+ },
+
+ preFilter: {
+ "ATTR": function( match ) {
+ match[1] = match[1].replace( runescape, funescape );
+
+ // Move the given value to match[3] whether quoted or unquoted
+ match[3] = ( match[4] || match[5] || "" ).replace( runescape, funescape );
+
+ if ( match[2] === "~=" ) {
+ match[3] = " " + match[3] + " ";
+ }
+
+ return match.slice( 0, 4 );
+ },
+
+ "CHILD": function( match ) {
+ /* matches from matchExpr["CHILD"]
+ 1 type (only|nth|...)
+ 2 what (child|of-type)
+ 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+ 4 xn-component of xn+y argument ([+-]?\d*n|)
+ 5 sign of xn-component
+ 6 x of xn-component
+ 7 sign of y-component
+ 8 y of y-component
+ */
+ match[1] = match[1].toLowerCase();
+
+ if ( match[1].slice( 0, 3 ) === "nth" ) {
+ // nth-* requires argument
+ if ( !match[3] ) {
+ Sizzle.error( match[0] );
+ }
+
+ // numeric x and y parameters for Expr.filter.CHILD
+ // remember that false/true cast respectively to 0/1
+ match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) );
+ match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" );
+
+ // other types prohibit arguments
+ } else if ( match[3] ) {
+ Sizzle.error( match[0] );
+ }
+
+ return match;
+ },
+
+ "PSEUDO": function( match ) {
+ var excess,
+ unquoted = !match[5] && match[2];
+
+ if ( matchExpr["CHILD"].test( match[0] ) ) {
+ return null;
+ }
+
+ // Accept quoted arguments as-is
+ if ( match[4] ) {
+ match[2] = match[4];
+
+ // Strip excess characters from unquoted arguments
+ } else if ( unquoted && rpseudo.test( unquoted ) &&
+ // Get excess from tokenize (recursively)
+ (excess = tokenize( unquoted, true )) &&
+ // advance to the next closing parenthesis
+ (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) {
+
+ // excess is a negative index
+ match[0] = match[0].slice( 0, excess );
+ match[2] = unquoted.slice( 0, excess );
+ }
+
+ // Return only captures needed by the pseudo filter method (type and argument)
+ return match.slice( 0, 3 );
+ }
+ },
+
+ filter: {
+
+ "TAG": function( nodeName ) {
+ if ( nodeName === "*" ) {
+ return function() { return true; };
+ }
+
+ nodeName = nodeName.replace( runescape, funescape ).toLowerCase();
+ return function( elem ) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+ };
+ },
+
+ "CLASS": function( className ) {
+ var pattern = classCache[ className + " " ];
+
+ return pattern ||
+ (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) &&
+ classCache( className, function( elem ) {
+ return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" );
+ });
+ },
+
+ "ATTR": function( name, operator, check ) {
+ return function( elem ) {
+ var result = Sizzle.attr( elem, name );
+
+ if ( result == null ) {
+ return operator === "!=";
+ }
+ if ( !operator ) {
+ return true;
+ }
+
+ result += "";
+
+ return operator === "=" ? result === check :
+ operator === "!=" ? result !== check :
+ operator === "^=" ? check && result.indexOf( check ) === 0 :
+ operator === "*=" ? check && result.indexOf( check ) > -1 :
+ operator === "$=" ? check && result.substr( result.length - check.length ) === check :
+ operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 :
+ operator === "|=" ? result === check || result.substr( 0, check.length + 1 ) === check + "-" :
+ false;
+ };
+ },
+
+ "CHILD": function( type, what, argument, first, last ) {
+ var simple = type.slice( 0, 3 ) !== "nth",
+ forward = type.slice( -4 ) !== "last",
+ ofType = what === "of-type";
+
+ return first === 1 && last === 0 ?
+
+ // Shortcut for :nth-*(n)
+ function( elem ) {
+ return !!elem.parentNode;
+ } :
+
+ function( elem, context, xml ) {
+ var cache, outerCache, node, diff, nodeIndex, start,
+ dir = simple !== forward ? "nextSibling" : "previousSibling",
+ parent = elem.parentNode,
+ name = ofType && elem.nodeName.toLowerCase(),
+ useCache = !xml && !ofType;
+
+ if ( parent ) {
+
+ // :(first|last|only)-(child|of-type)
+ if ( simple ) {
+ while ( dir ) {
+ node = elem;
+ while ( (node = node[ dir ]) ) {
+ if ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) {
+ return false;
+ }
+ }
+ // Reverse direction for :only-* (if we haven't yet done so)
+ start = dir = type === "only" && !start && "nextSibling";
+ }
+ return true;
+ }
+
+ start = [ forward ? parent.firstChild : parent.lastChild ];
+
+ // non-xml :nth-child(...) stores cache data on `parent`
+ if ( forward && useCache ) {
+ // Seek `elem` from a previously-cached index
+ outerCache = parent[ expando ] || (parent[ expando ] = {});
+ cache = outerCache[ type ] || [];
+ nodeIndex = cache[0] === dirruns && cache[1];
+ diff = cache[0] === dirruns && cache[2];
+ node = nodeIndex && parent.childNodes[ nodeIndex ];
+
+ while ( (node = ++nodeIndex && node && node[ dir ] ||
+
+ // Fallback to seeking `elem` from the start
+ (diff = nodeIndex = 0) || start.pop()) ) {
+
+ // When found, cache indexes on `parent` and break
+ if ( node.nodeType === 1 && ++diff && node === elem ) {
+ outerCache[ type ] = [ dirruns, nodeIndex, diff ];
+ break;
+ }
+ }
+
+ // Use previously-cached element index if available
+ } else if ( useCache && (cache = (elem[ expando ] || (elem[ expando ] = {}))[ type ]) && cache[0] === dirruns ) {
+ diff = cache[1];
+
+ // xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...)
+ } else {
+ // Use the same loop as above to seek `elem` from the start
+ while ( (node = ++nodeIndex && node && node[ dir ] ||
+ (diff = nodeIndex = 0) || start.pop()) ) {
+
+ if ( ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff ) {
+ // Cache the index of each encountered element
+ if ( useCache ) {
+ (node[ expando ] || (node[ expando ] = {}))[ type ] = [ dirruns, diff ];
+ }
+
+ if ( node === elem ) {
+ break;
+ }
+ }
+ }
+ }
+
+ // Incorporate the offset, then check against cycle size
+ diff -= last;
+ return diff === first || ( diff % first === 0 && diff / first >= 0 );
+ }
+ };
+ },
+
+ "PSEUDO": function( pseudo, argument ) {
+ // pseudo-class names are case-insensitive
+ // http://www.w3.org/TR/selectors/#pseudo-classes
+ // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+ // Remember that setFilters inherits from pseudos
+ var args,
+ fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+ Sizzle.error( "unsupported pseudo: " + pseudo );
+
+ // The user may use createPseudo to indicate that
+ // arguments are needed to create the filter function
+ // just as Sizzle does
+ if ( fn[ expando ] ) {
+ return fn( argument );
+ }
+
+ // But maintain support for old signatures
+ if ( fn.length > 1 ) {
+ args = [ pseudo, pseudo, "", argument ];
+ return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+ markFunction(function( seed, matches ) {
+ var idx,
+ matched = fn( seed, argument ),
+ i = matched.length;
+ while ( i-- ) {
+ idx = indexOf.call( seed, matched[i] );
+ seed[ idx ] = !( matches[ idx ] = matched[i] );
+ }
+ }) :
+ function( elem ) {
+ return fn( elem, 0, args );
+ };
+ }
+
+ return fn;
+ }
+ },
+
+ pseudos: {
+ // Potentially complex pseudos
+ "not": markFunction(function( selector ) {
+ // Trim the selector passed to compile
+ // to avoid treating leading and trailing
+ // spaces as combinators
+ var input = [],
+ results = [],
+ matcher = compile( selector.replace( rtrim, "$1" ) );
+
+ return matcher[ expando ] ?
+ markFunction(function( seed, matches, context, xml ) {
+ var elem,
+ unmatched = matcher( seed, null, xml, [] ),
+ i = seed.length;
+
+ // Match elements unmatched by `matcher`
+ while ( i-- ) {
+ if ( (elem = unmatched[i]) ) {
+ seed[i] = !(matches[i] = elem);
+ }
+ }
+ }) :
+ function( elem, context, xml ) {
+ input[0] = elem;
+ matcher( input, null, xml, results );
+ return !results.pop();
+ };
+ }),
+
+ "has": markFunction(function( selector ) {
+ return function( elem ) {
+ return Sizzle( selector, elem ).length > 0;
+ };
+ }),
+
+ "contains": markFunction(function( text ) {
+ return function( elem ) {
+ return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
+ };
+ }),
+
+ // "Whether an element is represented by a :lang() selector
+ // is based solely on the element's language value
+ // being equal to the identifier C,
+ // or beginning with the identifier C immediately followed by "-".
+ // The matching of C against the element's language value is performed case-insensitively.
+ // The identifier C does not have to be a valid language name."
+ // http://www.w3.org/TR/selectors/#lang-pseudo
+ "lang": markFunction( function( lang ) {
+ // lang value must be a valid identifider
+ if ( !ridentifier.test(lang || "") ) {
+ Sizzle.error( "unsupported lang: " + lang );
+ }
+ lang = lang.replace( runescape, funescape ).toLowerCase();
+ return function( elem ) {
+ var elemLang;
+ do {
+ if ( (elemLang = documentIsXML ?
+ elem.getAttribute("xml:lang") || elem.getAttribute("lang") :
+ elem.lang) ) {
+
+ elemLang = elemLang.toLowerCase();
+ return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
+ }
+ } while ( (elem = elem.parentNode) && elem.nodeType === 1 );
+ return false;
+ };
+ }),
+
+ // Miscellaneous
+ "target": function( elem ) {
+ var hash = window.location && window.location.hash;
+ return hash && hash.slice( 1 ) === elem.id;
+ },
+
+ "root": function( elem ) {
+ return elem === docElem;
+ },
+
+ "focus": function( elem ) {
+ return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
+ },
+
+ // Boolean properties
+ "enabled": function( elem ) {
+ return elem.disabled === false;
+ },
+
+ "disabled": function( elem ) {
+ return elem.disabled === true;
+ },
+
+ "checked": function( elem ) {
+ // In CSS3, :checked should return both checked and selected elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ var nodeName = elem.nodeName.toLowerCase();
+ return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
+ },
+
+ "selected": function( elem ) {
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if ( elem.parentNode ) {
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ // Contents
+ "empty": function( elem ) {
+ // http://www.w3.org/TR/selectors/#empty-pseudo
+ // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)),
+ // not comment, processing instructions, or others
+ // Thanks to Diego Perini for the nodeName shortcut
+ // Greater than "@" means alpha characters (specifically not starting with "#" or "?")
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ if ( elem.nodeName > "@" || elem.nodeType === 3 || elem.nodeType === 4 ) {
+ return false;
+ }
+ }
+ return true;
+ },
+
+ "parent": function( elem ) {
+ return !Expr.pseudos["empty"]( elem );
+ },
+
+ // Element/input types
+ "header": function( elem ) {
+ return rheader.test( elem.nodeName );
+ },
+
+ "input": function( elem ) {
+ return rinputs.test( elem.nodeName );
+ },
+
+ "button": function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === "button" || name === "button";
+ },
+
+ "text": function( elem ) {
+ var attr;
+ // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
+ // use getAttribute instead to test this case
+ return elem.nodeName.toLowerCase() === "input" &&
+ elem.type === "text" &&
+ ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === elem.type );
+ },
+
+ // Position-in-collection
+ "first": createPositionalPseudo(function() {
+ return [ 0 ];
+ }),
+
+ "last": createPositionalPseudo(function( matchIndexes, length ) {
+ return [ length - 1 ];
+ }),
+
+ "eq": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ return [ argument < 0 ? argument + length : argument ];
+ }),
+
+ "even": createPositionalPseudo(function( matchIndexes, length ) {
+ var i = 0;
+ for ( ; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "odd": createPositionalPseudo(function( matchIndexes, length ) {
+ var i = 1;
+ for ( ; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "lt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ var i = argument < 0 ? argument + length : argument;
+ for ( ; --i >= 0; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "gt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ var i = argument < 0 ? argument + length : argument;
+ for ( ; ++i < length; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ })
+ }
+};
+
+// Add button/input type pseudos
+for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
+ Expr.pseudos[ i ] = createInputPseudo( i );
+}
+for ( i in { submit: true, reset: true } ) {
+ Expr.pseudos[ i ] = createButtonPseudo( i );
+}
+
+function tokenize( selector, parseOnly ) {
+ var matched, match, tokens, type,
+ soFar, groups, preFilters,
+ cached = tokenCache[ selector + " " ];
+
+ if ( cached ) {
+ return parseOnly ? 0 : cached.slice( 0 );
+ }
+
+ soFar = selector;
+ groups = [];
+ preFilters = Expr.preFilter;
+
+ while ( soFar ) {
+
+ // Comma and first run
+ if ( !matched || (match = rcomma.exec( soFar )) ) {
+ if ( match ) {
+ // Don't consume trailing commas as valid
+ soFar = soFar.slice( match[0].length ) || soFar;
+ }
+ groups.push( tokens = [] );
+ }
+
+ matched = false;
+
+ // Combinators
+ if ( (match = rcombinators.exec( soFar )) ) {
+ matched = match.shift();
+ tokens.push( {
+ value: matched,
+ // Cast descendant combinators to space
+ type: match[0].replace( rtrim, " " )
+ } );
+ soFar = soFar.slice( matched.length );
+ }
+
+ // Filters
+ for ( type in Expr.filter ) {
+ if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
+ (match = preFilters[ type ]( match ))) ) {
+ matched = match.shift();
+ tokens.push( {
+ value: matched,
+ type: type,
+ matches: match
+ } );
+ soFar = soFar.slice( matched.length );
+ }
+ }
+
+ if ( !matched ) {
+ break;
+ }
+ }
+
+ // Return the length of the invalid excess
+ // if we're just parsing
+ // Otherwise, throw an error or return tokens
+ return parseOnly ?
+ soFar.length :
+ soFar ?
+ Sizzle.error( selector ) :
+ // Cache the tokens
+ tokenCache( selector, groups ).slice( 0 );
+}
+
+function toSelector( tokens ) {
+ var i = 0,
+ len = tokens.length,
+ selector = "";
+ for ( ; i < len; i++ ) {
+ selector += tokens[i].value;
+ }
+ return selector;
+}
+
+function addCombinator( matcher, combinator, base ) {
+ var dir = combinator.dir,
+ checkNonElements = base && combinator.dir === "parentNode",
+ doneName = done++;
+
+ return combinator.first ?
+ // Check against closest ancestor/preceding element
+ function( elem, context, xml ) {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ return matcher( elem, context, xml );
+ }
+ }
+ } :
+
+ // Check against all ancestor/preceding elements
+ function( elem, context, xml ) {
+ var data, cache, outerCache,
+ dirkey = dirruns + " " + doneName;
+
+ // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching
+ if ( xml ) {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ if ( matcher( elem, context, xml ) ) {
+ return true;
+ }
+ }
+ }
+ } else {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ outerCache = elem[ expando ] || (elem[ expando ] = {});
+ if ( (cache = outerCache[ dir ]) && cache[0] === dirkey ) {
+ if ( (data = cache[1]) === true || data === cachedruns ) {
+ return data === true;
+ }
+ } else {
+ cache = outerCache[ dir ] = [ dirkey ];
+ cache[1] = matcher( elem, context, xml ) || cachedruns;
+ if ( cache[1] === true ) {
+ return true;
+ }
+ }
+ }
+ }
+ }
+ };
+}
+
+function elementMatcher( matchers ) {
+ return matchers.length > 1 ?
+ function( elem, context, xml ) {
+ var i = matchers.length;
+ while ( i-- ) {
+ if ( !matchers[i]( elem, context, xml ) ) {
+ return false;
+ }
+ }
+ return true;
+ } :
+ matchers[0];
+}
+
+function condense( unmatched, map, filter, context, xml ) {
+ var elem,
+ newUnmatched = [],
+ i = 0,
+ len = unmatched.length,
+ mapped = map != null;
+
+ for ( ; i < len; i++ ) {
+ if ( (elem = unmatched[i]) ) {
+ if ( !filter || filter( elem, context, xml ) ) {
+ newUnmatched.push( elem );
+ if ( mapped ) {
+ map.push( i );
+ }
+ }
+ }
+ }
+
+ return newUnmatched;
+}
+
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+ if ( postFilter && !postFilter[ expando ] ) {
+ postFilter = setMatcher( postFilter );
+ }
+ if ( postFinder && !postFinder[ expando ] ) {
+ postFinder = setMatcher( postFinder, postSelector );
+ }
+ return markFunction(function( seed, results, context, xml ) {
+ var temp, i, elem,
+ preMap = [],
+ postMap = [],
+ preexisting = results.length,
+
+ // Get initial elements from seed or context
+ elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ),
+
+ // Prefilter to get matcher input, preserving a map for seed-results synchronization
+ matcherIn = preFilter && ( seed || !selector ) ?
+ condense( elems, preMap, preFilter, context, xml ) :
+ elems,
+
+ matcherOut = matcher ?
+ // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
+ postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+ // ...intermediate processing is necessary
+ [] :
+
+ // ...otherwise use results directly
+ results :
+ matcherIn;
+
+ // Find primary matches
+ if ( matcher ) {
+ matcher( matcherIn, matcherOut, context, xml );
+ }
+
+ // Apply postFilter
+ if ( postFilter ) {
+ temp = condense( matcherOut, postMap );
+ postFilter( temp, [], context, xml );
+
+ // Un-match failing elements by moving them back to matcherIn
+ i = temp.length;
+ while ( i-- ) {
+ if ( (elem = temp[i]) ) {
+ matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);
+ }
+ }
+ }
+
+ if ( seed ) {
+ if ( postFinder || preFilter ) {
+ if ( postFinder ) {
+ // Get the final matcherOut by condensing this intermediate into postFinder contexts
+ temp = [];
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( (elem = matcherOut[i]) ) {
+ // Restore matcherIn since elem is not yet a final match
+ temp.push( (matcherIn[i] = elem) );
+ }
+ }
+ postFinder( null, (matcherOut = []), temp, xml );
+ }
+
+ // Move matched elements from seed to results to keep them synchronized
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( (elem = matcherOut[i]) &&
+ (temp = postFinder ? indexOf.call( seed, elem ) : preMap[i]) > -1 ) {
+
+ seed[temp] = !(results[temp] = elem);
+ }
+ }
+ }
+
+ // Add elements to results, through postFinder if defined
+ } else {
+ matcherOut = condense(
+ matcherOut === results ?
+ matcherOut.splice( preexisting, matcherOut.length ) :
+ matcherOut
+ );
+ if ( postFinder ) {
+ postFinder( null, results, matcherOut, xml );
+ } else {
+ push.apply( results, matcherOut );
+ }
+ }
+ });
+}
+
+function matcherFromTokens( tokens ) {
+ var checkContext, matcher, j,
+ len = tokens.length,
+ leadingRelative = Expr.relative[ tokens[0].type ],
+ implicitRelative = leadingRelative || Expr.relative[" "],
+ i = leadingRelative ? 1 : 0,
+
+ // The foundational matcher ensures that elements are reachable from top-level context(s)
+ matchContext = addCombinator( function( elem ) {
+ return elem === checkContext;
+ }, implicitRelative, true ),
+ matchAnyContext = addCombinator( function( elem ) {
+ return indexOf.call( checkContext, elem ) > -1;
+ }, implicitRelative, true ),
+ matchers = [ function( elem, context, xml ) {
+ return ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
+ (checkContext = context).nodeType ?
+ matchContext( elem, context, xml ) :
+ matchAnyContext( elem, context, xml ) );
+ } ];
+
+ for ( ; i < len; i++ ) {
+ if ( (matcher = Expr.relative[ tokens[i].type ]) ) {
+ matchers = [ addCombinator(elementMatcher( matchers ), matcher) ];
+ } else {
+ matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );
+
+ // Return special upon seeing a positional matcher
+ if ( matcher[ expando ] ) {
+ // Find the next relative operator (if any) for proper handling
+ j = ++i;
+ for ( ; j < len; j++ ) {
+ if ( Expr.relative[ tokens[j].type ] ) {
+ break;
+ }
+ }
+ return setMatcher(
+ i > 1 && elementMatcher( matchers ),
+ i > 1 && toSelector( tokens.slice( 0, i - 1 ) ).replace( rtrim, "$1" ),
+ matcher,
+ i < j && matcherFromTokens( tokens.slice( i, j ) ),
+ j < len && matcherFromTokens( (tokens = tokens.slice( j )) ),
+ j < len && toSelector( tokens )
+ );
+ }
+ matchers.push( matcher );
+ }
+ }
+
+ return elementMatcher( matchers );
+}
+
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+ // A counter to specify which element is currently being matched
+ var matcherCachedRuns = 0,
+ bySet = setMatchers.length > 0,
+ byElement = elementMatchers.length > 0,
+ superMatcher = function( seed, context, xml, results, expandContext ) {
+ var elem, j, matcher,
+ setMatched = [],
+ matchedCount = 0,
+ i = "0",
+ unmatched = seed && [],
+ outermost = expandContext != null,
+ contextBackup = outermostContext,
+ // We must always have either seed elements or context
+ elems = seed || byElement && Expr.find["TAG"]( "*", expandContext && context.parentNode || context ),
+ // Nested matchers should use non-integer dirruns
+ dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.E);
+
+ if ( outermost ) {
+ outermostContext = context !== document && context;
+ cachedruns = matcherCachedRuns;
+ }
+
+ // Add elements passing elementMatchers directly to results
+ for ( ; (elem = elems[i]) != null; i++ ) {
+ if ( byElement && elem ) {
+ for ( j = 0; (matcher = elementMatchers[j]); j++ ) {
+ if ( matcher( elem, context, xml ) ) {
+ results.push( elem );
+ break;
+ }
+ }
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ cachedruns = ++matcherCachedRuns;
+ }
+ }
+
+ // Track unmatched elements for set filters
+ if ( bySet ) {
+ // They will have gone through all possible matchers
+ if ( (elem = !matcher && elem) ) {
+ matchedCount--;
+ }
+
+ // Lengthen the array for every element, matched or not
+ if ( seed ) {
+ unmatched.push( elem );
+ }
+ }
+ }
+
+ // Apply set filters to unmatched elements
+ // `i` starts as a string, so matchedCount would equal "00" if there are no elements
+ matchedCount += i;
+ if ( bySet && i !== matchedCount ) {
+ for ( j = 0; (matcher = setMatchers[j]); j++ ) {
+ matcher( unmatched, setMatched, context, xml );
+ }
+
+ if ( seed ) {
+ // Reintegrate element matches to eliminate the need for sorting
+ if ( matchedCount > 0 ) {
+ while ( i-- ) {
+ if ( !(unmatched[i] || setMatched[i]) ) {
+ setMatched[i] = pop.call( results );
+ }
+ }
+ }
+
+ // Discard index placeholder values to get only actual matches
+ setMatched = condense( setMatched );
+ }
+
+ // Add matches to results
+ push.apply( results, setMatched );
+
+ // Seedless set matches succeeding multiple successful matchers stipulate sorting
+ if ( outermost && !seed && setMatched.length > 0 &&
+ ( matchedCount + setMatchers.length ) > 1 ) {
+
+ Sizzle.uniqueSort( results );
+ }
+ }
+
+ // Override manipulation of globals by nested matchers
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ outermostContext = contextBackup;
+ }
+
+ return unmatched;
+ };
+
+ return bySet ?
+ markFunction( superMatcher ) :
+ superMatcher;
+}
+
+compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) {
+ var i,
+ setMatchers = [],
+ elementMatchers = [],
+ cached = compilerCache[ selector + " " ];
+
+ if ( !cached ) {
+ // Generate a function of recursive functions that can be used to check each element
+ if ( !group ) {
+ group = tokenize( selector );
+ }
+ i = group.length;
+ while ( i-- ) {
+ cached = matcherFromTokens( group[i] );
+ if ( cached[ expando ] ) {
+ setMatchers.push( cached );
+ } else {
+ elementMatchers.push( cached );
+ }
+ }
+
+ // Cache the compiled function
+ cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );
+ }
+ return cached;
+};
+
+function multipleContexts( selector, contexts, results ) {
+ var i = 0,
+ len = contexts.length;
+ for ( ; i < len; i++ ) {
+ Sizzle( selector, contexts[i], results );
+ }
+ return results;
+}
+
+function select( selector, context, results, seed ) {
+ var i, tokens, token, type, find,
+ match = tokenize( selector );
+
+ if ( !seed ) {
+ // Try to minimize operations if there is only one group
+ if ( match.length === 1 ) {
+
+ // Take a shortcut and set the context if the root selector is an ID
+ tokens = match[0] = match[0].slice( 0 );
+ if ( tokens.length > 2 && (token = tokens[0]).type === "ID" &&
+ context.nodeType === 9 && !documentIsXML &&
+ Expr.relative[ tokens[1].type ] ) {
+
+ context = Expr.find["ID"]( token.matches[0].replace( runescape, funescape ), context )[0];
+ if ( !context ) {
+ return results;
+ }
+
+ selector = selector.slice( tokens.shift().value.length );
+ }
+
+ // Fetch a seed set for right-to-left matching
+ for ( i = matchExpr["needsContext"].test( selector ) ? -1 : tokens.length - 1; i >= 0; i-- ) {
+ token = tokens[i];
+
+ // Abort if we hit a combinator
+ if ( Expr.relative[ (type = token.type) ] ) {
+ break;
+ }
+ if ( (find = Expr.find[ type ]) ) {
+ // Search, expanding context for leading sibling combinators
+ if ( (seed = find(
+ token.matches[0].replace( runescape, funescape ),
+ rsibling.test( tokens[0].type ) && context.parentNode || context
+ )) ) {
+
+ // If seed is empty or no tokens remain, we can return early
+ tokens.splice( i, 1 );
+ selector = seed.length && toSelector( tokens );
+ if ( !selector ) {
+ push.apply( results, slice.call( seed, 0 ) );
+ return results;
+ }
+
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ // Compile and execute a filtering function
+ // Provide `match` to avoid retokenization if we modified the selector above
+ compile( selector, match )(
+ seed,
+ context,
+ documentIsXML,
+ results,
+ rsibling.test( selector )
+ );
+ return results;
+}
+
+// Deprecated
+Expr.pseudos["nth"] = Expr.pseudos["eq"];
+
+// Easy API for creating new setFilters
+function setFilters() {}
+Expr.filters = setFilters.prototype = Expr.pseudos;
+Expr.setFilters = new setFilters();
+
+// Initialize with the default document
+setDocument();
+
+// Override sizzle attribute retrieval
+Sizzle.attr = jQuery.attr;
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.pseudos;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+
+
+})( window );
+var runtil = /Until$/,
+ rparentsprev = /^(?:parents|prev(?:Until|All))/,
+ isSimple = /^.[^:#\[\.,]*$/,
+ rneedsContext = jQuery.expr.match.needsContext,
+ // methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
+
+jQuery.fn.extend({
+ find: function( selector ) {
+ var i, ret, self;
+
+ if ( typeof selector !== "string" ) {
+ self = this;
+ return this.pushStack( jQuery( selector ).filter(function() {
+ for ( i = 0; i < self.length; i++ ) {
+ if ( jQuery.contains( self[ i ], this ) ) {
+ return true;
+ }
+ }
+ }) );
+ }
+
+ ret = [];
+ for ( i = 0; i < this.length; i++ ) {
+ jQuery.find( selector, this[ i ], ret );
+ }
+
+ // Needed because $( selector, context ) becomes $( context ).find( selector )
+ ret = this.pushStack( jQuery.unique( ret ) );
+ ret.selector = ( this.selector ? this.selector + " " : "" ) + selector;
+ return ret;
+ },
+
+ has: function( target ) {
+ var i,
+ targets = jQuery( target, this ),
+ len = targets.length;
+
+ return this.filter(function() {
+ for ( i = 0; i < len; i++ ) {
+ if ( jQuery.contains( this, targets[i] ) ) {
+ return true;
+ }
+ }
+ });
+ },
+
+ not: function( selector ) {
+ return this.pushStack( winnow(this, selector, false) );
+ },
+
+ filter: function( selector ) {
+ return this.pushStack( winnow(this, selector, true) );
+ },
+
+ is: function( selector ) {
+ return !!selector && (
+ typeof selector === "string" ?
+ // If this is a positional/relative selector, check membership in the returned set
+ // so $("p:first").is("p:last") won't return true for a doc with two "p".
+ rneedsContext.test( selector ) ?
+ jQuery( selector, this.context ).index( this[0] ) >= 0 :
+ jQuery.filter( selector, this ).length > 0 :
+ this.filter( selector ).length > 0 );
+ },
+
+ closest: function( selectors, context ) {
+ var cur,
+ i = 0,
+ l = this.length,
+ ret = [],
+ pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ?
+ jQuery( selectors, context || this.context ) :
+ 0;
+
+ for ( ; i < l; i++ ) {
+ cur = this[i];
+
+ while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) {
+ if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
+ ret.push( cur );
+ break;
+ }
+ cur = cur.parentNode;
+ }
+ }
+
+ return this.pushStack( ret.length > 1 ? jQuery.unique( ret ) : ret );
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function( elem ) {
+
+ // No argument, return index in parent
+ if ( !elem ) {
+ return ( this[0] && this[0].parentNode ) ? this.first().prevAll().length : -1;
+ }
+
+ // index in selector
+ if ( typeof elem === "string" ) {
+ return jQuery.inArray( this[0], jQuery( elem ) );
+ }
+
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[0] : elem, this );
+ },
+
+ add: function( selector, context ) {
+ var set = typeof selector === "string" ?
+ jQuery( selector, context ) :
+ jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ),
+ all = jQuery.merge( this.get(), set );
+
+ return this.pushStack( jQuery.unique(all) );
+ },
+
+ addBack: function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter(selector)
+ );
+ }
+});
+
+jQuery.fn.andSelf = jQuery.fn.addBack;
+
+function sibling( cur, dir ) {
+ do {
+ cur = cur[ dir ];
+ } while ( cur && cur.nodeType !== 1 );
+
+ return cur;
+}
+
+jQuery.each({
+ parent: function( elem ) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function( elem ) {
+ return jQuery.dir( elem, "parentNode" );
+ },
+ parentsUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "parentNode", until );
+ },
+ next: function( elem ) {
+ return sibling( elem, "nextSibling" );
+ },
+ prev: function( elem ) {
+ return sibling( elem, "previousSibling" );
+ },
+ nextAll: function( elem ) {
+ return jQuery.dir( elem, "nextSibling" );
+ },
+ prevAll: function( elem ) {
+ return jQuery.dir( elem, "previousSibling" );
+ },
+ nextUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "nextSibling", until );
+ },
+ prevUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "previousSibling", until );
+ },
+ siblings: function( elem ) {
+ return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem );
+ },
+ children: function( elem ) {
+ return jQuery.sibling( elem.firstChild );
+ },
+ contents: function( elem ) {
+ return jQuery.nodeName( elem, "iframe" ) ?
+ elem.contentDocument || elem.contentWindow.document :
+ jQuery.merge( [], elem.childNodes );
+ }
+}, function( name, fn ) {
+ jQuery.fn[ name ] = function( until, selector ) {
+ var ret = jQuery.map( this, fn, until );
+
+ if ( !runtil.test( name ) ) {
+ selector = until;
+ }
+
+ if ( selector && typeof selector === "string" ) {
+ ret = jQuery.filter( selector, ret );
+ }
+
+ ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
+
+ if ( this.length > 1 && rparentsprev.test( name ) ) {
+ ret = ret.reverse();
+ }
+
+ return this.pushStack( ret );
+ };
+});
+
+jQuery.extend({
+ filter: function( expr, elems, not ) {
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ return elems.length === 1 ?
+ jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
+ jQuery.find.matches(expr, elems);
+ },
+
+ dir: function( elem, dir, until ) {
+ var matched = [],
+ cur = elem[ dir ];
+
+ while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+ if ( cur.nodeType === 1 ) {
+ matched.push( cur );
+ }
+ cur = cur[dir];
+ }
+ return matched;
+ },
+
+ sibling: function( n, elem ) {
+ var r = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType === 1 && n !== elem ) {
+ r.push( n );
+ }
+ }
+
+ return r;
+ }
+});
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, keep ) {
+
+ // Can't pass null or undefined to indexOf in Firefox 4
+ // Set to 0 to skip string check
+ qualifier = qualifier || 0;
+
+ if ( jQuery.isFunction( qualifier ) ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ var retVal = !!qualifier.call( elem, i, elem );
+ return retVal === keep;
+ });
+
+ } else if ( qualifier.nodeType ) {
+ return jQuery.grep(elements, function( elem ) {
+ return ( elem === qualifier ) === keep;
+ });
+
+ } else if ( typeof qualifier === "string" ) {
+ var filtered = jQuery.grep(elements, function( elem ) {
+ return elem.nodeType === 1;
+ });
+
+ if ( isSimple.test( qualifier ) ) {
+ return jQuery.filter(qualifier, filtered, !keep);
+ } else {
+ qualifier = jQuery.filter( qualifier, filtered );
+ }
+ }
+
+ return jQuery.grep(elements, function( elem ) {
+ return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep;
+ });
+}
+function createSafeFragment( document ) {
+ var list = nodeNames.split( "|" ),
+ safeFrag = document.createDocumentFragment();
+
+ if ( safeFrag.createElement ) {
+ while ( list.length ) {
+ safeFrag.createElement(
+ list.pop()
+ );
+ }
+ }
+ return safeFrag;
+}
+
+var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" +
+ "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",
+ rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g,
+ rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"),
+ rleadingWhitespace = /^\s+/,
+ rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,
+ rtagName = /<([\w:]+)/,
+ rtbody = /<tbody/i,
+ rhtml = /<|&#?\w+;/,
+ rnoInnerhtml = /<(?:script|style|link)/i,
+ manipulation_rcheckableType = /^(?:checkbox|radio)$/i,
+ // checked="checked" or checked
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+ rscriptType = /^$|\/(?:java|ecma)script/i,
+ rscriptTypeMasked = /^true\/(.*)/,
+ rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,
+
+ // We have to close these tags to support XHTML (#13200)
+ wrapMap = {
+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
+ legend: [ 1, "<fieldset>", "</fieldset>" ],
+ area: [ 1, "<map>", "</map>" ],
+ param: [ 1, "<object>", "</object>" ],
+ thead: [ 1, "<table>", "</table>" ],
+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+ col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+
+ // IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags,
+ // unless wrapped in a div with non-breaking characters in front of it.
+ _default: jQuery.support.htmlSerialize ? [ 0, "", "" ] : [ 1, "X<div>", "</div>" ]
+ },
+ safeFragment = createSafeFragment( document ),
+ fragmentDiv = safeFragment.appendChild( document.createElement("div") );
+
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+jQuery.fn.extend({
+ text: function( value ) {
+ return jQuery.access( this, function( value ) {
+ return value === undefined ?
+ jQuery.text( this ) :
+ this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) );
+ }, null, value, arguments.length );
+ },
+
+ wrapAll: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapAll( html.call(this, i) );
+ });
+ }
+
+ if ( this[0] ) {
+ // The elements to wrap the target around
+ var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+
+ if ( this[0].parentNode ) {
+ wrap.insertBefore( this[0] );
+ }
+
+ wrap.map(function() {
+ var elem = this;
+
+ while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+ elem = elem.firstChild;
+ }
+
+ return elem;
+ }).append( this );
+ }
+
+ return this;
+ },
+
+ wrapInner: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapInner( html.call(this, i) );
+ });
+ }
+
+ return this.each(function() {
+ var self = jQuery( this ),
+ contents = self.contents();
+
+ if ( contents.length ) {
+ contents.wrapAll( html );
+
+ } else {
+ self.append( html );
+ }
+ });
+ },
+
+ wrap: function( html ) {
+ var isFunction = jQuery.isFunction( html );
+
+ return this.each(function(i) {
+ jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html );
+ });
+ },
+
+ unwrap: function() {
+ return this.parent().each(function() {
+ if ( !jQuery.nodeName( this, "body" ) ) {
+ jQuery( this ).replaceWith( this.childNodes );
+ }
+ }).end();
+ },
+
+ append: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+ this.appendChild( elem );
+ }
+ });
+ },
+
+ prepend: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+ this.insertBefore( elem, this.firstChild );
+ }
+ });
+ },
+
+ before: function() {
+ return this.domManip( arguments, false, function( elem ) {
+ if ( this.parentNode ) {
+ this.parentNode.insertBefore( elem, this );
+ }
+ });
+ },
+
+ after: function() {
+ return this.domManip( arguments, false, function( elem ) {
+ if ( this.parentNode ) {
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ }
+ });
+ },
+
+ // keepData is for internal use only--do not document
+ remove: function( selector, keepData ) {
+ var elem,
+ i = 0;
+
+ for ( ; (elem = this[i]) != null; i++ ) {
+ if ( !selector || jQuery.filter( selector, [ elem ] ).length > 0 ) {
+ if ( !keepData && elem.nodeType === 1 ) {
+ jQuery.cleanData( getAll( elem ) );
+ }
+
+ if ( elem.parentNode ) {
+ if ( keepData && jQuery.contains( elem.ownerDocument, elem ) ) {
+ setGlobalEval( getAll( elem, "script" ) );
+ }
+ elem.parentNode.removeChild( elem );
+ }
+ }
+ }
+
+ return this;
+ },
+
+ empty: function() {
+ var elem,
+ i = 0;
+
+ for ( ; (elem = this[i]) != null; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( getAll( elem, false ) );
+ }
+
+ // Remove any remaining nodes
+ while ( elem.firstChild ) {
+ elem.removeChild( elem.firstChild );
+ }
+
+ // If this is a select, ensure that it displays empty (#12336)
+ // Support: IE<9
+ if ( elem.options && jQuery.nodeName( elem, "select" ) ) {
+ elem.options.length = 0;
+ }
+ }
+
+ return this;
+ },
+
+ clone: function( dataAndEvents, deepDataAndEvents ) {
+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+ return this.map( function () {
+ return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+ });
+ },
+
+ html: function( value ) {
+ return jQuery.access( this, function( value ) {
+ var elem = this[0] || {},
+ i = 0,
+ l = this.length;
+
+ if ( value === undefined ) {
+ return elem.nodeType === 1 ?
+ elem.innerHTML.replace( rinlinejQuery, "" ) :
+ undefined;
+ }
+
+ // See if we can take a shortcut and just use innerHTML
+ if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+ ( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) &&
+ ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) &&
+ !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) {
+
+ value = value.replace( rxhtmlTag, "<$1></$2>" );
+
+ try {
+ for (; i < l; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ elem = this[i] || {};
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( getAll( elem, false ) );
+ elem.innerHTML = value;
+ }
+ }
+
+ elem = 0;
+
+ // If using innerHTML throws an exception, use the fallback method
+ } catch(e) {}
+ }
+
+ if ( elem ) {
+ this.empty().append( value );
+ }
+ }, null, value, arguments.length );
+ },
+
+ replaceWith: function( value ) {
+ var isFunc = jQuery.isFunction( value );
+
+ // Make sure that the elements are removed from the DOM before they are inserted
+ // this can help fix replacing a parent with child elements
+ if ( !isFunc && typeof value !== "string" ) {
+ value = jQuery( value ).not( this ).detach();
+ }
+
+ return this.domManip( [ value ], true, function( elem ) {
+ var next = this.nextSibling,
+ parent = this.parentNode;
+
+ if ( parent && this.nodeType === 1 || this.nodeType === 11 ) {
+
+ jQuery( this ).remove();
+
+ if ( next ) {
+ next.parentNode.insertBefore( elem, next );
+ } else {
+ parent.appendChild( elem );
+ }
+ }
+ });
+ },
+
+ detach: function( selector ) {
+ return this.remove( selector, true );
+ },
+
+ domManip: function( args, table, callback ) {
+
+ // Flatten any nested arrays
+ args = core_concat.apply( [], args );
+
+ var fragment, first, scripts, hasScripts, node, doc,
+ i = 0,
+ l = this.length,
+ set = this,
+ iNoClone = l - 1,
+ value = args[0],
+ isFunction = jQuery.isFunction( value );
+
+ // We can't cloneNode fragments that contain checked, in WebKit
+ if ( isFunction || !( l <= 1 || typeof value !== "string" || jQuery.support.checkClone || !rchecked.test( value ) ) ) {
+ return this.each(function( index ) {
+ var self = set.eq( index );
+ if ( isFunction ) {
+ args[0] = value.call( this, index, table ? self.html() : undefined );
+ }
+ self.domManip( args, table, callback );
+ });
+ }
+
+ if ( l ) {
+ fragment = jQuery.buildFragment( args, this[ 0 ].ownerDocument, false, this );
+ first = fragment.firstChild;
+
+ if ( fragment.childNodes.length === 1 ) {
+ fragment = first;
+ }
+
+ if ( first ) {
+ table = table && jQuery.nodeName( first, "tr" );
+ scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
+ hasScripts = scripts.length;
+
+ // Use the original fragment for the last item instead of the first because it can end up
+ // being emptied incorrectly in certain situations (#8070).
+ for ( ; i < l; i++ ) {
+ node = fragment;
+
+ if ( i !== iNoClone ) {
+ node = jQuery.clone( node, true, true );
+
+ // Keep references to cloned scripts for later restoration
+ if ( hasScripts ) {
+ jQuery.merge( scripts, getAll( node, "script" ) );
+ }
+ }
+
+ callback.call(
+ table && jQuery.nodeName( this[i], "table" ) ?
+ findOrAppend( this[i], "tbody" ) :
+ this[i],
+ node,
+ i
+ );
+ }
+
+ if ( hasScripts ) {
+ doc = scripts[ scripts.length - 1 ].ownerDocument;
+
+ // Reenable scripts
+ jQuery.map( scripts, restoreScript );
+
+ // Evaluate executable scripts on first document insertion
+ for ( i = 0; i < hasScripts; i++ ) {
+ node = scripts[ i ];
+ if ( rscriptType.test( node.type || "" ) &&
+ !jQuery._data( node, "globalEval" ) && jQuery.contains( doc, node ) ) {
+
+ if ( node.src ) {
+ // Hope ajax is available...
+ jQuery.ajax({
+ url: node.src,
+ type: "GET",
+ dataType: "script",
+ async: false,
+ global: false,
+ "throws": true
+ });
+ } else {
+ jQuery.globalEval( ( node.text || node.textContent || node.innerHTML || "" ).replace( rcleanScript, "" ) );
+ }
+ }
+ }
+ }
+
+ // Fix #11809: Avoid leaking memory
+ fragment = first = null;
+ }
+ }
+
+ return this;
+ }
+});
+
+function findOrAppend( elem, tag ) {
+ return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) );
+}
+
+// Replace/restore the type attribute of script elements for safe DOM manipulation
+function disableScript( elem ) {
+ var attr = elem.getAttributeNode("type");
+ elem.type = ( attr && attr.specified ) + "/" + elem.type;
+ return elem;
+}
+function restoreScript( elem ) {
+ var match = rscriptTypeMasked.exec( elem.type );
+ if ( match ) {
+ elem.type = match[1];
+ } else {
+ elem.removeAttribute("type");
+ }
+ return elem;
+}
+
+// Mark scripts as having already been evaluated
+function setGlobalEval( elems, refElements ) {
+ var elem,
+ i = 0;
+ for ( ; (elem = elems[i]) != null; i++ ) {
+ jQuery._data( elem, "globalEval", !refElements || jQuery._data( refElements[i], "globalEval" ) );
+ }
+}
+
+function cloneCopyEvent( src, dest ) {
+
+ if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
+ return;
+ }
+
+ var type, i, l,
+ oldData = jQuery._data( src ),
+ curData = jQuery._data( dest, oldData ),
+ events = oldData.events;
+
+ if ( events ) {
+ delete curData.handle;
+ curData.events = {};
+
+ for ( type in events ) {
+ for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+ jQuery.event.add( dest, type, events[ type ][ i ] );
+ }
+ }
+ }
+
+ // make the cloned public data object a copy from the original
+ if ( curData.data ) {
+ curData.data = jQuery.extend( {}, curData.data );
+ }
+}
+
+function fixCloneNodeIssues( src, dest ) {
+ var nodeName, data, e;
+
+ // We do not need to do anything for non-Elements
+ if ( dest.nodeType !== 1 ) {
+ return;
+ }
+
+ nodeName = dest.nodeName.toLowerCase();
+
+ // IE6-8 copies events bound via attachEvent when using cloneNode.
+ if ( !jQuery.support.noCloneEvent && dest[ jQuery.expando ] ) {
+ data = jQuery._data( dest );
+
+ for ( e in data.events ) {
+ jQuery.removeEvent( dest, e, data.handle );
+ }
+
+ // Event data gets referenced instead of copied if the expando gets copied too
+ dest.removeAttribute( jQuery.expando );
+ }
+
+ // IE blanks contents when cloning scripts, and tries to evaluate newly-set text
+ if ( nodeName === "script" && dest.text !== src.text ) {
+ disableScript( dest ).text = src.text;
+ restoreScript( dest );
+
+ // IE6-10 improperly clones children of object elements using classid.
+ // IE10 throws NoModificationAllowedError if parent is null, #12132.
+ } else if ( nodeName === "object" ) {
+ if ( dest.parentNode ) {
+ dest.outerHTML = src.outerHTML;
+ }
+
+ // This path appears unavoidable for IE9. When cloning an object
+ // element in IE9, the outerHTML strategy above is not sufficient.
+ // If the src has innerHTML and the destination does not,
+ // copy the src.innerHTML into the dest.innerHTML. #10324
+ if ( jQuery.support.html5Clone && ( src.innerHTML && !jQuery.trim(dest.innerHTML) ) ) {
+ dest.innerHTML = src.innerHTML;
+ }
+
+ } else if ( nodeName === "input" && manipulation_rcheckableType.test( src.type ) ) {
+ // IE6-8 fails to persist the checked state of a cloned checkbox
+ // or radio button. Worse, IE6-7 fail to give the cloned element
+ // a checked appearance if the defaultChecked value isn't also set
+
+ dest.defaultChecked = dest.checked = src.checked;
+
+ // IE6-7 get confused and end up setting the value of a cloned
+ // checkbox/radio button to an empty string instead of "on"
+ if ( dest.value !== src.value ) {
+ dest.value = src.value;
+ }
+
+ // IE6-8 fails to return the selected option to the default selected
+ // state when cloning options
+ } else if ( nodeName === "option" ) {
+ dest.defaultSelected = dest.selected = src.defaultSelected;
+
+ // IE6-8 fails to set the defaultValue to the correct value when
+ // cloning other types of input fields
+ } else if ( nodeName === "input" || nodeName === "textarea" ) {
+ dest.defaultValue = src.defaultValue;
+ }
+}
+
+jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function( name, original ) {
+ jQuery.fn[ name ] = function( selector ) {
+ var elems,
+ i = 0,
+ ret = [],
+ insert = jQuery( selector ),
+ last = insert.length - 1;
+
+ for ( ; i <= last; i++ ) {
+ elems = i === last ? this : this.clone(true);
+ jQuery( insert[i] )[ original ]( elems );
+
+ // Modern browsers can apply jQuery collections as arrays, but oldIE needs a .get()
+ core_push.apply( ret, elems.get() );
+ }
+
+ return this.pushStack( ret );
+ };
+});
+
+function getAll( context, tag ) {
+ var elems, elem,
+ i = 0,
+ found = typeof context.getElementsByTagName !== "undefined" ? context.getElementsByTagName( tag || "*" ) :
+ typeof context.querySelectorAll !== "undefined" ? context.querySelectorAll( tag || "*" ) :
+ undefined;
+
+ if ( !found ) {
+ for ( found = [], elems = context.childNodes || context; (elem = elems[i]) != null; i++ ) {
+ if ( !tag || jQuery.nodeName( elem, tag ) ) {
+ found.push( elem );
+ } else {
+ jQuery.merge( found, getAll( elem, tag ) );
+ }
+ }
+ }
+
+ return tag === undefined || tag && jQuery.nodeName( context, tag ) ?
+ jQuery.merge( [ context ], found ) :
+ found;
+}
+
+// Used in buildFragment, fixes the defaultChecked property
+function fixDefaultChecked( elem ) {
+ if ( manipulation_rcheckableType.test( elem.type ) ) {
+ elem.defaultChecked = elem.checked;
+ }
+}
+
+jQuery.extend({
+ clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+ var destElements, srcElements, node, i, clone,
+ inPage = jQuery.contains( elem.ownerDocument, elem );
+
+ if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) {
+ clone = elem.cloneNode( true );
+
+ // IE<=8 does not properly clone detached, unknown element nodes
+ } else {
+ fragmentDiv.innerHTML = elem.outerHTML;
+ fragmentDiv.removeChild( clone = fragmentDiv.firstChild );
+ }
+
+ if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
+ (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
+
+ // We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2
+ destElements = getAll( clone );
+ srcElements = getAll( elem );
+
+ // Fix all IE cloning issues
+ for ( i = 0; (node = srcElements[i]) != null; ++i ) {
+ // Ensure that the destination node is not null; Fixes #9587
+ if ( destElements[i] ) {
+ fixCloneNodeIssues( node, destElements[i] );
+ }
+ }
+ }
+
+ // Copy the events from the original to the clone
+ if ( dataAndEvents ) {
+ if ( deepDataAndEvents ) {
+ srcElements = srcElements || getAll( elem );
+ destElements = destElements || getAll( clone );
+
+ for ( i = 0; (node = srcElements[i]) != null; i++ ) {
+ cloneCopyEvent( node, destElements[i] );
+ }
+ } else {
+ cloneCopyEvent( elem, clone );
+ }
+ }
+
+ // Preserve script evaluation history
+ destElements = getAll( clone, "script" );
+ if ( destElements.length > 0 ) {
+ setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
+ }
+
+ destElements = srcElements = node = null;
+
+ // Return the cloned set
+ return clone;
+ },
+
+ buildFragment: function( elems, context, scripts, selection ) {
+ var contains, elem, tag, tmp, wrap, tbody, j,
+ l = elems.length,
+
+ // Ensure a safe fragment
+ safe = createSafeFragment( context ),
+
+ nodes = [],
+ i = 0;
+
+ for ( ; i < l; i++ ) {
+ elem = elems[ i ];
+
+ if ( elem || elem === 0 ) {
+
+ // Add nodes directly
+ if ( jQuery.type( elem ) === "object" ) {
+ jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
+
+ // Convert non-html into a text node
+ } else if ( !rhtml.test( elem ) ) {
+ nodes.push( context.createTextNode( elem ) );
+
+ // Convert html into DOM nodes
+ } else {
+ tmp = tmp || safe.appendChild( context.createElement("div") );
+
+ // Deserialize a standard representation
+ tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase();
+ wrap = wrapMap[ tag ] || wrapMap._default;
+
+ tmp.innerHTML = wrap[1] + elem.replace( rxhtmlTag, "<$1></$2>" ) + wrap[2];
+
+ // Descend through wrappers to the right content
+ j = wrap[0];
+ while ( j-- ) {
+ tmp = tmp.lastChild;
+ }
+
+ // Manually add leading whitespace removed by IE
+ if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+ nodes.push( context.createTextNode( rleadingWhitespace.exec( elem )[0] ) );
+ }
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !jQuery.support.tbody ) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ elem = tag === "table" && !rtbody.test( elem ) ?
+ tmp.firstChild :
+
+ // String was a bare <thead> or <tfoot>
+ wrap[1] === "<table>" && !rtbody.test( elem ) ?
+ tmp :
+ 0;
+
+ j = elem && elem.childNodes.length;
+ while ( j-- ) {
+ if ( jQuery.nodeName( (tbody = elem.childNodes[j]), "tbody" ) && !tbody.childNodes.length ) {
+ elem.removeChild( tbody );
+ }
+ }
+ }
+
+ jQuery.merge( nodes, tmp.childNodes );
+
+ // Fix #12392 for WebKit and IE > 9
+ tmp.textContent = "";
+
+ // Fix #12392 for oldIE
+ while ( tmp.firstChild ) {
+ tmp.removeChild( tmp.firstChild );
+ }
+
+ // Remember the top-level container for proper cleanup
+ tmp = safe.lastChild;
+ }
+ }
+ }
+
+ // Fix #11356: Clear elements from fragment
+ if ( tmp ) {
+ safe.removeChild( tmp );
+ }
+
+ // Reset defaultChecked for any radios and checkboxes
+ // about to be appended to the DOM in IE 6/7 (#8060)
+ if ( !jQuery.support.appendChecked ) {
+ jQuery.grep( getAll( nodes, "input" ), fixDefaultChecked );
+ }
+
+ i = 0;
+ while ( (elem = nodes[ i++ ]) ) {
+
+ // #4087 - If origin and destination elements are the same, and this is
+ // that element, do not do anything
+ if ( selection && jQuery.inArray( elem, selection ) !== -1 ) {
+ continue;
+ }
+
+ contains = jQuery.contains( elem.ownerDocument, elem );
+
+ // Append to fragment
+ tmp = getAll( safe.appendChild( elem ), "script" );
+
+ // Preserve script evaluation history
+ if ( contains ) {
+ setGlobalEval( tmp );
+ }
+
+ // Capture executables
+ if ( scripts ) {
+ j = 0;
+ while ( (elem = tmp[ j++ ]) ) {
+ if ( rscriptType.test( elem.type || "" ) ) {
+ scripts.push( elem );
+ }
+ }
+ }
+ }
+
+ tmp = null;
+
+ return safe;
+ },
+
+ cleanData: function( elems, /* internal */ acceptData ) {
+ var data, id, elem, type,
+ i = 0,
+ internalKey = jQuery.expando,
+ cache = jQuery.cache,
+ deleteExpando = jQuery.support.deleteExpando,
+ special = jQuery.event.special;
+
+ for ( ; (elem = elems[i]) != null; i++ ) {
+
+ if ( acceptData || jQuery.acceptData( elem ) ) {
+
+ id = elem[ internalKey ];
+ data = id && cache[ id ];
+
+ if ( data ) {
+ if ( data.events ) {
+ for ( type in data.events ) {
+ if ( special[ type ] ) {
+ jQuery.event.remove( elem, type );
+
+ // This is a shortcut to avoid jQuery.event.remove's overhead
+ } else {
+ jQuery.removeEvent( elem, type, data.handle );
+ }
+ }
+ }
+
+ // Remove cache only if it was not already removed by jQuery.event.remove
+ if ( cache[ id ] ) {
+
+ delete cache[ id ];
+
+ // IE does not allow us to delete expando properties from nodes,
+ // nor does it have a removeAttribute function on Document nodes;
+ // we must handle all of these cases
+ if ( deleteExpando ) {
+ delete elem[ internalKey ];
+
+ } else if ( typeof elem.removeAttribute !== "undefined" ) {
+ elem.removeAttribute( internalKey );
+
+ } else {
+ elem[ internalKey ] = null;
+ }
+
+ core_deletedIds.push( id );
+ }
+ }
+ }
+ }
+ }
+});
+var curCSS, getStyles, iframe,
+ ralpha = /alpha\([^)]*\)/i,
+ ropacity = /opacity\s*=\s*([^)]*)/,
+ rposition = /^(top|right|bottom|left)$/,
+ // swappable if display is none or starts with table except "table", "table-cell", or "table-caption"
+ // see here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
+ rdisplayswap = /^(none|table(?!-c[ea]).+)/,
+ rmargin = /^margin/,
+ rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ),
+ rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ),
+ rrelNum = new RegExp( "^([+-])=(" + core_pnum + ")", "i" ),
+ elemdisplay = { BODY: "block" },
+
+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+ cssNormalTransform = {
+ letterSpacing: 0,
+ fontWeight: 400
+ },
+
+ cssExpand = [ "Top", "Right", "Bottom", "Left" ],
+ cssPrefixes = [ "Webkit", "O", "Moz", "ms" ];
+
+// return a css property mapped to a potentially vendor prefixed property
+function vendorPropName( style, name ) {
+
+ // shortcut for names that are not vendor prefixed
+ if ( name in style ) {
+ return name;
+ }
+
+ // check for vendor prefixed names
+ var capName = name.charAt(0).toUpperCase() + name.slice(1),
+ origName = name,
+ i = cssPrefixes.length;
+
+ while ( i-- ) {
+ name = cssPrefixes[ i ] + capName;
+ if ( name in style ) {
+ return name;
+ }
+ }
+
+ return origName;
+}
+
+function isHidden( elem, el ) {
+ // isHidden might be called from jQuery#filter function;
+ // in that case, element will be second argument
+ elem = el || elem;
+ return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem );
+}
+
+function showHide( elements, show ) {
+ var elem,
+ values = [],
+ index = 0,
+ length = elements.length;
+
+ for ( ; index < length; index++ ) {
+ elem = elements[ index ];
+ if ( !elem.style ) {
+ continue;
+ }
+ values[ index ] = jQuery._data( elem, "olddisplay" );
+ if ( show ) {
+ // Reset the inline display of this element to learn if it is
+ // being hidden by cascaded rules or not
+ if ( !values[ index ] && elem.style.display === "none" ) {
+ elem.style.display = "";
+ }
+
+ // Set elements which have been overridden with display: none
+ // in a stylesheet to whatever the default browser style is
+ // for such an element
+ if ( elem.style.display === "" && isHidden( elem ) ) {
+ values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) );
+ }
+ } else if ( !values[ index ] && !isHidden( elem ) ) {
+ jQuery._data( elem, "olddisplay", jQuery.css( elem, "display" ) );
+ }
+ }
+
+ // Set the display of most of the elements in a second loop
+ // to avoid the constant reflow
+ for ( index = 0; index < length; index++ ) {
+ elem = elements[ index ];
+ if ( !elem.style ) {
+ continue;
+ }
+ if ( !show || elem.style.display === "none" || elem.style.display === "" ) {
+ elem.style.display = show ? values[ index ] || "" : "none";
+ }
+ }
+
+ return elements;
+}
+
+jQuery.fn.extend({
+ css: function( name, value ) {
+ return jQuery.access( this, function( elem, name, value ) {
+ var styles, len,
+ map = {},
+ i = 0;
+
+ if ( jQuery.isArray( name ) ) {
+ styles = getStyles( elem );
+ len = name.length;
+
+ for ( ; i < len; i++ ) {
+ map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
+ }
+
+ return map;
+ }
+
+ return value !== undefined ?
+ jQuery.style( elem, name, value ) :
+ jQuery.css( elem, name );
+ }, name, value, arguments.length > 1 );
+ },
+ show: function() {
+ return showHide( this, true );
+ },
+ hide: function() {
+ return showHide( this );
+ },
+ toggle: function( state ) {
+ var bool = typeof state === "boolean";
+
+ return this.each(function() {
+ if ( bool ? state : isHidden( this ) ) {
+ jQuery( this ).show();
+ } else {
+ jQuery( this ).hide();
+ }
+ });
+ }
+});
+
+jQuery.extend({
+ // Add in style property hooks for overriding the default
+ // behavior of getting and setting a style property
+ cssHooks: {
+ opacity: {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ // We should always get a number back from opacity
+ var ret = curCSS( elem, "opacity" );
+ return ret === "" ? "1" : ret;
+ }
+ }
+ }
+ },
+
+ // Exclude the following css properties to add px
+ cssNumber: {
+ "columnCount": true,
+ "fillOpacity": true,
+ "fontWeight": true,
+ "lineHeight": true,
+ "opacity": true,
+ "orphans": true,
+ "widows": true,
+ "zIndex": true,
+ "zoom": true
+ },
+
+ // Add in properties whose names you wish to fix before
+ // setting or getting the value
+ cssProps: {
+ // normalize float css property
+ "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
+ },
+
+ // Get and set the style property on a DOM Node
+ style: function( elem, name, value, extra ) {
+ // Don't set styles on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+ return;
+ }
+
+ // Make sure that we're working with the right name
+ var ret, type, hooks,
+ origName = jQuery.camelCase( name ),
+ style = elem.style;
+
+ name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) );
+
+ // gets hook for the prefixed version
+ // followed by the unprefixed version
+ hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+ // Check if we're setting a value
+ if ( value !== undefined ) {
+ type = typeof value;
+
+ // convert relative number strings (+= or -=) to relative numbers. #7345
+ if ( type === "string" && (ret = rrelNum.exec( value )) ) {
+ value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) );
+ // Fixes bug #9237
+ type = "number";
+ }
+
+ // Make sure that NaN and null values aren't set. See: #7116
+ if ( value == null || type === "number" && isNaN( value ) ) {
+ return;
+ }
+
+ // If a number was passed in, add 'px' to the (except for certain CSS properties)
+ if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
+ value += "px";
+ }
+
+ // Fixes #8908, it can be done more correctly by specifing setters in cssHooks,
+ // but it would mean to define eight (for every problematic property) identical functions
+ if ( !jQuery.support.clearCloneStyle && value === "" && name.indexOf("background") === 0 ) {
+ style[ name ] = "inherit";
+ }
+
+ // If a hook was provided, use that value, otherwise just set the specified value
+ if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) {
+
+ // Wrapped to prevent IE from throwing errors when 'invalid' values are provided
+ // Fixes bug #5509
+ try {
+ style[ name ] = value;
+ } catch(e) {}
+ }
+
+ } else {
+ // If a hook was provided get the non-computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
+ return ret;
+ }
+
+ // Otherwise just get the value from the style object
+ return style[ name ];
+ }
+ },
+
+ css: function( elem, name, extra, styles ) {
+ var val, num, hooks,
+ origName = jQuery.camelCase( name );
+
+ // Make sure that we're working with the right name
+ name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) );
+
+ // gets hook for the prefixed version
+ // followed by the unprefixed version
+ hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+ // If a hook was provided get the computed value from there
+ if ( hooks && "get" in hooks ) {
+ val = hooks.get( elem, true, extra );
+ }
+
+ // Otherwise, if a way to get the computed value exists, use that
+ if ( val === undefined ) {
+ val = curCSS( elem, name, styles );
+ }
+
+ //convert "normal" to computed value
+ if ( val === "normal" && name in cssNormalTransform ) {
+ val = cssNormalTransform[ name ];
+ }
+
+ // Return, converting to number if forced or a qualifier was provided and val looks numeric
+ if ( extra ) {
+ num = parseFloat( val );
+ return extra === true || jQuery.isNumeric( num ) ? num || 0 : val;
+ }
+ return val;
+ },
+
+ // A method for quickly swapping in/out CSS properties to get correct calculations
+ swap: function( elem, options, callback, args ) {
+ var ret, name,
+ old = {};
+
+ // Remember the old values, and insert the new ones
+ for ( name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ ret = callback.apply( elem, args || [] );
+
+ // Revert the old values
+ for ( name in options ) {
+ elem.style[ name ] = old[ name ];
+ }
+
+ return ret;
+ }
+});
+
+// NOTE: we've included the "window" in window.getComputedStyle
+// because jsdom on node.js will break without it.
+if ( window.getComputedStyle ) {
+ getStyles = function( elem ) {
+ return window.getComputedStyle( elem, null );
+ };
+
+ curCSS = function( elem, name, _computed ) {
+ var width, minWidth, maxWidth,
+ computed = _computed || getStyles( elem ),
+
+ // getPropertyValue is only needed for .css('filter') in IE9, see #12537
+ ret = computed ? computed.getPropertyValue( name ) || computed[ name ] : undefined,
+ style = elem.style;
+
+ if ( computed ) {
+
+ if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) {
+ ret = jQuery.style( elem, name );
+ }
+
+ // A tribute to the "awesome hack by Dean Edwards"
+ // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right
+ // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels
+ // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values
+ if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) {
+
+ // Remember the original values
+ width = style.width;
+ minWidth = style.minWidth;
+ maxWidth = style.maxWidth;
+
+ // Put in the new values to get a computed value out
+ style.minWidth = style.maxWidth = style.width = ret;
+ ret = computed.width;
+
+ // Revert the changed values
+ style.width = width;
+ style.minWidth = minWidth;
+ style.maxWidth = maxWidth;
+ }
+ }
+
+ return ret;
+ };
+} else if ( document.documentElement.currentStyle ) {
+ getStyles = function( elem ) {
+ return elem.currentStyle;
+ };
+
+ curCSS = function( elem, name, _computed ) {
+ var left, rs, rsLeft,
+ computed = _computed || getStyles( elem ),
+ ret = computed ? computed[ name ] : undefined,
+ style = elem.style;
+
+ // Avoid setting ret to empty string here
+ // so we don't default to auto
+ if ( ret == null && style && style[ name ] ) {
+ ret = style[ name ];
+ }
+
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ // but not position css attributes, as those are proportional to the parent element instead
+ // and we can't measure the parent instead because it might trigger a "stacking dolls" problem
+ if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) {
+
+ // Remember the original values
+ left = style.left;
+ rs = elem.runtimeStyle;
+ rsLeft = rs && rs.left;
+
+ // Put in the new values to get a computed value out
+ if ( rsLeft ) {
+ rs.left = elem.currentStyle.left;
+ }
+ style.left = name === "fontSize" ? "1em" : ret;
+ ret = style.pixelLeft + "px";
+
+ // Revert the changed values
+ style.left = left;
+ if ( rsLeft ) {
+ rs.left = rsLeft;
+ }
+ }
+
+ return ret === "" ? "auto" : ret;
+ };
+}
+
+function setPositiveNumber( elem, value, subtract ) {
+ var matches = rnumsplit.exec( value );
+ return matches ?
+ // Guard against undefined "subtract", e.g., when used as in cssHooks
+ Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) :
+ value;
+}
+
+function augmentWidthOrHeight( elem, name, extra, isBorderBox, styles ) {
+ var i = extra === ( isBorderBox ? "border" : "content" ) ?
+ // If we already have the right measurement, avoid augmentation
+ 4 :
+ // Otherwise initialize for horizontal or vertical properties
+ name === "width" ? 1 : 0,
+
+ val = 0;
+
+ for ( ; i < 4; i += 2 ) {
+ // both box models exclude margin, so add it if we want it
+ if ( extra === "margin" ) {
+ val += jQuery.css( elem, extra + cssExpand[ i ], true, styles );
+ }
+
+ if ( isBorderBox ) {
+ // border-box includes padding, so remove it if we want content
+ if ( extra === "content" ) {
+ val -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+ }
+
+ // at this point, extra isn't border nor margin, so remove border
+ if ( extra !== "margin" ) {
+ val -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+ }
+ } else {
+ // at this point, extra isn't content, so add padding
+ val += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+
+ // at this point, extra isn't content nor padding, so add border
+ if ( extra !== "padding" ) {
+ val += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+ }
+ }
+ }
+
+ return val;
+}
+
+function getWidthOrHeight( elem, name, extra ) {
+
+ // Start with offset property, which is equivalent to the border-box value
+ var valueIsBorderBox = true,
+ val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
+ styles = getStyles( elem ),
+ isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
+
+ // some non-html elements return undefined for offsetWidth, so check for null/undefined
+ // svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285
+ // MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668
+ if ( val <= 0 || val == null ) {
+ // Fall back to computed then uncomputed css if necessary
+ val = curCSS( elem, name, styles );
+ if ( val < 0 || val == null ) {
+ val = elem.style[ name ];
+ }
+
+ // Computed unit is not pixels. Stop here and return.
+ if ( rnumnonpx.test(val) ) {
+ return val;
+ }
+
+ // we need the check for style in case a browser which returns unreliable values
+ // for getComputedStyle silently falls back to the reliable elem.style
+ valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] );
+
+ // Normalize "", auto, and prepare for extra
+ val = parseFloat( val ) || 0;
+ }
+
+ // use the active box-sizing model to add/subtract irrelevant styles
+ return ( val +
+ augmentWidthOrHeight(
+ elem,
+ name,
+ extra || ( isBorderBox ? "border" : "content" ),
+ valueIsBorderBox,
+ styles
+ )
+ ) + "px";
+}
+
+// Try to determine the default display value of an element
+function css_defaultDisplay( nodeName ) {
+ var doc = document,
+ display = elemdisplay[ nodeName ];
+
+ if ( !display ) {
+ display = actualDisplay( nodeName, doc );
+
+ // If the simple way fails, read from inside an iframe
+ if ( display === "none" || !display ) {
+ // Use the already-created iframe if possible
+ iframe = ( iframe ||
+ jQuery("<iframe frameborder='0' width='0' height='0'/>")
+ .css( "cssText", "display:block !important" )
+ ).appendTo( doc.documentElement );
+
+ // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse
+ doc = ( iframe[0].contentWindow || iframe[0].contentDocument ).document;
+ doc.write("<!doctype html><html><body>");
+ doc.close();
+
+ display = actualDisplay( nodeName, doc );
+ iframe.detach();
+ }
+
+ // Store the correct default display
+ elemdisplay[ nodeName ] = display;
+ }
+
+ return display;
+}
+
+// Called ONLY from within css_defaultDisplay
+function actualDisplay( name, doc ) {
+ var elem = jQuery( doc.createElement( name ) ).appendTo( doc.body ),
+ display = jQuery.css( elem[0], "display" );
+ elem.remove();
+ return display;
+}
+
+jQuery.each([ "height", "width" ], function( i, name ) {
+ jQuery.cssHooks[ name ] = {
+ get: function( elem, computed, extra ) {
+ if ( computed ) {
+ // certain elements can have dimension info if we invisibly show them
+ // however, it must have a current display style that would benefit from this
+ return elem.offsetWidth === 0 && rdisplayswap.test( jQuery.css( elem, "display" ) ) ?
+ jQuery.swap( elem, cssShow, function() {
+ return getWidthOrHeight( elem, name, extra );
+ }) :
+ getWidthOrHeight( elem, name, extra );
+ }
+ },
+
+ set: function( elem, value, extra ) {
+ var styles = extra && getStyles( elem );
+ return setPositiveNumber( elem, value, extra ?
+ augmentWidthOrHeight(
+ elem,
+ name,
+ extra,
+ jQuery.support.boxSizing && jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+ styles
+ ) : 0
+ );
+ }
+ };
+});
+
+if ( !jQuery.support.opacity ) {
+ jQuery.cssHooks.opacity = {
+ get: function( elem, computed ) {
+ // IE uses filters for opacity
+ return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ?
+ ( 0.01 * parseFloat( RegExp.$1 ) ) + "" :
+ computed ? "1" : "";
+ },
+
+ set: function( elem, value ) {
+ var style = elem.style,
+ currentStyle = elem.currentStyle,
+ opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "",
+ filter = currentStyle && currentStyle.filter || style.filter || "";
+
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ style.zoom = 1;
+
+ // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652
+ // if value === "", then remove inline opacity #12685
+ if ( ( value >= 1 || value === "" ) &&
+ jQuery.trim( filter.replace( ralpha, "" ) ) === "" &&
+ style.removeAttribute ) {
+
+ // Setting style.filter to null, "" & " " still leave "filter:" in the cssText
+ // if "filter:" is present at all, clearType is disabled, we want to avoid this
+ // style.removeAttribute is IE Only, but so apparently is this code path...
+ style.removeAttribute( "filter" );
+
+ // if there is no filter style applied in a css rule or unset inline opacity, we are done
+ if ( value === "" || currentStyle && !currentStyle.filter ) {
+ return;
+ }
+ }
+
+ // otherwise, set new filter values
+ style.filter = ralpha.test( filter ) ?
+ filter.replace( ralpha, opacity ) :
+ filter + " " + opacity;
+ }
+ };
+}
+
+// These hooks cannot be added until DOM ready because the support test
+// for it is not run until after DOM ready
+jQuery(function() {
+ if ( !jQuery.support.reliableMarginRight ) {
+ jQuery.cssHooks.marginRight = {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ // Work around by temporarily setting element display to inline-block
+ return jQuery.swap( elem, { "display": "inline-block" },
+ curCSS, [ elem, "marginRight" ] );
+ }
+ }
+ };
+ }
+
+ // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+ // getComputedStyle returns percent when specified for top/left/bottom/right
+ // rather than make the css module depend on the offset module, we just check for it here
+ if ( !jQuery.support.pixelPosition && jQuery.fn.position ) {
+ jQuery.each( [ "top", "left" ], function( i, prop ) {
+ jQuery.cssHooks[ prop ] = {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ computed = curCSS( elem, prop );
+ // if curCSS returns percentage, fallback to offset
+ return rnumnonpx.test( computed ) ?
+ jQuery( elem ).position()[ prop ] + "px" :
+ computed;
+ }
+ }
+ };
+ });
+ }
+
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.hidden = function( elem ) {
+ return ( elem.offsetWidth === 0 && elem.offsetHeight === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none");
+ };
+
+ jQuery.expr.filters.visible = function( elem ) {
+ return !jQuery.expr.filters.hidden( elem );
+ };
+}
+
+// These hooks are used by animate to expand properties
+jQuery.each({
+ margin: "",
+ padding: "",
+ border: "Width"
+}, function( prefix, suffix ) {
+ jQuery.cssHooks[ prefix + suffix ] = {
+ expand: function( value ) {
+ var i = 0,
+ expanded = {},
+
+ // assumes a single number if not a string
+ parts = typeof value === "string" ? value.split(" ") : [ value ];
+
+ for ( ; i < 4; i++ ) {
+ expanded[ prefix + cssExpand[ i ] + suffix ] =
+ parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
+ }
+
+ return expanded;
+ }
+ };
+
+ if ( !rmargin.test( prefix ) ) {
+ jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
+ }
+});
+var r20 = /%20/g,
+ rbracket = /\[\]$/,
+ rCRLF = /\r?\n/g,
+ rsubmitterTypes = /^(?:submit|button|image|reset)$/i,
+ rsubmittable = /^(?:input|select|textarea|keygen)/i;
+
+jQuery.fn.extend({
+ serialize: function() {
+ return jQuery.param( this.serializeArray() );
+ },
+ serializeArray: function() {
+ return this.map(function(){
+ // Can add propHook for "elements" to filter or add form elements
+ var elements = jQuery.prop( this, "elements" );
+ return elements ? jQuery.makeArray( elements ) : this;
+ })
+ .filter(function(){
+ var type = this.type;
+ // Use .is(":disabled") so that fieldset[disabled] works
+ return this.name && !jQuery( this ).is( ":disabled" ) &&
+ rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
+ ( this.checked || !manipulation_rcheckableType.test( type ) );
+ })
+ .map(function( i, elem ){
+ var val = jQuery( this ).val();
+
+ return val == null ?
+ null :
+ jQuery.isArray( val ) ?
+ jQuery.map( val, function( val ){
+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }) :
+ { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }).get();
+ }
+});
+
+//Serialize an array of form elements or a set of
+//key/values into a query string
+jQuery.param = function( a, traditional ) {
+ var prefix,
+ s = [],
+ add = function( key, value ) {
+ // If value is a function, invoke it and return its value
+ value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value );
+ s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
+ };
+
+ // Set traditional to true for jQuery <= 1.3.2 behavior.
+ if ( traditional === undefined ) {
+ traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
+ }
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+ // Serialize the form elements
+ jQuery.each( a, function() {
+ add( this.name, this.value );
+ });
+
+ } else {
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for ( prefix in a ) {
+ buildParams( prefix, a[ prefix ], traditional, add );
+ }
+ }
+
+ // Return the resulting serialization
+ return s.join( "&" ).replace( r20, "+" );
+};
+
+function buildParams( prefix, obj, traditional, add ) {
+ var name;
+
+ if ( jQuery.isArray( obj ) ) {
+ // Serialize array item.
+ jQuery.each( obj, function( i, v ) {
+ if ( traditional || rbracket.test( prefix ) ) {
+ // Treat each array item as a scalar.
+ add( prefix, v );
+
+ } else {
+ // Item is non-scalar (array or object), encode its numeric index.
+ buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add );
+ }
+ });
+
+ } else if ( !traditional && jQuery.type( obj ) === "object" ) {
+ // Serialize object item.
+ for ( name in obj ) {
+ buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+ }
+
+ } else {
+ // Serialize scalar item.
+ add( prefix, obj );
+ }
+}
+var
+ // Document location
+ ajaxLocParts,
+ ajaxLocation,
+
+ ajax_nonce = jQuery.now(),
+
+ ajax_rquery = /\?/,
+ rhash = /#.*$/,
+ rts = /([?&])_=[^&]*/,
+ rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
+ // #7653, #8125, #8152: local protocol detection
+ rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
+ rnoContent = /^(?:GET|HEAD)$/,
+ rprotocol = /^\/\//,
+ rurl = /^([\w.+-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,
+
+ // Keep a copy of the old load method
+ _load = jQuery.fn.load,
+
+ /* Prefilters
+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+ * 2) These are called:
+ * - BEFORE asking for a transport
+ * - AFTER param serialization (s.data is a string if s.processData is true)
+ * 3) key is the dataType
+ * 4) the catchall symbol "*" can be used
+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+ */
+ prefilters = {},
+
+ /* Transports bindings
+ * 1) key is the dataType
+ * 2) the catchall symbol "*" can be used
+ * 3) selection will start with transport dataType and THEN go to "*" if needed
+ */
+ transports = {},
+
+ // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
+ allTypes = "*/".concat("*");
+
+// #8138, IE may throw an exception when accessing
+// a field from window.location if document.domain has been set
+try {
+ ajaxLocation = location.href;
+} catch( e ) {
+ // Use the href attribute of an A element
+ // since IE will modify it given document.location
+ ajaxLocation = document.createElement( "a" );
+ ajaxLocation.href = "";
+ ajaxLocation = ajaxLocation.href;
+}
+
+// Segment location into parts
+ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+ // dataTypeExpression is optional and defaults to "*"
+ return function( dataTypeExpression, func ) {
+
+ if ( typeof dataTypeExpression !== "string" ) {
+ func = dataTypeExpression;
+ dataTypeExpression = "*";
+ }
+
+ var dataType,
+ i = 0,
+ dataTypes = dataTypeExpression.toLowerCase().match( core_rnotwhite ) || [];
+
+ if ( jQuery.isFunction( func ) ) {
+ // For each dataType in the dataTypeExpression
+ while ( (dataType = dataTypes[i++]) ) {
+ // Prepend if requested
+ if ( dataType[0] === "+" ) {
+ dataType = dataType.slice( 1 ) || "*";
+ (structure[ dataType ] = structure[ dataType ] || []).unshift( func );
+
+ // Otherwise append
+ } else {
+ (structure[ dataType ] = structure[ dataType ] || []).push( func );
+ }
+ }
+ }
+ };
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
+
+ var inspected = {},
+ seekingTransport = ( structure === transports );
+
+ function inspect( dataType ) {
+ var selected;
+ inspected[ dataType ] = true;
+ jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
+ var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
+ if( typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[ dataTypeOrTransport ] ) {
+ options.dataTypes.unshift( dataTypeOrTransport );
+ inspect( dataTypeOrTransport );
+ return false;
+ } else if ( seekingTransport ) {
+ return !( selected = dataTypeOrTransport );
+ }
+ });
+ return selected;
+ }
+
+ return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
+}
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes #9887
+function ajaxExtend( target, src ) {
+ var key, deep,
+ flatOptions = jQuery.ajaxSettings.flatOptions || {};
+
+ for ( key in src ) {
+ if ( src[ key ] !== undefined ) {
+ ( flatOptions[ key ] ? target : ( deep || (deep = {}) ) )[ key ] = src[ key ];
+ }
+ }
+ if ( deep ) {
+ jQuery.extend( true, target, deep );
+ }
+
+ return target;
+}
+
+jQuery.fn.load = function( url, params, callback ) {
+ if ( typeof url !== "string" && _load ) {
+ return _load.apply( this, arguments );
+ }
+
+ var selector, type, response,
+ self = this,
+ off = url.indexOf(" ");
+
+ if ( off >= 0 ) {
+ selector = url.slice( off, url.length );
+ url = url.slice( 0, off );
+ }
+
+ // If it's a function
+ if ( jQuery.isFunction( params ) ) {
+
+ // We assume that it's the callback
+ callback = params;
+ params = undefined;
+
+ // Otherwise, build a param string
+ } else if ( params && typeof params === "object" ) {
+ type = "POST";
+ }
+
+ // If we have elements to modify, make the request
+ if ( self.length > 0 ) {
+ jQuery.ajax({
+ url: url,
+
+ // if "type" variable is undefined, then "GET" method will be used
+ type: type,
+ dataType: "html",
+ data: params
+ }).done(function( responseText ) {
+
+ // Save response for use in complete callback
+ response = arguments;
+
+ self.html( selector ?
+
+ // If a selector was specified, locate the right elements in a dummy div
+ // Exclude scripts to avoid IE 'Permission Denied' errors
+ jQuery("<div>").append( jQuery.parseHTML( responseText ) ).find( selector ) :
+
+ // Otherwise use the full result
+ responseText );
+
+ }).complete( callback && function( jqXHR, status ) {
+ self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] );
+ });
+ }
+
+ return this;
+};
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( [ "ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend" ], function( i, type ){
+ jQuery.fn[ type ] = function( fn ){
+ return this.on( type, fn );
+ };
+});
+
+jQuery.each( [ "get", "post" ], function( i, method ) {
+ jQuery[ method ] = function( url, data, callback, type ) {
+ // shift arguments if data argument was omitted
+ if ( jQuery.isFunction( data ) ) {
+ type = type || callback;
+ callback = data;
+ data = undefined;
+ }
+
+ return jQuery.ajax({
+ url: url,
+ type: method,
+ dataType: type,
+ data: data,
+ success: callback
+ });
+ };
+});
+
+jQuery.extend({
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+ etag: {},
+
+ ajaxSettings: {
+ url: ajaxLocation,
+ type: "GET",
+ isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
+ global: true,
+ processData: true,
+ async: true,
+ contentType: "application/x-www-form-urlencoded; charset=UTF-8",
+ /*
+ timeout: 0,
+ data: null,
+ dataType: null,
+ username: null,
+ password: null,
+ cache: null,
+ throws: false,
+ traditional: false,
+ headers: {},
+ */
+
+ accepts: {
+ "*": allTypes,
+ text: "text/plain",
+ html: "text/html",
+ xml: "application/xml, text/xml",
+ json: "application/json, text/javascript"
+ },
+
+ contents: {
+ xml: /xml/,
+ html: /html/,
+ json: /json/
+ },
+
+ responseFields: {
+ xml: "responseXML",
+ text: "responseText"
+ },
+
+ // Data converters
+ // Keys separate source (or catchall "*") and destination types with a single space
+ converters: {
+
+ // Convert anything to text
+ "* text": window.String,
+
+ // Text to html (true = no transformation)
+ "text html": true,
+
+ // Evaluate text as a json expression
+ "text json": jQuery.parseJSON,
+
+ // Parse text as xml
+ "text xml": jQuery.parseXML
+ },
+
+ // For options that shouldn't be deep extended:
+ // you can add your own custom options here if
+ // and when you create one that shouldn't be
+ // deep extended (see ajaxExtend)
+ flatOptions: {
+ url: true,
+ context: true
+ }
+ },
+
+ // Creates a full fledged settings object into target
+ // with both ajaxSettings and settings fields.
+ // If target is omitted, writes into ajaxSettings.
+ ajaxSetup: function( target, settings ) {
+ return settings ?
+
+ // Building a settings object
+ ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
+
+ // Extending ajaxSettings
+ ajaxExtend( jQuery.ajaxSettings, target );
+ },
+
+ ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+ ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+ // Main method
+ ajax: function( url, options ) {
+
+ // If url is an object, simulate pre-1.5 signature
+ if ( typeof url === "object" ) {
+ options = url;
+ url = undefined;
+ }
+
+ // Force options to be an object
+ options = options || {};
+
+ var transport,
+ // URL without anti-cache param
+ cacheURL,
+ // Response headers
+ responseHeadersString,
+ responseHeaders,
+ // timeout handle
+ timeoutTimer,
+ // Cross-domain detection vars
+ parts,
+ // To know if global events are to be dispatched
+ fireGlobals,
+ // Loop variable
+ i,
+ // Create the final options object
+ s = jQuery.ajaxSetup( {}, options ),
+ // Callbacks context
+ callbackContext = s.context || s,
+ // Context for global events is callbackContext if it is a DOM node or jQuery collection
+ globalEventContext = s.context && ( callbackContext.nodeType || callbackContext.jquery ) ?
+ jQuery( callbackContext ) :
+ jQuery.event,
+ // Deferreds
+ deferred = jQuery.Deferred(),
+ completeDeferred = jQuery.Callbacks("once memory"),
+ // Status-dependent callbacks
+ statusCode = s.statusCode || {},
+ // Headers (they are sent all at once)
+ requestHeaders = {},
+ requestHeadersNames = {},
+ // The jqXHR state
+ state = 0,
+ // Default abort message
+ strAbort = "canceled",
+ // Fake xhr
+ jqXHR = {
+ readyState: 0,
+
+ // Builds headers hashtable if needed
+ getResponseHeader: function( key ) {
+ var match;
+ if ( state === 2 ) {
+ if ( !responseHeaders ) {
+ responseHeaders = {};
+ while ( (match = rheaders.exec( responseHeadersString )) ) {
+ responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
+ }
+ }
+ match = responseHeaders[ key.toLowerCase() ];
+ }
+ return match == null ? null : match;
+ },
+
+ // Raw string
+ getAllResponseHeaders: function() {
+ return state === 2 ? responseHeadersString : null;
+ },
+
+ // Caches the header
+ setRequestHeader: function( name, value ) {
+ var lname = name.toLowerCase();
+ if ( !state ) {
+ name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
+ requestHeaders[ name ] = value;
+ }
+ return this;
+ },
+
+ // Overrides response content-type header
+ overrideMimeType: function( type ) {
+ if ( !state ) {
+ s.mimeType = type;
+ }
+ return this;
+ },
+
+ // Status-dependent callbacks
+ statusCode: function( map ) {
+ var code;
+ if ( map ) {
+ if ( state < 2 ) {
+ for ( code in map ) {
+ // Lazy-add the new callback in a way that preserves old ones
+ statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
+ }
+ } else {
+ // Execute the appropriate callbacks
+ jqXHR.always( map[ jqXHR.status ] );
+ }
+ }
+ return this;
+ },
+
+ // Cancel the request
+ abort: function( statusText ) {
+ var finalText = statusText || strAbort;
+ if ( transport ) {
+ transport.abort( finalText );
+ }
+ done( 0, finalText );
+ return this;
+ }
+ };
+
+ // Attach deferreds
+ deferred.promise( jqXHR ).complete = completeDeferred.add;
+ jqXHR.success = jqXHR.done;
+ jqXHR.error = jqXHR.fail;
+
+ // Remove hash character (#7531: and string promotion)
+ // Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+ // Handle falsy url in the settings object (#10093: consistency with old signature)
+ // We also use the url parameter if available
+ s.url = ( ( url || s.url || ajaxLocation ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+
+ // Alias method option to type as per ticket #12004
+ s.type = options.method || options.type || s.method || s.type;
+
+ // Extract dataTypes list
+ s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().match( core_rnotwhite ) || [""];
+
+ // A cross-domain request is in order when we have a protocol:host:port mismatch
+ if ( s.crossDomain == null ) {
+ parts = rurl.exec( s.url.toLowerCase() );
+ s.crossDomain = !!( parts &&
+ ( parts[ 1 ] !== ajaxLocParts[ 1 ] || parts[ 2 ] !== ajaxLocParts[ 2 ] ||
+ ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
+ ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) )
+ );
+ }
+
+ // Convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" ) {
+ s.data = jQuery.param( s.data, s.traditional );
+ }
+
+ // Apply prefilters
+ inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+ // If request was aborted inside a prefilter, stop there
+ if ( state === 2 ) {
+ return jqXHR;
+ }
+
+ // We can fire global events as of now if asked to
+ fireGlobals = s.global;
+
+ // Watch for a new set of requests
+ if ( fireGlobals && jQuery.active++ === 0 ) {
+ jQuery.event.trigger("ajaxStart");
+ }
+
+ // Uppercase the type
+ s.type = s.type.toUpperCase();
+
+ // Determine if request has content
+ s.hasContent = !rnoContent.test( s.type );
+
+ // Save the URL in case we're toying with the If-Modified-Since
+ // and/or If-None-Match header later on
+ cacheURL = s.url;
+
+ // More options handling for requests with no content
+ if ( !s.hasContent ) {
+
+ // If data is available, append data to url
+ if ( s.data ) {
+ cacheURL = ( s.url += ( ajax_rquery.test( cacheURL ) ? "&" : "?" ) + s.data );
+ // #9682: remove data so that it's not used in an eventual retry
+ delete s.data;
+ }
+
+ // Add anti-cache in url if needed
+ if ( s.cache === false ) {
+ s.url = rts.test( cacheURL ) ?
+
+ // If there is already a '_' parameter, set its value
+ cacheURL.replace( rts, "$1_=" + ajax_nonce++ ) :
+
+ // Otherwise add one to the end
+ cacheURL + ( ajax_rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ajax_nonce++;
+ }
+ }
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ if ( jQuery.lastModified[ cacheURL ] ) {
+ jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
+ }
+ if ( jQuery.etag[ cacheURL ] ) {
+ jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
+ }
+ }
+
+ // Set the correct header, if data is being sent
+ if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+ jqXHR.setRequestHeader( "Content-Type", s.contentType );
+ }
+
+ // Set the Accepts header for the server, depending on the dataType
+ jqXHR.setRequestHeader(
+ "Accept",
+ s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
+ s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+ s.accepts[ "*" ]
+ );
+
+ // Check for headers option
+ for ( i in s.headers ) {
+ jqXHR.setRequestHeader( i, s.headers[ i ] );
+ }
+
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
+ // Abort if not done already and return
+ return jqXHR.abort();
+ }
+
+ // aborting is no longer a cancellation
+ strAbort = "abort";
+
+ // Install callbacks on deferreds
+ for ( i in { success: 1, error: 1, complete: 1 } ) {
+ jqXHR[ i ]( s[ i ] );
+ }
+
+ // Get transport
+ transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+ // If no transport, we auto-abort
+ if ( !transport ) {
+ done( -1, "No Transport" );
+ } else {
+ jqXHR.readyState = 1;
+
+ // Send global event
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+ }
+ // Timeout
+ if ( s.async && s.timeout > 0 ) {
+ timeoutTimer = setTimeout(function() {
+ jqXHR.abort("timeout");
+ }, s.timeout );
+ }
+
+ try {
+ state = 1;
+ transport.send( requestHeaders, done );
+ } catch ( e ) {
+ // Propagate exception as error if not done
+ if ( state < 2 ) {
+ done( -1, e );
+ // Simply rethrow otherwise
+ } else {
+ throw e;
+ }
+ }
+ }
+
+ // Callback for when everything is done
+ function done( status, nativeStatusText, responses, headers ) {
+ var isSuccess, success, error, response, modified,
+ statusText = nativeStatusText;
+
+ // Called once
+ if ( state === 2 ) {
+ return;
+ }
+
+ // State is "done" now
+ state = 2;
+
+ // Clear timeout if it exists
+ if ( timeoutTimer ) {
+ clearTimeout( timeoutTimer );
+ }
+
+ // Dereference transport for early garbage collection
+ // (no matter how long the jqXHR object will be used)
+ transport = undefined;
+
+ // Cache response headers
+ responseHeadersString = headers || "";
+
+ // Set readyState
+ jqXHR.readyState = status > 0 ? 4 : 0;
+
+ // Get response data
+ if ( responses ) {
+ response = ajaxHandleResponses( s, jqXHR, responses );
+ }
+
+ // If successful, handle type chaining
+ if ( status >= 200 && status < 300 || status === 304 ) {
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ modified = jqXHR.getResponseHeader("Last-Modified");
+ if ( modified ) {
+ jQuery.lastModified[ cacheURL ] = modified;
+ }
+ modified = jqXHR.getResponseHeader("etag");
+ if ( modified ) {
+ jQuery.etag[ cacheURL ] = modified;
+ }
+ }
+
+ // If not modified
+ if ( status === 304 ) {
+ isSuccess = true;
+ statusText = "notmodified";
+
+ // If we have data
+ } else {
+ isSuccess = ajaxConvert( s, response );
+ statusText = isSuccess.state;
+ success = isSuccess.data;
+ error = isSuccess.error;
+ isSuccess = !error;
+ }
+ } else {
+ // We extract error from statusText
+ // then normalize statusText and status for non-aborts
+ error = statusText;
+ if ( status || !statusText ) {
+ statusText = "error";
+ if ( status < 0 ) {
+ status = 0;
+ }
+ }
+ }
+
+ // Set data for the fake xhr object
+ jqXHR.status = status;
+ jqXHR.statusText = ( nativeStatusText || statusText ) + "";
+
+ // Success/Error
+ if ( isSuccess ) {
+ deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+ } else {
+ deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+ }
+
+ // Status-dependent callbacks
+ jqXHR.statusCode( statusCode );
+ statusCode = undefined;
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
+ [ jqXHR, s, isSuccess ? success : error ] );
+ }
+
+ // Complete
+ completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
+ // Handle the global AJAX counter
+ if ( !( --jQuery.active ) ) {
+ jQuery.event.trigger("ajaxStop");
+ }
+ }
+ }
+
+ return jqXHR;
+ },
+
+ getScript: function( url, callback ) {
+ return jQuery.get( url, undefined, callback, "script" );
+ },
+
+ getJSON: function( url, data, callback ) {
+ return jQuery.get( url, data, callback, "json" );
+ }
+});
+
+/* Handles responses to an ajax request:
+ * - sets all responseXXX fields accordingly
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
*/
-(function(){var R=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g,L=0,H=Object.prototype.toString;var F=function(Y,U,ab,ac){ab=ab||[];U=U||document;if(U.nodeType!==1&&U.nodeType!==9){return[]}if(!Y||typeof Y!=="string"){return ab}var Z=[],W,af,ai,T,ad,V,X=true;R.lastIndex=0;while((W=R.exec(Y))!==null){Z.push(W[1]);if(W[2]){V=RegExp.rightContext;break}}if(Z.length>1&&M.exec(Y)){if(Z.length===2&&I.relative[Z[0]]){af=J(Z[0]+Z[1],U)}else{af=I.relative[Z[0]]?[U]:F(Z.shift(),U);while(Z.length){Y=Z.shift();if(I.relative[Y]){Y+=Z.shift()}af=J(Y,af)}}}else{var ae=ac?{expr:Z.pop(),set:E(ac)}:F.find(Z.pop(),Z.length===1&&U.parentNode?U.parentNode:U,Q(U));af=F.filter(ae.expr,ae.set);if(Z.length>0){ai=E(af)}else{X=false}while(Z.length){var ah=Z.pop(),ag=ah;if(!I.relative[ah]){ah=""}else{ag=Z.pop()}if(ag==null){ag=U}I.relative[ah](ai,ag,Q(U))}}if(!ai){ai=af}if(!ai){throw"Syntax error, unrecognized expression: "+(ah||Y)}if(H.call(ai)==="[object Array]"){if(!X){ab.push.apply(ab,ai)}else{if(U.nodeType===1){for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&(ai[aa]===true||ai[aa].nodeType===1&&K(U,ai[aa]))){ab.push(af[aa])}}}else{for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&ai[aa].nodeType===1){ab.push(af[aa])}}}}}else{E(ai,ab)}if(V){F(V,U,ab,ac);if(G){hasDuplicate=false;ab.sort(G);if(hasDuplicate){for(var aa=1;aa<ab.length;aa++){if(ab[aa]===ab[aa-1]){ab.splice(aa--,1)}}}}}return ab};F.matches=function(T,U){return F(T,null,null,U)};F.find=function(aa,T,ab){var Z,X;if(!aa){return[]}for(var W=0,V=I.order.length;W<V;W++){var Y=I.order[W],X;if((X=I.match[Y].exec(aa))){var U=RegExp.leftContext;if(U.substr(U.length-1)!=="\\"){X[1]=(X[1]||"").replace(/\\/g,"");Z=I.find[Y](X,T,ab);if(Z!=null){aa=aa.replace(I.match[Y],"");break}}}}if(!Z){Z=T.getElementsByTagName("*")}return{set:Z,expr:aa}};F.filter=function(ad,ac,ag,W){var V=ad,ai=[],aa=ac,Y,T,Z=ac&&ac[0]&&Q(ac[0]);while(ad&&ac.length){for(var ab in I.filter){if((Y=I.match[ab].exec(ad))!=null){var U=I.filter[ab],ah,af;T=false;if(aa==ai){ai=[]}if(I.preFilter[ab]){Y=I.preFilter[ab](Y,aa,ag,ai,W,Z);if(!Y){T=ah=true}else{if(Y===true){continue}}}if(Y){for(var X=0;(af=aa[X])!=null;X++){if(af){ah=U(af,Y,X,aa);var ae=W^!!ah;if(ag&&ah!=null){if(ae){T=true}else{aa[X]=false}}else{if(ae){ai.push(af);T=true}}}}}if(ah!==g){if(!ag){aa=ai}ad=ad.replace(I.match[ab],"");if(!T){return[]}break}}}if(ad==V){if(T==null){throw"Syntax error, unrecognized expression: "+ad}else{break}}V=ad}return aa};var I=F.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(T){return T.getAttribute("href")}},relative:{"+":function(aa,T,Z){var X=typeof T==="string",ab=X&&!/\W/.test(T),Y=X&&!ab;if(ab&&!Z){T=T.toUpperCase()}for(var W=0,V=aa.length,U;W<V;W++){if((U=aa[W])){while((U=U.previousSibling)&&U.nodeType!==1){}aa[W]=Y||U&&U.nodeName===T?U||false:U===T}}if(Y){F.filter(T,aa,true)}},">":function(Z,U,aa){var X=typeof U==="string";if(X&&!/\W/.test(U)){U=aa?U:U.toUpperCase();for(var V=0,T=Z.length;V<T;V++){var Y=Z[V];if(Y){var W=Y.parentNode;Z[V]=W.nodeName===U?W:false}}}else{for(var V=0,T=Z.length;V<T;V++){var Y=Z[V];if(Y){Z[V]=X?Y.parentNode:Y.parentNode===U}}if(X){F.filter(U,Z,true)}}},"":function(W,U,Y){var V=L++,T=S;if(!U.match(/\W/)){var X=U=Y?U:U.toUpperCase();T=P}T("parentNode",U,V,W,X,Y)},"~":function(W,U,Y){var V=L++,T=S;if(typeof U==="string"&&!U.match(/\W/)){var X=U=Y?U:U.toUpperCase();T=P}T("previousSibling",U,V,W,X,Y)}},find:{ID:function(U,V,W){if(typeof V.getElementById!=="undefined"&&!W){var T=V.getElementById(U[1]);return T?[T]:[]}},NAME:function(V,Y,Z){if(typeof Y.getElementsByName!=="undefined"){var U=[],X=Y.getElementsByName(V[1]);for(var W=0,T=X.length;W<T;W++){if(X[W].getAttribute("name")===V[1]){U.push(X[W])}}return U.length===0?null:U}},TAG:function(T,U){return U.getElementsByTagName(T[1])}},preFilter:{CLASS:function(W,U,V,T,Z,aa){W=" "+W[1].replace(/\\/g,"")+" ";if(aa){return W}for(var X=0,Y;(Y=U[X])!=null;X++){if(Y){if(Z^(Y.className&&(" "+Y.className+" ").indexOf(W)>=0)){if(!V){T.push(Y)}}else{if(V){U[X]=false}}}}return false},ID:function(T){return T[1].replace(/\\/g,"")},TAG:function(U,T){for(var V=0;T[V]===false;V++){}return T[V]&&Q(T[V])?U[1]:U[1].toUpperCase()},CHILD:function(T){if(T[1]=="nth"){var U=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(T[2]=="even"&&"2n"||T[2]=="odd"&&"2n+1"||!/\D/.test(T[2])&&"0n+"+T[2]||T[2]);T[2]=(U[1]+(U[2]||1))-0;T[3]=U[3]-0}T[0]=L++;return T},ATTR:function(X,U,V,T,Y,Z){var W=X[1].replace(/\\/g,"");if(!Z&&I.attrMap[W]){X[1]=I.attrMap[W]}if(X[2]==="~="){X[4]=" "+X[4]+" "}return X},PSEUDO:function(X,U,V,T,Y){if(X[1]==="not"){if(X[3].match(R).length>1||/^\w/.test(X[3])){X[3]=F(X[3],null,null,U)}else{var W=F.filter(X[3],U,V,true^Y);if(!V){T.push.apply(T,W)}return false}}else{if(I.match.POS.test(X[0])||I.match.CHILD.test(X[0])){return true}}return X},POS:function(T){T.unshift(true);return T}},filters:{enabled:function(T){return T.disabled===false&&T.type!=="hidden"},disabled:function(T){return T.disabled===true},checked:function(T){return T.checked===true},selected:function(T){T.parentNode.selectedIndex;return T.selected===true},parent:function(T){return !!T.firstChild},empty:function(T){return !T.firstChild},has:function(V,U,T){return !!F(T[3],V).length},header:function(T){return/h\d/i.test(T.nodeName)},text:function(T){return"text"===T.type},radio:function(T){return"radio"===T.type},checkbox:function(T){return"checkbox"===T.type},file:function(T){return"file"===T.type},password:function(T){return"password"===T.type},submit:function(T){return"submit"===T.type},image:function(T){return"image"===T.type},reset:function(T){return"reset"===T.type},button:function(T){return"button"===T.type||T.nodeName.toUpperCase()==="BUTTON"},input:function(T){return/input|select|textarea|button/i.test(T.nodeName)}},setFilters:{first:function(U,T){return T===0},last:function(V,U,T,W){return U===W.length-1},even:function(U,T){return T%2===0},odd:function(U,T){return T%2===1},lt:function(V,U,T){return U<T[3]-0},gt:function(V,U,T){return U>T[3]-0},nth:function(V,U,T){return T[3]-0==U},eq:function(V,U,T){return T[3]-0==U}},filter:{PSEUDO:function(Z,V,W,aa){var U=V[1],X=I.filters[U];if(X){return X(Z,W,V,aa)}else{if(U==="contains"){return(Z.textContent||Z.innerText||"").indexOf(V[3])>=0}else{if(U==="not"){var Y=V[3];for(var W=0,T=Y.length;W<T;W++){if(Y[W]===Z){return false}}return true}}}},CHILD:function(T,W){var Z=W[1],U=T;switch(Z){case"only":case"first":while(U=U.previousSibling){if(U.nodeType===1){return false}}if(Z=="first"){return true}U=T;case"last":while(U=U.nextSibling){if(U.nodeType===1){return false}}return true;case"nth":var V=W[2],ac=W[3];if(V==1&&ac==0){return true}var Y=W[0],ab=T.parentNode;if(ab&&(ab.sizcache!==Y||!T.nodeIndex)){var X=0;for(U=ab.firstChild;U;U=U.nextSibling){if(U.nodeType===1){U.nodeIndex=++X}}ab.sizcache=Y}var aa=T.nodeIndex-ac;if(V==0){return aa==0}else{return(aa%V==0&&aa/V>=0)}}},ID:function(U,T){return U.nodeType===1&&U.getAttribute("id")===T},TAG:function(U,T){return(T==="*"&&U.nodeType===1)||U.nodeName===T},CLASS:function(U,T){return(" "+(U.className||U.getAttribute("class"))+" ").indexOf(T)>-1},ATTR:function(Y,W){var V=W[1],T=I.attrHandle[V]?I.attrHandle[V](Y):Y[V]!=null?Y[V]:Y.getAttribute(V),Z=T+"",X=W[2],U=W[4];return T==null?X==="!=":X==="="?Z===U:X==="*="?Z.indexOf(U)>=0:X==="~="?(" "+Z+" ").indexOf(U)>=0:!U?Z&&T!==false:X==="!="?Z!=U:X==="^="?Z.indexOf(U)===0:X==="$="?Z.substr(Z.length-U.length)===U:X==="|="?Z===U||Z.substr(0,U.length+1)===U+"-":false},POS:function(X,U,V,Y){var T=U[2],W=I.setFilters[T];if(W){return W(X,V,U,Y)}}}};var M=I.match.POS;for(var O in I.match){I.match[O]=RegExp(I.match[O].source+/(?![^\[]*\])(?![^\(]*\))/.source)}var E=function(U,T){U=Array.prototype.slice.call(U);if(T){T.push.apply(T,U);return T}return U};try{Array.prototype.slice.call(document.documentElement.childNodes)}catch(N){E=function(X,W){var U=W||[];if(H.call(X)==="[object Array]"){Array.prototype.push.apply(U,X)}else{if(typeof X.length==="number"){for(var V=0,T=X.length;V<T;V++){U.push(X[V])}}else{for(var V=0;X[V];V++){U.push(X[V])}}}return U}}var G;if(document.documentElement.compareDocumentPosition){G=function(U,T){var V=U.compareDocumentPosition(T)&4?-1:U===T?0:1;if(V===0){hasDuplicate=true}return V}}else{if("sourceIndex" in document.documentElement){G=function(U,T){var V=U.sourceIndex-T.sourceIndex;if(V===0){hasDuplicate=true}return V}}else{if(document.createRange){G=function(W,U){var V=W.ownerDocument.createRange(),T=U.ownerDocument.createRange();V.selectNode(W);V.collapse(true);T.selectNode(U);T.collapse(true);var X=V.compareBoundaryPoints(Range.START_TO_END,T);if(X===0){hasDuplicate=true}return X}}}}(function(){var U=document.createElement("form"),V="script"+(new Date).getTime();U.innerHTML="<input name='"+V+"'/>";var T=document.documentElement;T.insertBefore(U,T.firstChild);if(!!document.getElementById(V)){I.find.ID=function(X,Y,Z){if(typeof Y.getElementById!=="undefined"&&!Z){var W=Y.getElementById(X[1]);return W?W.id===X[1]||typeof W.getAttributeNode!=="undefined"&&W.getAttributeNode("id").nodeValue===X[1]?[W]:g:[]}};I.filter.ID=function(Y,W){var X=typeof Y.getAttributeNode!=="undefined"&&Y.getAttributeNode("id");return Y.nodeType===1&&X&&X.nodeValue===W}}T.removeChild(U)})();(function(){var T=document.createElement("div");T.appendChild(document.createComment(""));if(T.getElementsByTagName("*").length>0){I.find.TAG=function(U,Y){var X=Y.getElementsByTagName(U[1]);if(U[1]==="*"){var W=[];for(var V=0;X[V];V++){if(X[V].nodeType===1){W.push(X[V])}}X=W}return X}}T.innerHTML="<a href='#'></a>";if(T.firstChild&&typeof T.firstChild.getAttribute!=="undefined"&&T.firstChild.getAttribute("href")!=="#"){I.attrHandle.href=function(U){return U.getAttribute("href",2)}}})();if(document.querySelectorAll){(function(){var T=F,U=document.createElement("div");U.innerHTML="<p class='TEST'></p>";if(U.querySelectorAll&&U.querySelectorAll(".TEST").length===0){return}F=function(Y,X,V,W){X=X||document;if(!W&&X.nodeType===9&&!Q(X)){try{return E(X.querySelectorAll(Y),V)}catch(Z){}}return T(Y,X,V,W)};F.find=T.find;F.filter=T.filter;F.selectors=T.selectors;F.matches=T.matches})()}if(document.getElementsByClassName&&document.documentElement.getElementsByClassName){(function(){var T=document.createElement("div");T.innerHTML="<div class='test e'></div><div class='test'></div>";if(T.getElementsByClassName("e").length===0){return}T.lastChild.className="e";if(T.getElementsByClassName("e").length===1){return}I.order.splice(1,0,"CLASS");I.find.CLASS=function(U,V,W){if(typeof V.getElementsByClassName!=="undefined"&&!W){return V.getElementsByClassName(U[1])}}})()}function P(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W<V;W++){var T=ad[W];if(T){if(ab&&T.nodeType===1){T.sizcache=Y;T.sizset=W}T=T[U];var X=false;while(T){if(T.sizcache===Y){X=ad[T.sizset];break}if(T.nodeType===1&&!ac){T.sizcache=Y;T.sizset=W}if(T.nodeName===Z){X=T;break}T=T[U]}ad[W]=X}}}function S(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W<V;W++){var T=ad[W];if(T){if(ab&&T.nodeType===1){T.sizcache=Y;T.sizset=W}T=T[U];var X=false;while(T){if(T.sizcache===Y){X=ad[T.sizset];break}if(T.nodeType===1){if(!ac){T.sizcache=Y;T.sizset=W}if(typeof Z!=="string"){if(T===Z){X=true;break}}else{if(F.filter(Z,[T]).length>0){X=T;break}}}T=T[U]}ad[W]=X}}}var K=document.compareDocumentPosition?function(U,T){return U.compareDocumentPosition(T)&16}:function(U,T){return U!==T&&(U.contains?U.contains(T):true)};var Q=function(T){return T.nodeType===9&&T.documentElement.nodeName!=="HTML"||!!T.ownerDocument&&Q(T.ownerDocument)};var J=function(T,aa){var W=[],X="",Y,V=aa.nodeType?[aa]:aa;while((Y=I.match.PSEUDO.exec(T))){X+=Y[0];T=T.replace(I.match.PSEUDO,"")}T=I.relative[T]?T+"*":T;for(var Z=0,U=V.length;Z<U;Z++){F(T,V[Z],W)}return F.filter(X,W)};o.find=F;o.filter=F.filter;o.expr=F.selectors;o.expr[":"]=o.expr.filters;F.selectors.filters.hidden=function(T){return T.offsetWidth===0||T.offsetHeight===0};F.selectors.filters.visible=function(T){return T.offsetWidth>0||T.offsetHeight>0};F.selectors.filters.animated=function(T){return o.grep(o.timers,function(U){return T===U.elem}).length};o.multiFilter=function(V,T,U){if(U){V=":not("+V+")"}return F.matches(V,T)};o.dir=function(V,U){var T=[],W=V[U];while(W&&W!=document){if(W.nodeType==1){T.push(W)}W=W[U]}return T};o.nth=function(X,T,V,W){T=T||1;var U=0;for(;X;X=X[V]){if(X.nodeType==1&&++U==T){break}}return X};o.sibling=function(V,U){var T=[];for(;V;V=V.nextSibling){if(V.nodeType==1&&V!=U){T.push(V)}}return T};return;l.Sizzle=F})();o.event={add:function(I,F,H,K){if(I.nodeType==3||I.nodeType==8){return}if(I.setInterval&&I!=l){I=l}if(!H.guid){H.guid=this.guid++}if(K!==g){var G=H;H=this.proxy(G);H.data=K}var E=o.data(I,"events")||o.data(I,"events",{}),J=o.data(I,"handle")||o.data(I,"handle",function(){return typeof o!=="undefined"&&!o.event.triggered?o.event.handle.apply(arguments.callee.elem,arguments):g});J.elem=I;o.each(F.split(/\s+/),function(M,N){var O=N.split(".");N=O.shift();H.type=O.slice().sort().join(".");var L=E[N];if(o.event.specialAll[N]){o.event.specialAll[N].setup.call(I,K,O)}if(!L){L=E[N]={};if(!o.event.special[N]||o.event.special[N].setup.call(I,K,O)===false){if(I.addEventListener){I.addEventListener(N,J,false)}else{if(I.attachEvent){I.attachEvent("on"+N,J)}}}}L[H.guid]=H;o.event.global[N]=true});I=null},guid:1,global:{},remove:function(K,H,J){if(K.nodeType==3||K.nodeType==8){return}var G=o.data(K,"events"),F,E;if(G){if(H===g||(typeof H==="string"&&H.charAt(0)==".")){for(var I in G){this.remove(K,I+(H||""))}}else{if(H.type){J=H.handler;H=H.type}o.each(H.split(/\s+/),function(M,O){var Q=O.split(".");O=Q.shift();var N=RegExp("(^|\\.)"+Q.slice().sort().join(".*\\.")+"(\\.|$)");if(G[O]){if(J){delete G[O][J.guid]}else{for(var P in G[O]){if(N.test(G[O][P].type)){delete G[O][P]}}}if(o.event.specialAll[O]){o.event.specialAll[O].teardown.call(K,Q)}for(F in G[O]){break}if(!F){if(!o.event.special[O]||o.event.special[O].teardown.call(K,Q)===false){if(K.removeEventListener){K.removeEventListener(O,o.data(K,"handle"),false)}else{if(K.detachEvent){K.detachEvent("on"+O,o.data(K,"handle"))}}}F=null;delete G[O]}}})}for(F in G){break}if(!F){var L=o.data(K,"handle");if(L){L.elem=null}o.removeData(K,"events");o.removeData(K,"handle")}}},trigger:function(I,K,H,E){var G=I.type||I;if(!E){I=typeof I==="object"?I[h]?I:o.extend(o.Event(G),I):o.Event(G);if(G.indexOf("!")>=0){I.type=G=G.slice(0,-1);I.exclusive=true}if(!H){I.stopPropagation();if(this.global[G]){o.each(o.cache,function(){if(this.events&&this.events[G]){o.event.trigger(I,K,this.handle.elem)}})}}if(!H||H.nodeType==3||H.nodeType==8){return g}I.result=g;I.target=H;K=o.makeArray(K);K.unshift(I)}I.currentTarget=H;var J=o.data(H,"handle");if(J){J.apply(H,K)}if((!H[G]||(o.nodeName(H,"a")&&G=="click"))&&H["on"+G]&&H["on"+G].apply(H,K)===false){I.result=false}if(!E&&H[G]&&!I.isDefaultPrevented()&&!(o.nodeName(H,"a")&&G=="click")){this.triggered=true;try{H[G]()}catch(L){}}this.triggered=false;if(!I.isPropagationStopped()){var F=H.parentNode||H.ownerDocument;if(F){o.event.trigger(I,K,F,true)}}},handle:function(K){var J,E;K=arguments[0]=o.event.fix(K||l.event);K.currentTarget=this;var L=K.type.split(".");K.type=L.shift();J=!L.length&&!K.exclusive;var I=RegExp("(^|\\.)"+L.slice().sort().join(".*\\.")+"(\\.|$)");E=(o.data(this,"events")||{})[K.type];for(var G in E){var H=E[G];if(J||I.test(H.type)){K.handler=H;K.data=H.data;var F=H.apply(this,arguments);if(F!==g){K.result=F;if(F===false){K.preventDefault();K.stopPropagation()}}if(K.isImmediatePropagationStopped()){break}}}},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(H){if(H[h]){return H}var F=H;H=o.Event(F);for(var G=this.props.length,J;G;){J=this.props[--G];H[J]=F[J]}if(!H.target){H.target=H.srcElement||document}if(H.target.nodeType==3){H.target=H.target.parentNode}if(!H.relatedTarget&&H.fromElement){H.relatedTarget=H.fromElement==H.target?H.toElement:H.fromElement}if(H.pageX==null&&H.clientX!=null){var I=document.documentElement,E=document.body;H.pageX=H.clientX+(I&&I.scrollLeft||E&&E.scrollLeft||0)-(I.clientLeft||0);H.pageY=H.clientY+(I&&I.scrollTop||E&&E.scrollTop||0)-(I.clientTop||0)}if(!H.which&&((H.charCode||H.charCode===0)?H.charCode:H.keyCode)){H.which=H.charCode||H.keyCode}if(!H.metaKey&&H.ctrlKey){H.metaKey=H.ctrlKey}if(!H.which&&H.button){H.which=(H.button&1?1:(H.button&2?3:(H.button&4?2:0)))}return H},proxy:function(F,E){E=E||function(){return F.apply(this,arguments)};E.guid=F.guid=F.guid||E.guid||this.guid++;return E},special:{ready:{setup:B,teardown:function(){}}},specialAll:{live:{setup:function(E,F){o.event.add(this,F[0],c)},teardown:function(G){if(G.length){var E=0,F=RegExp("(^|\\.)"+G[0]+"(\\.|$)");o.each((o.data(this,"events").live||{}),function(){if(F.test(this.type)){E++}});if(E<1){o.event.remove(this,G[0],c)}}}}}};o.Event=function(E){if(!this.preventDefault){return new o.Event(E)}if(E&&E.type){this.originalEvent=E;this.type=E.type}else{this.type=E}this.timeStamp=e();this[h]=true};function k(){return false}function u(){return true}o.Event.prototype={preventDefault:function(){this.isDefaultPrevented=u;var E=this.originalEvent;if(!E){return}if(E.preventDefault){E.preventDefault()}E.returnValue=false},stopPropagation:function(){this.isPropagationStopped=u;var E=this.originalEvent;if(!E){return}if(E.stopPropagation){E.stopPropagation()}E.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=u;this.stopPropagation()},isDefaultPrevented:k,isPropagationStopped:k,isImmediatePropagationStopped:k};var a=function(F){var E=F.relatedTarget;while(E&&E!=this){try{E=E.parentNode}catch(G){E=this}}if(E!=this){F.type=F.data;o.event.handle.apply(this,arguments)}};o.each({mouseover:"mouseenter",mouseout:"mouseleave"},function(F,E){o.event.special[E]={setup:function(){o.event.add(this,F,a,E)},teardown:function(){o.event.remove(this,F,a)}}});o.fn.extend({bind:function(F,G,E){return F=="unload"?this.one(F,G,E):this.each(function(){o.event.add(this,F,E||G,E&&G)})},one:function(G,H,F){var E=o.event.proxy(F||H,function(I){o(this).unbind(I,E);return(F||H).apply(this,arguments)});return this.each(function(){o.event.add(this,G,E,F&&H)})},unbind:function(F,E){return this.each(function(){o.event.remove(this,F,E)})},trigger:function(E,F){return this.each(function(){o.event.trigger(E,F,this)})},triggerHandler:function(E,G){if(this[0]){var F=o.Event(E);F.preventDefault();F.stopPropagation();o.event.trigger(F,G,this[0]);return F.result}},toggle:function(G){var E=arguments,F=1;while(F<E.length){o.event.proxy(G,E[F++])}return this.click(o.event.proxy(G,function(H){this.lastToggle=(this.lastToggle||0)%F;H.preventDefault();return E[this.lastToggle++].apply(this,arguments)||false}))},hover:function(E,F){return this.mouseenter(E).mouseleave(F)},ready:function(E){B();if(o.isReady){E.call(document,o)}else{o.readyList.push(E)}return this},live:function(G,F){var E=o.event.proxy(F);E.guid+=this.selector+G;o(document).bind(i(G,this.selector),this.selector,E);return this},die:function(F,E){o(document).unbind(i(F,this.selector),E?{guid:E.guid+this.selector+F}:null);return this}});function c(H){var E=RegExp("(^|\\.)"+H.type+"(\\.|$)"),G=true,F=[];o.each(o.data(this,"events").live||[],function(I,J){if(E.test(J.type)){var K=o(H.target).closest(J.data)[0];if(K){F.push({elem:K,fn:J})}}});F.sort(function(J,I){return o.data(J.elem,"closest")-o.data(I.elem,"closest")});o.each(F,function(){if(this.fn.call(this.elem,H,this.fn.data)===false){return(G=false)}});return G}function i(F,E){return["live",F,E.replace(/\./g,"`").replace(/ /g,"|")].join(".")}o.extend({isReady:false,readyList:[],ready:function(){if(!o.isReady){o.isReady=true;if(o.readyList){o.each(o.readyList,function(){this.call(document,o)});o.readyList=null}o(document).triggerHandler("ready")}}});var x=false;function B(){if(x){return}x=true;if(document.addEventListener){document.addEventListener("DOMContentLoaded",function(){document.removeEventListener("DOMContentLoaded",arguments.callee,false);o.ready()},false)}else{if(document.attachEvent){document.attachEvent("onreadystatechange",function(){if(document.readyState==="complete"){document.detachEvent("onreadystatechange",arguments.callee);o.ready()}});if(document.documentElement.doScroll&&l==l.top){(function(){if(o.isReady){return}try{document.documentElement.doScroll("left")}catch(E){setTimeout(arguments.callee,0);return}o.ready()})()}}}o.event.add(l,"load",o.ready)}o.each(("blur,focus,load,resize,scroll,unload,click,dblclick,mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave,change,select,submit,keydown,keypress,keyup,error").split(","),function(F,E){o.fn[E]=function(G){return G?this.bind(E,G):this.trigger(E)}});o(l).bind("unload",function(){for(var E in o.cache){if(E!=1&&o.cache[E].handle){o.event.remove(o.cache[E].handle.elem)}}});(function(){o.support={};var F=document.documentElement,G=document.createElement("script"),K=document.createElement("div"),J="script"+(new Date).getTime();K.style.display="none";K.innerHTML=' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>';var H=K.getElementsByTagName("*"),E=K.getElementsByTagName("a")[0];if(!H||!H.length||!E){return}o.support={leadingWhitespace:K.firstChild.nodeType==3,tbody:!K.getElementsByTagName("tbody").length,objectAll:!!K.getElementsByTagName("object")[0].getElementsByTagName("*").length,htmlSerialize:!!K.getElementsByTagName("link").length,style:/red/.test(E.getAttribute("style")),hrefNormalized:E.getAttribute("href")==="/a",opacity:E.style.opacity==="0.5",cssFloat:!!E.style.cssFloat,scriptEval:false,noCloneEvent:true,boxModel:null};G.type="text/javascript";try{G.appendChild(document.createTextNode("window."+J+"=1;"))}catch(I){}F.insertBefore(G,F.firstChild);if(l[J]){o.support.scriptEval=true;delete l[J]}F.removeChild(G);if(K.attachEvent&&K.fireEvent){K.attachEvent("onclick",function(){o.support.noCloneEvent=false;K.detachEvent("onclick",arguments.callee)});K.cloneNode(true).fireEvent("onclick")}o(function(){var L=document.createElement("div");L.style.width=L.style.paddingLeft="1px";document.body.appendChild(L);o.boxModel=o.support.boxModel=L.offsetWidth===2;document.body.removeChild(L).style.display="none"})})();var w=o.support.cssFloat?"cssFloat":"styleFloat";o.props={"for":"htmlFor","class":"className","float":w,cssFloat:w,styleFloat:w,readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",tabindex:"tabIndex"};o.fn.extend({_load:o.fn.load,load:function(G,J,K){if(typeof G!=="string"){return this._load(G)}var I=G.indexOf(" ");if(I>=0){var E=G.slice(I,G.length);G=G.slice(0,I)}var H="GET";if(J){if(o.isFunction(J)){K=J;J=null}else{if(typeof J==="object"){J=o.param(J);H="POST"}}}var F=this;o.ajax({url:G,type:H,dataType:"html",data:J,complete:function(M,L){if(L=="success"||L=="notmodified"){F.html(E?o("<div/>").append(M.responseText.replace(/<script(.|\s)*?\/script>/g,"")).find(E):M.responseText)}if(K){F.each(K,[M.responseText,L,M])}}});return this},serialize:function(){return o.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?o.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||/select|textarea/i.test(this.nodeName)||/text|hidden|password|search/i.test(this.type))}).map(function(E,F){var G=o(this).val();return G==null?null:o.isArray(G)?o.map(G,function(I,H){return{name:F.name,value:I}}):{name:F.name,value:G}}).get()}});o.each("ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","),function(E,F){o.fn[F]=function(G){return this.bind(F,G)}});var r=e();o.extend({get:function(E,G,H,F){if(o.isFunction(G)){H=G;G=null}return o.ajax({type:"GET",url:E,data:G,success:H,dataType:F})},getScript:function(E,F){return o.get(E,null,F,"script")},getJSON:function(E,F,G){return o.get(E,F,G,"json")},post:function(E,G,H,F){if(o.isFunction(G)){H=G;G={}}return o.ajax({type:"POST",url:E,data:G,success:H,dataType:F})},ajaxSetup:function(E){o.extend(o.ajaxSettings,E)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return l.ActiveXObject?new ActiveXObject("Microsoft.XMLHTTP"):new XMLHttpRequest()},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},ajax:function(M){M=o.extend(true,M,o.extend(true,{},o.ajaxSettings,M));var W,F=/=\?(&|$)/g,R,V,G=M.type.toUpperCase();if(M.data&&M.processData&&typeof M.data!=="string"){M.data=o.param(M.data)}if(M.dataType=="jsonp"){if(G=="GET"){if(!M.url.match(F)){M.url+=(M.url.match(/\?/)?"&":"?")+(M.jsonp||"callback")+"=?"}}else{if(!M.data||!M.data.match(F)){M.data=(M.data?M.data+"&":"")+(M.jsonp||"callback")+"=?"}}M.dataType="json"}if(M.dataType=="json"&&(M.data&&M.data.match(F)||M.url.match(F))){W="jsonp"+r++;if(M.data){M.data=(M.data+"").replace(F,"="+W+"$1")}M.url=M.url.replace(F,"="+W+"$1");M.dataType="script";l[W]=function(X){V=X;I();L();l[W]=g;try{delete l[W]}catch(Y){}if(H){H.removeChild(T)}}}if(M.dataType=="script"&&M.cache==null){M.cache=false}if(M.cache===false&&G=="GET"){var E=e();var U=M.url.replace(/(\?|&)_=.*?(&|$)/,"$1_="+E+"$2");M.url=U+((U==M.url)?(M.url.match(/\?/)?"&":"?")+"_="+E:"")}if(M.data&&G=="GET"){M.url+=(M.url.match(/\?/)?"&":"?")+M.data;M.data=null}if(M.global&&!o.active++){o.event.trigger("ajaxStart")}var Q=/^(\w+:)?\/\/([^\/?#]+)/.exec(M.url);if(M.dataType=="script"&&G=="GET"&&Q&&(Q[1]&&Q[1]!=location.protocol||Q[2]!=location.host)){var H=document.getElementsByTagName("head")[0];var T=document.createElement("script");T.src=M.url;if(M.scriptCharset){T.charset=M.scriptCharset}if(!W){var O=false;T.onload=T.onreadystatechange=function(){if(!O&&(!this.readyState||this.readyState=="loaded"||this.readyState=="complete")){O=true;I();L();T.onload=T.onreadystatechange=null;H.removeChild(T)}}}H.appendChild(T);return g}var K=false;var J=M.xhr();if(M.username){J.open(G,M.url,M.async,M.username,M.password)}else{J.open(G,M.url,M.async)}try{if(M.data){J.setRequestHeader("Content-Type",M.contentType)}if(M.ifModified){J.setRequestHeader("If-Modified-Since",o.lastModified[M.url]||"Thu, 01 Jan 1970 00:00:00 GMT")}J.setRequestHeader("X-Requested-With","XMLHttpRequest");J.setRequestHeader("Accept",M.dataType&&M.accepts[M.dataType]?M.accepts[M.dataType]+", */*":M.accepts._default)}catch(S){}if(M.beforeSend&&M.beforeSend(J,M)===false){if(M.global&&!--o.active){o.event.trigger("ajaxStop")}J.abort();return false}if(M.global){o.event.trigger("ajaxSend",[J,M])}var N=function(X){if(J.readyState==0){if(P){clearInterval(P);P=null;if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}}else{if(!K&&J&&(J.readyState==4||X=="timeout")){K=true;if(P){clearInterval(P);P=null}R=X=="timeout"?"timeout":!o.httpSuccess(J)?"error":M.ifModified&&o.httpNotModified(J,M.url)?"notmodified":"success";if(R=="success"){try{V=o.httpData(J,M.dataType,M)}catch(Z){R="parsererror"}}if(R=="success"){var Y;try{Y=J.getResponseHeader("Last-Modified")}catch(Z){}if(M.ifModified&&Y){o.lastModified[M.url]=Y}if(!W){I()}}else{o.handleError(M,J,R)}L();if(X){J.abort()}if(M.async){J=null}}}};if(M.async){var P=setInterval(N,13);if(M.timeout>0){setTimeout(function(){if(J&&!K){N("timeout")}},M.timeout)}}try{J.send(M.data)}catch(S){o.handleError(M,J,null,S)}if(!M.async){N()}function I(){if(M.success){M.success(V,R)}if(M.global){o.event.trigger("ajaxSuccess",[J,M])}}function L(){if(M.complete){M.complete(J,R)}if(M.global){o.event.trigger("ajaxComplete",[J,M])}if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}return J},handleError:function(F,H,E,G){if(F.error){F.error(H,E,G)}if(F.global){o.event.trigger("ajaxError",[H,F,G])}},active:0,httpSuccess:function(F){try{return !F.status&&location.protocol=="file:"||(F.status>=200&&F.status<300)||F.status==304||F.status==1223}catch(E){}return false},httpNotModified:function(G,E){try{var H=G.getResponseHeader("Last-Modified");return G.status==304||H==o.lastModified[E]}catch(F){}return false},httpData:function(J,H,G){var F=J.getResponseHeader("content-type"),E=H=="xml"||!H&&F&&F.indexOf("xml")>=0,I=E?J.responseXML:J.responseText;if(E&&I.documentElement.tagName=="parsererror"){throw"parsererror"}if(G&&G.dataFilter){I=G.dataFilter(I,H)}if(typeof I==="string"){if(H=="script"){o.globalEval(I)}if(H=="json"){I=l["eval"]("("+I+")")}}return I},param:function(E){var G=[];function H(I,J){G[G.length]=encodeURIComponent(I)+"="+encodeURIComponent(J)}if(o.isArray(E)||E.jquery){o.each(E,function(){H(this.name,this.value)})}else{for(var F in E){if(o.isArray(E[F])){o.each(E[F],function(){H(F,this)})}else{H(F,o.isFunction(E[F])?E[F]():E[F])}}}return G.join("&").replace(/%20/g,"+")}});var m={},n,d=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];function t(F,E){var G={};o.each(d.concat.apply([],d.slice(0,E)),function(){G[this]=F});return G}o.fn.extend({show:function(J,L){if(J){return this.animate(t("show",3),J,L)}else{for(var H=0,F=this.length;H<F;H++){var E=o.data(this[H],"olddisplay");this[H].style.display=E||"";if(o.css(this[H],"display")==="none"){var G=this[H].tagName,K;if(m[G]){K=m[G]}else{var I=o("<"+G+" />").appendTo("body");K=I.css("display");if(K==="none"){K="block"}I.remove();m[G]=K}o.data(this[H],"olddisplay",K)}}for(var H=0,F=this.length;H<F;H++){this[H].style.display=o.data(this[H],"olddisplay")||""}return this}},hide:function(H,I){if(H){return this.animate(t("hide",3),H,I)}else{for(var G=0,F=this.length;G<F;G++){var E=o.data(this[G],"olddisplay");if(!E&&E!=="none"){o.data(this[G],"olddisplay",o.css(this[G],"display"))}}for(var G=0,F=this.length;G<F;G++){this[G].style.display="none"}return this}},_toggle:o.fn.toggle,toggle:function(G,F){var E=typeof G==="boolean";return o.isFunction(G)&&o.isFunction(F)?this._toggle.apply(this,arguments):G==null||E?this.each(function(){var H=E?G:o(this).is(":hidden");o(this)[H?"show":"hide"]()}):this.animate(t("toggle",3),G,F)},fadeTo:function(E,G,F){return this.animate({opacity:G},E,F)},animate:function(I,F,H,G){var E=o.speed(F,H,G);return this[E.queue===false?"each":"queue"](function(){var K=o.extend({},E),M,L=this.nodeType==1&&o(this).is(":hidden"),J=this;for(M in I){if(I[M]=="hide"&&L||I[M]=="show"&&!L){return K.complete.call(this)}if((M=="height"||M=="width")&&this.style){K.display=o.css(this,"display");K.overflow=this.style.overflow}}if(K.overflow!=null){this.style.overflow="hidden"}K.curAnim=o.extend({},I);o.each(I,function(O,S){var R=new o.fx(J,K,O);if(/toggle|show|hide/.test(S)){R[S=="toggle"?L?"show":"hide":S](I)}else{var Q=S.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/),T=R.cur(true)||0;if(Q){var N=parseFloat(Q[2]),P=Q[3]||"px";if(P!="px"){J.style[O]=(N||1)+P;T=((N||1)/R.cur(true))*T;J.style[O]=T+P}if(Q[1]){N=((Q[1]=="-="?-1:1)*N)+T}R.custom(T,N,P)}else{R.custom(T,S,"")}}});return true})},stop:function(F,E){var G=o.timers;if(F){this.queue([])}this.each(function(){for(var H=G.length-1;H>=0;H--){if(G[H].elem==this){if(E){G[H](true)}G.splice(H,1)}}});if(!E){this.dequeue()}return this}});o.each({slideDown:t("show",1),slideUp:t("hide",1),slideToggle:t("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(E,F){o.fn[E]=function(G,H){return this.animate(F,G,H)}});o.extend({speed:function(G,H,F){var E=typeof G==="object"?G:{complete:F||!F&&H||o.isFunction(G)&&G,duration:G,easing:F&&H||H&&!o.isFunction(H)&&H};E.duration=o.fx.off?0:typeof E.duration==="number"?E.duration:o.fx.speeds[E.duration]||o.fx.speeds._default;E.old=E.complete;E.complete=function(){if(E.queue!==false){o(this).dequeue()}if(o.isFunction(E.old)){E.old.call(this)}};return E},easing:{linear:function(G,H,E,F){return E+F*G},swing:function(G,H,E,F){return((-Math.cos(G*Math.PI)/2)+0.5)*F+E}},timers:[],fx:function(F,E,G){this.options=E;this.elem=F;this.prop=G;if(!E.orig){E.orig={}}}});o.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(o.fx.step[this.prop]||o.fx.step._default)(this);if((this.prop=="height"||this.prop=="width")&&this.elem.style){this.elem.style.display="block"}},cur:function(F){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var E=parseFloat(o.css(this.elem,this.prop,F));return E&&E>-10000?E:parseFloat(o.curCSS(this.elem,this.prop))||0},custom:function(I,H,G){this.startTime=e();this.start=I;this.end=H;this.unit=G||this.unit||"px";this.now=this.start;this.pos=this.state=0;var E=this;function F(J){return E.step(J)}F.elem=this.elem;if(F()&&o.timers.push(F)&&!n){n=setInterval(function(){var K=o.timers;for(var J=0;J<K.length;J++){if(!K[J]()){K.splice(J--,1)}}if(!K.length){clearInterval(n);n=g}},13)}},show:function(){this.options.orig[this.prop]=o.attr(this.elem.style,this.prop);this.options.show=true;this.custom(this.prop=="width"||this.prop=="height"?1:0,this.cur());o(this.elem).show()},hide:function(){this.options.orig[this.prop]=o.attr(this.elem.style,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(H){var G=e();if(H||G>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;var E=true;for(var F in this.options.curAnim){if(this.options.curAnim[F]!==true){E=false}}if(E){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;this.elem.style.display=this.options.display;if(o.css(this.elem,"display")=="none"){this.elem.style.display="block"}}if(this.options.hide){o(this.elem).hide()}if(this.options.hide||this.options.show){for(var I in this.options.curAnim){o.attr(this.elem.style,I,this.options.orig[I])}}this.options.complete.call(this.elem)}return false}else{var J=G-this.startTime;this.state=J/this.options.duration;this.pos=o.easing[this.options.easing||(o.easing.swing?"swing":"linear")](this.state,J,0,1,this.options.duration);this.now=this.start+((this.end-this.start)*this.pos);this.update()}return true}};o.extend(o.fx,{speeds:{slow:600,fast:200,_default:400},step:{opacity:function(E){o.attr(E.elem.style,"opacity",E.now)},_default:function(E){if(E.elem.style&&E.elem.style[E.prop]!=null){E.elem.style[E.prop]=E.now+E.unit}else{E.elem[E.prop]=E.now}}}});if(document.documentElement.getBoundingClientRect){o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}var G=this[0].getBoundingClientRect(),J=this[0].ownerDocument,F=J.body,E=J.documentElement,L=E.clientTop||F.clientTop||0,K=E.clientLeft||F.clientLeft||0,I=G.top+(self.pageYOffset||o.boxModel&&E.scrollTop||F.scrollTop)-L,H=G.left+(self.pageXOffset||o.boxModel&&E.scrollLeft||F.scrollLeft)-K;return{top:I,left:H}}}else{o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}o.offset.initialized||o.offset.initialize();var J=this[0],G=J.offsetParent,F=J,O=J.ownerDocument,M,H=O.documentElement,K=O.body,L=O.defaultView,E=L.getComputedStyle(J,null),N=J.offsetTop,I=J.offsetLeft;while((J=J.parentNode)&&J!==K&&J!==H){M=L.getComputedStyle(J,null);N-=J.scrollTop,I-=J.scrollLeft;if(J===G){N+=J.offsetTop,I+=J.offsetLeft;if(o.offset.doesNotAddBorder&&!(o.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(J.tagName))){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}F=G,G=J.offsetParent}if(o.offset.subtractsBorderForOverflowNotVisible&&M.overflow!=="visible"){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}E=M}if(E.position==="relative"||E.position==="static"){N+=K.offsetTop,I+=K.offsetLeft}if(E.position==="fixed"){N+=Math.max(H.scrollTop,K.scrollTop),I+=Math.max(H.scrollLeft,K.scrollLeft)}return{top:N,left:I}}}o.offset={initialize:function(){if(this.initialized){return}var L=document.body,F=document.createElement("div"),H,G,N,I,M,E,J=L.style.marginTop,K='<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>';M={position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"};for(E in M){F.style[E]=M[E]}F.innerHTML=K;L.insertBefore(F,L.firstChild);H=F.firstChild,G=H.firstChild,I=H.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(G.offsetTop!==5);this.doesAddBorderForTableAndCells=(I.offsetTop===5);H.style.overflow="hidden",H.style.position="relative";this.subtractsBorderForOverflowNotVisible=(G.offsetTop===-5);L.style.marginTop="1px";this.doesNotIncludeMarginInBodyOffset=(L.offsetTop===0);L.style.marginTop=J;L.removeChild(F);this.initialized=true},bodyOffset:function(E){o.offset.initialized||o.offset.initialize();var G=E.offsetTop,F=E.offsetLeft;if(o.offset.doesNotIncludeMarginInBodyOffset){G+=parseInt(o.curCSS(E,"marginTop",true),10)||0,F+=parseInt(o.curCSS(E,"marginLeft",true),10)||0}return{top:G,left:F}}};o.fn.extend({position:function(){var I=0,H=0,F;if(this[0]){var G=this.offsetParent(),J=this.offset(),E=/^body|html$/i.test(G[0].tagName)?{top:0,left:0}:G.offset();J.top-=j(this,"marginTop");J.left-=j(this,"marginLeft");E.top+=j(G,"borderTopWidth");E.left+=j(G,"borderLeftWidth");F={top:J.top-E.top,left:J.left-E.left}}return F},offsetParent:function(){var E=this[0].offsetParent||document.body;while(E&&(!/^body|html$/i.test(E.tagName)&&o.css(E,"position")=="static")){E=E.offsetParent}return o(E)}});o.each(["Left","Top"],function(F,E){var G="scroll"+E;o.fn[G]=function(H){if(!this[0]){return null}return H!==g?this.each(function(){this==l||this==document?l.scrollTo(!F?H:o(l).scrollLeft(),F?H:o(l).scrollTop()):this[G]=H}):this[0]==l||this[0]==document?self[F?"pageYOffset":"pageXOffset"]||o.boxModel&&document.documentElement[G]||document.body[G]:this[0][G]}});o.each(["Height","Width"],function(I,G){var E=I?"Left":"Top",H=I?"Right":"Bottom",F=G.toLowerCase();o.fn["inner"+G]=function(){return this[0]?o.css(this[0],F,false,"padding"):null};o.fn["outer"+G]=function(K){return this[0]?o.css(this[0],F,false,K?"margin":"border"):null};var J=G.toLowerCase();o.fn[J]=function(K){return this[0]==l?document.compatMode=="CSS1Compat"&&document.documentElement["client"+G]||document.body["client"+G]:this[0]==document?Math.max(document.documentElement["client"+G],document.body["scroll"+G],document.documentElement["scroll"+G],document.body["offset"+G],document.documentElement["offset"+G]):K===g?(this.length?o.css(this[0],J):null):this.css(J,typeof K==="string"?K:K+"px")}})})(); \ No newline at end of file
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+ var ct, type, finalDataType, firstDataType,
+ contents = s.contents,
+ dataTypes = s.dataTypes,
+ responseFields = s.responseFields;
+
+ // Fill responseXXX fields
+ for ( type in responseFields ) {
+ if ( type in responses ) {
+ jqXHR[ responseFields[type] ] = responses[ type ];
+ }
+ }
+
+ // Remove auto dataType and get content-type in the process
+ while( dataTypes[ 0 ] === "*" ) {
+ dataTypes.shift();
+ if ( ct === undefined ) {
+ ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
+ }
+ }
+
+ // Check if we're dealing with a known content-type
+ if ( ct ) {
+ for ( type in contents ) {
+ if ( contents[ type ] && contents[ type ].test( ct ) ) {
+ dataTypes.unshift( type );
+ break;
+ }
+ }
+ }
+
+ // Check to see if we have a response for the expected dataType
+ if ( dataTypes[ 0 ] in responses ) {
+ finalDataType = dataTypes[ 0 ];
+ } else {
+ // Try convertible dataTypes
+ for ( type in responses ) {
+ if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
+ finalDataType = type;
+ break;
+ }
+ if ( !firstDataType ) {
+ firstDataType = type;
+ }
+ }
+ // Or just use first one
+ finalDataType = finalDataType || firstDataType;
+ }
+
+ // If we found a dataType
+ // We add the dataType to the list if needed
+ // and return the corresponding response
+ if ( finalDataType ) {
+ if ( finalDataType !== dataTypes[ 0 ] ) {
+ dataTypes.unshift( finalDataType );
+ }
+ return responses[ finalDataType ];
+ }
+}
+
+// Chain conversions given the request and the original response
+function ajaxConvert( s, response ) {
+
+ var conv, conv2, current, tmp,
+ converters = {},
+ i = 0,
+ // Work with a copy of dataTypes in case we need to modify it for conversion
+ dataTypes = s.dataTypes.slice(),
+ prev = dataTypes[ 0 ];
+
+ // Apply the dataFilter if provided
+ if ( s.dataFilter ) {
+ response = s.dataFilter( response, s.dataType );
+ }
+
+ // Create converters map with lowercased keys
+ if ( dataTypes[ 1 ] ) {
+ for ( conv in s.converters ) {
+ converters[ conv.toLowerCase() ] = s.converters[ conv ];
+ }
+ }
+
+ // Convert to each sequential dataType, tolerating list modification
+ for ( ; (current = dataTypes[++i]); ) {
+
+ // There's only work to do if current dataType is non-auto
+ if ( current !== "*" ) {
+
+ // Convert response if prev dataType is non-auto and differs from current
+ if ( prev !== "*" && prev !== current ) {
+
+ // Seek a direct converter
+ conv = converters[ prev + " " + current ] || converters[ "* " + current ];
+
+ // If none found, seek a pair
+ if ( !conv ) {
+ for ( conv2 in converters ) {
+
+ // If conv2 outputs current
+ tmp = conv2.split(" ");
+ if ( tmp[ 1 ] === current ) {
+
+ // If prev can be converted to accepted input
+ conv = converters[ prev + " " + tmp[ 0 ] ] ||
+ converters[ "* " + tmp[ 0 ] ];
+ if ( conv ) {
+ // Condense equivalence converters
+ if ( conv === true ) {
+ conv = converters[ conv2 ];
+
+ // Otherwise, insert the intermediate dataType
+ } else if ( converters[ conv2 ] !== true ) {
+ current = tmp[ 0 ];
+ dataTypes.splice( i--, 0, current );
+ }
+
+ break;
+ }
+ }
+ }
+ }
+
+ // Apply converter (if not an equivalence)
+ if ( conv !== true ) {
+
+ // Unless errors are allowed to bubble, catch and return them
+ if ( conv && s["throws"] ) {
+ response = conv( response );
+ } else {
+ try {
+ response = conv( response );
+ } catch ( e ) {
+ return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current };
+ }
+ }
+ }
+ }
+
+ // Update prev for next iteration
+ prev = current;
+ }
+ }
+
+ return { state: "success", data: response };
+}
+// Install script dataType
+jQuery.ajaxSetup({
+ accepts: {
+ script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
+ },
+ contents: {
+ script: /(?:java|ecma)script/
+ },
+ converters: {
+ "text script": function( text ) {
+ jQuery.globalEval( text );
+ return text;
+ }
+ }
+});
+
+// Handle cache's special case and global
+jQuery.ajaxPrefilter( "script", function( s ) {
+ if ( s.cache === undefined ) {
+ s.cache = false;
+ }
+ if ( s.crossDomain ) {
+ s.type = "GET";
+ s.global = false;
+ }
+});
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function(s) {
+
+ // This transport only deals with cross domain requests
+ if ( s.crossDomain ) {
+
+ var script,
+ head = document.head || jQuery("head")[0] || document.documentElement;
+
+ return {
+
+ send: function( _, callback ) {
+
+ script = document.createElement("script");
+
+ script.async = true;
+
+ if ( s.scriptCharset ) {
+ script.charset = s.scriptCharset;
+ }
+
+ script.src = s.url;
+
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function( _, isAbort ) {
+
+ if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
+
+ // Handle memory leak in IE
+ script.onload = script.onreadystatechange = null;
+
+ // Remove the script
+ if ( script.parentNode ) {
+ script.parentNode.removeChild( script );
+ }
+
+ // Dereference the script
+ script = null;
+
+ // Callback if not abort
+ if ( !isAbort ) {
+ callback( 200, "success" );
+ }
+ }
+ };
+
+ // Circumvent IE6 bugs with base elements (#2709 and #4378) by prepending
+ // Use native DOM manipulation to avoid our domManip AJAX trickery
+ head.insertBefore( script, head.firstChild );
+ },
+
+ abort: function() {
+ if ( script ) {
+ script.onload( undefined, true );
+ }
+ }
+ };
+ }
+});
+var oldCallbacks = [],
+ rjsonp = /(=)\?(?=&|$)|\?\?/;
+
+// Default jsonp settings
+jQuery.ajaxSetup({
+ jsonp: "callback",
+ jsonpCallback: function() {
+ var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( ajax_nonce++ ) );
+ this[ callback ] = true;
+ return callback;
+ }
+});
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+ var callbackName, overwritten, responseContainer,
+ jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
+ "url" :
+ typeof s.data === "string" && !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && rjsonp.test( s.data ) && "data"
+ );
+
+ // Handle iff the expected data type is "jsonp" or we have a parameter to set
+ if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
+
+ // Get callback name, remembering preexisting value associated with it
+ callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ?
+ s.jsonpCallback() :
+ s.jsonpCallback;
+
+ // Insert callback into url or form data
+ if ( jsonProp ) {
+ s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
+ } else if ( s.jsonp !== false ) {
+ s.url += ( ajax_rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+ }
+
+ // Use data converter to retrieve json after script execution
+ s.converters["script json"] = function() {
+ if ( !responseContainer ) {
+ jQuery.error( callbackName + " was not called" );
+ }
+ return responseContainer[ 0 ];
+ };
+
+ // force json dataType
+ s.dataTypes[ 0 ] = "json";
+
+ // Install callback
+ overwritten = window[ callbackName ];
+ window[ callbackName ] = function() {
+ responseContainer = arguments;
+ };
+
+ // Clean-up function (fires after converters)
+ jqXHR.always(function() {
+ // Restore preexisting value
+ window[ callbackName ] = overwritten;
+
+ // Save back as free
+ if ( s[ callbackName ] ) {
+ // make sure that re-using the options doesn't screw things around
+ s.jsonpCallback = originalSettings.jsonpCallback;
+
+ // save the callback name for future use
+ oldCallbacks.push( callbackName );
+ }
+
+ // Call if it was a function and we have a response
+ if ( responseContainer && jQuery.isFunction( overwritten ) ) {
+ overwritten( responseContainer[ 0 ] );
+ }
+
+ responseContainer = overwritten = undefined;
+ });
+
+ // Delegate to script
+ return "script";
+ }
+});
+var xhrCallbacks, xhrSupported,
+ xhrId = 0,
+ // #5280: Internet Explorer will keep connections alive if we don't abort on unload
+ xhrOnUnloadAbort = window.ActiveXObject && function() {
+ // Abort all pending requests
+ var key;
+ for ( key in xhrCallbacks ) {
+ xhrCallbacks[ key ]( undefined, true );
+ }
+ };
+
+// Functions to create xhrs
+function createStandardXHR() {
+ try {
+ return new window.XMLHttpRequest();
+ } catch( e ) {}
+}
+
+function createActiveXHR() {
+ try {
+ return new window.ActiveXObject("Microsoft.XMLHTTP");
+ } catch( e ) {}
+}
+
+// Create the request object
+// (This is still attached to ajaxSettings for backward compatibility)
+jQuery.ajaxSettings.xhr = window.ActiveXObject ?
+ /* Microsoft failed to properly
+ * implement the XMLHttpRequest in IE7 (can't request local files),
+ * so we use the ActiveXObject when it is available
+ * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
+ * we need a fallback.
+ */
+ function() {
+ return !this.isLocal && createStandardXHR() || createActiveXHR();
+ } :
+ // For all other browsers, use the standard XMLHttpRequest object
+ createStandardXHR;
+
+// Determine support properties
+xhrSupported = jQuery.ajaxSettings.xhr();
+jQuery.support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
+xhrSupported = jQuery.support.ajax = !!xhrSupported;
+
+// Create transport if the browser can provide an xhr
+if ( xhrSupported ) {
+
+ jQuery.ajaxTransport(function( s ) {
+ // Cross domain only allowed if supported through XMLHttpRequest
+ if ( !s.crossDomain || jQuery.support.cors ) {
+
+ var callback;
+
+ return {
+ send: function( headers, complete ) {
+
+ // Get a new xhr
+ var handle, i,
+ xhr = s.xhr();
+
+ // Open the socket
+ // Passing null username, generates a login popup on Opera (#2865)
+ if ( s.username ) {
+ xhr.open( s.type, s.url, s.async, s.username, s.password );
+ } else {
+ xhr.open( s.type, s.url, s.async );
+ }
+
+ // Apply custom fields if provided
+ if ( s.xhrFields ) {
+ for ( i in s.xhrFields ) {
+ xhr[ i ] = s.xhrFields[ i ];
+ }
+ }
+
+ // Override mime type if needed
+ if ( s.mimeType && xhr.overrideMimeType ) {
+ xhr.overrideMimeType( s.mimeType );
+ }
+
+ // X-Requested-With header
+ // For cross-domain requests, seeing as conditions for a preflight are
+ // akin to a jigsaw puzzle, we simply never set it to be sure.
+ // (it can always be set on a per-request basis or even using ajaxSetup)
+ // For same-domain requests, won't change header if already provided.
+ if ( !s.crossDomain && !headers["X-Requested-With"] ) {
+ headers["X-Requested-With"] = "XMLHttpRequest";
+ }
+
+ // Need an extra try/catch for cross domain requests in Firefox 3
+ try {
+ for ( i in headers ) {
+ xhr.setRequestHeader( i, headers[ i ] );
+ }
+ } catch( err ) {}
+
+ // Do send the request
+ // This may raise an exception which is actually
+ // handled in jQuery.ajax (so no try/catch here)
+ xhr.send( ( s.hasContent && s.data ) || null );
+
+ // Listener
+ callback = function( _, isAbort ) {
+
+ var status,
+ statusText,
+ responseHeaders,
+ responses,
+ xml;
+
+ // Firefox throws exceptions when accessing properties
+ // of an xhr when a network error occurred
+ // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
+ try {
+
+ // Was never called and is aborted or complete
+ if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
+
+ // Only called once
+ callback = undefined;
+
+ // Do not keep as active anymore
+ if ( handle ) {
+ xhr.onreadystatechange = jQuery.noop;
+ if ( xhrOnUnloadAbort ) {
+ delete xhrCallbacks[ handle ];
+ }
+ }
+
+ // If it's an abort
+ if ( isAbort ) {
+ // Abort it manually if needed
+ if ( xhr.readyState !== 4 ) {
+ xhr.abort();
+ }
+ } else {
+ responses = {};
+ status = xhr.status;
+ xml = xhr.responseXML;
+ responseHeaders = xhr.getAllResponseHeaders();
+
+ // Construct response list
+ if ( xml && xml.documentElement /* #4958 */ ) {
+ responses.xml = xml;
+ }
+
+ // When requesting binary data, IE6-9 will throw an exception
+ // on any attempt to access responseText (#11426)
+ if ( typeof xhr.responseText === "string" ) {
+ responses.text = xhr.responseText;
+ }
+
+ // Firefox throws an exception when accessing
+ // statusText for faulty cross-domain requests
+ try {
+ statusText = xhr.statusText;
+ } catch( e ) {
+ // We normalize with Webkit giving an empty statusText
+ statusText = "";
+ }
+
+ // Filter status for non standard behaviors
+
+ // If the request is local and we have data: assume a success
+ // (success with no data won't get notified, that's the best we
+ // can do given current implementations)
+ if ( !status && s.isLocal && !s.crossDomain ) {
+ status = responses.text ? 200 : 404;
+ // IE - #1450: sometimes returns 1223 when it should be 204
+ } else if ( status === 1223 ) {
+ status = 204;
+ }
+ }
+ }
+ } catch( firefoxAccessException ) {
+ if ( !isAbort ) {
+ complete( -1, firefoxAccessException );
+ }
+ }
+
+ // Call complete if needed
+ if ( responses ) {
+ complete( status, statusText, responses, responseHeaders );
+ }
+ };
+
+ if ( !s.async ) {
+ // if we're in sync mode we fire the callback
+ callback();
+ } else if ( xhr.readyState === 4 ) {
+ // (IE6 & IE7) if it's in cache and has been
+ // retrieved directly we need to fire the callback
+ setTimeout( callback );
+ } else {
+ handle = ++xhrId;
+ if ( xhrOnUnloadAbort ) {
+ // Create the active xhrs callbacks list if needed
+ // and attach the unload handler
+ if ( !xhrCallbacks ) {
+ xhrCallbacks = {};
+ jQuery( window ).unload( xhrOnUnloadAbort );
+ }
+ // Add to list of active xhrs callbacks
+ xhrCallbacks[ handle ] = callback;
+ }
+ xhr.onreadystatechange = callback;
+ }
+ },
+
+ abort: function() {
+ if ( callback ) {
+ callback( undefined, true );
+ }
+ }
+ };
+ }
+ });
+}
+var fxNow, timerId,
+ rfxtypes = /^(?:toggle|show|hide)$/,
+ rfxnum = new RegExp( "^(?:([+-])=|)(" + core_pnum + ")([a-z%]*)$", "i" ),
+ rrun = /queueHooks$/,
+ animationPrefilters = [ defaultPrefilter ],
+ tweeners = {
+ "*": [function( prop, value ) {
+ var end, unit,
+ tween = this.createTween( prop, value ),
+ parts = rfxnum.exec( value ),
+ target = tween.cur(),
+ start = +target || 0,
+ scale = 1,
+ maxIterations = 20;
+
+ if ( parts ) {
+ end = +parts[2];
+ unit = parts[3] || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+
+ // We need to compute starting value
+ if ( unit !== "px" && start ) {
+ // Iteratively approximate from a nonzero starting point
+ // Prefer the current property, because this process will be trivial if it uses the same units
+ // Fallback to end or a simple constant
+ start = jQuery.css( tween.elem, prop, true ) || end || 1;
+
+ do {
+ // If previous iteration zeroed out, double until we get *something*
+ // Use a string for doubling factor so we don't accidentally see scale as unchanged below
+ scale = scale || ".5";
+
+ // Adjust and apply
+ start = start / scale;
+ jQuery.style( tween.elem, prop, start + unit );
+
+ // Update scale, tolerating zero or NaN from tween.cur()
+ // And breaking the loop if scale is unchanged or perfect, or if we've just had enough
+ } while ( scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations );
+ }
+
+ tween.unit = unit;
+ tween.start = start;
+ // If a +=/-= token was provided, we're doing a relative animation
+ tween.end = parts[1] ? start + ( parts[1] + 1 ) * end : end;
+ }
+ return tween;
+ }]
+ };
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+ setTimeout(function() {
+ fxNow = undefined;
+ });
+ return ( fxNow = jQuery.now() );
+}
+
+function createTweens( animation, props ) {
+ jQuery.each( props, function( prop, value ) {
+ var collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ),
+ index = 0,
+ length = collection.length;
+ for ( ; index < length; index++ ) {
+ if ( collection[ index ].call( animation, prop, value ) ) {
+
+ // we're done with this property
+ return;
+ }
+ }
+ });
+}
+
+function Animation( elem, properties, options ) {
+ var result,
+ stopped,
+ index = 0,
+ length = animationPrefilters.length,
+ deferred = jQuery.Deferred().always( function() {
+ // don't match elem in the :animated selector
+ delete tick.elem;
+ }),
+ tick = function() {
+ if ( stopped ) {
+ return false;
+ }
+ var currentTime = fxNow || createFxNow(),
+ remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
+ // archaic crash bug won't allow us to use 1 - ( 0.5 || 0 ) (#12497)
+ temp = remaining / animation.duration || 0,
+ percent = 1 - temp,
+ index = 0,
+ length = animation.tweens.length;
+
+ for ( ; index < length ; index++ ) {
+ animation.tweens[ index ].run( percent );
+ }
+
+ deferred.notifyWith( elem, [ animation, percent, remaining ]);
+
+ if ( percent < 1 && length ) {
+ return remaining;
+ } else {
+ deferred.resolveWith( elem, [ animation ] );
+ return false;
+ }
+ },
+ animation = deferred.promise({
+ elem: elem,
+ props: jQuery.extend( {}, properties ),
+ opts: jQuery.extend( true, { specialEasing: {} }, options ),
+ originalProperties: properties,
+ originalOptions: options,
+ startTime: fxNow || createFxNow(),
+ duration: options.duration,
+ tweens: [],
+ createTween: function( prop, end ) {
+ var tween = jQuery.Tween( elem, animation.opts, prop, end,
+ animation.opts.specialEasing[ prop ] || animation.opts.easing );
+ animation.tweens.push( tween );
+ return tween;
+ },
+ stop: function( gotoEnd ) {
+ var index = 0,
+ // if we are going to the end, we want to run all the tweens
+ // otherwise we skip this part
+ length = gotoEnd ? animation.tweens.length : 0;
+ if ( stopped ) {
+ return this;
+ }
+ stopped = true;
+ for ( ; index < length ; index++ ) {
+ animation.tweens[ index ].run( 1 );
+ }
+
+ // resolve when we played the last frame
+ // otherwise, reject
+ if ( gotoEnd ) {
+ deferred.resolveWith( elem, [ animation, gotoEnd ] );
+ } else {
+ deferred.rejectWith( elem, [ animation, gotoEnd ] );
+ }
+ return this;
+ }
+ }),
+ props = animation.props;
+
+ propFilter( props, animation.opts.specialEasing );
+
+ for ( ; index < length ; index++ ) {
+ result = animationPrefilters[ index ].call( animation, elem, props, animation.opts );
+ if ( result ) {
+ return result;
+ }
+ }
+
+ createTweens( animation, props );
+
+ if ( jQuery.isFunction( animation.opts.start ) ) {
+ animation.opts.start.call( elem, animation );
+ }
+
+ jQuery.fx.timer(
+ jQuery.extend( tick, {
+ elem: elem,
+ anim: animation,
+ queue: animation.opts.queue
+ })
+ );
+
+ // attach callbacks from options
+ return animation.progress( animation.opts.progress )
+ .done( animation.opts.done, animation.opts.complete )
+ .fail( animation.opts.fail )
+ .always( animation.opts.always );
+}
+
+function propFilter( props, specialEasing ) {
+ var index, name, easing, value, hooks;
+
+ // camelCase, specialEasing and expand cssHook pass
+ for ( index in props ) {
+ name = jQuery.camelCase( index );
+ easing = specialEasing[ name ];
+ value = props[ index ];
+ if ( jQuery.isArray( value ) ) {
+ easing = value[ 1 ];
+ value = props[ index ] = value[ 0 ];
+ }
+
+ if ( index !== name ) {
+ props[ name ] = value;
+ delete props[ index ];
+ }
+
+ hooks = jQuery.cssHooks[ name ];
+ if ( hooks && "expand" in hooks ) {
+ value = hooks.expand( value );
+ delete props[ name ];
+
+ // not quite $.extend, this wont overwrite keys already present.
+ // also - reusing 'index' from above because we have the correct "name"
+ for ( index in value ) {
+ if ( !( index in props ) ) {
+ props[ index ] = value[ index ];
+ specialEasing[ index ] = easing;
+ }
+ }
+ } else {
+ specialEasing[ name ] = easing;
+ }
+ }
+}
+
+jQuery.Animation = jQuery.extend( Animation, {
+
+ tweener: function( props, callback ) {
+ if ( jQuery.isFunction( props ) ) {
+ callback = props;
+ props = [ "*" ];
+ } else {
+ props = props.split(" ");
+ }
+
+ var prop,
+ index = 0,
+ length = props.length;
+
+ for ( ; index < length ; index++ ) {
+ prop = props[ index ];
+ tweeners[ prop ] = tweeners[ prop ] || [];
+ tweeners[ prop ].unshift( callback );
+ }
+ },
+
+ prefilter: function( callback, prepend ) {
+ if ( prepend ) {
+ animationPrefilters.unshift( callback );
+ } else {
+ animationPrefilters.push( callback );
+ }
+ }
+});
+
+function defaultPrefilter( elem, props, opts ) {
+ /*jshint validthis:true */
+ var index, prop, value, length, dataShow, toggle, tween, hooks, oldfire,
+ anim = this,
+ style = elem.style,
+ orig = {},
+ handled = [],
+ hidden = elem.nodeType && isHidden( elem );
+
+ // handle queue: false promises
+ if ( !opts.queue ) {
+ hooks = jQuery._queueHooks( elem, "fx" );
+ if ( hooks.unqueued == null ) {
+ hooks.unqueued = 0;
+ oldfire = hooks.empty.fire;
+ hooks.empty.fire = function() {
+ if ( !hooks.unqueued ) {
+ oldfire();
+ }
+ };
+ }
+ hooks.unqueued++;
+
+ anim.always(function() {
+ // doing this makes sure that the complete handler will be called
+ // before this completes
+ anim.always(function() {
+ hooks.unqueued--;
+ if ( !jQuery.queue( elem, "fx" ).length ) {
+ hooks.empty.fire();
+ }
+ });
+ });
+ }
+
+ // height/width overflow pass
+ if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) {
+ // Make sure that nothing sneaks out
+ // Record all 3 overflow attributes because IE does not
+ // change the overflow attribute when overflowX and
+ // overflowY are set to the same value
+ opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
+
+ // Set display property to inline-block for height/width
+ // animations on inline elements that are having width/height animated
+ if ( jQuery.css( elem, "display" ) === "inline" &&
+ jQuery.css( elem, "float" ) === "none" ) {
+
+ // inline-level elements accept inline-block;
+ // block-level elements need to be inline with layout
+ if ( !jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay( elem.nodeName ) === "inline" ) {
+ style.display = "inline-block";
+
+ } else {
+ style.zoom = 1;
+ }
+ }
+ }
+
+ if ( opts.overflow ) {
+ style.overflow = "hidden";
+ if ( !jQuery.support.shrinkWrapBlocks ) {
+ anim.done(function() {
+ style.overflow = opts.overflow[ 0 ];
+ style.overflowX = opts.overflow[ 1 ];
+ style.overflowY = opts.overflow[ 2 ];
+ });
+ }
+ }
+
+
+ // show/hide pass
+ for ( index in props ) {
+ value = props[ index ];
+ if ( rfxtypes.exec( value ) ) {
+ delete props[ index ];
+ toggle = toggle || value === "toggle";
+ if ( value === ( hidden ? "hide" : "show" ) ) {
+ continue;
+ }
+ handled.push( index );
+ }
+ }
+
+ length = handled.length;
+ if ( length ) {
+ dataShow = jQuery._data( elem, "fxshow" ) || jQuery._data( elem, "fxshow", {} );
+ if ( "hidden" in dataShow ) {
+ hidden = dataShow.hidden;
+ }
+
+ // store state if its toggle - enables .stop().toggle() to "reverse"
+ if ( toggle ) {
+ dataShow.hidden = !hidden;
+ }
+ if ( hidden ) {
+ jQuery( elem ).show();
+ } else {
+ anim.done(function() {
+ jQuery( elem ).hide();
+ });
+ }
+ anim.done(function() {
+ var prop;
+ jQuery._removeData( elem, "fxshow" );
+ for ( prop in orig ) {
+ jQuery.style( elem, prop, orig[ prop ] );
+ }
+ });
+ for ( index = 0 ; index < length ; index++ ) {
+ prop = handled[ index ];
+ tween = anim.createTween( prop, hidden ? dataShow[ prop ] : 0 );
+ orig[ prop ] = dataShow[ prop ] || jQuery.style( elem, prop );
+
+ if ( !( prop in dataShow ) ) {
+ dataShow[ prop ] = tween.start;
+ if ( hidden ) {
+ tween.end = tween.start;
+ tween.start = prop === "width" || prop === "height" ? 1 : 0;
+ }
+ }
+ }
+ }
+}
+
+function Tween( elem, options, prop, end, easing ) {
+ return new Tween.prototype.init( elem, options, prop, end, easing );
+}
+jQuery.Tween = Tween;
+
+Tween.prototype = {
+ constructor: Tween,
+ init: function( elem, options, prop, end, easing, unit ) {
+ this.elem = elem;
+ this.prop = prop;
+ this.easing = easing || "swing";
+ this.options = options;
+ this.start = this.now = this.cur();
+ this.end = end;
+ this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+ },
+ cur: function() {
+ var hooks = Tween.propHooks[ this.prop ];
+
+ return hooks && hooks.get ?
+ hooks.get( this ) :
+ Tween.propHooks._default.get( this );
+ },
+ run: function( percent ) {
+ var eased,
+ hooks = Tween.propHooks[ this.prop ];
+
+ if ( this.options.duration ) {
+ this.pos = eased = jQuery.easing[ this.easing ](
+ percent, this.options.duration * percent, 0, 1, this.options.duration
+ );
+ } else {
+ this.pos = eased = percent;
+ }
+ this.now = ( this.end - this.start ) * eased + this.start;
+
+ if ( this.options.step ) {
+ this.options.step.call( this.elem, this.now, this );
+ }
+
+ if ( hooks && hooks.set ) {
+ hooks.set( this );
+ } else {
+ Tween.propHooks._default.set( this );
+ }
+ return this;
+ }
+};
+
+Tween.prototype.init.prototype = Tween.prototype;
+
+Tween.propHooks = {
+ _default: {
+ get: function( tween ) {
+ var result;
+
+ if ( tween.elem[ tween.prop ] != null &&
+ (!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) {
+ return tween.elem[ tween.prop ];
+ }
+
+ // passing a non empty string as a 3rd parameter to .css will automatically
+ // attempt a parseFloat and fallback to a string if the parse fails
+ // so, simple values such as "10px" are parsed to Float.
+ // complex values such as "rotate(1rad)" are returned as is.
+ result = jQuery.css( tween.elem, tween.prop, "auto" );
+ // Empty strings, null, undefined and "auto" are converted to 0.
+ return !result || result === "auto" ? 0 : result;
+ },
+ set: function( tween ) {
+ // use step hook for back compat - use cssHook if its there - use .style if its
+ // available and use plain properties where available
+ if ( jQuery.fx.step[ tween.prop ] ) {
+ jQuery.fx.step[ tween.prop ]( tween );
+ } else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) {
+ jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
+ } else {
+ tween.elem[ tween.prop ] = tween.now;
+ }
+ }
+ }
+};
+
+// Remove in 2.0 - this supports IE8's panic based approach
+// to setting things on disconnected nodes
+
+Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+ set: function( tween ) {
+ if ( tween.elem.nodeType && tween.elem.parentNode ) {
+ tween.elem[ tween.prop ] = tween.now;
+ }
+ }
+};
+
+jQuery.each([ "toggle", "show", "hide" ], function( i, name ) {
+ var cssFn = jQuery.fn[ name ];
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return speed == null || typeof speed === "boolean" ?
+ cssFn.apply( this, arguments ) :
+ this.animate( genFx( name, true ), speed, easing, callback );
+ };
+});
+
+jQuery.fn.extend({
+ fadeTo: function( speed, to, easing, callback ) {
+
+ // show any hidden elements after setting opacity to 0
+ return this.filter( isHidden ).css( "opacity", 0 ).show()
+
+ // animate to the value specified
+ .end().animate({ opacity: to }, speed, easing, callback );
+ },
+ animate: function( prop, speed, easing, callback ) {
+ var empty = jQuery.isEmptyObject( prop ),
+ optall = jQuery.speed( speed, easing, callback ),
+ doAnimation = function() {
+ // Operate on a copy of prop so per-property easing won't be lost
+ var anim = Animation( this, jQuery.extend( {}, prop ), optall );
+ doAnimation.finish = function() {
+ anim.stop( true );
+ };
+ // Empty animations, or finishing resolves immediately
+ if ( empty || jQuery._data( this, "finish" ) ) {
+ anim.stop( true );
+ }
+ };
+ doAnimation.finish = doAnimation;
+
+ return empty || optall.queue === false ?
+ this.each( doAnimation ) :
+ this.queue( optall.queue, doAnimation );
+ },
+ stop: function( type, clearQueue, gotoEnd ) {
+ var stopQueue = function( hooks ) {
+ var stop = hooks.stop;
+ delete hooks.stop;
+ stop( gotoEnd );
+ };
+
+ if ( typeof type !== "string" ) {
+ gotoEnd = clearQueue;
+ clearQueue = type;
+ type = undefined;
+ }
+ if ( clearQueue && type !== false ) {
+ this.queue( type || "fx", [] );
+ }
+
+ return this.each(function() {
+ var dequeue = true,
+ index = type != null && type + "queueHooks",
+ timers = jQuery.timers,
+ data = jQuery._data( this );
+
+ if ( index ) {
+ if ( data[ index ] && data[ index ].stop ) {
+ stopQueue( data[ index ] );
+ }
+ } else {
+ for ( index in data ) {
+ if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
+ stopQueue( data[ index ] );
+ }
+ }
+ }
+
+ for ( index = timers.length; index--; ) {
+ if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) {
+ timers[ index ].anim.stop( gotoEnd );
+ dequeue = false;
+ timers.splice( index, 1 );
+ }
+ }
+
+ // start the next in the queue if the last step wasn't forced
+ // timers currently will call their complete callbacks, which will dequeue
+ // but only if they were gotoEnd
+ if ( dequeue || !gotoEnd ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ },
+ finish: function( type ) {
+ if ( type !== false ) {
+ type = type || "fx";
+ }
+ return this.each(function() {
+ var index,
+ data = jQuery._data( this ),
+ queue = data[ type + "queue" ],
+ hooks = data[ type + "queueHooks" ],
+ timers = jQuery.timers,
+ length = queue ? queue.length : 0;
+
+ // enable finishing flag on private data
+ data.finish = true;
+
+ // empty the queue first
+ jQuery.queue( this, type, [] );
+
+ if ( hooks && hooks.cur && hooks.cur.finish ) {
+ hooks.cur.finish.call( this );
+ }
+
+ // look for any active animations, and finish them
+ for ( index = timers.length; index--; ) {
+ if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
+ timers[ index ].anim.stop( true );
+ timers.splice( index, 1 );
+ }
+ }
+
+ // look for any animations in the old queue and finish them
+ for ( index = 0; index < length; index++ ) {
+ if ( queue[ index ] && queue[ index ].finish ) {
+ queue[ index ].finish.call( this );
+ }
+ }
+
+ // turn off finishing flag
+ delete data.finish;
+ });
+ }
+});
+
+// Generate parameters to create a standard animation
+function genFx( type, includeWidth ) {
+ var which,
+ attrs = { height: type },
+ i = 0;
+
+ // if we include width, step value is 1 to do all cssExpand values,
+ // if we don't include width, step value is 2 to skip over Left and Right
+ includeWidth = includeWidth? 1 : 0;
+ for( ; i < 4 ; i += 2 - includeWidth ) {
+ which = cssExpand[ i ];
+ attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
+ }
+
+ if ( includeWidth ) {
+ attrs.opacity = attrs.width = type;
+ }
+
+ return attrs;
+}
+
+// Generate shortcuts for custom animations
+jQuery.each({
+ slideDown: genFx("show"),
+ slideUp: genFx("hide"),
+ slideToggle: genFx("toggle"),
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" },
+ fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return this.animate( props, speed, easing, callback );
+ };
+});
+
+jQuery.speed = function( speed, easing, fn ) {
+ var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+ complete: fn || !fn && easing ||
+ jQuery.isFunction( speed ) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
+ };
+
+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+ opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default;
+
+ // normalize opt.queue - true/undefined/null -> "fx"
+ if ( opt.queue == null || opt.queue === true ) {
+ opt.queue = "fx";
+ }
+
+ // Queueing
+ opt.old = opt.complete;
+
+ opt.complete = function() {
+ if ( jQuery.isFunction( opt.old ) ) {
+ opt.old.call( this );
+ }
+
+ if ( opt.queue ) {
+ jQuery.dequeue( this, opt.queue );
+ }
+ };
+
+ return opt;
+};
+
+jQuery.easing = {
+ linear: function( p ) {
+ return p;
+ },
+ swing: function( p ) {
+ return 0.5 - Math.cos( p*Math.PI ) / 2;
+ }
+};
+
+jQuery.timers = [];
+jQuery.fx = Tween.prototype.init;
+jQuery.fx.tick = function() {
+ var timer,
+ timers = jQuery.timers,
+ i = 0;
+
+ fxNow = jQuery.now();
+
+ for ( ; i < timers.length; i++ ) {
+ timer = timers[ i ];
+ // Checks the timer has not already been removed
+ if ( !timer() && timers[ i ] === timer ) {
+ timers.splice( i--, 1 );
+ }
+ }
+
+ if ( !timers.length ) {
+ jQuery.fx.stop();
+ }
+ fxNow = undefined;
+};
+
+jQuery.fx.timer = function( timer ) {
+ if ( timer() && jQuery.timers.push( timer ) ) {
+ jQuery.fx.start();
+ }
+};
+
+jQuery.fx.interval = 13;
+
+jQuery.fx.start = function() {
+ if ( !timerId ) {
+ timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval );
+ }
+};
+
+jQuery.fx.stop = function() {
+ clearInterval( timerId );
+ timerId = null;
+};
+
+jQuery.fx.speeds = {
+ slow: 600,
+ fast: 200,
+ // Default speed
+ _default: 400
+};
+
+// Back Compat <1.8 extension point
+jQuery.fx.step = {};
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.animated = function( elem ) {
+ return jQuery.grep(jQuery.timers, function( fn ) {
+ return elem === fn.elem;
+ }).length;
+ };
+}
+jQuery.fn.offset = function( options ) {
+ if ( arguments.length ) {
+ return options === undefined ?
+ this :
+ this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ var docElem, win,
+ box = { top: 0, left: 0 },
+ elem = this[ 0 ],
+ doc = elem && elem.ownerDocument;
+
+ if ( !doc ) {
+ return;
+ }
+
+ docElem = doc.documentElement;
+
+ // Make sure it's not a disconnected DOM node
+ if ( !jQuery.contains( docElem, elem ) ) {
+ return box;
+ }
+
+ // If we don't have gBCR, just use 0,0 rather than error
+ // BlackBerry 5, iOS 3 (original iPhone)
+ if ( typeof elem.getBoundingClientRect !== "undefined" ) {
+ box = elem.getBoundingClientRect();
+ }
+ win = getWindow( doc );
+ return {
+ top: box.top + ( win.pageYOffset || docElem.scrollTop ) - ( docElem.clientTop || 0 ),
+ left: box.left + ( win.pageXOffset || docElem.scrollLeft ) - ( docElem.clientLeft || 0 )
+ };
+};
+
+jQuery.offset = {
+
+ setOffset: function( elem, options, i ) {
+ var position = jQuery.css( elem, "position" );
+
+ // set position first, in-case top/left are set even on static elem
+ if ( position === "static" ) {
+ elem.style.position = "relative";
+ }
+
+ var curElem = jQuery( elem ),
+ curOffset = curElem.offset(),
+ curCSSTop = jQuery.css( elem, "top" ),
+ curCSSLeft = jQuery.css( elem, "left" ),
+ calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
+ props = {}, curPosition = {}, curTop, curLeft;
+
+ // need to be able to calculate position if either top or left is auto and position is either absolute or fixed
+ if ( calculatePosition ) {
+ curPosition = curElem.position();
+ curTop = curPosition.top;
+ curLeft = curPosition.left;
+ } else {
+ curTop = parseFloat( curCSSTop ) || 0;
+ curLeft = parseFloat( curCSSLeft ) || 0;
+ }
+
+ if ( jQuery.isFunction( options ) ) {
+ options = options.call( elem, i, curOffset );
+ }
+
+ if ( options.top != null ) {
+ props.top = ( options.top - curOffset.top ) + curTop;
+ }
+ if ( options.left != null ) {
+ props.left = ( options.left - curOffset.left ) + curLeft;
+ }
+
+ if ( "using" in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ }
+};
+
+
+jQuery.fn.extend({
+
+ position: function() {
+ if ( !this[ 0 ] ) {
+ return;
+ }
+
+ var offsetParent, offset,
+ parentOffset = { top: 0, left: 0 },
+ elem = this[ 0 ];
+
+ // fixed elements are offset from window (parentOffset = {top:0, left: 0}, because it is it's only offset parent
+ if ( jQuery.css( elem, "position" ) === "fixed" ) {
+ // we assume that getBoundingClientRect is available when computed position is fixed
+ offset = elem.getBoundingClientRect();
+ } else {
+ // Get *real* offsetParent
+ offsetParent = this.offsetParent();
+
+ // Get correct offsets
+ offset = this.offset();
+ if ( !jQuery.nodeName( offsetParent[ 0 ], "html" ) ) {
+ parentOffset = offsetParent.offset();
+ }
+
+ // Add offsetParent borders
+ parentOffset.top += jQuery.css( offsetParent[ 0 ], "borderTopWidth", true );
+ parentOffset.left += jQuery.css( offsetParent[ 0 ], "borderLeftWidth", true );
+ }
+
+ // Subtract parent offsets and element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ return {
+ top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
+ left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true)
+ };
+ },
+
+ offsetParent: function() {
+ return this.map(function() {
+ var offsetParent = this.offsetParent || document.documentElement;
+ while ( offsetParent && ( !jQuery.nodeName( offsetParent, "html" ) && jQuery.css( offsetParent, "position") === "static" ) ) {
+ offsetParent = offsetParent.offsetParent;
+ }
+ return offsetParent || document.documentElement;
+ });
+ }
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) {
+ var top = /Y/.test( prop );
+
+ jQuery.fn[ method ] = function( val ) {
+ return jQuery.access( this, function( elem, method, val ) {
+ var win = getWindow( elem );
+
+ if ( val === undefined ) {
+ return win ? (prop in win) ? win[ prop ] :
+ win.document.documentElement[ method ] :
+ elem[ method ];
+ }
+
+ if ( win ) {
+ win.scrollTo(
+ !top ? val : jQuery( win ).scrollLeft(),
+ top ? val : jQuery( win ).scrollTop()
+ );
+
+ } else {
+ elem[ method ] = val;
+ }
+ }, method, val, arguments.length, null );
+ };
+});
+
+function getWindow( elem ) {
+ return jQuery.isWindow( elem ) ?
+ elem :
+ elem.nodeType === 9 ?
+ elem.defaultView || elem.parentWindow :
+ false;
+}
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
+ jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) {
+ // margin is only for outerHeight, outerWidth
+ jQuery.fn[ funcName ] = function( margin, value ) {
+ var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+ extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
+
+ return jQuery.access( this, function( elem, type, value ) {
+ var doc;
+
+ if ( jQuery.isWindow( elem ) ) {
+ // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there
+ // isn't a whole lot we can do. See pull request at this URL for discussion:
+ // https://github.com/jquery/jquery/pull/764
+ return elem.document.documentElement[ "client" + name ];
+ }
+
+ // Get document width or height
+ if ( elem.nodeType === 9 ) {
+ doc = elem.documentElement;
+
+ // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest
+ // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it.
+ return Math.max(
+ elem.body[ "scroll" + name ], doc[ "scroll" + name ],
+ elem.body[ "offset" + name ], doc[ "offset" + name ],
+ doc[ "client" + name ]
+ );
+ }
+
+ return value === undefined ?
+ // Get width or height on the element, requesting but not forcing parseFloat
+ jQuery.css( elem, type, extra ) :
+
+ // Set width or height on the element
+ jQuery.style( elem, type, value, extra );
+ }, type, chainable ? margin : undefined, chainable, null );
+ };
+ });
+});
+// Limit scope pollution from any deprecated API
+// (function() {
+
+// })();
+// Expose jQuery to the global object
+window.jQuery = window.$ = jQuery;
+
+// Expose jQuery as an AMD module, but only for AMD loaders that
+// understand the issues with loading multiple versions of jQuery
+// in a page that all might call define(). The loader will indicate
+// they have special allowances for multiple jQuery versions by
+// specifying define.amd.jQuery = true. Register as a named module,
+// since jQuery can be concatenated with other files that may use define,
+// but not use a proper concatenation script that understands anonymous
+// AMD modules. A named AMD is safest and most robust way to register.
+// Lowercase jquery is used because AMD module names are derived from
+// file names, and jQuery is normally delivered in a lowercase file name.
+// Do this after creating the global so that if an AMD module wants to call
+// noConflict to hide this version of jQuery, it will work.
+if ( typeof define === "function" && define.amd && define.amd.jQuery ) {
+ define( "jquery", [], function () { return jQuery; } );
+}
+
+})( window );
diff --git a/lib/jquery.localscroll.js b/lib/jquery.localscroll.js
deleted file mode 100644
index fa583a45..00000000
--- a/lib/jquery.localscroll.js
+++ /dev/null
@@ -1,9 +0,0 @@
-/**
- * jQuery.LocalScroll - Animated scrolling navigation, using anchors.
- * Copyright (c) 2007-2009 Ariel Flesler - aflesler(at)gmail(dot)com | http://flesler.blogspot.com
- * Dual licensed under MIT and GPL.
- * Date: 3/11/2009
- * @author Ariel Flesler
- * @version 1.2.7
- **/
-;(function($){var l=location.href.replace(/#.*/,'');var g=$.localScroll=function(a){$('body').localScroll(a)};g.defaults={duration:1e3,axis:'y',event:'click',stop:true,target:window,reset:true};g.hash=function(a){if(location.hash){a=$.extend({},g.defaults,a);a.hash=false;if(a.reset){var e=a.duration;delete a.duration;$(a.target).scrollTo(0,a);a.duration=e}i(0,location,a)}};$.fn.localScroll=function(b){b=$.extend({},g.defaults,b);return b.lazy?this.bind(b.event,function(a){var e=$([a.target,a.target.parentNode]).filter(d)[0];if(e)i(a,e,b)}):this.find('a,area').filter(d).bind(b.event,function(a){i(a,this,b)}).end().end();function d(){return!!this.href&&!!this.hash&&this.href.replace(this.hash,'')==l&&(!b.filter||$(this).is(b.filter))}};function i(a,e,b){var d=e.hash.slice(1),f=document.getElementById(d)||document.getElementsByName(d)[0];if(!f)return;if(a)a.preventDefault();var h=$(b.target);if(b.lock&&h.is(':animated')||b.onBefore&&b.onBefore.call(b,a,f,h)===false)return;if(b.stop)h.stop(true);if(b.hash){var j=f.id==d?'id':'name',k=$('<a> </a>').attr(j,d).css({position:'absolute',top:$(window).scrollTop(),left:$(window).scrollLeft()});f[j]='';$('body').prepend(k);location=e.hash;k.remove();f[j]=d}h.scrollTo(f,b).trigger('notify.serialScroll',[f])}})(jQuery); \ No newline at end of file
diff --git a/lib/jquery.scrollTo.js b/lib/jquery.scrollTo.js
deleted file mode 100644
index 5e787781..00000000
--- a/lib/jquery.scrollTo.js
+++ /dev/null
@@ -1,11 +0,0 @@
-/**
- * jQuery.ScrollTo - Easy element scrolling using jQuery.
- * Copyright (c) 2007-2009 Ariel Flesler - aflesler(at)gmail(dot)com | http://flesler.blogspot.com
- * Dual licensed under MIT and GPL.
- * Date: 5/25/2009
- * @author Ariel Flesler
- * @version 1.4.2
- *
- * http://flesler.blogspot.com/2007/10/jqueryscrollto.html
- */
-;(function(d){var k=d.scrollTo=function(a,i,e){d(window).scrollTo(a,i,e)};k.defaults={axis:'xy',duration:parseFloat(d.fn.jquery)>=1.3?0:1};k.window=function(a){return d(window)._scrollable()};d.fn._scrollable=function(){return this.map(function(){var a=this,i=!a.nodeName||d.inArray(a.nodeName.toLowerCase(),['iframe','#document','html','body'])!=-1;if(!i)return a;var e=(a.contentWindow||a).document||a.ownerDocument||a;return d.browser.safari||e.compatMode=='BackCompat'?e.body:e.documentElement})};d.fn.scrollTo=function(n,j,b){if(typeof j=='object'){b=j;j=0}if(typeof b=='function')b={onAfter:b};if(n=='max')n=9e9;b=d.extend({},k.defaults,b);j=j||b.speed||b.duration;b.queue=b.queue&&b.axis.length>1;if(b.queue)j/=2;b.offset=p(b.offset);b.over=p(b.over);return this._scrollable().each(function(){var q=this,r=d(q),f=n,s,g={},u=r.is('html,body');switch(typeof f){case'number':case'string':if(/^([+-]=)?\d+(\.\d+)?(px|%)?$/.test(f)){f=p(f);break}f=d(f,this);case'object':if(f.is||f.style)s=(f=d(f)).offset()}d.each(b.axis.split(''),function(a,i){var e=i=='x'?'Left':'Top',h=e.toLowerCase(),c='scroll'+e,l=q[c],m=k.max(q,i);if(s){g[c]=s[h]+(u?0:l-r.offset()[h]);if(b.margin){g[c]-=parseInt(f.css('margin'+e))||0;g[c]-=parseInt(f.css('border'+e+'Width'))||0}g[c]+=b.offset[h]||0;if(b.over[h])g[c]+=f[i=='x'?'width':'height']()*b.over[h]}else{var o=f[h];g[c]=o.slice&&o.slice(-1)=='%'?parseFloat(o)/100*m:o}if(/^\d+$/.test(g[c]))g[c]=g[c]<=0?0:Math.min(g[c],m);if(!a&&b.queue){if(l!=g[c])t(b.onAfterFirst);delete g[c]}});t(b.onAfter);function t(a){r.animate(g,j,b.easing,a&&function(){a.call(this,n,b)})}}).end()};k.max=function(a,i){var e=i=='x'?'Width':'Height',h='scroll'+e;if(!d(a).is('html,body'))return a[h]-d(a)[e.toLowerCase()]();var c='client'+e,l=a.ownerDocument.documentElement,m=a.ownerDocument.body;return Math.max(l[h],m[h])-Math.min(l[c],m[c])};function p(a){return typeof a=='object'?a:{top:a,left:a}}})(jQuery); \ No newline at end of file
diff --git a/lib/superfish/css/superfish.css b/lib/superfish/css/superfish.css
index cc33fdb4..3b21323e 100644
--- a/lib/superfish/css/superfish.css
+++ b/lib/superfish/css/superfish.css
@@ -57,6 +57,9 @@ ul.sf-menu li li li.sfHover ul {
float: left;
margin-bottom: 1em;
}
+.sf-menu ul {
+ box-shadow: 2px 2px 6px rgba(0,0,0,.2);
+}
.sf-menu a {
border-left: 1px solid #fff;
border-top: 1px solid #CFDEFF;
@@ -121,16 +124,3 @@ li.sfHover > a > .sf-sub-indicator {
.sf-menu ul li.sfHover > a > .sf-sub-indicator {
background-position: -10px 0; /* arrow hovers for modern browsers*/
}
-
-/*** shadows for all but IE6 ***/
-.sf-shadow ul {
- background: url('../images/shadow.png') no-repeat bottom right;
- padding: 0 8px 9px 0;
- -moz-border-radius-bottomleft: 17px;
- -moz-border-radius-topright: 17px;
- -webkit-border-top-right-radius: 17px;
- -webkit-border-bottom-left-radius: 17px;
-}
-.sf-shadow ul.sf-shadow-off {
- background: transparent;
-}
diff --git a/lib/superfish/images/arrows-ffffff-rtl.png b/lib/superfish/images/arrows-ffffff-rtl.png
deleted file mode 100644
index 2fe14a36..00000000
--- a/lib/superfish/images/arrows-ffffff-rtl.png
+++ /dev/null
Binary files differ
diff --git a/lib/superfish/images/shadow.png b/lib/superfish/images/shadow.png
deleted file mode 100644
index c04d21b7..00000000
--- a/lib/superfish/images/shadow.png
+++ /dev/null
Binary files differ
diff --git a/lib/superfish/js/superfish.js b/lib/superfish/js/superfish.js
index c6a9c7de..45d2e9a6 100644
--- a/lib/superfish/js/superfish.js
+++ b/lib/superfish/js/superfish.js
@@ -1,13 +1,12 @@
/*
- * Superfish v1.4.8 - jQuery menu widget
- * Copyright (c) 2008 Joel Birch
+ * Superfish v1.5.1 - jQuery menu widget
+ * Copyright (c) 2013 Joel Birch
*
* Dual licensed under the MIT and GPL licenses:
* http://www.opensource.org/licenses/mit-license.php
* http://www.gnu.org/licenses/gpl.html
*
- * CHANGELOG: http://users.tpg.com.au/j_birch/plugins/superfish/changelog.txt
*/
;(function($){
@@ -15,8 +14,8 @@
var sf = $.fn.superfish,
c = sf.c,
- $arrow = $(['<span class="',c.arrowClass,'"> &#187;</span>'].join('')),
- over = function(){
+ $arrow = $('<span class="'+c.arrowClass+'"> &#187;</span>'),
+ over = function(e){
var $$ = $(this), menu = getMenu($$);
clearTimeout(menu.sfTimer);
$$.showSuperfishUl().siblings().hideSuperfishUl();
@@ -27,59 +26,67 @@
menu.sfTimer=setTimeout(function(){
o.retainPath=($.inArray($$[0],o.$path)>-1);
$$.hideSuperfishUl();
- if (o.$path.length && $$.parents(['li.',o.hoverClass].join('')).length<1){over.call(o.$path);}
+ if (o.$path.length && $$.parents('li.'+o.hoverClass).length<1){
+ o.onIdle.call(this);
+ over.call(o.$path);
+ }
},o.delay);
},
- getMenu = function($menu){
- var menu = $menu.parents(['ul.',c.menuClass,':first'].join(''))[0];
+ getMenu = function($child){
+ if ($child.hasClass(c.menuClass)){
+ $.error('Superfish requires you to update to a version of hoverIntent that supports event-delegation, such as this one: https://github.com/joeldbirch/onHoverIntent');
+ }
+ var menu = $child.closest('.'+c.menuClass)[0];
sf.op = sf.o[menu.serial];
return menu;
},
+ applyHandlers = function($menu){
+ var targets = 'li:has(ul)';
+ if ($.fn.hoverIntent && !sf.op.disableHI){
+ $menu.hoverIntent(over, out, targets);
+ } else {
+ $menu.on('mouseenter', targets, over);
+ $menu.on('mouseleave', targets, out);
+ }
+ $menu.on('focusin', targets, over);
+ $menu.on('focusout', targets, out);
+ },
addArrow = function($a){ $a.addClass(c.anchorClass).append($arrow.clone()); };
- return this.each(function() {
+ return this.addClass(c.menuClass).each(function() {
var s = this.serial = sf.o.length;
var o = $.extend({},sf.defaults,op);
- o.$path = $('li.'+o.pathClass,this).slice(0,o.pathLevels).each(function(){
- $(this).addClass([o.hoverClass,c.bcClass].join(' '))
+ var $$ = $(this);
+ o.$path = $$.find('li.'+o.pathClass).slice(0,o.pathLevels).each(function(){
+ $(this).addClass(o.hoverClass+' '+c.bcClass)
.filter('li:has(ul)').removeClass(o.pathClass);
});
sf.o[s] = sf.op = o;
- $('li:has(ul)',this)[($.fn.hoverIntent && !o.disableHI) ? 'hoverIntent' : 'hover'](over,out).each(function() {
- if (o.autoArrows) addArrow( $('>a:first-child',this) );
+ applyHandlers($$);
+
+ $$.find('li:has(ul)').each(function() {
+ if (o.autoArrows) {
+ addArrow( $('>a:first-child',this) );
+ }
})
.not('.'+c.bcClass)
.hideSuperfishUl();
- var $a = $('a',this);
- $a.each(function(i){
- var $li = $a.eq(i).parents('li');
- $a.eq(i).focus(function(){over.call($li);}).blur(function(){out.call($li);});
- });
o.onInit.call(this);
- }).each(function() {
- var menuClasses = [c.menuClass];
- if (sf.op.dropShadows && !($.browser.msie && $.browser.version < 7)) menuClasses.push(c.shadowClass);
- $(this).addClass(menuClasses.join(' '));
});
};
var sf = $.fn.superfish;
sf.o = [];
sf.op = {};
- sf.IE7fix = function(){
- var o = sf.op;
- if ($.browser.msie && $.browser.version > 6 && o.dropShadows && o.animation.opacity!=undefined)
- this.toggleClass(sf.c.shadowClass+'-off');
- };
+
sf.c = {
bcClass : 'sf-breadcrumb',
menuClass : 'sf-js-enabled',
anchorClass : 'sf-with-ul',
- arrowClass : 'sf-sub-indicator',
- shadowClass : 'sf-shadow'
+ arrowClass : 'sf-sub-indicator'
};
sf.defaults = {
hoverClass : 'sfHover',
@@ -89,31 +96,29 @@
animation : {opacity:'show'},
speed : 'normal',
autoArrows : true,
- dropShadows : true,
disableHI : false, // true disables hoverIntent detection
onInit : function(){}, // callback functions
onBeforeShow: function(){},
onShow : function(){},
- onHide : function(){}
+ onHide : function(){},
+ onIdle : function(){}
};
$.fn.extend({
hideSuperfishUl : function(){
var o = sf.op,
not = (o.retainPath===true) ? o.$path : '';
o.retainPath = false;
- var $ul = $(['li.',o.hoverClass].join(''),this).add(this).not(not).removeClass(o.hoverClass)
+ var $ul = $('li.'+o.hoverClass,this).add(this).not(not).removeClass(o.hoverClass)
.find('>ul').hide().css('visibility','hidden');
o.onHide.call($ul);
return this;
},
showSuperfishUl : function(){
var o = sf.op,
- sh = sf.c.shadowClass+'-off',
$ul = this.addClass(o.hoverClass)
.find('>ul:hidden').css('visibility','visible');
- sf.IE7fix.call($ul);
o.onBeforeShow.call($ul);
- $ul.animate(o.animation,o.speed,function(){ sf.IE7fix.call($ul); o.onShow.call($ul); });
+ $ul.animate(o.animation,o.speed,function(){ o.onShow.call($ul); });
return this;
}
});
diff --git a/modules/tag/controllers/tags.php b/modules/tag/controllers/tags.php
index 77d45a95..32e857c6 100644
--- a/modules/tag/controllers/tags.php
+++ b/modules/tag/controllers/tags.php
@@ -48,18 +48,17 @@ class Tags_Controller extends Controller {
public function autocomplete() {
$tags = array();
- $tag_parts = explode(",", Input::instance()->get("q"));
- $limit = Input::instance()->get("limit");
+ $tag_parts = explode(",", Input::instance()->get("term"));
$tag_part = ltrim(end($tag_parts));
$tag_list = ORM::factory("tag")
->where("name", "LIKE", Database::escape_for_like($tag_part) . "%")
->order_by("name", "ASC")
- ->limit($limit)
+ ->limit(100)
->find_all();
foreach ($tag_list as $tag) {
- $tags[] = html::clean($tag->name);
+ $tags[] = (string)html::clean($tag->name);
}
- ajax::response(implode("\n", $tags));
+ ajax::response(json_encode($tags));
}
}
diff --git a/modules/tag/helpers/tag_event.php b/modules/tag/helpers/tag_event.php
index d62ae36e..79d6e0bc 100644
--- a/modules/tag/helpers/tag_event.php
+++ b/modules/tag/helpers/tag_event.php
@@ -72,8 +72,7 @@ class tag_event_Core {
$url = url::site("tags/autocomplete");
$form->script("")
->text("$('form input[name=tags]').ready(function() {
- $('form input[name=tags]').gallery_autocomplete(
- '$url', {max: 30, multiple: true, multipleSeparator: ',', cacheLength: 1});
+ $('form input[name=tags]').gallery_autocomplete('$url', {multiple: true});
});");
$tag_names = array();
diff --git a/modules/tag/views/tag_block.html.php b/modules/tag/views/tag_block.html.php
index d25b8dcb..afa61b15 100644
--- a/modules/tag/views/tag_block.html.php
+++ b/modules/tag/views/tag_block.html.php
@@ -2,15 +2,13 @@
<script type="text/javascript">
$("#g-add-tag-form").ready(function() {
var url = $("#g-tag-cloud-autocomplete-url").attr("href");
- $("#g-add-tag-form input:text").gallery_autocomplete(
- url, {
- max: 30,
- multiple: true,
- multipleSeparator: ',',
- cacheLength: 1,
- selectFirst: false
- }
- );
+ function split(val) {
+ return val.split(/,\s*/);
+ }
+ function extract_last(term) {
+ return split(term).pop();
+ }
+ $("#g-add-tag-form input:text").gallery_autocomplete(url, {multiple: true});
$("#g-add-tag-form").ajaxForm({
dataType: "json",
success: function(data) {
diff --git a/themes/wind/css/screen.css b/themes/wind/css/screen.css
index d3e0f83c..adddb93c 100644
--- a/themes/wind/css/screen.css
+++ b/themes/wind/css/screen.css
@@ -948,6 +948,12 @@ button {
display: inline-block;
}
+/* Autocomplete */
+
+.ui-autocomplete {
+ text-align: left;
+}
+
/* Status and validation messages ~~~~ */
.g-message-block {
diff --git a/themes/wind/js/ui.init.js b/themes/wind/js/ui.init.js
index 3ee3e32e..5a83c015 100644
--- a/themes/wind/js/ui.init.js
+++ b/themes/wind/js/ui.init.js
@@ -82,9 +82,6 @@ $(document).ready(function() {
} else {
var sib_height = $(this).prev().height();
}
- if ($.browser.msie && $.browser.version <= 8) {
- sib_height = sib_height + 1;
- }
$(this).css("height", sib_height);
$(this).css("position", "relative");
$(this).css("top", 0).css("left", 0);